lists.openwall.net   lists  /  announce  owl-users  owl-dev  john-users  john-dev  passwdqc-users  yescrypt  popa3d-users  /  oss-security  kernel-hardening  musl  sabotage  tlsify  passwords  /  crypt-dev  xvendor  /  Bugtraq  Full-Disclosure  linux-kernel  linux-netdev  linux-ext4  linux-hardening  linux-cve-announce  PHC 
Open Source and information security mailing list archives
 
Hash Suite: Windows password security audit tool. GUI, reports in PDF.
[<prev] [next>] [<thread-prev] [day] [month] [year] [list]
Message-ID: <2024080300-haven-acorn-9191@gregkh>
Date: Sat,  3 Aug 2024 09:06:01 +0200
From: Greg Kroah-Hartman <gregkh@...uxfoundation.org>
To: linux-kernel@...r.kernel.org,
	akpm@...ux-foundation.org,
	torvalds@...ux-foundation.org,
	stable@...r.kernel.org
Cc: lwn@....net,
	jslaby@...e.cz,
	Greg Kroah-Hartman <gregkh@...uxfoundation.org>
Subject: Re: Linux 6.6.44

diff --git a/Documentation/devicetree/bindings/thermal/thermal-zones.yaml b/Documentation/devicetree/bindings/thermal/thermal-zones.yaml
index 4f3acdc4dec0..98cdd98212c4 100644
--- a/Documentation/devicetree/bindings/thermal/thermal-zones.yaml
+++ b/Documentation/devicetree/bindings/thermal/thermal-zones.yaml
@@ -49,7 +49,10 @@ properties:
       to take when the temperature crosses those thresholds.
 
 patternProperties:
-  "^[a-zA-Z][a-zA-Z0-9\\-]{1,12}-thermal$":
+  # Node name is limited in size due to Linux kernel requirements - 19
+  # characters in total (see THERMAL_NAME_LENGTH, including terminating NUL
+  # byte):
+  "^[a-zA-Z][a-zA-Z0-9\\-]{1,10}-thermal$":
     type: object
     description:
       Each thermal zone node contains information about how frequently it
diff --git a/Makefile b/Makefile
index 37b5144449a9..2e5d92ce2774 100644
--- a/Makefile
+++ b/Makefile
@@ -1,7 +1,7 @@
 # SPDX-License-Identifier: GPL-2.0
 VERSION = 6
 PATCHLEVEL = 6
-SUBLEVEL = 43
+SUBLEVEL = 44
 EXTRAVERSION =
 NAME = Hurr durr I'ma ninja sloth
 
diff --git a/arch/arm/boot/dts/allwinner/Makefile b/arch/arm/boot/dts/allwinner/Makefile
index eebb5a0c873a..296be33ec934 100644
--- a/arch/arm/boot/dts/allwinner/Makefile
+++ b/arch/arm/boot/dts/allwinner/Makefile
@@ -259,68 +259,6 @@ dtb-$(CONFIG_MACH_SUN8I) += \
 	sun8i-v3s-licheepi-zero.dtb \
 	sun8i-v3s-licheepi-zero-dock.dtb \
 	sun8i-v40-bananapi-m2-berry.dtb
-dtb-$(CONFIG_MACH_SUN8I) += \
-	sun8i-a23-evb.dtb \
-	sun8i-a23-gt90h-v4.dtb \
-	sun8i-a23-inet86dz.dtb \
-	sun8i-a23-ippo-q8h-v5.dtb \
-	sun8i-a23-ippo-q8h-v1.2.dtb \
-	sun8i-a23-polaroid-mid2407pxe03.dtb \
-	sun8i-a23-polaroid-mid2809pxe04.dtb \
-	sun8i-a23-q8-tablet.dtb \
-	sun8i-a33-et-q8-v1.6.dtb \
-	sun8i-a33-ga10h-v1.1.dtb \
-	sun8i-a33-inet-d978-rev2.dtb \
-	sun8i-a33-ippo-q8h-v1.2.dtb \
-	sun8i-a33-olinuxino.dtb \
-	sun8i-a33-q8-tablet.dtb \
-	sun8i-a33-sinlinx-sina33.dtb \
-	sun8i-a83t-allwinner-h8homlet-v2.dtb \
-	sun8i-a83t-bananapi-m3.dtb \
-	sun8i-a83t-cubietruck-plus.dtb \
-	sun8i-a83t-tbs-a711.dtb \
-	sun8i-h2-plus-bananapi-m2-zero.dtb \
-	sun8i-h2-plus-libretech-all-h3-cc.dtb \
-	sun8i-h2-plus-orangepi-r1.dtb \
-	sun8i-h2-plus-orangepi-zero.dtb \
-	sun8i-h3-bananapi-m2-plus.dtb \
-	sun8i-h3-bananapi-m2-plus-v1.2.dtb \
-	sun8i-h3-beelink-x2.dtb \
-	sun8i-h3-libretech-all-h3-cc.dtb \
-	sun8i-h3-mapleboard-mp130.dtb \
-	sun8i-h3-nanopi-duo2.dtb \
-	sun8i-h3-nanopi-m1.dtb\
-	\
-	sun8i-h3-nanopi-m1-plus.dtb \
-	sun8i-h3-nanopi-neo.dtb \
-	sun8i-h3-nanopi-neo-air.dtb \
-	sun8i-h3-nanopi-r1.dtb \
-	sun8i-h3-orangepi-2.dtb \
-	sun8i-h3-orangepi-lite.dtb \
-	sun8i-h3-orangepi-one.dtb \
-	sun8i-h3-orangepi-pc.dtb \
-	sun8i-h3-orangepi-pc-plus.dtb \
-	sun8i-h3-orangepi-plus.dtb \
-	sun8i-h3-orangepi-plus2e.dtb \
-	sun8i-h3-orangepi-zero-plus2.dtb \
-	sun8i-h3-rervision-dvk.dtb \
-	sun8i-h3-zeropi.dtb \
-	sun8i-h3-emlid-neutis-n5h3-devboard.dtb \
-	sun8i-r16-bananapi-m2m.dtb \
-	sun8i-r16-nintendo-nes-classic.dtb \
-	sun8i-r16-nintendo-super-nes-classic.dtb \
-	sun8i-r16-parrot.dtb \
-	sun8i-r40-bananapi-m2-ultra.dtb \
-	sun8i-r40-oka40i-c.dtb \
-	sun8i-s3-elimo-initium.dtb \
-	sun8i-s3-lichee-zero-plus.dtb \
-	sun8i-s3-pinecube.dtb \
-	sun8i-t113s-mangopi-mq-r-t113.dtb \
-	sun8i-t3-cqa3t-bv3.dtb \
-	sun8i-v3-sl631-imx179.dtb \
-	sun8i-v3s-licheepi-zero.dtb \
-	sun8i-v3s-licheepi-zero-dock.dtb \
-	sun8i-v40-bananapi-m2-berry.dtb
 dtb-$(CONFIG_MACH_SUN9I) += \
 	sun9i-a80-optimus.dtb \
 	sun9i-a80-cubieboard4.dtb
diff --git a/arch/arm/boot/dts/nxp/imx/imx6q-kontron-samx6i.dtsi b/arch/arm/boot/dts/nxp/imx/imx6q-kontron-samx6i.dtsi
index 4d6a0c3e8455..ff062f4fd726 100644
--- a/arch/arm/boot/dts/nxp/imx/imx6q-kontron-samx6i.dtsi
+++ b/arch/arm/boot/dts/nxp/imx/imx6q-kontron-samx6i.dtsi
@@ -5,31 +5,8 @@
 
 #include "imx6q.dtsi"
 #include "imx6qdl-kontron-samx6i.dtsi"
-#include <dt-bindings/gpio/gpio.h>
 
 / {
 	model = "Kontron SMARC sAMX6i Quad/Dual";
 	compatible = "kontron,imx6q-samx6i", "fsl,imx6q";
 };
-
-/* Quad/Dual SoMs have 3 chip-select signals */
-&ecspi4 {
-	cs-gpios = <&gpio3 24 GPIO_ACTIVE_LOW>,
-		   <&gpio3 29 GPIO_ACTIVE_LOW>,
-		   <&gpio3 25 GPIO_ACTIVE_LOW>;
-};
-
-&pinctrl_ecspi4 {
-	fsl,pins = <
-		MX6QDL_PAD_EIM_D21__ECSPI4_SCLK 0x100b1
-		MX6QDL_PAD_EIM_D28__ECSPI4_MOSI 0x100b1
-		MX6QDL_PAD_EIM_D22__ECSPI4_MISO 0x100b1
-
-		/* SPI4_IMX_CS2# - connected to internal flash */
-		MX6QDL_PAD_EIM_D24__GPIO3_IO24 0x1b0b0
-		/* SPI4_IMX_CS0# - connected to SMARC SPI0_CS0# */
-		MX6QDL_PAD_EIM_D29__GPIO3_IO29 0x1b0b0
-		/* SPI4_CS3# - connected to  SMARC SPI0_CS1# */
-		MX6QDL_PAD_EIM_D25__GPIO3_IO25 0x1b0b0
-	>;
-};
diff --git a/arch/arm/boot/dts/nxp/imx/imx6qdl-kontron-samx6i.dtsi b/arch/arm/boot/dts/nxp/imx/imx6qdl-kontron-samx6i.dtsi
index 85aeebc9485d..668d33d1ff0c 100644
--- a/arch/arm/boot/dts/nxp/imx/imx6qdl-kontron-samx6i.dtsi
+++ b/arch/arm/boot/dts/nxp/imx/imx6qdl-kontron-samx6i.dtsi
@@ -244,7 +244,8 @@ &ecspi4 {
 	pinctrl-names = "default";
 	pinctrl-0 = <&pinctrl_ecspi4>;
 	cs-gpios = <&gpio3 24 GPIO_ACTIVE_LOW>,
-		   <&gpio3 29 GPIO_ACTIVE_LOW>;
+		   <&gpio3 29 GPIO_ACTIVE_LOW>,
+		   <&gpio3 25 GPIO_ACTIVE_LOW>;
 	status = "okay";
 
 	/* default boot source: workaround #1 for errata ERR006282 */
@@ -259,7 +260,7 @@ smarc_flash: flash@0 {
 &fec {
 	pinctrl-names = "default";
 	pinctrl-0 = <&pinctrl_enet>;
-	phy-mode = "rgmii";
+	phy-connection-type = "rgmii-id";
 	phy-handle = <&ethphy>;
 
 	mdio {
@@ -269,7 +270,7 @@ mdio {
 		ethphy: ethernet-phy@1 {
 			compatible = "ethernet-phy-ieee802.3-c22";
 			reg = <1>;
-			reset-gpios = <&gpio1 25 GPIO_ACTIVE_LOW>;
+			reset-gpios = <&gpio2 1 GPIO_ACTIVE_LOW>;
 			reset-assert-us = <1000>;
 		};
 	};
@@ -464,6 +465,8 @@ MX6QDL_PAD_EIM_D22__ECSPI4_MISO 0x100b1
 			MX6QDL_PAD_EIM_D24__GPIO3_IO24 0x1b0b0
 			/* SPI_IMX_CS0# - connected to SMARC SPI0_CS0# */
 			MX6QDL_PAD_EIM_D29__GPIO3_IO29 0x1b0b0
+			/* SPI4_CS3# - connected to SMARC SPI0_CS1# */
+			MX6QDL_PAD_EIM_D25__GPIO3_IO25 0x1b0b0
 		>;
 	};
 
@@ -516,7 +519,7 @@ MX6QDL_PAD_RGMII_RX_CTL__RGMII_RX_CTL 0x1b0b0
 			MX6QDL_PAD_ENET_MDIO__ENET_MDIO       0x1b0b0
 			MX6QDL_PAD_ENET_MDC__ENET_MDC         0x1b0b0
 			MX6QDL_PAD_ENET_REF_CLK__ENET_TX_CLK  0x1b0b0
-			MX6QDL_PAD_ENET_CRS_DV__GPIO1_IO25    0x1b0b0 /* RST_GBE0_PHY# */
+			MX6QDL_PAD_NANDF_D1__GPIO2_IO01       0x1b0b0 /* RST_GBE0_PHY# */
 		>;
 	};
 
@@ -729,7 +732,7 @@ &pcie {
 	pinctrl-names = "default";
 	pinctrl-0 = <&pinctrl_pcie>;
 	wake-up-gpio = <&gpio6 18 GPIO_ACTIVE_HIGH>;
-	reset-gpio = <&gpio3 13 GPIO_ACTIVE_HIGH>;
+	reset-gpio = <&gpio3 13 GPIO_ACTIVE_LOW>;
 };
 
 /* LCD_BKLT_PWM */
@@ -817,5 +820,6 @@ &wdog1 {
 	/* CPLD is feeded by watchdog (hardwired) */
 	pinctrl-names = "default";
 	pinctrl-0 = <&pinctrl_wdog1>;
+	fsl,ext-reset-output;
 	status = "okay";
 };
diff --git a/arch/arm/boot/dts/st/stm32mp151.dtsi b/arch/arm/boot/dts/st/stm32mp151.dtsi
index 61508917521c..aec7fa5ab5d8 100644
--- a/arch/arm/boot/dts/st/stm32mp151.dtsi
+++ b/arch/arm/boot/dts/st/stm32mp151.dtsi
@@ -50,6 +50,7 @@ timer {
 			     <GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
 			     <GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>;
 		interrupt-parent = <&intc>;
+		arm,no-tick-in-suspend;
 	};
 
 	clocks {
diff --git a/arch/arm/mach-pxa/spitz.c b/arch/arm/mach-pxa/spitz.c
index cc691b199429..a42417de53f7 100644
--- a/arch/arm/mach-pxa/spitz.c
+++ b/arch/arm/mach-pxa/spitz.c
@@ -520,10 +520,8 @@ static struct gpiod_lookup_table spitz_ads7846_gpio_table = {
 static struct gpiod_lookup_table spitz_lcdcon_gpio_table = {
 	.dev_id = "spi2.1",
 	.table = {
-		GPIO_LOOKUP("gpio-pxa", SPITZ_GPIO_BACKLIGHT_CONT,
-			    "BL_CONT", GPIO_ACTIVE_LOW),
-		GPIO_LOOKUP("gpio-pxa", SPITZ_GPIO_BACKLIGHT_ON,
-			    "BL_ON", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("sharp-scoop.1", 6, "BL_CONT", GPIO_ACTIVE_LOW),
+		GPIO_LOOKUP("sharp-scoop.1", 7, "BL_ON", GPIO_ACTIVE_HIGH),
 		{ },
 	},
 };
@@ -531,10 +529,8 @@ static struct gpiod_lookup_table spitz_lcdcon_gpio_table = {
 static struct gpiod_lookup_table akita_lcdcon_gpio_table = {
 	.dev_id = "spi2.1",
 	.table = {
-		GPIO_LOOKUP("gpio-pxa", AKITA_GPIO_BACKLIGHT_CONT,
-			    "BL_CONT", GPIO_ACTIVE_LOW),
-		GPIO_LOOKUP("gpio-pxa", AKITA_GPIO_BACKLIGHT_ON,
-			    "BL_ON", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("i2c-max7310", 3, "BL_ON", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("i2c-max7310", 4, "BL_CONT", GPIO_ACTIVE_LOW),
 		{ },
 	},
 };
@@ -941,12 +937,9 @@ static inline void spitz_i2c_init(void) {}
 static struct gpiod_lookup_table spitz_audio_gpio_table = {
 	.dev_id = "spitz-audio",
 	.table = {
-		GPIO_LOOKUP("sharp-scoop.0", SPITZ_GPIO_MUTE_L - SPITZ_SCP_GPIO_BASE,
-			    "mute-l", GPIO_ACTIVE_HIGH),
-		GPIO_LOOKUP("sharp-scoop.0", SPITZ_GPIO_MUTE_R - SPITZ_SCP_GPIO_BASE,
-			    "mute-r", GPIO_ACTIVE_HIGH),
-		GPIO_LOOKUP("sharp-scoop.1", SPITZ_GPIO_MIC_BIAS - SPITZ_SCP2_GPIO_BASE,
-			    "mic", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("sharp-scoop.0", 3, "mute-l", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("sharp-scoop.0", 4, "mute-r", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("sharp-scoop.1", 8, "mic", GPIO_ACTIVE_HIGH),
 		{ },
 	},
 };
@@ -954,12 +947,9 @@ static struct gpiod_lookup_table spitz_audio_gpio_table = {
 static struct gpiod_lookup_table akita_audio_gpio_table = {
 	.dev_id = "spitz-audio",
 	.table = {
-		GPIO_LOOKUP("sharp-scoop.0", SPITZ_GPIO_MUTE_L - SPITZ_SCP_GPIO_BASE,
-			    "mute-l", GPIO_ACTIVE_HIGH),
-		GPIO_LOOKUP("sharp-scoop.0", SPITZ_GPIO_MUTE_R - SPITZ_SCP_GPIO_BASE,
-			    "mute-r", GPIO_ACTIVE_HIGH),
-		GPIO_LOOKUP("i2c-max7310", AKITA_GPIO_MIC_BIAS - AKITA_IOEXP_GPIO_BASE,
-			    "mic", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("sharp-scoop.0", 3, "mute-l", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("sharp-scoop.0", 4, "mute-r", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("i2c-max7310", 2, "mic", GPIO_ACTIVE_HIGH),
 		{ },
 	},
 };
diff --git a/arch/arm64/boot/dts/amlogic/meson-g12-common.dtsi b/arch/arm64/boot/dts/amlogic/meson-g12-common.dtsi
index ff68b911b729..0ff0d090548d 100644
--- a/arch/arm64/boot/dts/amlogic/meson-g12-common.dtsi
+++ b/arch/arm64/boot/dts/amlogic/meson-g12-common.dtsi
@@ -215,6 +215,11 @@ hdmi_tx: hdmi-tx@0 {
 				#sound-dai-cells = <0>;
 				status = "disabled";
 
+				assigned-clocks = <&clkc CLKID_HDMI_SEL>,
+						  <&clkc CLKID_HDMI>;
+				assigned-clock-parents = <&xtal>, <0>;
+				assigned-clock-rates = <0>, <24000000>;
+
 				/* VPU VENC Input */
 				hdmi_tx_venc_port: port@0 {
 					reg = <0>;
diff --git a/arch/arm64/boot/dts/amlogic/meson-g12.dtsi b/arch/arm64/boot/dts/amlogic/meson-g12.dtsi
index 6a1f4dcf6488..7b655e07e80c 100644
--- a/arch/arm64/boot/dts/amlogic/meson-g12.dtsi
+++ b/arch/arm64/boot/dts/amlogic/meson-g12.dtsi
@@ -367,6 +367,10 @@ &ethmac {
 	power-domains = <&pwrc PWRC_G12A_ETH_ID>;
 };
 
+&hdmi_tx {
+	power-domains = <&pwrc PWRC_G12A_VPU_ID>;
+};
+
 &vpu {
 	power-domains = <&pwrc PWRC_G12A_VPU_ID>;
 };
diff --git a/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi b/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi
index 12ef6e81c8bd..ed00e67e6923 100644
--- a/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi
+++ b/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi
@@ -311,10 +311,16 @@ &hdmi_tx {
 		 <&reset RESET_HDMI_SYSTEM_RESET>,
 		 <&reset RESET_HDMI_TX>;
 	reset-names = "hdmitx_apb", "hdmitx", "hdmitx_phy";
-	clocks = <&clkc CLKID_HDMI_PCLK>,
-		 <&clkc CLKID_CLK81>,
+	clocks = <&clkc CLKID_HDMI>,
+		 <&clkc CLKID_HDMI_PCLK>,
 		 <&clkc CLKID_GCLK_VENCI_INT0>;
 	clock-names = "isfr", "iahb", "venci";
+	power-domains = <&pwrc PWRC_GXBB_VPU_ID>;
+
+	assigned-clocks = <&clkc CLKID_HDMI_SEL>,
+			  <&clkc CLKID_HDMI>;
+	assigned-clock-parents = <&xtal>, <0>;
+	assigned-clock-rates = <0>, <24000000>;
 };
 
 &sysctrl {
diff --git a/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi b/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi
index 17bcfa4702e1..f58d1790de1c 100644
--- a/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi
+++ b/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi
@@ -323,10 +323,16 @@ &hdmi_tx {
 		 <&reset RESET_HDMI_SYSTEM_RESET>,
 		 <&reset RESET_HDMI_TX>;
 	reset-names = "hdmitx_apb", "hdmitx", "hdmitx_phy";
-	clocks = <&clkc CLKID_HDMI_PCLK>,
-		 <&clkc CLKID_CLK81>,
+	clocks = <&clkc CLKID_HDMI>,
+		 <&clkc CLKID_HDMI_PCLK>,
 		 <&clkc CLKID_GCLK_VENCI_INT0>;
 	clock-names = "isfr", "iahb", "venci";
+	power-domains = <&pwrc PWRC_GXBB_VPU_ID>;
+
+	assigned-clocks = <&clkc CLKID_HDMI_SEL>,
+			  <&clkc CLKID_HDMI>;
+	assigned-clock-parents = <&xtal>, <0>;
+	assigned-clock-rates = <0>, <24000000>;
 };
 
 &sysctrl {
diff --git a/arch/arm64/boot/dts/amlogic/meson-sm1.dtsi b/arch/arm64/boot/dts/amlogic/meson-sm1.dtsi
index 643f94d9d08e..13e742ba00be 100644
--- a/arch/arm64/boot/dts/amlogic/meson-sm1.dtsi
+++ b/arch/arm64/boot/dts/amlogic/meson-sm1.dtsi
@@ -339,7 +339,7 @@ tdmin_lb: audio-controller@3c0 {
 		};
 
 		spdifin: audio-controller@400 {
-			compatible = "amlogic,g12a-spdifin",
+			compatible = "amlogic,sm1-spdifin",
 				     "amlogic,axg-spdifin";
 			reg = <0x0 0x400 0x0 0x30>;
 			#sound-dai-cells = <0>;
@@ -353,7 +353,7 @@ spdifin: audio-controller@400 {
 		};
 
 		spdifout_a: audio-controller@480 {
-			compatible = "amlogic,g12a-spdifout",
+			compatible = "amlogic,sm1-spdifout",
 				     "amlogic,axg-spdifout";
 			reg = <0x0 0x480 0x0 0x50>;
 			#sound-dai-cells = <0>;
@@ -518,6 +518,10 @@ &gpio_intc {
 		     "amlogic,meson-gpio-intc";
 };
 
+&hdmi_tx {
+	power-domains = <&pwrc PWRC_SM1_VPU_ID>;
+};
+
 &pcie {
 	power-domains = <&pwrc PWRC_SM1_PCIE_ID>;
 };
diff --git a/arch/arm64/boot/dts/freescale/imx8mp.dtsi b/arch/arm64/boot/dts/freescale/imx8mp.dtsi
index 4b50920ac204..d1488ebfef3f 100644
--- a/arch/arm64/boot/dts/freescale/imx8mp.dtsi
+++ b/arch/arm64/boot/dts/freescale/imx8mp.dtsi
@@ -785,6 +785,23 @@ pgc_usb2_phy: power-domain@3 {
 						reg = <IMX8MP_POWER_DOMAIN_USB2_PHY>;
 					};
 
+					pgc_mlmix: power-domain@4 {
+						#power-domain-cells = <0>;
+						reg = <IMX8MP_POWER_DOMAIN_MLMIX>;
+						clocks = <&clk IMX8MP_CLK_ML_AXI>,
+							 <&clk IMX8MP_CLK_ML_AHB>,
+							 <&clk IMX8MP_CLK_NPU_ROOT>;
+						assigned-clocks = <&clk IMX8MP_CLK_ML_CORE>,
+								  <&clk IMX8MP_CLK_ML_AXI>,
+								  <&clk IMX8MP_CLK_ML_AHB>;
+						assigned-clock-parents = <&clk IMX8MP_SYS_PLL1_800M>,
+									 <&clk IMX8MP_SYS_PLL1_800M>,
+									 <&clk IMX8MP_SYS_PLL1_800M>;
+						assigned-clock-rates = <800000000>,
+								       <800000000>,
+								       <300000000>;
+					};
+
 					pgc_audio: power-domain@5 {
 						#power-domain-cells = <0>;
 						reg = <IMX8MP_POWER_DOMAIN_AUDIOMIX>;
@@ -817,6 +834,12 @@ pgc_gpumix: power-domain@7 {
 						assigned-clock-rates = <800000000>, <400000000>;
 					};
 
+					pgc_vpumix: power-domain@8 {
+						#power-domain-cells = <0>;
+						reg = <IMX8MP_POWER_DOMAIN_VPUMIX>;
+						clocks = <&clk IMX8MP_CLK_VPU_ROOT>;
+					};
+
 					pgc_gpu3d: power-domain@9 {
 						#power-domain-cells = <0>;
 						reg = <IMX8MP_POWER_DOMAIN_GPU3D>;
@@ -832,60 +855,64 @@ pgc_mediamix: power-domain@10 {
 							 <&clk IMX8MP_CLK_MEDIA_APB_ROOT>;
 					};
 
-					pgc_mipi_phy2: power-domain@16 {
+					pgc_vpu_g1: power-domain@11 {
 						#power-domain-cells = <0>;
-						reg = <IMX8MP_POWER_DOMAIN_MIPI_PHY2>;
+						power-domains = <&pgc_vpumix>;
+						reg = <IMX8MP_POWER_DOMAIN_VPU_G1>;
+						clocks = <&clk IMX8MP_CLK_VPU_G1_ROOT>;
 					};
 
-					pgc_hsiomix: power-domain@17 {
+					pgc_vpu_g2: power-domain@12 {
 						#power-domain-cells = <0>;
-						reg = <IMX8MP_POWER_DOMAIN_HSIOMIX>;
-						clocks = <&clk IMX8MP_CLK_HSIO_AXI>,
-							 <&clk IMX8MP_CLK_HSIO_ROOT>;
-						assigned-clocks = <&clk IMX8MP_CLK_HSIO_AXI>;
-						assigned-clock-parents = <&clk IMX8MP_SYS_PLL2_500M>;
-						assigned-clock-rates = <500000000>;
+						power-domains = <&pgc_vpumix>;
+						reg = <IMX8MP_POWER_DOMAIN_VPU_G2>;
+						clocks = <&clk IMX8MP_CLK_VPU_G2_ROOT>;
+
 					};
 
-					pgc_ispdwp: power-domain@18 {
+					pgc_vpu_vc8000e: power-domain@13 {
 						#power-domain-cells = <0>;
-						reg = <IMX8MP_POWER_DOMAIN_MEDIAMIX_ISPDWP>;
-						clocks = <&clk IMX8MP_CLK_MEDIA_ISP_ROOT>;
+						power-domains = <&pgc_vpumix>;
+						reg = <IMX8MP_POWER_DOMAIN_VPU_VC8000E>;
+						clocks = <&clk IMX8MP_CLK_VPU_VC8KE_ROOT>;
 					};
 
-					pgc_vpumix: power-domain@19 {
+					pgc_hdmimix: power-domain@14 {
 						#power-domain-cells = <0>;
-						reg = <IMX8MP_POWER_DOMAIN_VPUMIX>;
-						clocks = <&clk IMX8MP_CLK_VPU_ROOT>;
+						reg = <IMX8MP_POWER_DOMAIN_HDMIMIX>;
+						clocks = <&clk IMX8MP_CLK_HDMI_ROOT>,
+							 <&clk IMX8MP_CLK_HDMI_APB>;
+						assigned-clocks = <&clk IMX8MP_CLK_HDMI_AXI>,
+								  <&clk IMX8MP_CLK_HDMI_APB>;
+						assigned-clock-parents = <&clk IMX8MP_SYS_PLL2_500M>,
+									 <&clk IMX8MP_SYS_PLL1_133M>;
+						assigned-clock-rates = <500000000>, <133000000>;
 					};
 
-					pgc_vpu_g1: power-domain@20 {
+					pgc_hdmi_phy: power-domain@15 {
 						#power-domain-cells = <0>;
-						power-domains = <&pgc_vpumix>;
-						reg = <IMX8MP_POWER_DOMAIN_VPU_G1>;
-						clocks = <&clk IMX8MP_CLK_VPU_G1_ROOT>;
+						reg = <IMX8MP_POWER_DOMAIN_HDMI_PHY>;
 					};
 
-					pgc_vpu_g2: power-domain@21 {
+					pgc_mipi_phy2: power-domain@16 {
 						#power-domain-cells = <0>;
-						power-domains = <&pgc_vpumix>;
-						reg = <IMX8MP_POWER_DOMAIN_VPU_G2>;
-						clocks = <&clk IMX8MP_CLK_VPU_G2_ROOT>;
+						reg = <IMX8MP_POWER_DOMAIN_MIPI_PHY2>;
 					};
 
-					pgc_vpu_vc8000e: power-domain@22 {
+					pgc_hsiomix: power-domain@17 {
 						#power-domain-cells = <0>;
-						power-domains = <&pgc_vpumix>;
-						reg = <IMX8MP_POWER_DOMAIN_VPU_VC8000E>;
-						clocks = <&clk IMX8MP_CLK_VPU_VC8KE_ROOT>;
+						reg = <IMX8MP_POWER_DOMAIN_HSIOMIX>;
+						clocks = <&clk IMX8MP_CLK_HSIO_AXI>,
+							 <&clk IMX8MP_CLK_HSIO_ROOT>;
+						assigned-clocks = <&clk IMX8MP_CLK_HSIO_AXI>;
+						assigned-clock-parents = <&clk IMX8MP_SYS_PLL2_500M>;
+						assigned-clock-rates = <500000000>;
 					};
 
-					pgc_mlmix: power-domain@24 {
+					pgc_ispdwp: power-domain@18 {
 						#power-domain-cells = <0>;
-						reg = <IMX8MP_POWER_DOMAIN_MLMIX>;
-						clocks = <&clk IMX8MP_CLK_ML_AXI>,
-							 <&clk IMX8MP_CLK_ML_AHB>,
-							 <&clk IMX8MP_CLK_NPU_ROOT>;
+						reg = <IMX8MP_POWER_DOMAIN_MEDIAMIX_ISPDWP>;
+						clocks = <&clk IMX8MP_CLK_MEDIA_ISP_ROOT>;
 					};
 				};
 			};
@@ -1831,6 +1858,27 @@ hsio_blk_ctrl: blk-ctrl@...10000 {
 				#power-domain-cells = <1>;
 				#clock-cells = <0>;
 			};
+
+			hdmi_blk_ctrl: blk-ctrl@...c0000 {
+				compatible = "fsl,imx8mp-hdmi-blk-ctrl", "syscon";
+				reg = <0x32fc0000 0x1000>;
+				clocks = <&clk IMX8MP_CLK_HDMI_APB>,
+					 <&clk IMX8MP_CLK_HDMI_ROOT>,
+					 <&clk IMX8MP_CLK_HDMI_REF_266M>,
+					 <&clk IMX8MP_CLK_HDMI_24M>,
+					 <&clk IMX8MP_CLK_HDMI_FDCC_TST>;
+				clock-names = "apb", "axi", "ref_266m", "ref_24m", "fdcc";
+				power-domains = <&pgc_hdmimix>, <&pgc_hdmimix>,
+						<&pgc_hdmimix>, <&pgc_hdmimix>,
+						<&pgc_hdmimix>, <&pgc_hdmimix>,
+						<&pgc_hdmimix>, <&pgc_hdmi_phy>,
+						<&pgc_hdmimix>, <&pgc_hdmimix>;
+				power-domain-names = "bus", "irqsteer", "lcdif",
+						     "pai", "pvi", "trng",
+						     "hdmi-tx", "hdmi-tx-phy",
+						     "hdcp", "hrv";
+				#power-domain-cells = <1>;
+			};
 		};
 
 		pcie: pcie@...00000 {
@@ -1970,6 +2018,18 @@ vpumix_blk_ctrl: blk-ctrl@...30000 {
 			interconnect-names = "g1", "g2", "vc8000e";
 		};
 
+		npu: npu@...00000 {
+			compatible = "vivante,gc";
+			reg = <0x38500000 0x200000>;
+			interrupts = <GIC_SPI 13 IRQ_TYPE_LEVEL_HIGH>;
+			clocks = <&clk IMX8MP_CLK_NPU_ROOT>,
+				 <&clk IMX8MP_CLK_NPU_ROOT>,
+				 <&clk IMX8MP_CLK_ML_AXI>,
+				 <&clk IMX8MP_CLK_ML_AHB>;
+			clock-names = "core", "shader", "bus", "reg";
+			power-domains = <&pgc_mlmix>;
+		};
+
 		gic: interrupt-controller@...00000 {
 			compatible = "arm,gic-v3";
 			reg = <0x38800000 0x10000>,
diff --git a/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts b/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts
index 7ef517e9e374..15838c1ee8cc 100644
--- a/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts
+++ b/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts
@@ -318,8 +318,8 @@ asm_sel {
 	/* eMMC is shared pin with parallel NAND */
 	emmc_pins_default: emmc-pins-default {
 		mux {
-			function = "emmc", "emmc_rst";
-			groups = "emmc";
+			function = "emmc";
+			groups = "emmc", "emmc_rst";
 		};
 
 		/* "NDL0","NDL1","NDL2","NDL3","NDL4","NDL5","NDL6","NDL7",
diff --git a/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts b/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts
index a75dc63a1362..0a14ef1da60d 100644
--- a/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts
+++ b/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts
@@ -244,8 +244,8 @@ &pio {
 	/* eMMC is shared pin with parallel NAND */
 	emmc_pins_default: emmc-pins-default {
 		mux {
-			function = "emmc", "emmc_rst";
-			groups = "emmc";
+			function = "emmc";
+			groups = "emmc", "emmc_rst";
 		};
 
 		/* "NDL0","NDL1","NDL2","NDL3","NDL4","NDL5","NDL6","NDL7",
diff --git a/arch/arm64/boot/dts/mediatek/mt8183-kukui-audio-da7219.dtsi b/arch/arm64/boot/dts/mediatek/mt8183-kukui-audio-da7219.dtsi
index 2c69e7658dba..b9a6fd4f86d4 100644
--- a/arch/arm64/boot/dts/mediatek/mt8183-kukui-audio-da7219.dtsi
+++ b/arch/arm64/boot/dts/mediatek/mt8183-kukui-audio-da7219.dtsi
@@ -28,7 +28,7 @@ da7219_aad {
 			dlg,btn-cfg = <50>;
 			dlg,mic-det-thr = <500>;
 			dlg,jack-ins-deb = <20>;
-			dlg,jack-det-rate = "32ms_64ms";
+			dlg,jack-det-rate = "32_64";
 			dlg,jack-rem-deb = <1>;
 
 			dlg,a-d-btn-thr = <0xa>;
diff --git a/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi b/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi
index 820260348de9..32f6899f885e 100644
--- a/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi
+++ b/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi
@@ -156,21 +156,24 @@ anx_bridge: anx7625@58 {
 		vdd18-supply = <&pp1800_mipibrdg>;
 		vdd33-supply = <&vddio_mipibrdg>;
 
-		#address-cells = <1>;
-		#size-cells = <0>;
-		port@0 {
-			reg = <0>;
+		ports {
+			#address-cells = <1>;
+			#size-cells = <0>;
 
-			anx7625_in: endpoint {
-				remote-endpoint = <&dsi_out>;
+			port@0 {
+				reg = <0>;
+
+				anx7625_in: endpoint {
+					remote-endpoint = <&dsi_out>;
+				};
 			};
-		};
 
-		port@1 {
-			reg = <1>;
+			port@1 {
+				reg = <1>;
 
-			anx7625_out: endpoint {
-				remote-endpoint = <&panel_in>;
+				anx7625_out: endpoint {
+					remote-endpoint = <&panel_in>;
+				};
 			};
 		};
 
diff --git a/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi b/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi
index d846342c1d3b..2c6587f260f8 100644
--- a/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi
+++ b/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi
@@ -775,7 +775,6 @@ pins-tx {
 		};
 		pins-rts {
 			pinmux = <PINMUX_GPIO47__FUNC_URTS1>;
-			output-enable;
 		};
 		pins-cts {
 			pinmux = <PINMUX_GPIO46__FUNC_UCTS1>;
@@ -794,7 +793,6 @@ pins-tx {
 		};
 		pins-rts {
 			pinmux = <PINMUX_GPIO47__FUNC_URTS1>;
-			output-enable;
 		};
 		pins-cts {
 			pinmux = <PINMUX_GPIO46__FUNC_UCTS1>;
diff --git a/arch/arm64/boot/dts/mediatek/mt8192-asurada.dtsi b/arch/arm64/boot/dts/mediatek/mt8192-asurada.dtsi
index dc39ebd1bbfc..6b4b7a7cd35e 100644
--- a/arch/arm64/boot/dts/mediatek/mt8192-asurada.dtsi
+++ b/arch/arm64/boot/dts/mediatek/mt8192-asurada.dtsi
@@ -147,6 +147,7 @@ pp3300_mipibrdg: regulator-3v3-mipibrdg {
 		regulator-boot-on;
 		gpio = <&pio 127 GPIO_ACTIVE_HIGH>;
 		vin-supply = <&pp3300_g>;
+		off-on-delay-us = <500000>;
 	};
 
 	/* separately switched 3.3V power rail */
diff --git a/arch/arm64/boot/dts/mediatek/mt8195.dtsi b/arch/arm64/boot/dts/mediatek/mt8195.dtsi
index 2bb9d9aa65fe..20e6d90cc411 100644
--- a/arch/arm64/boot/dts/mediatek/mt8195.dtsi
+++ b/arch/arm64/boot/dts/mediatek/mt8195.dtsi
@@ -3395,7 +3395,7 @@ vpu1_crit: trip-crit {
 			};
 		};
 
-		gpu0-thermal {
+		gpu-thermal {
 			polling-delay = <1000>;
 			polling-delay-passive = <250>;
 			thermal-sensors = <&lvts_ap MT8195_AP_GPU0>;
diff --git a/arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi b/arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi
index 06f8ff624181..d5b35ff0175c 100644
--- a/arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi
+++ b/arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi
@@ -405,7 +405,6 @@ &usb3_dwc3 {
 
 &hsusb_phy1 {
 	status = "okay";
-	extcon = <&typec>;
 
 	vdda-pll-supply = <&vreg_l12a_1p8>;
 	vdda-phy-dpdm-supply = <&vreg_l24a_3p075>;
diff --git a/arch/arm64/boot/dts/qcom/msm8996.dtsi b/arch/arm64/boot/dts/qcom/msm8996.dtsi
index dd407aa3abfb..1f7cbb35886d 100644
--- a/arch/arm64/boot/dts/qcom/msm8996.dtsi
+++ b/arch/arm64/boot/dts/qcom/msm8996.dtsi
@@ -2090,7 +2090,7 @@ ufshc: ufshc@...000 {
 				<&gcc GCC_UFS_RX_SYMBOL_0_CLK>;
 			freq-table-hz =
 				<100000000 200000000>,
-				<0 0>,
+				<100000000 200000000>,
 				<0 0>,
 				<0 0>,
 				<0 0>,
diff --git a/arch/arm64/boot/dts/qcom/msm8998.dtsi b/arch/arm64/boot/dts/qcom/msm8998.dtsi
index f91c58c844af..9c072ce19735 100644
--- a/arch/arm64/boot/dts/qcom/msm8998.dtsi
+++ b/arch/arm64/boot/dts/qcom/msm8998.dtsi
@@ -1588,7 +1588,6 @@ adreno_smmu: iommu@...0000 {
 			 * SoC VDDMX RPM Power Domain in the Adreno driver.
 			 */
 			power-domains = <&gpucc GPU_GX_GDSC>;
-			status = "disabled";
 		};
 
 		gpucc: clock-controller@...5000 {
diff --git a/arch/arm64/boot/dts/qcom/qdu1000.dtsi b/arch/arm64/boot/dts/qcom/qdu1000.dtsi
index 1c0e5d271e91..dbdc06be6260 100644
--- a/arch/arm64/boot/dts/qcom/qdu1000.dtsi
+++ b/arch/arm64/boot/dts/qcom/qdu1000.dtsi
@@ -1452,7 +1452,21 @@ system-cache-controller@...00000 {
 				    "llcc_broadcast_base",
 				    "multi_channel_register";
 			interrupts = <GIC_SPI 266 IRQ_TYPE_LEVEL_HIGH>;
-			multi-ch-bit-off = <24 2>;
+
+			nvmem-cells = <&multi_chan_ddr>;
+			nvmem-cell-names = "multi-chan-ddr";
+		};
+
+		sec_qfprom: efuse@...c8000 {
+			compatible = "qcom,qdu1000-sec-qfprom", "qcom,sec-qfprom";
+			reg = <0 0x221c8000 0 0x1000>;
+			#address-cells = <1>;
+			#size-cells = <1>;
+
+			multi_chan_ddr: multi-chan-ddr@12b {
+				reg = <0x12b 0x1>;
+				bits = <0 2>;
+			};
 		};
 	};
 
diff --git a/arch/arm64/boot/dts/qcom/qrb4210-rb2.dts b/arch/arm64/boot/dts/qcom/qrb4210-rb2.dts
index c8e80bb405e7..5def8c1154ce 100644
--- a/arch/arm64/boot/dts/qcom/qrb4210-rb2.dts
+++ b/arch/arm64/boot/dts/qcom/qrb4210-rb2.dts
@@ -364,6 +364,8 @@ vreg_l8a_0p664: l8 {
 		vreg_l9a_1p8: l9 {
 			regulator-min-microvolt = <1800000>;
 			regulator-max-microvolt = <2000000>;
+			regulator-always-on;
+			regulator-boot-on;
 		};
 
 		vreg_l10a_1p8: l10 {
diff --git a/arch/arm64/boot/dts/qcom/sa8775p.dtsi b/arch/arm64/boot/dts/qcom/sa8775p.dtsi
index 88ef3b5d374b..44bea063aedb 100644
--- a/arch/arm64/boot/dts/qcom/sa8775p.dtsi
+++ b/arch/arm64/boot/dts/qcom/sa8775p.dtsi
@@ -2350,6 +2350,7 @@ ethernet1: ethernet@...00000 {
 			phy-names = "serdes";
 
 			iommus = <&apps_smmu 0x140 0xf>;
+			dma-coherent;
 
 			snps,tso;
 			snps,pbl = <32>;
@@ -2383,6 +2384,7 @@ ethernet0: ethernet@...40000 {
 			phy-names = "serdes";
 
 			iommus = <&apps_smmu 0x120 0xf>;
+			dma-coherent;
 
 			snps,tso;
 			snps,pbl = <32>;
diff --git a/arch/arm64/boot/dts/qcom/sc8180x.dtsi b/arch/arm64/boot/dts/qcom/sc8180x.dtsi
index dd207eb81360..92b85de7706d 100644
--- a/arch/arm64/boot/dts/qcom/sc8180x.dtsi
+++ b/arch/arm64/boot/dts/qcom/sc8180x.dtsi
@@ -1853,7 +1853,7 @@ pcie3: pci@...8000 {
 			power-domains = <&gcc PCIE_3_GDSC>;
 
 			interconnects = <&aggre2_noc MASTER_PCIE_3 0 &mc_virt SLAVE_EBI_CH0 0>,
-					<&gem_noc MASTER_AMPSS_M0 0 &config_noc SLAVE_PCIE_0 0>;
+					<&gem_noc MASTER_AMPSS_M0 0 &config_noc SLAVE_PCIE_3 0>;
 			interconnect-names = "pcie-mem", "cpu-pcie";
 
 			phys = <&pcie3_phy>;
@@ -1952,7 +1952,7 @@ pcie1: pci@...0000 {
 			power-domains = <&gcc PCIE_1_GDSC>;
 
 			interconnects = <&aggre2_noc MASTER_PCIE_1 0 &mc_virt SLAVE_EBI_CH0 0>,
-					<&gem_noc MASTER_AMPSS_M0 0 &config_noc SLAVE_PCIE_0 0>;
+					<&gem_noc MASTER_AMPSS_M0 0 &config_noc SLAVE_PCIE_1 0>;
 			interconnect-names = "pcie-mem", "cpu-pcie";
 
 			phys = <&pcie1_phy>;
@@ -2051,7 +2051,7 @@ pcie2: pci@...8000 {
 			power-domains = <&gcc PCIE_2_GDSC>;
 
 			interconnects = <&aggre2_noc MASTER_PCIE_2 0 &mc_virt SLAVE_EBI_CH0 0>,
-					<&gem_noc MASTER_AMPSS_M0 0 &config_noc SLAVE_PCIE_0 0>;
+					<&gem_noc MASTER_AMPSS_M0 0 &config_noc SLAVE_PCIE_2 0>;
 			interconnect-names = "pcie-mem", "cpu-pcie";
 
 			phys = <&pcie2_phy>;
@@ -2093,7 +2093,7 @@ ufs_mem_hc: ufshc@...4000 {
 				     "jedec,ufs-2.0";
 			reg = <0 0x01d84000 0 0x2500>;
 			interrupts = <GIC_SPI 265 IRQ_TYPE_LEVEL_HIGH>;
-			phys = <&ufs_mem_phy_lanes>;
+			phys = <&ufs_mem_phy>;
 			phy-names = "ufsphy";
 			lanes-per-direction = <2>;
 			#reset-cells = <1>;
@@ -2132,10 +2132,8 @@ ufs_mem_hc: ufshc@...4000 {
 
 		ufs_mem_phy: phy-wrapper@...7000 {
 			compatible = "qcom,sc8180x-qmp-ufs-phy";
-			reg = <0 0x01d87000 0 0x1c0>;
-			#address-cells = <2>;
-			#size-cells = <2>;
-			ranges;
+			reg = <0 0x01d87000 0 0x1000>;
+
 			clocks = <&rpmhcc RPMH_CXO_CLK>,
 				 <&gcc GCC_UFS_PHY_PHY_AUX_CLK>;
 			clock-names = "ref",
@@ -2143,16 +2141,12 @@ ufs_mem_phy: phy-wrapper@...7000 {
 
 			resets = <&ufs_mem_hc 0>;
 			reset-names = "ufsphy";
-			status = "disabled";
 
-			ufs_mem_phy_lanes: phy@...7400 {
-				reg = <0 0x01d87400 0 0x108>,
-				      <0 0x01d87600 0 0x1e0>,
-				      <0 0x01d87c00 0 0x1dc>,
-				      <0 0x01d87800 0 0x108>,
-				      <0 0x01d87a00 0 0x1e0>;
-				#phy-cells = <0>;
-			};
+			power-domains = <&gcc UFS_PHY_GDSC>;
+
+			#phy-cells = <0>;
+
+			status = "disabled";
 		};
 
 		ipa_virt: interconnect@...0000 {
diff --git a/arch/arm64/boot/dts/qcom/sdm845.dtsi b/arch/arm64/boot/dts/qcom/sdm845.dtsi
index 5bf0d5af452a..9d9b378c07e1 100644
--- a/arch/arm64/boot/dts/qcom/sdm845.dtsi
+++ b/arch/arm64/boot/dts/qcom/sdm845.dtsi
@@ -2634,6 +2634,8 @@ ufs_mem_phy: phy@...7000 {
 			clocks = <&gcc GCC_UFS_MEM_CLKREF_CLK>,
 				 <&gcc GCC_UFS_PHY_PHY_AUX_CLK>;
 
+			power-domains = <&gcc UFS_PHY_GDSC>;
+
 			resets = <&ufs_mem_hc 0>;
 			reset-names = "ufsphy";
 			status = "disabled";
diff --git a/arch/arm64/boot/dts/qcom/sdm850-lenovo-yoga-c630.dts b/arch/arm64/boot/dts/qcom/sdm850-lenovo-yoga-c630.dts
index 92a812b5f423..fe5c12da666e 100644
--- a/arch/arm64/boot/dts/qcom/sdm850-lenovo-yoga-c630.dts
+++ b/arch/arm64/boot/dts/qcom/sdm850-lenovo-yoga-c630.dts
@@ -488,6 +488,7 @@ ecsh: hid@5c {
 &ipa {
 	qcom,gsi-loader = "self";
 	memory-region = <&ipa_fw_mem>;
+	firmware-name = "qcom/sdm850/LENOVO/81JL/ipa_fws.elf";
 	status = "okay";
 };
 
diff --git a/arch/arm64/boot/dts/qcom/sm6115.dtsi b/arch/arm64/boot/dts/qcom/sm6115.dtsi
index 87cbc4e8b1ed..821db9b85185 100644
--- a/arch/arm64/boot/dts/qcom/sm6115.dtsi
+++ b/arch/arm64/boot/dts/qcom/sm6115.dtsi
@@ -1043,6 +1043,8 @@ ufs_mem_phy: phy@...7000 {
 			clocks = <&gcc GCC_UFS_CLKREF_CLK>, <&gcc GCC_UFS_PHY_PHY_AUX_CLK>;
 			clock-names = "ref", "ref_aux";
 
+			power-domains = <&gcc GCC_UFS_PHY_GDSC>;
+
 			resets = <&ufs_mem_hc 0>;
 			reset-names = "ufsphy";
 			status = "disabled";
diff --git a/arch/arm64/boot/dts/qcom/sm6350.dtsi b/arch/arm64/boot/dts/qcom/sm6350.dtsi
index 71ccda7389ee..2efceb49a321 100644
--- a/arch/arm64/boot/dts/qcom/sm6350.dtsi
+++ b/arch/arm64/boot/dts/qcom/sm6350.dtsi
@@ -1197,6 +1197,8 @@ ufs_mem_phy: phy@...7000 {
 			clocks = <&gcc GCC_UFS_MEM_CLKREF_CLK>,
 				 <&gcc GCC_UFS_PHY_PHY_AUX_CLK>;
 
+			power-domains = <&gcc UFS_PHY_GDSC>;
+
 			resets = <&ufs_mem_hc 0>;
 			reset-names = "ufsphy";
 
@@ -1297,6 +1299,7 @@ fastrpc {
 					compatible = "qcom,fastrpc";
 					qcom,glink-channels = "fastrpcglink-apps-dsp";
 					label = "adsp";
+					qcom,non-secure-domain;
 					#address-cells = <1>;
 					#size-cells = <0>;
 
@@ -1557,6 +1560,7 @@ fastrpc {
 					compatible = "qcom,fastrpc";
 					qcom,glink-channels = "fastrpcglink-apps-dsp";
 					label = "cdsp";
+					qcom,non-secure-domain;
 					#address-cells = <1>;
 					#size-cells = <0>;
 
diff --git a/arch/arm64/boot/dts/qcom/sm8250.dtsi b/arch/arm64/boot/dts/qcom/sm8250.dtsi
index 64a656dcfa1f..b522d19f3a13 100644
--- a/arch/arm64/boot/dts/qcom/sm8250.dtsi
+++ b/arch/arm64/boot/dts/qcom/sm8250.dtsi
@@ -2169,7 +2169,7 @@ ufs_mem_hc: ufshc@...4000 {
 				     "jedec,ufs-2.0";
 			reg = <0 0x01d84000 0 0x3000>;
 			interrupts = <GIC_SPI 265 IRQ_TYPE_LEVEL_HIGH>;
-			phys = <&ufs_mem_phy_lanes>;
+			phys = <&ufs_mem_phy>;
 			phy-names = "ufsphy";
 			lanes-per-direction = <2>;
 			#reset-cells = <1>;
@@ -2217,10 +2217,8 @@ ufs_mem_hc: ufshc@...4000 {
 
 		ufs_mem_phy: phy@...7000 {
 			compatible = "qcom,sm8250-qmp-ufs-phy";
-			reg = <0 0x01d87000 0 0x1c0>;
-			#address-cells = <2>;
-			#size-cells = <2>;
-			ranges;
+			reg = <0 0x01d87000 0 0x1000>;
+
 			clock-names = "ref",
 				      "ref_aux";
 			clocks = <&rpmhcc RPMH_CXO_CLK>,
@@ -2228,16 +2226,12 @@ ufs_mem_phy: phy@...7000 {
 
 			resets = <&ufs_mem_hc 0>;
 			reset-names = "ufsphy";
-			status = "disabled";
 
-			ufs_mem_phy_lanes: phy@...7400 {
-				reg = <0 0x01d87400 0 0x16c>,
-				      <0 0x01d87600 0 0x200>,
-				      <0 0x01d87c00 0 0x200>,
-				      <0 0x01d87800 0 0x16c>,
-				      <0 0x01d87a00 0 0x200>;
-				#phy-cells = <0>;
-			};
+			power-domains = <&gcc UFS_PHY_GDSC>;
+
+			#phy-cells = <0>;
+
+			status = "disabled";
 		};
 
 		cryptobam: dma-controller@...4000 {
diff --git a/arch/arm64/boot/dts/qcom/sm8350.dtsi b/arch/arm64/boot/dts/qcom/sm8350.dtsi
index 5ed464c37422..d4f1b36c7aeb 100644
--- a/arch/arm64/boot/dts/qcom/sm8350.dtsi
+++ b/arch/arm64/boot/dts/qcom/sm8350.dtsi
@@ -1731,6 +1731,8 @@ ufs_mem_phy: phy@...7000 {
 			clocks = <&rpmhcc RPMH_CXO_CLK>,
 				 <&gcc GCC_UFS_PHY_PHY_AUX_CLK>;
 
+			power-domains = <&gcc UFS_PHY_GDSC>;
+
 			resets = <&ufs_mem_hc 0>;
 			reset-names = "ufsphy";
 			status = "disabled";
diff --git a/arch/arm64/boot/dts/qcom/sm8450.dtsi b/arch/arm64/boot/dts/qcom/sm8450.dtsi
index 0229bd706a2e..a34f460240a0 100644
--- a/arch/arm64/boot/dts/qcom/sm8450.dtsi
+++ b/arch/arm64/boot/dts/qcom/sm8450.dtsi
@@ -4200,6 +4200,8 @@ ufs_mem_phy: phy@...7000 {
 				 <&gcc GCC_UFS_PHY_PHY_AUX_CLK>,
 				 <&gcc GCC_UFS_0_CLKREF_EN>;
 
+			power-domains = <&gcc UFS_PHY_GDSC>;
+
 			resets = <&ufs_mem_hc 0>;
 			reset-names = "ufsphy";
 			status = "disabled";
diff --git a/arch/arm64/boot/dts/renesas/r8a779a0.dtsi b/arch/arm64/boot/dts/renesas/r8a779a0.dtsi
index 504ac8c93faf..84e0eb48a1b8 100644
--- a/arch/arm64/boot/dts/renesas/r8a779a0.dtsi
+++ b/arch/arm64/boot/dts/renesas/r8a779a0.dtsi
@@ -2910,6 +2910,9 @@ timer {
 		interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
 				      <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
 				      <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
-				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>;
+				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+		interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+				  "hyp-virt";
 	};
 };
diff --git a/arch/arm64/boot/dts/renesas/r8a779f0.dtsi b/arch/arm64/boot/dts/renesas/r8a779f0.dtsi
index ecdd5a523fa3..555fff9364e3 100644
--- a/arch/arm64/boot/dts/renesas/r8a779f0.dtsi
+++ b/arch/arm64/boot/dts/renesas/r8a779f0.dtsi
@@ -1181,7 +1181,10 @@ timer {
 		interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
 				      <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
 				      <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
-				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>;
+				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+		interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+				  "hyp-virt";
 	};
 
 	ufs30_clk: ufs30-clk {
diff --git a/arch/arm64/boot/dts/renesas/r8a779g0.dtsi b/arch/arm64/boot/dts/renesas/r8a779g0.dtsi
index d7677595204d..87fbc5331690 100644
--- a/arch/arm64/boot/dts/renesas/r8a779g0.dtsi
+++ b/arch/arm64/boot/dts/renesas/r8a779g0.dtsi
@@ -2350,6 +2350,9 @@ timer {
 		interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
 				      <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
 				      <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
-				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>;
+				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+		interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+				  "hyp-virt";
 	};
 };
diff --git a/arch/arm64/boot/dts/renesas/r9a07g043u.dtsi b/arch/arm64/boot/dts/renesas/r9a07g043u.dtsi
index b3f83d0ebcbb..4b72de43b71c 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g043u.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g043u.dtsi
@@ -50,7 +50,10 @@ timer {
 		interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
 				      <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
 				      <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
-				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>;
+				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+		interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+				  "hyp-virt";
 	};
 };
 
diff --git a/arch/arm64/boot/dts/renesas/r9a07g044.dtsi b/arch/arm64/boot/dts/renesas/r9a07g044.dtsi
index 081d8f49db87..a877738c3048 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g044.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g044.dtsi
@@ -1288,6 +1288,9 @@ timer {
 		interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
 				      <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
 				      <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
-				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>;
+				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+		interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+				  "hyp-virt";
 	};
 };
diff --git a/arch/arm64/boot/dts/renesas/r9a07g054.dtsi b/arch/arm64/boot/dts/renesas/r9a07g054.dtsi
index 0d327464d2ba..3f01b096cfb7 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g054.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g054.dtsi
@@ -1295,6 +1295,9 @@ timer {
 		interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
 				      <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
 				      <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
-				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>;
+				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+		interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+				  "hyp-virt";
 	};
 };
diff --git a/arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts b/arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts
index 4f6541262ab8..5ca0cc19f92c 100644
--- a/arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts
+++ b/arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts
@@ -17,6 +17,7 @@ aliases {
 		ethernet0 = &gmac;
 		mmc0 = &emmc;
 		mmc1 = &sdmmc;
+		mmc2 = &sdio;
 	};
 
 	chosen {
@@ -144,11 +145,25 @@ &emmc {
 
 &gmac {
 	clock_in_out = "output";
+	phy-handle = <&rtl8201f>;
 	phy-supply = <&vcc_io>;
-	snps,reset-gpio = <&gpio0 RK_PA7 GPIO_ACTIVE_LOW>;
-	snps,reset-active-low;
-	snps,reset-delays-us = <0 50000 50000>;
 	status = "okay";
+
+	mdio {
+		compatible = "snps,dwmac-mdio";
+		#address-cells = <1>;
+		#size-cells = <0>;
+
+		rtl8201f: ethernet-phy@1 {
+			compatible = "ethernet-phy-ieee802.3-c22";
+			reg = <1>;
+			pinctrl-names = "default";
+			pinctrl-0 = <&mac_rst>;
+			reset-assert-us = <20000>;
+			reset-deassert-us = <50000>;
+			reset-gpios = <&gpio0 RK_PA7 GPIO_ACTIVE_LOW>;
+		};
+	};
 };
 
 &i2c1 {
@@ -159,6 +174,26 @@ &pinctrl {
 	pinctrl-names = "default";
 	pinctrl-0 = <&rtc_32k>;
 
+	bluetooth {
+		bt_reg_on: bt-reg-on {
+			rockchip,pins = <4 RK_PB3 RK_FUNC_GPIO &pcfg_pull_none>;
+		};
+
+		bt_wake_host: bt-wake-host {
+			rockchip,pins = <4 RK_PB4 RK_FUNC_GPIO &pcfg_pull_down>;
+		};
+
+		host_wake_bt: host-wake-bt {
+			rockchip,pins = <4 RK_PB2 RK_FUNC_GPIO &pcfg_pull_none>;
+		};
+	};
+
+	gmac {
+		mac_rst: mac-rst {
+			rockchip,pins = <0 RK_PA7 RK_FUNC_GPIO &pcfg_pull_none>;
+		};
+	};
+
 	leds {
 		green_led: green-led {
 			rockchip,pins = <0 RK_PA6 RK_FUNC_GPIO &pcfg_pull_none>;
@@ -202,15 +237,31 @@ &sdio {
 	cap-sd-highspeed;
 	cap-sdio-irq;
 	keep-power-in-suspend;
-	max-frequency = <1000000>;
+	max-frequency = <100000000>;
 	mmc-pwrseq = <&sdio_pwrseq>;
+	no-mmc;
+	no-sd;
 	non-removable;
-	sd-uhs-sdr104;
+	sd-uhs-sdr50;
+	vmmc-supply = <&vcc_io>;
+	vqmmc-supply = <&vcc_1v8>;
 	status = "okay";
+
+	rtl8723ds: wifi@1 {
+		reg = <1>;
+		interrupt-parent = <&gpio0>;
+		interrupts = <RK_PA0 IRQ_TYPE_LEVEL_HIGH>;
+		interrupt-names = "host-wake";
+		pinctrl-names = "default";
+		pinctrl-0 = <&wifi_host_wake>;
+	};
 };
 
 &sdmmc {
+	cap-mmc-highspeed;
 	cap-sd-highspeed;
+	disable-wp;
+	vmmc-supply = <&vcc_io>;
 	status = "okay";
 };
 
@@ -229,16 +280,22 @@ u2phy_otg: otg-port {
 };
 
 &uart0 {
+	pinctrl-names = "default";
+	pinctrl-0 = <&uart0_xfer>;
 	status = "okay";
 };
 
 &uart4 {
+	uart-has-rtscts;
 	status = "okay";
 
 	bluetooth {
-		compatible = "realtek,rtl8723bs-bt";
-		device-wake-gpios = <&gpio4 RK_PB3 GPIO_ACTIVE_HIGH>;
+		compatible = "realtek,rtl8723ds-bt";
+		device-wake-gpios = <&gpio4 RK_PB2 GPIO_ACTIVE_HIGH>;
+		enable-gpios = <&gpio4 RK_PB3 GPIO_ACTIVE_HIGH>;
 		host-wake-gpios = <&gpio4 RK_PB4 GPIO_ACTIVE_HIGH>;
+		pinctrl-names = "default";
+		pinctrl-0 = <&bt_reg_on &bt_wake_host &host_wake_bt>;
 	};
 };
 
diff --git a/arch/arm64/boot/dts/rockchip/rk3328.dtsi b/arch/arm64/boot/dts/rockchip/rk3328.dtsi
index 3778fe5c42a4..126165ba1ea2 100644
--- a/arch/arm64/boot/dts/rockchip/rk3328.dtsi
+++ b/arch/arm64/boot/dts/rockchip/rk3328.dtsi
@@ -822,8 +822,8 @@ cru: clock-controller@...40000 {
 			<0>, <24000000>,
 			<24000000>, <24000000>,
 			<15000000>, <15000000>,
-			<100000000>, <100000000>,
-			<100000000>, <100000000>,
+			<300000000>, <100000000>,
+			<400000000>, <100000000>,
 			<50000000>, <100000000>,
 			<100000000>, <100000000>,
 			<50000000>, <50000000>,
diff --git a/arch/arm64/boot/dts/rockchip/rk3566-roc-pc.dts b/arch/arm64/boot/dts/rockchip/rk3566-roc-pc.dts
index 938092fce186..68a72ac24cd4 100644
--- a/arch/arm64/boot/dts/rockchip/rk3566-roc-pc.dts
+++ b/arch/arm64/boot/dts/rockchip/rk3566-roc-pc.dts
@@ -268,7 +268,7 @@ rk809: pmic@20 {
 		vcc9-supply = <&vcc3v3_sys>;
 
 		codec {
-			mic-in-differential;
+			rockchip,mic-in-differential;
 		};
 
 		regulators {
diff --git a/arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts b/arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts
index 19f8fc369b13..8c3ab07d3807 100644
--- a/arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts
+++ b/arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts
@@ -475,7 +475,7 @@ regulator-state-mem {
 		};
 
 		codec {
-			mic-in-differential;
+			rockchip,mic-in-differential;
 		};
 	};
 };
diff --git a/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r66s.dts b/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r66s.dts
index 58ab7e9971db..b5e67990dd0f 100644
--- a/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r66s.dts
+++ b/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r66s.dts
@@ -11,6 +11,10 @@ aliases {
 	};
 };
 
+&pmu_io_domains {
+	vccio3-supply = <&vccio_sd>;
+};
+
 &sdmmc0 {
 	bus-width = <4>;
 	cap-mmc-highspeed;
diff --git a/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r66s.dtsi b/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r66s.dtsi
index 89e84e3a9262..25c49bdbadbc 100644
--- a/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r66s.dtsi
+++ b/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r66s.dtsi
@@ -39,9 +39,9 @@ status_led: led-status {
 		};
 	};
 
-	dc_12v: dc-12v-regulator {
+	vcc12v_dcin: vcc12v-dcin-regulator {
 		compatible = "regulator-fixed";
-		regulator-name = "dc_12v";
+		regulator-name = "vcc12v_dcin";
 		regulator-always-on;
 		regulator-boot-on;
 		regulator-min-microvolt = <12000000>;
@@ -65,7 +65,7 @@ vcc3v3_sys: vcc3v3-sys-regulator {
 		regulator-boot-on;
 		regulator-min-microvolt = <3300000>;
 		regulator-max-microvolt = <3300000>;
-		vin-supply = <&dc_12v>;
+		vin-supply = <&vcc12v_dcin>;
 	};
 
 	vcc5v0_sys: vcc5v0-sys-regulator {
@@ -75,16 +75,7 @@ vcc5v0_sys: vcc5v0-sys-regulator {
 		regulator-boot-on;
 		regulator-min-microvolt = <5000000>;
 		regulator-max-microvolt = <5000000>;
-		vin-supply = <&dc_12v>;
-	};
-
-	vcc5v0_usb_host: vcc5v0-usb-host-regulator {
-		compatible = "regulator-fixed";
-		regulator-name = "vcc5v0_usb_host";
-		regulator-always-on;
-		regulator-boot-on;
-		regulator-min-microvolt = <5000000>;
-		regulator-max-microvolt = <5000000>;
+		vin-supply = <&vcc12v_dcin>;
 	};
 
 	vcc5v0_usb_otg: vcc5v0-usb-otg-regulator {
@@ -94,8 +85,9 @@ vcc5v0_usb_otg: vcc5v0-usb-otg-regulator {
 		pinctrl-names = "default";
 		pinctrl-0 = <&vcc5v0_usb_otg_en>;
 		regulator-name = "vcc5v0_usb_otg";
-		regulator-always-on;
-		regulator-boot-on;
+		regulator-min-microvolt = <5000000>;
+		regulator-max-microvolt = <5000000>;
+		vin-supply = <&vcc5v0_sys>;
 	};
 };
 
@@ -123,6 +115,10 @@ &cpu3 {
 	cpu-supply = <&vdd_cpu>;
 };
 
+&display_subsystem {
+	status = "disabled";
+};
+
 &gpu {
 	mali-supply = <&vdd_gpu>;
 	status = "okay";
@@ -405,8 +401,8 @@ vcc5v0_usb_otg_en: vcc5v0-usb-otg-en {
 &pmu_io_domains {
 	pmuio1-supply = <&vcc3v3_pmu>;
 	pmuio2-supply = <&vcc3v3_pmu>;
-	vccio1-supply = <&vccio_acodec>;
-	vccio3-supply = <&vccio_sd>;
+	vccio1-supply = <&vcc_3v3>;
+	vccio2-supply = <&vcc_1v8>;
 	vccio4-supply = <&vcc_1v8>;
 	vccio5-supply = <&vcc_3v3>;
 	vccio6-supply = <&vcc_1v8>;
@@ -429,28 +425,12 @@ &uart2 {
 	status = "okay";
 };
 
-&usb_host0_ehci {
-	status = "okay";
-};
-
-&usb_host0_ohci {
-	status = "okay";
-};
-
 &usb_host0_xhci {
 	dr_mode = "host";
 	extcon = <&usb2phy0>;
 	status = "okay";
 };
 
-&usb_host1_ehci {
-	status = "okay";
-};
-
-&usb_host1_ohci {
-	status = "okay";
-};
-
 &usb_host1_xhci {
 	status = "okay";
 };
@@ -460,7 +440,7 @@ &usb2phy0 {
 };
 
 &usb2phy0_host {
-	phy-supply = <&vcc5v0_usb_host>;
+	phy-supply = <&vcc5v0_sys>;
 	status = "okay";
 };
 
diff --git a/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r68s.dts b/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r68s.dts
index e1fe5e442689..ce2a5e1ccefc 100644
--- a/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r68s.dts
+++ b/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r68s.dts
@@ -39,7 +39,7 @@ &gmac0_tx_bus2
 		     &gmac0_rx_bus2
 		     &gmac0_rgmii_clk
 		     &gmac0_rgmii_bus>;
-	snps,reset-gpio = <&gpio0 RK_PB0 GPIO_ACTIVE_LOW>;
+	snps,reset-gpio = <&gpio1 RK_PB0 GPIO_ACTIVE_LOW>;
 	snps,reset-active-low;
 	/* Reset time is 15ms, 50ms for rtl8211f */
 	snps,reset-delays-us = <0 15000 50000>;
@@ -61,7 +61,7 @@ &gmac1m1_tx_bus2
 		     &gmac1m1_rx_bus2
 		     &gmac1m1_rgmii_clk
 		     &gmac1m1_rgmii_bus>;
-	snps,reset-gpio = <&gpio0 RK_PB1 GPIO_ACTIVE_LOW>;
+	snps,reset-gpio = <&gpio1 RK_PB1 GPIO_ACTIVE_LOW>;
 	snps,reset-active-low;
 	/* Reset time is 15ms, 50ms for rtl8211f */
 	snps,reset-delays-us = <0 15000 50000>;
@@ -71,18 +71,18 @@ &gmac1m1_rgmii_clk
 };
 
 &mdio0 {
-	rgmii_phy0: ethernet-phy@0 {
+	rgmii_phy0: ethernet-phy@1 {
 		compatible = "ethernet-phy-ieee802.3-c22";
-		reg = <0>;
+		reg = <0x1>;
 		pinctrl-0 = <&eth_phy0_reset_pin>;
 		pinctrl-names = "default";
 	};
 };
 
 &mdio1 {
-	rgmii_phy1: ethernet-phy@0 {
+	rgmii_phy1: ethernet-phy@1 {
 		compatible = "ethernet-phy-ieee802.3-c22";
-		reg = <0>;
+		reg = <0x1>;
 		pinctrl-0 = <&eth_phy1_reset_pin>;
 		pinctrl-names = "default";
 	};
@@ -102,6 +102,10 @@ eth_phy1_reset_pin: eth-phy1-reset-pin {
 	};
 };
 
+&pmu_io_domains {
+	vccio3-supply = <&vcc_3v3>;
+};
+
 &sdhci {
 	bus-width = <8>;
 	max-frequency = <200000000>;
diff --git a/arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts b/arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts
index e05ab11981f5..17830e8c9a59 100644
--- a/arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts
+++ b/arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts
@@ -530,10 +530,6 @@ regulator-state-mem {
 				};
 			};
 		};
-
-		codec {
-			mic-in-differential;
-		};
 	};
 };
 
diff --git a/arch/arm64/boot/dts/rockchip/rk356x.dtsi b/arch/arm64/boot/dts/rockchip/rk356x.dtsi
index 820c98dbccc0..2f885bc3665b 100644
--- a/arch/arm64/boot/dts/rockchip/rk356x.dtsi
+++ b/arch/arm64/boot/dts/rockchip/rk356x.dtsi
@@ -749,6 +749,7 @@ vop_mmu: iommu@...43e00 {
 		clocks = <&cru ACLK_VOP>, <&cru HCLK_VOP>;
 		clock-names = "aclk", "iface";
 		#iommu-cells = <0>;
+		power-domains = <&power RK3568_PD_VO>;
 		status = "disabled";
 	};
 
diff --git a/arch/arm64/boot/dts/ti/k3-am62-verdin.dtsi b/arch/arm64/boot/dts/ti/k3-am62-verdin.dtsi
index d4f8776c9277..0a5634ca005d 100644
--- a/arch/arm64/boot/dts/ti/k3-am62-verdin.dtsi
+++ b/arch/arm64/boot/dts/ti/k3-am62-verdin.dtsi
@@ -1309,8 +1309,6 @@ &mcasp0 {
 	       0 0 0 0
 	>;
 	tdm-slots = <2>;
-	rx-num-evt = <32>;
-	tx-num-evt = <32>;
 	#sound-dai-cells = <0>;
 	status = "disabled";
 };
@@ -1327,8 +1325,6 @@ &mcasp1 {
 	       0 0 0 0
 	>;
 	tdm-slots = <2>;
-	rx-num-evt = <32>;
-	tx-num-evt = <32>;
 	#sound-dai-cells = <0>;
 	status = "disabled";
 };
diff --git a/arch/arm64/boot/dts/ti/k3-am625-beagleplay.dts b/arch/arm64/boot/dts/ti/k3-am625-beagleplay.dts
index 2de74428a8bd..3560349d6305 100644
--- a/arch/arm64/boot/dts/ti/k3-am625-beagleplay.dts
+++ b/arch/arm64/boot/dts/ti/k3-am625-beagleplay.dts
@@ -903,6 +903,4 @@ &mcasp1 {
 	       0 0 0 0
 	       0 0 0 0
 	>;
-	tx-num-evt = <32>;
-	rx-num-evt = <32>;
 };
diff --git a/arch/arm64/boot/dts/ti/k3-am62x-sk-common.dtsi b/arch/arm64/boot/dts/ti/k3-am62x-sk-common.dtsi
index 677ff8de4b6e..0f8c0f6a0f57 100644
--- a/arch/arm64/boot/dts/ti/k3-am62x-sk-common.dtsi
+++ b/arch/arm64/boot/dts/ti/k3-am62x-sk-common.dtsi
@@ -481,8 +481,6 @@ &mcasp1 {
 	       0 0 0 0
 	       0 0 0 0
 	>;
-	tx-num-evt = <32>;
-	rx-num-evt = <32>;
 };
 
 &dss {
diff --git a/arch/loongarch/kernel/hw_breakpoint.c b/arch/loongarch/kernel/hw_breakpoint.c
index 621ad7634df7..a6e4b605bfa8 100644
--- a/arch/loongarch/kernel/hw_breakpoint.c
+++ b/arch/loongarch/kernel/hw_breakpoint.c
@@ -221,7 +221,7 @@ static int hw_breakpoint_control(struct perf_event *bp,
 		}
 		enable = csr_read64(LOONGARCH_CSR_CRMD);
 		csr_write64(CSR_CRMD_WE | enable, LOONGARCH_CSR_CRMD);
-		if (bp->hw.target)
+		if (bp->hw.target && test_tsk_thread_flag(bp->hw.target, TIF_LOAD_WATCH))
 			regs->csr_prmd |= CSR_PRMD_PWE;
 		break;
 	case HW_BREAKPOINT_UNINSTALL:
diff --git a/arch/loongarch/kernel/ptrace.c b/arch/loongarch/kernel/ptrace.c
index 200109de1971..19dc6eff45cc 100644
--- a/arch/loongarch/kernel/ptrace.c
+++ b/arch/loongarch/kernel/ptrace.c
@@ -589,6 +589,7 @@ static int ptrace_hbp_set_ctrl(unsigned int note_type,
 	struct perf_event *bp;
 	struct perf_event_attr attr;
 	struct arch_hw_breakpoint_ctrl ctrl;
+	struct thread_info *ti = task_thread_info(tsk);
 
 	bp = ptrace_hbp_get_initialised_bp(note_type, tsk, idx);
 	if (IS_ERR(bp))
@@ -613,8 +614,10 @@ static int ptrace_hbp_set_ctrl(unsigned int note_type,
 		if (err)
 			return err;
 		attr.disabled = 0;
+		set_ti_thread_flag(ti, TIF_LOAD_WATCH);
 	} else {
 		attr.disabled = 1;
+		clear_ti_thread_flag(ti, TIF_LOAD_WATCH);
 	}
 
 	return modify_user_hw_breakpoint(bp, &attr);
diff --git a/arch/m68k/amiga/config.c b/arch/m68k/amiga/config.c
index 3137b45750df..b7cb28f5ee29 100644
--- a/arch/m68k/amiga/config.c
+++ b/arch/m68k/amiga/config.c
@@ -180,6 +180,15 @@ int __init amiga_parse_bootinfo(const struct bi_record *record)
 			dev->slotsize = be16_to_cpu(cd->cd_SlotSize);
 			dev->boardaddr = be32_to_cpu(cd->cd_BoardAddr);
 			dev->boardsize = be32_to_cpu(cd->cd_BoardSize);
+
+			/* CS-LAB Warp 1260 workaround */
+			if (be16_to_cpu(dev->rom.er_Manufacturer) == ZORRO_MANUF(ZORRO_PROD_CSLAB_WARP_1260) &&
+			    dev->rom.er_Product == ZORRO_PROD(ZORRO_PROD_CSLAB_WARP_1260)) {
+
+				/* turn off all interrupts */
+				pr_info("Warp 1260 card detected: applying interrupt storm workaround\n");
+				*(uint32_t *)(dev->boardaddr + 0x1000) = 0xfff;
+			}
 		} else
 			pr_warn("amiga_parse_bootinfo: too many AutoConfig devices\n");
 #endif /* CONFIG_ZORRO */
diff --git a/arch/m68k/atari/ataints.c b/arch/m68k/atari/ataints.c
index 56f02ea2c248..715d1e0d973e 100644
--- a/arch/m68k/atari/ataints.c
+++ b/arch/m68k/atari/ataints.c
@@ -302,11 +302,7 @@ void __init atari_init_IRQ(void)
 
 	if (ATARIHW_PRESENT(SCU)) {
 		/* init the SCU if present */
-		tt_scu.sys_mask = 0x10;		/* enable VBL (for the cursor) and
-									 * disable HSYNC interrupts (who
-									 * needs them?)  MFP and SCC are
-									 * enabled in VME mask
-									 */
+		tt_scu.sys_mask = 0x0;		/* disable all interrupts */
 		tt_scu.vme_mask = 0x60;		/* enable MFP and SCC ints */
 	} else {
 		/* If no SCU and no Hades, the HSYNC interrupt needs to be
diff --git a/arch/m68k/include/asm/cmpxchg.h b/arch/m68k/include/asm/cmpxchg.h
index d7f3de9c5d6f..4ba14f3535fc 100644
--- a/arch/m68k/include/asm/cmpxchg.h
+++ b/arch/m68k/include/asm/cmpxchg.h
@@ -32,7 +32,7 @@ static inline unsigned long __arch_xchg(unsigned long x, volatile void * ptr, in
 		x = tmp;
 		break;
 	default:
-		tmp = __invalid_xchg_size(x, ptr, size);
+		x = __invalid_xchg_size(x, ptr, size);
 		break;
 	}
 
diff --git a/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi b/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi
index ee3e2153dd13..c0be84a6e81f 100644
--- a/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi
+++ b/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi
@@ -23,14 +23,6 @@ cpu0: cpu@0 {
 		};
 	};
 
-	memory@...000 {
-		compatible = "memory";
-		device_type = "memory";
-		reg = <0x00000000 0x00200000 0x00000000 0x0ee00000>, /* 238 MB at 2 MB */
-			<0x00000000 0x20000000 0x00000000 0x1f000000>, /* 496 MB at 512 MB */
-			<0x00000001 0x10000000 0x00000001 0xb0000000>; /* 6912 MB at 4352MB */
-	};
-
 	cpu_clk: cpu_clk {
 		#clock-cells = <0>;
 		compatible = "fixed-clock";
@@ -52,6 +44,13 @@ package0: bus@...00000 {
 			0 0x40000000 0 0x40000000 0 0x40000000
 			0xfe 0x00000000 0xfe 0x00000000 0 0x40000000>;
 
+		isa@...00000 {
+			compatible = "isa";
+			#size-cells = <1>;
+			#address-cells = <2>;
+			ranges = <1 0x0 0x0 0x18000000 0x4000>;
+		};
+
 		pm: reset-controller@...07000 {
 			compatible = "loongson,ls2k-pm";
 			reg = <0 0x1fe07000 0 0x422>;
@@ -137,7 +136,8 @@ gmac@3,0 {
 					     <13 IRQ_TYPE_LEVEL_LOW>;
 				interrupt-names = "macirq", "eth_lpi";
 				interrupt-parent = <&liointc0>;
-				phy-mode = "rgmii";
+				phy-mode = "rgmii-id";
+				phy-handle = <&phy1>;
 				mdio {
 					#address-cells = <1>;
 					#size-cells = <0>;
@@ -160,7 +160,8 @@ gmac@3,1 {
 					     <15 IRQ_TYPE_LEVEL_LOW>;
 				interrupt-names = "macirq", "eth_lpi";
 				interrupt-parent = <&liointc0>;
-				phy-mode = "rgmii";
+				phy-mode = "rgmii-id";
+				phy-handle = <&phy1>;
 				mdio {
 					#address-cells = <1>;
 					#size-cells = <0>;
diff --git a/arch/mips/include/asm/mach-loongson64/boot_param.h b/arch/mips/include/asm/mach-loongson64/boot_param.h
index e007edd6b60a..9218b3ae3383 100644
--- a/arch/mips/include/asm/mach-loongson64/boot_param.h
+++ b/arch/mips/include/asm/mach-loongson64/boot_param.h
@@ -42,12 +42,14 @@ enum loongson_cpu_type {
 	Legacy_1B = 0x5,
 	Legacy_2G = 0x6,
 	Legacy_2H = 0x7,
+	Legacy_2K = 0x8,
 	Loongson_1A = 0x100,
 	Loongson_1B = 0x101,
 	Loongson_2E = 0x200,
 	Loongson_2F = 0x201,
 	Loongson_2G = 0x202,
 	Loongson_2H = 0x203,
+	Loongson_2K = 0x204,
 	Loongson_3A = 0x300,
 	Loongson_3B = 0x301
 };
diff --git a/arch/mips/include/asm/mips-cm.h b/arch/mips/include/asm/mips-cm.h
index 23c67c0871b1..696b40beb774 100644
--- a/arch/mips/include/asm/mips-cm.h
+++ b/arch/mips/include/asm/mips-cm.h
@@ -228,6 +228,10 @@ GCR_ACCESSOR_RO(32, 0x0d0, gic_status)
 GCR_ACCESSOR_RO(32, 0x0f0, cpc_status)
 #define CM_GCR_CPC_STATUS_EX			BIT(0)
 
+/* GCR_ACCESS - Controls core/IOCU access to GCRs */
+GCR_ACCESSOR_RW(32, 0x120, access_cm3)
+#define CM_GCR_ACCESS_ACCESSEN			GENMASK(7, 0)
+
 /* GCR_L2_CONFIG - Indicates L2 cache configuration when Config5.L2C=1 */
 GCR_ACCESSOR_RW(32, 0x130, l2_config)
 #define CM_GCR_L2_CONFIG_BYPASS			BIT(20)
diff --git a/arch/mips/kernel/smp-cps.c b/arch/mips/kernel/smp-cps.c
index dd55d59b88db..d445f8e849ab 100644
--- a/arch/mips/kernel/smp-cps.c
+++ b/arch/mips/kernel/smp-cps.c
@@ -222,7 +222,10 @@ static void boot_core(unsigned int core, unsigned int vpe_id)
 	write_gcr_co_reset_ext_base(CM_GCR_Cx_RESET_EXT_BASE_UEB);
 
 	/* Ensure the core can access the GCRs */
-	set_gcr_access(1 << core);
+	if (mips_cm_revision() < CM_REV_CM3)
+		set_gcr_access(1 << core);
+	else
+		set_gcr_access_cm3(1 << core);
 
 	if (mips_cpc_present()) {
 		/* Reset the core */
diff --git a/arch/mips/loongson64/env.c b/arch/mips/loongson64/env.c
index ef3750a6ffac..09ff05269861 100644
--- a/arch/mips/loongson64/env.c
+++ b/arch/mips/loongson64/env.c
@@ -88,6 +88,12 @@ void __init prom_lefi_init_env(void)
 	cpu_clock_freq = ecpu->cpu_clock_freq;
 	loongson_sysconf.cputype = ecpu->cputype;
 	switch (ecpu->cputype) {
+	case Legacy_2K:
+	case Loongson_2K:
+		smp_group[0] = 0x900000001fe11000;
+		loongson_sysconf.cores_per_node = 2;
+		loongson_sysconf.cores_per_package = 2;
+		break;
 	case Legacy_3A:
 	case Loongson_3A:
 		loongson_sysconf.cores_per_node = 4;
@@ -221,6 +227,8 @@ void __init prom_lefi_init_env(void)
 		default:
 			break;
 		}
+	} else if ((read_c0_prid() & PRID_IMP_MASK) == PRID_IMP_LOONGSON_64R) {
+		loongson_fdt_blob = __dtb_loongson64_2core_2k1000_begin;
 	} else if ((read_c0_prid() & PRID_IMP_MASK) == PRID_IMP_LOONGSON_64G) {
 		if (loongson_sysconf.bridgetype == LS7A)
 			loongson_fdt_blob = __dtb_loongson64g_4core_ls7a_begin;
diff --git a/arch/mips/loongson64/reset.c b/arch/mips/loongson64/reset.c
index e420800043b0..2a8e4cd72605 100644
--- a/arch/mips/loongson64/reset.c
+++ b/arch/mips/loongson64/reset.c
@@ -11,6 +11,7 @@
 #include <linux/init.h>
 #include <linux/kexec.h>
 #include <linux/pm.h>
+#include <linux/reboot.h>
 #include <linux/slab.h>
 
 #include <asm/bootinfo.h>
@@ -21,36 +22,21 @@
 #include <loongson.h>
 #include <boot_param.h>
 
-static void loongson_restart(char *command)
+static int firmware_restart(struct sys_off_data *unusedd)
 {
 
 	void (*fw_restart)(void) = (void *)loongson_sysconf.restart_addr;
 
 	fw_restart();
-	while (1) {
-		if (cpu_wait)
-			cpu_wait();
-	}
+	return NOTIFY_DONE;
 }
 
-static void loongson_poweroff(void)
+static int firmware_poweroff(struct sys_off_data *unused)
 {
 	void (*fw_poweroff)(void) = (void *)loongson_sysconf.poweroff_addr;
 
 	fw_poweroff();
-	while (1) {
-		if (cpu_wait)
-			cpu_wait();
-	}
-}
-
-static void loongson_halt(void)
-{
-	pr_notice("\n\n** You can safely turn off the power now **\n\n");
-	while (1) {
-		if (cpu_wait)
-			cpu_wait();
-	}
+	return NOTIFY_DONE;
 }
 
 #ifdef CONFIG_KEXEC
@@ -154,9 +140,17 @@ static void loongson_crash_shutdown(struct pt_regs *regs)
 
 static int __init mips_reboot_setup(void)
 {
-	_machine_restart = loongson_restart;
-	_machine_halt = loongson_halt;
-	pm_power_off = loongson_poweroff;
+	if (loongson_sysconf.restart_addr) {
+		register_sys_off_handler(SYS_OFF_MODE_RESTART,
+				 SYS_OFF_PRIO_FIRMWARE,
+				 firmware_restart, NULL);
+	}
+
+	if (loongson_sysconf.poweroff_addr) {
+		register_sys_off_handler(SYS_OFF_MODE_POWER_OFF,
+				 SYS_OFF_PRIO_FIRMWARE,
+				 firmware_poweroff, NULL);
+	}
 
 #ifdef CONFIG_KEXEC
 	kexec_argv = kmalloc(KEXEC_ARGV_SIZE, GFP_KERNEL);
diff --git a/arch/mips/loongson64/smp.c b/arch/mips/loongson64/smp.c
index e015a26a40f7..979993679d91 100644
--- a/arch/mips/loongson64/smp.c
+++ b/arch/mips/loongson64/smp.c
@@ -466,12 +466,25 @@ static void loongson3_smp_finish(void)
 static void __init loongson3_smp_setup(void)
 {
 	int i = 0, num = 0; /* i: physical id, num: logical id */
+	int max_cpus = 0;
 
 	init_cpu_possible(cpu_none_mask);
 
+	for (i = 0; i < ARRAY_SIZE(smp_group); i++) {
+		if (!smp_group[i])
+			break;
+		max_cpus += loongson_sysconf.cores_per_node;
+	}
+
+	if (max_cpus < loongson_sysconf.nr_cpus) {
+		pr_err("SMP Groups are less than the number of CPUs\n");
+		loongson_sysconf.nr_cpus = max_cpus ? max_cpus : 1;
+	}
+
 	/* For unified kernel, NR_CPUS is the maximum possible value,
 	 * loongson_sysconf.nr_cpus is the really present value
 	 */
+	i = 0;
 	while (i < loongson_sysconf.nr_cpus) {
 		if (loongson_sysconf.reserved_cpus_mask & (1<<i)) {
 			/* Reserved physical CPU cores */
@@ -492,14 +505,14 @@ static void __init loongson3_smp_setup(void)
 		__cpu_logical_map[num] = -1;
 		num++;
 	}
-
 	csr_ipi_probe();
 	ipi_set0_regs_init();
 	ipi_clear0_regs_init();
 	ipi_status0_regs_init();
 	ipi_en0_regs_init();
 	ipi_mailbox_buf_init();
-	ipi_write_enable(0);
+	if (smp_group[0])
+		ipi_write_enable(0);
 
 	cpu_set_core(&cpu_data[0],
 		     cpu_logical_map(0) % loongson_sysconf.cores_per_package);
@@ -818,6 +831,9 @@ static int loongson3_disable_clock(unsigned int cpu)
 	uint64_t core_id = cpu_core(&cpu_data[cpu]);
 	uint64_t package_id = cpu_data[cpu].package;
 
+	if (!loongson_chipcfg[package_id] || !loongson_freqctrl[package_id])
+		return 0;
+
 	if ((read_c0_prid() & PRID_REV_MASK) == PRID_REV_LOONGSON3A_R1) {
 		LOONGSON_CHIPCFG(package_id) &= ~(1 << (12 + core_id));
 	} else {
@@ -832,6 +848,9 @@ static int loongson3_enable_clock(unsigned int cpu)
 	uint64_t core_id = cpu_core(&cpu_data[cpu]);
 	uint64_t package_id = cpu_data[cpu].package;
 
+	if (!loongson_chipcfg[package_id] || !loongson_freqctrl[package_id])
+		return 0;
+
 	if ((read_c0_prid() & PRID_REV_MASK) == PRID_REV_LOONGSON3A_R1) {
 		LOONGSON_CHIPCFG(package_id) |= 1 << (12 + core_id);
 	} else {
diff --git a/arch/mips/pci/pcie-octeon.c b/arch/mips/pci/pcie-octeon.c
old mode 100755
new mode 100644
diff --git a/arch/mips/sgi-ip30/ip30-console.c b/arch/mips/sgi-ip30/ip30-console.c
index b91f8c4fdc78..a087b7ebe129 100644
--- a/arch/mips/sgi-ip30/ip30-console.c
+++ b/arch/mips/sgi-ip30/ip30-console.c
@@ -1,6 +1,7 @@
 // SPDX-License-Identifier: GPL-2.0
 
 #include <linux/io.h>
+#include <linux/processor.h>
 
 #include <asm/sn/ioc3.h>
 
diff --git a/arch/parisc/Kconfig b/arch/parisc/Kconfig
index 722e83edad28..2834a6406497 100644
--- a/arch/parisc/Kconfig
+++ b/arch/parisc/Kconfig
@@ -83,6 +83,7 @@ config PARISC
 	select HAVE_SOFTIRQ_ON_OWN_STACK if IRQSTACKS
 	select TRACE_IRQFLAGS_SUPPORT
 	select HAVE_FUNCTION_DESCRIPTORS if 64BIT
+	select PCI_MSI_ARCH_FALLBACKS if PCI_MSI
 
 	help
 	  The PA-RISC microprocessor is designed by Hewlett-Packard and used
diff --git a/arch/powerpc/configs/85xx-hw.config b/arch/powerpc/configs/85xx-hw.config
index 524db76f47b7..8aff83217397 100644
--- a/arch/powerpc/configs/85xx-hw.config
+++ b/arch/powerpc/configs/85xx-hw.config
@@ -24,6 +24,7 @@ CONFIG_FS_ENET=y
 CONFIG_FSL_CORENET_CF=y
 CONFIG_FSL_DMA=y
 CONFIG_FSL_HV_MANAGER=y
+CONFIG_FSL_IFC=y
 CONFIG_FSL_PQ_MDIO=y
 CONFIG_FSL_RIO=y
 CONFIG_FSL_XGMAC_MDIO=y
@@ -58,6 +59,7 @@ CONFIG_INPUT_FF_MEMLESS=m
 CONFIG_MARVELL_PHY=y
 CONFIG_MDIO_BUS_MUX_GPIO=y
 CONFIG_MDIO_BUS_MUX_MMIOREG=y
+CONFIG_MEMORY=y
 CONFIG_MMC_SDHCI_OF_ESDHC=y
 CONFIG_MMC_SDHCI_PLTFM=y
 CONFIG_MMC_SDHCI=y
diff --git a/arch/powerpc/kernel/prom.c b/arch/powerpc/kernel/prom.c
index 77364729a1b6..bf6d8ad3819e 100644
--- a/arch/powerpc/kernel/prom.c
+++ b/arch/powerpc/kernel/prom.c
@@ -327,6 +327,7 @@ static int __init early_init_dt_scan_cpus(unsigned long node,
 					  void *data)
 {
 	const char *type = of_get_flat_dt_prop(node, "device_type", NULL);
+	const __be32 *cpu_version = NULL;
 	const __be32 *prop;
 	const __be32 *intserv;
 	int i, nthreads;
@@ -410,7 +411,7 @@ static int __init early_init_dt_scan_cpus(unsigned long node,
 		prop = of_get_flat_dt_prop(node, "cpu-version", NULL);
 		if (prop && (be32_to_cpup(prop) & 0xff000000) == 0x0f000000) {
 			identify_cpu(0, be32_to_cpup(prop));
-			seq_buf_printf(&ppc_hw_desc, "0x%04x ", be32_to_cpup(prop));
+			cpu_version = prop;
 		}
 
 		check_cpu_feature_properties(node);
@@ -421,6 +422,12 @@ static int __init early_init_dt_scan_cpus(unsigned long node,
 	}
 
 	identical_pvr_fixup(node);
+
+	// We can now add the CPU name & PVR to the hardware description
+	seq_buf_printf(&ppc_hw_desc, "%s 0x%04lx ", cur_cpu_spec->cpu_name, mfspr(SPRN_PVR));
+	if (cpu_version)
+		seq_buf_printf(&ppc_hw_desc, "0x%04x ", be32_to_cpup(cpu_version));
+
 	init_mmu_slb_size(node);
 
 #ifdef CONFIG_PPC64
@@ -858,9 +865,6 @@ void __init early_init_devtree(void *params)
 
 	dt_cpu_ftrs_scan();
 
-	// We can now add the CPU name & PVR to the hardware description
-	seq_buf_printf(&ppc_hw_desc, "%s 0x%04lx ", cur_cpu_spec->cpu_name, mfspr(SPRN_PVR));
-
 	/* Retrieve CPU related informations from the flat tree
 	 * (altivec support, boot CPU ID, ...)
 	 */
diff --git a/arch/powerpc/kvm/book3s_hv.c b/arch/powerpc/kvm/book3s_hv.c
index 0429488ba170..1bb00c721544 100644
--- a/arch/powerpc/kvm/book3s_hv.c
+++ b/arch/powerpc/kvm/book3s_hv.c
@@ -2249,7 +2249,7 @@ static int kvmppc_get_one_reg_hv(struct kvm_vcpu *vcpu, u64 id,
 		*val = get_reg_val(id, kvmppc_get_siar_hv(vcpu));
 		break;
 	case KVM_REG_PPC_SDAR:
-		*val = get_reg_val(id, kvmppc_get_siar_hv(vcpu));
+		*val = get_reg_val(id, kvmppc_get_sdar_hv(vcpu));
 		break;
 	case KVM_REG_PPC_SIER:
 		*val = get_reg_val(id, kvmppc_get_sier_hv(vcpu, 0));
@@ -2484,7 +2484,7 @@ static int kvmppc_set_one_reg_hv(struct kvm_vcpu *vcpu, u64 id,
 		vcpu->arch.mmcrs = set_reg_val(id, *val);
 		break;
 	case KVM_REG_PPC_MMCR3:
-		*val = get_reg_val(id, vcpu->arch.mmcr[3]);
+		kvmppc_set_mmcr_hv(vcpu, 3, set_reg_val(id, *val));
 		break;
 	case KVM_REG_PPC_PMC1 ... KVM_REG_PPC_PMC8:
 		i = id - KVM_REG_PPC_PMC1;
diff --git a/arch/powerpc/kvm/powerpc.c b/arch/powerpc/kvm/powerpc.c
index 7197c8256668..6cef200c2404 100644
--- a/arch/powerpc/kvm/powerpc.c
+++ b/arch/powerpc/kvm/powerpc.c
@@ -1990,8 +1990,10 @@ static int kvm_vcpu_ioctl_enable_cap(struct kvm_vcpu *vcpu,
 			break;
 
 		r = -ENXIO;
-		if (!xive_enabled())
+		if (!xive_enabled()) {
+			fdput(f);
 			break;
+		}
 
 		r = -EPERM;
 		dev = kvm_device_from_filp(f.file);
diff --git a/arch/powerpc/mm/nohash/8xx.c b/arch/powerpc/mm/nohash/8xx.c
index a642a7929892..324501630278 100644
--- a/arch/powerpc/mm/nohash/8xx.c
+++ b/arch/powerpc/mm/nohash/8xx.c
@@ -92,7 +92,8 @@ static int __ref __early_map_kernel_hugepage(unsigned long va, phys_addr_t pa,
 		return -EINVAL;
 
 	set_huge_pte_at(&init_mm, va, ptep,
-			pte_mkhuge(pfn_pte(pa >> PAGE_SHIFT, prot)), psize);
+			pte_mkhuge(pfn_pte(pa >> PAGE_SHIFT, prot)),
+			1UL << mmu_psize_to_shift(psize));
 
 	return 0;
 }
diff --git a/arch/powerpc/xmon/ppc-dis.c b/arch/powerpc/xmon/ppc-dis.c
index 75fa98221d48..af105e1bc3fc 100644
--- a/arch/powerpc/xmon/ppc-dis.c
+++ b/arch/powerpc/xmon/ppc-dis.c
@@ -122,32 +122,21 @@ int print_insn_powerpc (unsigned long insn, unsigned long memaddr)
   bool insn_is_short;
   ppc_cpu_t dialect;
 
-  dialect = PPC_OPCODE_PPC | PPC_OPCODE_COMMON
-            | PPC_OPCODE_64 | PPC_OPCODE_POWER4 | PPC_OPCODE_ALTIVEC;
+  dialect = PPC_OPCODE_PPC | PPC_OPCODE_COMMON;
 
-  if (cpu_has_feature(CPU_FTRS_POWER5))
-    dialect |= PPC_OPCODE_POWER5;
+  if (IS_ENABLED(CONFIG_PPC64))
+    dialect |= PPC_OPCODE_64 | PPC_OPCODE_POWER4 | PPC_OPCODE_CELL |
+	PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7 | PPC_OPCODE_POWER8 |
+	PPC_OPCODE_POWER9;
 
-  if (cpu_has_feature(CPU_FTRS_CELL))
-    dialect |= (PPC_OPCODE_CELL | PPC_OPCODE_ALTIVEC);
+  if (cpu_has_feature(CPU_FTR_TM))
+    dialect |= PPC_OPCODE_HTM;
 
-  if (cpu_has_feature(CPU_FTRS_POWER6))
-    dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_ALTIVEC);
+  if (cpu_has_feature(CPU_FTR_ALTIVEC))
+    dialect |= PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2;
 
-  if (cpu_has_feature(CPU_FTRS_POWER7))
-    dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7
-                | PPC_OPCODE_ALTIVEC | PPC_OPCODE_VSX);
-
-  if (cpu_has_feature(CPU_FTRS_POWER8))
-    dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7
-		| PPC_OPCODE_POWER8 | PPC_OPCODE_HTM
-		| PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2 | PPC_OPCODE_VSX);
-
-  if (cpu_has_feature(CPU_FTRS_POWER9))
-    dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7
-		| PPC_OPCODE_POWER8 | PPC_OPCODE_POWER9 | PPC_OPCODE_HTM
-		| PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2
-		| PPC_OPCODE_VSX | PPC_OPCODE_VSX3);
+  if (cpu_has_feature(CPU_FTR_VSX))
+    dialect |= PPC_OPCODE_VSX | PPC_OPCODE_VSX3;
 
   /* Get the major opcode of the insn.  */
   opcode = NULL;
diff --git a/arch/s390/kernel/perf_cpum_cf.c b/arch/s390/kernel/perf_cpum_cf.c
index 850c11ea631a..5466e7bada03 100644
--- a/arch/s390/kernel/perf_cpum_cf.c
+++ b/arch/s390/kernel/perf_cpum_cf.c
@@ -556,25 +556,31 @@ static int cfdiag_diffctr(struct cpu_cf_events *cpuhw, unsigned long auth)
 	struct cf_trailer_entry *trailer_start, *trailer_stop;
 	struct cf_ctrset_entry *ctrstart, *ctrstop;
 	size_t offset = 0;
+	int i;
 
-	auth &= (1 << CPUMF_LCCTL_ENABLE_SHIFT) - 1;
-	do {
+	for (i = CPUMF_CTR_SET_BASIC; i < CPUMF_CTR_SET_MAX; ++i) {
 		ctrstart = (struct cf_ctrset_entry *)(cpuhw->start + offset);
 		ctrstop = (struct cf_ctrset_entry *)(cpuhw->stop + offset);
 
+		/* Counter set not authorized */
+		if (!(auth & cpumf_ctr_ctl[i]))
+			continue;
+		/* Counter set size zero was not saved */
+		if (!cpum_cf_read_setsize(i))
+			continue;
+
 		if (memcmp(ctrstop, ctrstart, sizeof(*ctrstop))) {
 			pr_err_once("cpum_cf_diag counter set compare error "
 				    "in set %i\n", ctrstart->set);
 			return 0;
 		}
-		auth &= ~cpumf_ctr_ctl[ctrstart->set];
 		if (ctrstart->def == CF_DIAG_CTRSET_DEF) {
 			cfdiag_diffctrset((u64 *)(ctrstart + 1),
 					  (u64 *)(ctrstop + 1), ctrstart->ctr);
 			offset += ctrstart->ctr * sizeof(u64) +
 							sizeof(*ctrstart);
 		}
-	} while (ctrstart->def && auth);
+	}
 
 	/* Save time_stamp from start of event in stop's trailer */
 	trailer_start = (struct cf_trailer_entry *)(cpuhw->start + offset);
diff --git a/arch/s390/kernel/uv.c b/arch/s390/kernel/uv.c
index fc07bc39e698..81fdee22a497 100644
--- a/arch/s390/kernel/uv.c
+++ b/arch/s390/kernel/uv.c
@@ -181,36 +181,36 @@ int uv_convert_owned_from_secure(unsigned long paddr)
 }
 
 /*
- * Calculate the expected ref_count for a page that would otherwise have no
+ * Calculate the expected ref_count for a folio that would otherwise have no
  * further pins. This was cribbed from similar functions in other places in
  * the kernel, but with some slight modifications. We know that a secure
- * page can not be a huge page for example.
+ * folio can not be a large folio, for example.
  */
-static int expected_page_refs(struct page *page)
+static int expected_folio_refs(struct folio *folio)
 {
 	int res;
 
-	res = page_mapcount(page);
-	if (PageSwapCache(page)) {
+	res = folio_mapcount(folio);
+	if (folio_test_swapcache(folio)) {
 		res++;
-	} else if (page_mapping(page)) {
+	} else if (folio_mapping(folio)) {
 		res++;
-		if (page_has_private(page))
+		if (folio->private)
 			res++;
 	}
 	return res;
 }
 
-static int make_page_secure(struct page *page, struct uv_cb_header *uvcb)
+static int make_folio_secure(struct folio *folio, struct uv_cb_header *uvcb)
 {
 	int expected, cc = 0;
 
-	if (PageWriteback(page))
+	if (folio_test_writeback(folio))
 		return -EAGAIN;
-	expected = expected_page_refs(page);
-	if (!page_ref_freeze(page, expected))
+	expected = expected_folio_refs(folio);
+	if (!folio_ref_freeze(folio, expected))
 		return -EBUSY;
-	set_bit(PG_arch_1, &page->flags);
+	set_bit(PG_arch_1, &folio->flags);
 	/*
 	 * If the UVC does not succeed or fail immediately, we don't want to
 	 * loop for long, or we might get stall notifications.
@@ -220,9 +220,9 @@ static int make_page_secure(struct page *page, struct uv_cb_header *uvcb)
 	 * -EAGAIN and we let the callers deal with it.
 	 */
 	cc = __uv_call(0, (u64)uvcb);
-	page_ref_unfreeze(page, expected);
+	folio_ref_unfreeze(folio, expected);
 	/*
-	 * Return -ENXIO if the page was not mapped, -EINVAL for other errors.
+	 * Return -ENXIO if the folio was not mapped, -EINVAL for other errors.
 	 * If busy or partially completed, return -EAGAIN.
 	 */
 	if (cc == UVC_CC_OK)
@@ -277,7 +277,7 @@ int gmap_make_secure(struct gmap *gmap, unsigned long gaddr, void *uvcb)
 	bool local_drain = false;
 	spinlock_t *ptelock;
 	unsigned long uaddr;
-	struct page *page;
+	struct folio *folio;
 	pte_t *ptep;
 	int rc;
 
@@ -306,15 +306,26 @@ int gmap_make_secure(struct gmap *gmap, unsigned long gaddr, void *uvcb)
 	if (!ptep)
 		goto out;
 	if (pte_present(*ptep) && !(pte_val(*ptep) & _PAGE_INVALID) && pte_write(*ptep)) {
-		page = pte_page(*ptep);
+		folio = page_folio(pte_page(*ptep));
+		rc = -EINVAL;
+		if (folio_test_large(folio))
+			goto unlock;
 		rc = -EAGAIN;
-		if (trylock_page(page)) {
+		if (folio_trylock(folio)) {
 			if (should_export_before_import(uvcb, gmap->mm))
-				uv_convert_from_secure(page_to_phys(page));
-			rc = make_page_secure(page, uvcb);
-			unlock_page(page);
+				uv_convert_from_secure(PFN_PHYS(folio_pfn(folio)));
+			rc = make_folio_secure(folio, uvcb);
+			folio_unlock(folio);
 		}
+
+		/*
+		 * Once we drop the PTL, the folio may get unmapped and
+		 * freed immediately. We need a temporary reference.
+		 */
+		if (rc == -EAGAIN)
+			folio_get(folio);
 	}
+unlock:
 	pte_unmap_unlock(ptep, ptelock);
 out:
 	mmap_read_unlock(gmap->mm);
@@ -324,10 +335,11 @@ int gmap_make_secure(struct gmap *gmap, unsigned long gaddr, void *uvcb)
 		 * If we are here because the UVC returned busy or partial
 		 * completion, this is just a useless check, but it is safe.
 		 */
-		wait_on_page_writeback(page);
+		folio_wait_writeback(folio);
+		folio_put(folio);
 	} else if (rc == -EBUSY) {
 		/*
-		 * If we have tried a local drain and the page refcount
+		 * If we have tried a local drain and the folio refcount
 		 * still does not match our expected safe value, try with a
 		 * system wide drain. This is needed if the pagevecs holding
 		 * the page are on a different CPU.
@@ -338,7 +350,7 @@ int gmap_make_secure(struct gmap *gmap, unsigned long gaddr, void *uvcb)
 			return -EAGAIN;
 		}
 		/*
-		 * We are here if the page refcount does not match the
+		 * We are here if the folio refcount does not match the
 		 * expected safe value. The main culprits are usually
 		 * pagevecs. With lru_add_drain() we drain the pagevecs
 		 * on the local CPU so that hopefully the refcount will
diff --git a/arch/s390/mm/fault.c b/arch/s390/mm/fault.c
index b678295931c3..1a231181a413 100644
--- a/arch/s390/mm/fault.c
+++ b/arch/s390/mm/fault.c
@@ -331,14 +331,16 @@ static noinline void do_fault_error(struct pt_regs *regs, vm_fault_t fault)
 				do_no_context(regs, fault);
 			else
 				do_sigsegv(regs, SEGV_MAPERR);
-		} else if (fault & VM_FAULT_SIGBUS) {
+		} else if (fault & (VM_FAULT_SIGBUS | VM_FAULT_HWPOISON)) {
 			/* Kernel mode? Handle exceptions or die */
 			if (!user_mode(regs))
 				do_no_context(regs, fault);
 			else
 				do_sigbus(regs);
-		} else
+		} else {
+			pr_emerg("Unexpected fault flags: %08x\n", fault);
 			BUG();
+		}
 		break;
 	}
 }
diff --git a/arch/s390/pci/pci_irq.c b/arch/s390/pci/pci_irq.c
index 0ef83b6ac0db..84482a921332 100644
--- a/arch/s390/pci/pci_irq.c
+++ b/arch/s390/pci/pci_irq.c
@@ -268,33 +268,20 @@ static void zpci_floating_irq_handler(struct airq_struct *airq,
 	}
 }
 
-int arch_setup_msi_irqs(struct pci_dev *pdev, int nvec, int type)
+static int __alloc_airq(struct zpci_dev *zdev, int msi_vecs,
+			unsigned long *bit)
 {
-	struct zpci_dev *zdev = to_zpci(pdev);
-	unsigned int hwirq, msi_vecs, cpu;
-	unsigned long bit;
-	struct msi_desc *msi;
-	struct msi_msg msg;
-	int cpu_addr;
-	int rc, irq;
-
-	zdev->aisb = -1UL;
-	zdev->msi_first_bit = -1U;
-	if (type == PCI_CAP_ID_MSI && nvec > 1)
-		return 1;
-	msi_vecs = min_t(unsigned int, nvec, zdev->max_msi);
-
 	if (irq_delivery == DIRECTED) {
 		/* Allocate cpu vector bits */
-		bit = airq_iv_alloc(zpci_ibv[0], msi_vecs);
-		if (bit == -1UL)
+		*bit = airq_iv_alloc(zpci_ibv[0], msi_vecs);
+		if (*bit == -1UL)
 			return -EIO;
 	} else {
 		/* Allocate adapter summary indicator bit */
-		bit = airq_iv_alloc_bit(zpci_sbv);
-		if (bit == -1UL)
+		*bit = airq_iv_alloc_bit(zpci_sbv);
+		if (*bit == -1UL)
 			return -EIO;
-		zdev->aisb = bit;
+		zdev->aisb = *bit;
 
 		/* Create adapter interrupt vector */
 		zdev->aibv = airq_iv_create(msi_vecs, AIRQ_IV_DATA | AIRQ_IV_BITLOCK, NULL);
@@ -302,27 +289,66 @@ int arch_setup_msi_irqs(struct pci_dev *pdev, int nvec, int type)
 			return -ENOMEM;
 
 		/* Wire up shortcut pointer */
-		zpci_ibv[bit] = zdev->aibv;
+		zpci_ibv[*bit] = zdev->aibv;
 		/* Each function has its own interrupt vector */
-		bit = 0;
+		*bit = 0;
 	}
+	return 0;
+}
 
-	/* Request MSI interrupts */
+int arch_setup_msi_irqs(struct pci_dev *pdev, int nvec, int type)
+{
+	unsigned int hwirq, msi_vecs, irqs_per_msi, i, cpu;
+	struct zpci_dev *zdev = to_zpci(pdev);
+	struct msi_desc *msi;
+	struct msi_msg msg;
+	unsigned long bit;
+	int cpu_addr;
+	int rc, irq;
+
+	zdev->aisb = -1UL;
+	zdev->msi_first_bit = -1U;
+
+	msi_vecs = min_t(unsigned int, nvec, zdev->max_msi);
+	if (msi_vecs < nvec) {
+		pr_info("%s requested %d irqs, allocate system limit of %d",
+			pci_name(pdev), nvec, zdev->max_msi);
+	}
+
+	rc = __alloc_airq(zdev, msi_vecs, &bit);
+	if (rc < 0)
+		return rc;
+
+	/*
+	 * Request MSI interrupts:
+	 * When using MSI, nvec_used interrupt sources and their irq
+	 * descriptors are controlled through one msi descriptor.
+	 * Thus the outer loop over msi descriptors shall run only once,
+	 * while two inner loops iterate over the interrupt vectors.
+	 * When using MSI-X, each interrupt vector/irq descriptor
+	 * is bound to exactly one msi descriptor (nvec_used is one).
+	 * So the inner loops are executed once, while the outer iterates
+	 * over the MSI-X descriptors.
+	 */
 	hwirq = bit;
 	msi_for_each_desc(msi, &pdev->dev, MSI_DESC_NOTASSOCIATED) {
-		rc = -EIO;
 		if (hwirq - bit >= msi_vecs)
 			break;
-		irq = __irq_alloc_descs(-1, 0, 1, 0, THIS_MODULE,
-				(irq_delivery == DIRECTED) ?
-				msi->affinity : NULL);
+		irqs_per_msi = min_t(unsigned int, msi_vecs, msi->nvec_used);
+		irq = __irq_alloc_descs(-1, 0, irqs_per_msi, 0, THIS_MODULE,
+					(irq_delivery == DIRECTED) ?
+					msi->affinity : NULL);
 		if (irq < 0)
 			return -ENOMEM;
-		rc = irq_set_msi_desc(irq, msi);
-		if (rc)
-			return rc;
-		irq_set_chip_and_handler(irq, &zpci_irq_chip,
-					 handle_percpu_irq);
+
+		for (i = 0; i < irqs_per_msi; i++) {
+			rc = irq_set_msi_desc_off(irq, i, msi);
+			if (rc)
+				return rc;
+			irq_set_chip_and_handler(irq + i, &zpci_irq_chip,
+						 handle_percpu_irq);
+		}
+
 		msg.data = hwirq - bit;
 		if (irq_delivery == DIRECTED) {
 			if (msi->affinity)
@@ -335,31 +361,35 @@ int arch_setup_msi_irqs(struct pci_dev *pdev, int nvec, int type)
 			msg.address_lo |= (cpu_addr << 8);
 
 			for_each_possible_cpu(cpu) {
-				airq_iv_set_data(zpci_ibv[cpu], hwirq, irq);
+				for (i = 0; i < irqs_per_msi; i++)
+					airq_iv_set_data(zpci_ibv[cpu],
+							 hwirq + i, irq + i);
 			}
 		} else {
 			msg.address_lo = zdev->msi_addr & 0xffffffff;
-			airq_iv_set_data(zdev->aibv, hwirq, irq);
+			for (i = 0; i < irqs_per_msi; i++)
+				airq_iv_set_data(zdev->aibv, hwirq + i, irq + i);
 		}
 		msg.address_hi = zdev->msi_addr >> 32;
 		pci_write_msi_msg(irq, &msg);
-		hwirq++;
+		hwirq += irqs_per_msi;
 	}
 
 	zdev->msi_first_bit = bit;
-	zdev->msi_nr_irqs = msi_vecs;
+	zdev->msi_nr_irqs = hwirq - bit;
 
 	rc = zpci_set_irq(zdev);
 	if (rc)
 		return rc;
 
-	return (msi_vecs == nvec) ? 0 : msi_vecs;
+	return (zdev->msi_nr_irqs == nvec) ? 0 : zdev->msi_nr_irqs;
 }
 
 void arch_teardown_msi_irqs(struct pci_dev *pdev)
 {
 	struct zpci_dev *zdev = to_zpci(pdev);
 	struct msi_desc *msi;
+	unsigned int i;
 	int rc;
 
 	/* Disable interrupts */
@@ -369,8 +399,10 @@ void arch_teardown_msi_irqs(struct pci_dev *pdev)
 
 	/* Release MSI interrupts */
 	msi_for_each_desc(msi, &pdev->dev, MSI_DESC_ASSOCIATED) {
-		irq_set_msi_desc(msi->irq, NULL);
-		irq_free_desc(msi->irq);
+		for (i = 0; i < msi->nvec_used; i++) {
+			irq_set_msi_desc(msi->irq + i, NULL);
+			irq_free_desc(msi->irq + i);
+		}
 		msi->msg.address_lo = 0;
 		msi->msg.address_hi = 0;
 		msi->msg.data = 0;
diff --git a/arch/sparc/include/asm/oplib_64.h b/arch/sparc/include/asm/oplib_64.h
index a67abebd4359..1b86d02a8455 100644
--- a/arch/sparc/include/asm/oplib_64.h
+++ b/arch/sparc/include/asm/oplib_64.h
@@ -247,6 +247,7 @@ void prom_sun4v_guest_soft_state(void);
 int prom_ihandle2path(int handle, char *buffer, int bufsize);
 
 /* Client interface level routines. */
+void prom_cif_init(void *cif_handler);
 void p1275_cmd_direct(unsigned long *);
 
 #endif /* !(__SPARC64_OPLIB_H) */
diff --git a/arch/sparc/prom/init_64.c b/arch/sparc/prom/init_64.c
index 103aa9104318..f7b8a1a865b8 100644
--- a/arch/sparc/prom/init_64.c
+++ b/arch/sparc/prom/init_64.c
@@ -26,9 +26,6 @@ phandle prom_chosen_node;
  * routines in the prom library.
  * It gets passed the pointer to the PROM vector.
  */
-
-extern void prom_cif_init(void *);
-
 void __init prom_init(void *cif_handler)
 {
 	phandle node;
diff --git a/arch/sparc/prom/p1275.c b/arch/sparc/prom/p1275.c
index 889aa602f8d8..51c3f984bbf7 100644
--- a/arch/sparc/prom/p1275.c
+++ b/arch/sparc/prom/p1275.c
@@ -49,7 +49,7 @@ void p1275_cmd_direct(unsigned long *args)
 	local_irq_restore(flags);
 }
 
-void prom_cif_init(void *cif_handler, void *cif_stack)
+void prom_cif_init(void *cif_handler)
 {
 	p1275buf.prom_cif_handler = (void (*)(long *))cif_handler;
 }
diff --git a/arch/um/drivers/ubd_kern.c b/arch/um/drivers/ubd_kern.c
index 81405aeab8bf..ef7b4b911a45 100644
--- a/arch/um/drivers/ubd_kern.c
+++ b/arch/um/drivers/ubd_kern.c
@@ -456,43 +456,31 @@ static int bulk_req_safe_read(
 	return n;
 }
 
-/* Called without dev->lock held, and only in interrupt context. */
-static void ubd_handler(void)
+static void ubd_end_request(struct io_thread_req *io_req)
 {
-	int n;
-	int count;
-
-	while(1){
-		n = bulk_req_safe_read(
-			thread_fd,
-			irq_req_buffer,
-			&irq_remainder,
-			&irq_remainder_size,
-			UBD_REQ_BUFFER_SIZE
-		);
-		if (n < 0) {
-			if(n == -EAGAIN)
-				break;
-			printk(KERN_ERR "spurious interrupt in ubd_handler, "
-			       "err = %d\n", -n);
-			return;
-		}
-		for (count = 0; count < n/sizeof(struct io_thread_req *); count++) {
-			struct io_thread_req *io_req = (*irq_req_buffer)[count];
-
-			if ((io_req->error == BLK_STS_NOTSUPP) && (req_op(io_req->req) == REQ_OP_DISCARD)) {
-				blk_queue_max_discard_sectors(io_req->req->q, 0);
-				blk_queue_max_write_zeroes_sectors(io_req->req->q, 0);
-			}
-			blk_mq_end_request(io_req->req, io_req->error);
-			kfree(io_req);
-		}
+	if (io_req->error == BLK_STS_NOTSUPP) {
+		if (req_op(io_req->req) == REQ_OP_DISCARD)
+			blk_queue_max_discard_sectors(io_req->req->q, 0);
+		else if (req_op(io_req->req) == REQ_OP_WRITE_ZEROES)
+			blk_queue_max_write_zeroes_sectors(io_req->req->q, 0);
 	}
+	blk_mq_end_request(io_req->req, io_req->error);
+	kfree(io_req);
 }
 
 static irqreturn_t ubd_intr(int irq, void *dev)
 {
-	ubd_handler();
+	int len, i;
+
+	while ((len = bulk_req_safe_read(thread_fd, irq_req_buffer,
+			&irq_remainder, &irq_remainder_size,
+			UBD_REQ_BUFFER_SIZE)) >= 0) {
+		for (i = 0; i < len / sizeof(struct io_thread_req *); i++)
+			ubd_end_request((*irq_req_buffer)[i]);
+	}
+
+	if (len < 0 && len != -EAGAIN)
+		pr_err("spurious interrupt in %s, err = %d\n", __func__, len);
 	return IRQ_HANDLED;
 }
 
diff --git a/arch/um/kernel/time.c b/arch/um/kernel/time.c
index 3e270da6b6f6..c8c4ef94c753 100644
--- a/arch/um/kernel/time.c
+++ b/arch/um/kernel/time.c
@@ -874,9 +874,9 @@ int setup_time_travel_start(char *str)
 	return 1;
 }
 
-__setup("time-travel-start", setup_time_travel_start);
+__setup("time-travel-start=", setup_time_travel_start);
 __uml_help(setup_time_travel_start,
-"time-travel-start=<seconds>\n"
+"time-travel-start=<nanoseconds>\n"
 "Configure the UML instance's wall clock to start at this value rather than\n"
 "the host's wall clock at the time of UML boot.\n");
 #endif
diff --git a/arch/um/os-Linux/signal.c b/arch/um/os-Linux/signal.c
index 24a403a70a02..850d21e6473e 100644
--- a/arch/um/os-Linux/signal.c
+++ b/arch/um/os-Linux/signal.c
@@ -8,6 +8,7 @@
 
 #include <stdlib.h>
 #include <stdarg.h>
+#include <stdbool.h>
 #include <errno.h>
 #include <signal.h>
 #include <string.h>
@@ -65,9 +66,7 @@ static void sig_handler_common(int sig, struct siginfo *si, mcontext_t *mc)
 
 int signals_enabled;
 #ifdef UML_CONFIG_UML_TIME_TRAVEL_SUPPORT
-static int signals_blocked;
-#else
-#define signals_blocked 0
+static int signals_blocked, signals_blocked_pending;
 #endif
 static unsigned int signals_pending;
 static unsigned int signals_active = 0;
@@ -76,14 +75,27 @@ void sig_handler(int sig, struct siginfo *si, mcontext_t *mc)
 {
 	int enabled = signals_enabled;
 
-	if ((signals_blocked || !enabled) && (sig == SIGIO)) {
+#ifdef UML_CONFIG_UML_TIME_TRAVEL_SUPPORT
+	if ((signals_blocked ||
+	     __atomic_load_n(&signals_blocked_pending, __ATOMIC_SEQ_CST)) &&
+	    (sig == SIGIO)) {
+		/* increment so unblock will do another round */
+		__atomic_add_fetch(&signals_blocked_pending, 1,
+				   __ATOMIC_SEQ_CST);
+		return;
+	}
+#endif
+
+	if (!enabled && (sig == SIGIO)) {
 		/*
 		 * In TT_MODE_EXTERNAL, need to still call time-travel
-		 * handlers unless signals are also blocked for the
-		 * external time message processing. This will mark
-		 * signals_pending by itself (only if necessary.)
+		 * handlers. This will mark signals_pending by itself
+		 * (only if necessary.)
+		 * Note we won't get here if signals are hard-blocked
+		 * (which is handled above), in that case the hard-
+		 * unblock will handle things.
 		 */
-		if (!signals_blocked && time_travel_mode == TT_MODE_EXTERNAL)
+		if (time_travel_mode == TT_MODE_EXTERNAL)
 			sigio_run_timetravel_handlers();
 		else
 			signals_pending |= SIGIO_MASK;
@@ -380,33 +392,99 @@ int um_set_signals_trace(int enable)
 #ifdef UML_CONFIG_UML_TIME_TRAVEL_SUPPORT
 void mark_sigio_pending(void)
 {
+	/*
+	 * It would seem that this should be atomic so
+	 * it isn't a read-modify-write with a signal
+	 * that could happen in the middle, losing the
+	 * value set by the signal.
+	 *
+	 * However, this function is only called when in
+	 * time-travel=ext simulation mode, in which case
+	 * the only signal ever pending is SIGIO, which
+	 * is blocked while this can be called, and the
+	 * timer signal (SIGALRM) cannot happen.
+	 */
 	signals_pending |= SIGIO_MASK;
 }
 
 void block_signals_hard(void)
 {
-	if (signals_blocked)
-		return;
-	signals_blocked = 1;
+	signals_blocked++;
 	barrier();
 }
 
 void unblock_signals_hard(void)
 {
+	static bool unblocking;
+
 	if (!signals_blocked)
+		panic("unblocking signals while not blocked");
+
+	if (--signals_blocked)
 		return;
-	/* Must be set to 0 before we check the pending bits etc. */
-	signals_blocked = 0;
+	/*
+	 * Must be set to 0 before we check pending so the
+	 * SIGIO handler will run as normal unless we're still
+	 * going to process signals_blocked_pending.
+	 */
 	barrier();
 
-	if (signals_pending && signals_enabled) {
-		/* this is a bit inefficient, but that's not really important */
-		block_signals();
-		unblock_signals();
-	} else if (signals_pending & SIGIO_MASK) {
-		/* we need to run time-travel handlers even if not enabled */
-		sigio_run_timetravel_handlers();
+	/*
+	 * Note that block_signals_hard()/unblock_signals_hard() can be called
+	 * within the unblock_signals()/sigio_run_timetravel_handlers() below.
+	 * This would still be prone to race conditions since it's actually a
+	 * call _within_ e.g. vu_req_read_message(), where we observed this
+	 * issue, which loops. Thus, if the inner call handles the recorded
+	 * pending signals, we can get out of the inner call with the real
+	 * signal hander no longer blocked, and still have a race. Thus don't
+	 * handle unblocking in the inner call, if it happens, but only in
+	 * the outermost call - 'unblocking' serves as an ownership for the
+	 * signals_blocked_pending decrement.
+	 */
+	if (unblocking)
+		return;
+	unblocking = true;
+
+	while (__atomic_load_n(&signals_blocked_pending, __ATOMIC_SEQ_CST)) {
+		if (signals_enabled) {
+			/* signals are enabled so we can touch this */
+			signals_pending |= SIGIO_MASK;
+			/*
+			 * this is a bit inefficient, but that's
+			 * not really important
+			 */
+			block_signals();
+			unblock_signals();
+		} else {
+			/*
+			 * we need to run time-travel handlers even
+			 * if not enabled
+			 */
+			sigio_run_timetravel_handlers();
+		}
+
+		/*
+		 * The decrement of signals_blocked_pending must be atomic so
+		 * that the signal handler will either happen before or after
+		 * the decrement, not during a read-modify-write:
+		 *  - If it happens before, it can increment it and we'll
+		 *    decrement it and do another round in the loop.
+		 *  - If it happens after it'll see 0 for both signals_blocked
+		 *    and signals_blocked_pending and thus run the handler as
+		 *    usual (subject to signals_enabled, but that's unrelated.)
+		 *
+		 * Note that a call to unblock_signals_hard() within the calls
+		 * to unblock_signals() or sigio_run_timetravel_handlers() above
+		 * will do nothing due to the 'unblocking' state, so this cannot
+		 * underflow as the only one decrementing will be the outermost
+		 * one.
+		 */
+		if (__atomic_sub_fetch(&signals_blocked_pending, 1,
+				       __ATOMIC_SEQ_CST) < 0)
+			panic("signals_blocked_pending underflow");
 	}
+
+	unblocking = false;
 }
 #endif
 
diff --git a/arch/x86/Kconfig.assembler b/arch/x86/Kconfig.assembler
index 8ad41da301e5..16d0b022d6ff 100644
--- a/arch/x86/Kconfig.assembler
+++ b/arch/x86/Kconfig.assembler
@@ -26,6 +26,6 @@ config AS_GFNI
 	  Supported by binutils >= 2.30 and LLVM integrated assembler
 
 config AS_WRUSS
-	def_bool $(as-instr,wrussq %rax$(comma)(%rbx))
+	def_bool $(as-instr64,wrussq %rax$(comma)(%rbx))
 	help
 	  Supported by binutils >= 2.31 and LLVM integrated assembler
diff --git a/arch/x86/events/core.c b/arch/x86/events/core.c
index c688cb22dcd6..8811fedc9776 100644
--- a/arch/x86/events/core.c
+++ b/arch/x86/events/core.c
@@ -2547,6 +2547,7 @@ static ssize_t set_attr_rdpmc(struct device *cdev,
 			      struct device_attribute *attr,
 			      const char *buf, size_t count)
 {
+	static DEFINE_MUTEX(rdpmc_mutex);
 	unsigned long val;
 	ssize_t ret;
 
@@ -2560,6 +2561,8 @@ static ssize_t set_attr_rdpmc(struct device *cdev,
 	if (x86_pmu.attr_rdpmc_broken)
 		return -ENOTSUPP;
 
+	guard(mutex)(&rdpmc_mutex);
+
 	if (val != x86_pmu.attr_rdpmc) {
 		/*
 		 * Changing into or out of never available or always available,
diff --git a/arch/x86/events/intel/cstate.c b/arch/x86/events/intel/cstate.c
index 96fffb2d521d..cc6609cbfc8d 100644
--- a/arch/x86/events/intel/cstate.c
+++ b/arch/x86/events/intel/cstate.c
@@ -80,7 +80,7 @@
  *	MSR_PKG_C7_RESIDENCY:  Package C7 Residency Counter.
  *			       perf code: 0x03
  *			       Available model: NHM,WSM,SNB,IVB,HSW,BDW,SKL,CNL,
- *						KBL,CML,ICL,TGL,RKL,ADL,RPL,MTL
+ *						KBL,CML,ICL,TGL,RKL
  *			       Scope: Package (physical package)
  *	MSR_PKG_C8_RESIDENCY:  Package C8 Residency Counter.
  *			       perf code: 0x04
@@ -89,8 +89,7 @@
  *			       Scope: Package (physical package)
  *	MSR_PKG_C9_RESIDENCY:  Package C9 Residency Counter.
  *			       perf code: 0x05
- *			       Available model: HSW ULT,KBL,CNL,CML,ICL,TGL,RKL,
- *						ADL,RPL,MTL
+ *			       Available model: HSW ULT,KBL,CNL,CML,ICL,TGL,RKL
  *			       Scope: Package (physical package)
  *	MSR_PKG_C10_RESIDENCY: Package C10 Residency Counter.
  *			       perf code: 0x06
@@ -582,9 +581,7 @@ static const struct cstate_model adl_cstates __initconst = {
 	.pkg_events		= BIT(PERF_CSTATE_PKG_C2_RES) |
 				  BIT(PERF_CSTATE_PKG_C3_RES) |
 				  BIT(PERF_CSTATE_PKG_C6_RES) |
-				  BIT(PERF_CSTATE_PKG_C7_RES) |
 				  BIT(PERF_CSTATE_PKG_C8_RES) |
-				  BIT(PERF_CSTATE_PKG_C9_RES) |
 				  BIT(PERF_CSTATE_PKG_C10_RES),
 };
 
diff --git a/arch/x86/events/intel/ds.c b/arch/x86/events/intel/ds.c
index 2b53f696c3c9..b592bed9ebcc 100644
--- a/arch/x86/events/intel/ds.c
+++ b/arch/x86/events/intel/ds.c
@@ -1830,8 +1830,12 @@ static void setup_pebs_adaptive_sample_data(struct perf_event *event,
 	set_linear_ip(regs, basic->ip);
 	regs->flags = PERF_EFLAGS_EXACT;
 
-	if ((sample_type & PERF_SAMPLE_WEIGHT_STRUCT) && (x86_pmu.flags & PMU_FL_RETIRE_LATENCY))
-		data->weight.var3_w = format_size >> PEBS_RETIRE_LATENCY_OFFSET & PEBS_LATENCY_MASK;
+	if (sample_type & PERF_SAMPLE_WEIGHT_STRUCT) {
+		if (x86_pmu.flags & PMU_FL_RETIRE_LATENCY)
+			data->weight.var3_w = format_size >> PEBS_RETIRE_LATENCY_OFFSET & PEBS_LATENCY_MASK;
+		else
+			data->weight.var3_w = 0;
+	}
 
 	/*
 	 * The record for MEMINFO is in front of GP
diff --git a/arch/x86/events/intel/pt.c b/arch/x86/events/intel/pt.c
index 42a55794004a..cc5c6a326496 100644
--- a/arch/x86/events/intel/pt.c
+++ b/arch/x86/events/intel/pt.c
@@ -877,7 +877,7 @@ static void pt_update_head(struct pt *pt)
  */
 static void *pt_buffer_region(struct pt_buffer *buf)
 {
-	return phys_to_virt(TOPA_ENTRY(buf->cur, buf->cur_idx)->base << TOPA_SHIFT);
+	return phys_to_virt((phys_addr_t)TOPA_ENTRY(buf->cur, buf->cur_idx)->base << TOPA_SHIFT);
 }
 
 /**
@@ -989,7 +989,7 @@ pt_topa_entry_for_page(struct pt_buffer *buf, unsigned int pg)
 	 * order allocations, there shouldn't be many of these.
 	 */
 	list_for_each_entry(topa, &buf->tables, list) {
-		if (topa->offset + topa->size > pg << PAGE_SHIFT)
+		if (topa->offset + topa->size > (unsigned long)pg << PAGE_SHIFT)
 			goto found;
 	}
 
diff --git a/arch/x86/events/intel/pt.h b/arch/x86/events/intel/pt.h
index 96906a62aacd..f5e46c04c145 100644
--- a/arch/x86/events/intel/pt.h
+++ b/arch/x86/events/intel/pt.h
@@ -33,8 +33,8 @@ struct topa_entry {
 	u64	rsvd2	: 1;
 	u64	size	: 4;
 	u64	rsvd3	: 2;
-	u64	base	: 36;
-	u64	rsvd4	: 16;
+	u64	base	: 40;
+	u64	rsvd4	: 12;
 };
 
 /* TSC to Core Crystal Clock Ratio */
diff --git a/arch/x86/events/intel/uncore_snbep.c b/arch/x86/events/intel/uncore_snbep.c
index 49bc27ab26ad..a8f11e60b987 100644
--- a/arch/x86/events/intel/uncore_snbep.c
+++ b/arch/x86/events/intel/uncore_snbep.c
@@ -461,6 +461,7 @@
 #define SPR_UBOX_DID				0x3250
 
 /* SPR CHA */
+#define SPR_CHA_EVENT_MASK_EXT			0xffffffff
 #define SPR_CHA_PMON_CTL_TID_EN			(1 << 16)
 #define SPR_CHA_PMON_EVENT_MASK			(SNBEP_PMON_RAW_EVENT_MASK | \
 						 SPR_CHA_PMON_CTL_TID_EN)
@@ -477,6 +478,7 @@ DEFINE_UNCORE_FORMAT_ATTR(umask_ext, umask, "config:8-15,32-43,45-55");
 DEFINE_UNCORE_FORMAT_ATTR(umask_ext2, umask, "config:8-15,32-57");
 DEFINE_UNCORE_FORMAT_ATTR(umask_ext3, umask, "config:8-15,32-39");
 DEFINE_UNCORE_FORMAT_ATTR(umask_ext4, umask, "config:8-15,32-55");
+DEFINE_UNCORE_FORMAT_ATTR(umask_ext5, umask, "config:8-15,32-63");
 DEFINE_UNCORE_FORMAT_ATTR(qor, qor, "config:16");
 DEFINE_UNCORE_FORMAT_ATTR(edge, edge, "config:18");
 DEFINE_UNCORE_FORMAT_ATTR(tid_en, tid_en, "config:19");
@@ -5954,7 +5956,7 @@ static struct intel_uncore_ops spr_uncore_chabox_ops = {
 
 static struct attribute *spr_uncore_cha_formats_attr[] = {
 	&format_attr_event.attr,
-	&format_attr_umask_ext4.attr,
+	&format_attr_umask_ext5.attr,
 	&format_attr_tid_en2.attr,
 	&format_attr_edge.attr,
 	&format_attr_inv.attr,
@@ -5990,7 +5992,7 @@ ATTRIBUTE_GROUPS(uncore_alias);
 static struct intel_uncore_type spr_uncore_chabox = {
 	.name			= "cha",
 	.event_mask		= SPR_CHA_PMON_EVENT_MASK,
-	.event_mask_ext		= SPR_RAW_EVENT_MASK_EXT,
+	.event_mask_ext		= SPR_CHA_EVENT_MASK_EXT,
 	.num_shared_regs	= 1,
 	.constraints		= skx_uncore_chabox_constraints,
 	.ops			= &spr_uncore_chabox_ops,
diff --git a/arch/x86/include/asm/kvm_host.h b/arch/x86/include/asm/kvm_host.h
index ccba66da7a5d..257bf2e71d06 100644
--- a/arch/x86/include/asm/kvm_host.h
+++ b/arch/x86/include/asm/kvm_host.h
@@ -1758,7 +1758,7 @@ struct kvm_x86_nested_ops {
 	bool (*is_exception_vmexit)(struct kvm_vcpu *vcpu, u8 vector,
 				    u32 error_code);
 	int (*check_events)(struct kvm_vcpu *vcpu);
-	bool (*has_events)(struct kvm_vcpu *vcpu);
+	bool (*has_events)(struct kvm_vcpu *vcpu, bool for_injection);
 	void (*triple_fault)(struct kvm_vcpu *vcpu);
 	int (*get_state)(struct kvm_vcpu *vcpu,
 			 struct kvm_nested_state __user *user_kvm_nested_state,
diff --git a/arch/x86/include/asm/shstk.h b/arch/x86/include/asm/shstk.h
index 42fee8959df7..896909f306e3 100644
--- a/arch/x86/include/asm/shstk.h
+++ b/arch/x86/include/asm/shstk.h
@@ -21,6 +21,7 @@ unsigned long shstk_alloc_thread_stack(struct task_struct *p, unsigned long clon
 void shstk_free(struct task_struct *p);
 int setup_signal_shadow_stack(struct ksignal *ksig);
 int restore_signal_shadow_stack(void);
+int shstk_update_last_frame(unsigned long val);
 #else
 static inline long shstk_prctl(struct task_struct *task, int option,
 			       unsigned long arg2) { return -EINVAL; }
@@ -31,6 +32,7 @@ static inline unsigned long shstk_alloc_thread_stack(struct task_struct *p,
 static inline void shstk_free(struct task_struct *p) {}
 static inline int setup_signal_shadow_stack(struct ksignal *ksig) { return 0; }
 static inline int restore_signal_shadow_stack(void) { return 0; }
+static inline int shstk_update_last_frame(unsigned long val) { return 0; }
 #endif /* CONFIG_X86_USER_SHADOW_STACK */
 
 #endif /* __ASSEMBLY__ */
diff --git a/arch/x86/kernel/devicetree.c b/arch/x86/kernel/devicetree.c
index 87d38f17ff5c..c13c9cb40b9b 100644
--- a/arch/x86/kernel/devicetree.c
+++ b/arch/x86/kernel/devicetree.c
@@ -82,7 +82,7 @@ static int x86_of_pci_irq_enable(struct pci_dev *dev)
 
 	ret = pci_read_config_byte(dev, PCI_INTERRUPT_PIN, &pin);
 	if (ret)
-		return ret;
+		return pcibios_err_to_errno(ret);
 	if (!pin)
 		return 0;
 
diff --git a/arch/x86/kernel/shstk.c b/arch/x86/kernel/shstk.c
index 59e15dd8d0f8..19e4db582fb6 100644
--- a/arch/x86/kernel/shstk.c
+++ b/arch/x86/kernel/shstk.c
@@ -577,3 +577,14 @@ long shstk_prctl(struct task_struct *task, int option, unsigned long arg2)
 		return wrss_control(true);
 	return -EINVAL;
 }
+
+int shstk_update_last_frame(unsigned long val)
+{
+	unsigned long ssp;
+
+	if (!features_enabled(ARCH_SHSTK_SHSTK))
+		return 0;
+
+	ssp = get_user_shstk_addr();
+	return write_user_shstk_64((u64 __user *)ssp, (u64)val);
+}
diff --git a/arch/x86/kernel/uprobes.c b/arch/x86/kernel/uprobes.c
index 6c07f6daaa22..6402fb3089d2 100644
--- a/arch/x86/kernel/uprobes.c
+++ b/arch/x86/kernel/uprobes.c
@@ -1076,8 +1076,13 @@ arch_uretprobe_hijack_return_addr(unsigned long trampoline_vaddr, struct pt_regs
 		return orig_ret_vaddr;
 
 	nleft = copy_to_user((void __user *)regs->sp, &trampoline_vaddr, rasize);
-	if (likely(!nleft))
+	if (likely(!nleft)) {
+		if (shstk_update_last_frame(trampoline_vaddr)) {
+			force_sig(SIGSEGV);
+			return -1;
+		}
 		return orig_ret_vaddr;
+	}
 
 	if (nleft != rasize) {
 		pr_err("return address clobbered: pid=%d, %%sp=%#lx, %%ip=%#lx\n",
diff --git a/arch/x86/kvm/vmx/nested.c b/arch/x86/kvm/vmx/nested.c
index c5ec0ef51ff7..d1b4a85def0a 100644
--- a/arch/x86/kvm/vmx/nested.c
+++ b/arch/x86/kvm/vmx/nested.c
@@ -3962,7 +3962,7 @@ static bool nested_vmx_preemption_timer_pending(struct kvm_vcpu *vcpu)
 	       to_vmx(vcpu)->nested.preemption_timer_expired;
 }
 
-static bool vmx_has_nested_events(struct kvm_vcpu *vcpu)
+static bool vmx_has_nested_events(struct kvm_vcpu *vcpu, bool for_injection)
 {
 	return nested_vmx_preemption_timer_pending(vcpu) ||
 	       to_vmx(vcpu)->nested.mtf_pending;
diff --git a/arch/x86/kvm/vmx/vmx.c b/arch/x86/kvm/vmx/vmx.c
index dae499e2da84..f5f652a546bf 100644
--- a/arch/x86/kvm/vmx/vmx.c
+++ b/arch/x86/kvm/vmx/vmx.c
@@ -5048,14 +5048,19 @@ static int vmx_nmi_allowed(struct kvm_vcpu *vcpu, bool for_injection)
 	return !vmx_nmi_blocked(vcpu);
 }
 
+bool __vmx_interrupt_blocked(struct kvm_vcpu *vcpu)
+{
+	return !(vmx_get_rflags(vcpu) & X86_EFLAGS_IF) ||
+	       (vmcs_read32(GUEST_INTERRUPTIBILITY_INFO) &
+		(GUEST_INTR_STATE_STI | GUEST_INTR_STATE_MOV_SS));
+}
+
 bool vmx_interrupt_blocked(struct kvm_vcpu *vcpu)
 {
 	if (is_guest_mode(vcpu) && nested_exit_on_intr(vcpu))
 		return false;
 
-	return !(vmx_get_rflags(vcpu) & X86_EFLAGS_IF) ||
-	       (vmcs_read32(GUEST_INTERRUPTIBILITY_INFO) &
-		(GUEST_INTR_STATE_STI | GUEST_INTR_STATE_MOV_SS));
+	return __vmx_interrupt_blocked(vcpu);
 }
 
 static int vmx_interrupt_allowed(struct kvm_vcpu *vcpu, bool for_injection)
diff --git a/arch/x86/kvm/vmx/vmx.h b/arch/x86/kvm/vmx/vmx.h
index c2130d2c8e24..912b0c469742 100644
--- a/arch/x86/kvm/vmx/vmx.h
+++ b/arch/x86/kvm/vmx/vmx.h
@@ -400,6 +400,7 @@ u64 construct_eptp(struct kvm_vcpu *vcpu, hpa_t root_hpa, int root_level);
 bool vmx_guest_inject_ac(struct kvm_vcpu *vcpu);
 void vmx_update_exception_bitmap(struct kvm_vcpu *vcpu);
 bool vmx_nmi_blocked(struct kvm_vcpu *vcpu);
+bool __vmx_interrupt_blocked(struct kvm_vcpu *vcpu);
 bool vmx_interrupt_blocked(struct kvm_vcpu *vcpu);
 bool vmx_get_nmi_mask(struct kvm_vcpu *vcpu);
 void vmx_set_nmi_mask(struct kvm_vcpu *vcpu, bool masked);
diff --git a/arch/x86/kvm/x86.c b/arch/x86/kvm/x86.c
index 9dd4624bdef2..c7e7ab1593d5 100644
--- a/arch/x86/kvm/x86.c
+++ b/arch/x86/kvm/x86.c
@@ -10254,7 +10254,7 @@ static int kvm_check_and_inject_events(struct kvm_vcpu *vcpu,
 
 	if (is_guest_mode(vcpu) &&
 	    kvm_x86_ops.nested_ops->has_events &&
-	    kvm_x86_ops.nested_ops->has_events(vcpu))
+	    kvm_x86_ops.nested_ops->has_events(vcpu, true))
 		*req_immediate_exit = true;
 
 	/*
@@ -12882,7 +12882,7 @@ static inline bool kvm_vcpu_has_events(struct kvm_vcpu *vcpu)
 
 	if (is_guest_mode(vcpu) &&
 	    kvm_x86_ops.nested_ops->has_events &&
-	    kvm_x86_ops.nested_ops->has_events(vcpu))
+	    kvm_x86_ops.nested_ops->has_events(vcpu, false))
 		return true;
 
 	if (kvm_xen_has_pending_events(vcpu))
diff --git a/arch/x86/pci/intel_mid_pci.c b/arch/x86/pci/intel_mid_pci.c
index 8edd62206604..722a33be08a1 100644
--- a/arch/x86/pci/intel_mid_pci.c
+++ b/arch/x86/pci/intel_mid_pci.c
@@ -233,9 +233,9 @@ static int intel_mid_pci_irq_enable(struct pci_dev *dev)
 		return 0;
 
 	ret = pci_read_config_byte(dev, PCI_INTERRUPT_LINE, &gsi);
-	if (ret < 0) {
+	if (ret) {
 		dev_warn(&dev->dev, "Failed to read interrupt line: %d\n", ret);
-		return ret;
+		return pcibios_err_to_errno(ret);
 	}
 
 	id = x86_match_cpu(intel_mid_cpu_ids);
diff --git a/arch/x86/pci/xen.c b/arch/x86/pci/xen.c
index 652cd53e77f6..0f2fe524f60d 100644
--- a/arch/x86/pci/xen.c
+++ b/arch/x86/pci/xen.c
@@ -38,10 +38,10 @@ static int xen_pcifront_enable_irq(struct pci_dev *dev)
 	u8 gsi;
 
 	rc = pci_read_config_byte(dev, PCI_INTERRUPT_LINE, &gsi);
-	if (rc < 0) {
+	if (rc) {
 		dev_warn(&dev->dev, "Xen PCI: failed to read interrupt line: %d\n",
 			 rc);
-		return rc;
+		return pcibios_err_to_errno(rc);
 	}
 	/* In PV DomU the Xen PCI backend puts the PIRQ in the interrupt line.*/
 	pirq = gsi;
diff --git a/arch/x86/platform/intel/iosf_mbi.c b/arch/x86/platform/intel/iosf_mbi.c
index fdd49d70b437..c81cea208c2c 100644
--- a/arch/x86/platform/intel/iosf_mbi.c
+++ b/arch/x86/platform/intel/iosf_mbi.c
@@ -62,7 +62,7 @@ static int iosf_mbi_pci_read_mdr(u32 mcrx, u32 mcr, u32 *mdr)
 
 fail_read:
 	dev_err(&mbi_pdev->dev, "PCI config access failed with %d\n", result);
-	return result;
+	return pcibios_err_to_errno(result);
 }
 
 static int iosf_mbi_pci_write_mdr(u32 mcrx, u32 mcr, u32 mdr)
@@ -91,7 +91,7 @@ static int iosf_mbi_pci_write_mdr(u32 mcrx, u32 mcr, u32 mdr)
 
 fail_write:
 	dev_err(&mbi_pdev->dev, "PCI config access failed with %d\n", result);
-	return result;
+	return pcibios_err_to_errno(result);
 }
 
 int iosf_mbi_read(u8 port, u8 opcode, u32 offset, u32 *mdr)
diff --git a/arch/x86/xen/p2m.c b/arch/x86/xen/p2m.c
index 9bdc3b656b2c..4c2bf989edaf 100644
--- a/arch/x86/xen/p2m.c
+++ b/arch/x86/xen/p2m.c
@@ -731,7 +731,7 @@ int set_foreign_p2m_mapping(struct gnttab_map_grant_ref *map_ops,
 		 * immediate unmapping.
 		 */
 		map_ops[i].status = GNTST_general_error;
-		unmap[0].host_addr = map_ops[i].host_addr,
+		unmap[0].host_addr = map_ops[i].host_addr;
 		unmap[0].handle = map_ops[i].handle;
 		map_ops[i].handle = INVALID_GRANT_HANDLE;
 		if (map_ops[i].flags & GNTMAP_device_map)
@@ -741,7 +741,7 @@ int set_foreign_p2m_mapping(struct gnttab_map_grant_ref *map_ops,
 
 		if (kmap_ops) {
 			kmap_ops[i].status = GNTST_general_error;
-			unmap[1].host_addr = kmap_ops[i].host_addr,
+			unmap[1].host_addr = kmap_ops[i].host_addr;
 			unmap[1].handle = kmap_ops[i].handle;
 			kmap_ops[i].handle = INVALID_GRANT_HANDLE;
 			if (kmap_ops[i].flags & GNTMAP_device_map)
diff --git a/block/bio-integrity.c b/block/bio-integrity.c
index ec8ac8cf6e1b..15e444b2fcc1 100644
--- a/block/bio-integrity.c
+++ b/block/bio-integrity.c
@@ -217,6 +217,7 @@ bool bio_integrity_prep(struct bio *bio)
 	unsigned long start, end;
 	unsigned int len, nr_pages;
 	unsigned int bytes, offset, i;
+	gfp_t gfp = GFP_NOIO;
 
 	if (!bi)
 		return true;
@@ -239,11 +240,19 @@ bool bio_integrity_prep(struct bio *bio)
 		if (!bi->profile->generate_fn ||
 		    !(bi->flags & BLK_INTEGRITY_GENERATE))
 			return true;
+
+		/*
+		 * Zero the memory allocated to not leak uninitialized kernel
+		 * memory to disk.  For PI this only affects the app tag, but
+		 * for non-integrity metadata it affects the entire metadata
+		 * buffer.
+		 */
+		gfp |= __GFP_ZERO;
 	}
 
 	/* Allocate kernel buffer for protection data */
 	len = bio_integrity_bytes(bi, bio_sectors(bio));
-	buf = kmalloc(len, GFP_NOIO);
+	buf = kmalloc(len, gfp);
 	if (unlikely(buf == NULL)) {
 		printk(KERN_ERR "could not allocate integrity buffer\n");
 		goto err_end_io;
diff --git a/block/blk-mq.c b/block/blk-mq.c
index 4c91889affa7..7cc315527a44 100644
--- a/block/blk-mq.c
+++ b/block/blk-mq.c
@@ -447,6 +447,10 @@ static struct request *__blk_mq_alloc_requests(struct blk_mq_alloc_data *data)
 	if (data->cmd_flags & REQ_NOWAIT)
 		data->flags |= BLK_MQ_REQ_NOWAIT;
 
+retry:
+	data->ctx = blk_mq_get_ctx(q);
+	data->hctx = blk_mq_map_queue(q, data->cmd_flags, data->ctx);
+
 	if (q->elevator) {
 		/*
 		 * All requests use scheduler tags when an I/O scheduler is
@@ -468,13 +472,9 @@ static struct request *__blk_mq_alloc_requests(struct blk_mq_alloc_data *data)
 			if (ops->limit_depth)
 				ops->limit_depth(data->cmd_flags, data);
 		}
-	}
-
-retry:
-	data->ctx = blk_mq_get_ctx(q);
-	data->hctx = blk_mq_map_queue(q, data->cmd_flags, data->ctx);
-	if (!(data->rq_flags & RQF_SCHED_TAGS))
+	} else {
 		blk_mq_tag_busy(data->hctx);
+	}
 
 	if (data->flags & BLK_MQ_REQ_RESERVED)
 		data->rq_flags |= RQF_RESV;
diff --git a/block/genhd.c b/block/genhd.c
index 33b1ebf6ef82..203c880c3e1c 100644
--- a/block/genhd.c
+++ b/block/genhd.c
@@ -655,12 +655,12 @@ void del_gendisk(struct gendisk *disk)
 	 */
 	if (!test_bit(GD_DEAD, &disk->state))
 		blk_report_disk_dead(disk, false);
-	__blk_mark_disk_dead(disk);
 
 	/*
 	 * Drop all partitions now that the disk is marked dead.
 	 */
 	mutex_lock(&disk->open_mutex);
+	__blk_mark_disk_dead(disk);
 	xa_for_each_start(&disk->part_tbl, idx, part, 1)
 		drop_partition(part);
 	mutex_unlock(&disk->open_mutex);
diff --git a/block/mq-deadline.c b/block/mq-deadline.c
index 02a916ba62ee..78a8aa204c15 100644
--- a/block/mq-deadline.c
+++ b/block/mq-deadline.c
@@ -621,6 +621,20 @@ static struct request *dd_dispatch_request(struct blk_mq_hw_ctx *hctx)
 	return rq;
 }
 
+/*
+ * 'depth' is a number in the range 1..INT_MAX representing a number of
+ * requests. Scale it with a factor (1 << bt->sb.shift) / q->nr_requests since
+ * 1..(1 << bt->sb.shift) is the range expected by sbitmap_get_shallow().
+ * Values larger than q->nr_requests have the same effect as q->nr_requests.
+ */
+static int dd_to_word_depth(struct blk_mq_hw_ctx *hctx, unsigned int qdepth)
+{
+	struct sbitmap_queue *bt = &hctx->sched_tags->bitmap_tags;
+	const unsigned int nrr = hctx->queue->nr_requests;
+
+	return ((qdepth << bt->sb.shift) + nrr - 1) / nrr;
+}
+
 /*
  * Called by __blk_mq_alloc_request(). The shallow_depth value set by this
  * function is used by __blk_mq_get_tag().
@@ -637,7 +651,7 @@ static void dd_limit_depth(blk_opf_t opf, struct blk_mq_alloc_data *data)
 	 * Throttle asynchronous requests and writes such that these requests
 	 * do not block the allocation of synchronous requests.
 	 */
-	data->shallow_depth = dd->async_depth;
+	data->shallow_depth = dd_to_word_depth(data->hctx, dd->async_depth);
 }
 
 /* Called by blk_mq_update_nr_requests(). */
@@ -647,9 +661,9 @@ static void dd_depth_updated(struct blk_mq_hw_ctx *hctx)
 	struct deadline_data *dd = q->elevator->elevator_data;
 	struct blk_mq_tags *tags = hctx->sched_tags;
 
-	dd->async_depth = max(1UL, 3 * q->nr_requests / 4);
+	dd->async_depth = q->nr_requests;
 
-	sbitmap_queue_min_shallow_depth(&tags->bitmap_tags, dd->async_depth);
+	sbitmap_queue_min_shallow_depth(&tags->bitmap_tags, 1);
 }
 
 /* Called by blk_mq_init_hctx() and blk_mq_init_sched(). */
diff --git a/drivers/android/binder.c b/drivers/android/binder.c
index e67a91120385..ccaceedbc2c0 100644
--- a/drivers/android/binder.c
+++ b/drivers/android/binder.c
@@ -570,9 +570,7 @@ static bool binder_has_work(struct binder_thread *thread, bool do_proc_work)
 static bool binder_available_for_proc_work_ilocked(struct binder_thread *thread)
 {
 	return !thread->transaction_stack &&
-		binder_worklist_empty_ilocked(&thread->todo) &&
-		(thread->looper & (BINDER_LOOPER_STATE_ENTERED |
-				   BINDER_LOOPER_STATE_REGISTERED));
+		binder_worklist_empty_ilocked(&thread->todo);
 }
 
 static void binder_wakeup_poll_threads_ilocked(struct binder_proc *proc,
diff --git a/drivers/ata/libata-scsi.c b/drivers/ata/libata-scsi.c
index 0e078bf5aba0..77dbd516a054 100644
--- a/drivers/ata/libata-scsi.c
+++ b/drivers/ata/libata-scsi.c
@@ -230,6 +230,80 @@ void ata_scsi_set_sense_information(struct ata_device *dev,
 				   SCSI_SENSE_BUFFERSIZE, information);
 }
 
+/**
+ *	ata_scsi_set_passthru_sense_fields - Set ATA fields in sense buffer
+ *	@qc: ATA PASS-THROUGH command.
+ *
+ *	Populates "ATA Status Return sense data descriptor" / "Fixed format
+ *	sense data" with ATA taskfile fields.
+ *
+ *	LOCKING:
+ *	None.
+ */
+static void ata_scsi_set_passthru_sense_fields(struct ata_queued_cmd *qc)
+{
+	struct scsi_cmnd *cmd = qc->scsicmd;
+	struct ata_taskfile *tf = &qc->result_tf;
+	unsigned char *sb = cmd->sense_buffer;
+
+	if ((sb[0] & 0x7f) >= 0x72) {
+		unsigned char *desc;
+		u8 len;
+
+		/* descriptor format */
+		len = sb[7];
+		desc = (char *)scsi_sense_desc_find(sb, len + 8, 9);
+		if (!desc) {
+			if (SCSI_SENSE_BUFFERSIZE < len + 14)
+				return;
+			sb[7] = len + 14;
+			desc = sb + 8 + len;
+		}
+		desc[0] = 9;
+		desc[1] = 12;
+		/*
+		 * Copy registers into sense buffer.
+		 */
+		desc[2] = 0x00;
+		desc[3] = tf->error;
+		desc[5] = tf->nsect;
+		desc[7] = tf->lbal;
+		desc[9] = tf->lbam;
+		desc[11] = tf->lbah;
+		desc[12] = tf->device;
+		desc[13] = tf->status;
+
+		/*
+		 * Fill in Extend bit, and the high order bytes
+		 * if applicable.
+		 */
+		if (tf->flags & ATA_TFLAG_LBA48) {
+			desc[2] |= 0x01;
+			desc[4] = tf->hob_nsect;
+			desc[6] = tf->hob_lbal;
+			desc[8] = tf->hob_lbam;
+			desc[10] = tf->hob_lbah;
+		}
+	} else {
+		/* Fixed sense format */
+		sb[0] |= 0x80;
+		sb[3] = tf->error;
+		sb[4] = tf->status;
+		sb[5] = tf->device;
+		sb[6] = tf->nsect;
+		if (tf->flags & ATA_TFLAG_LBA48)  {
+			sb[8] |= 0x80;
+			if (tf->hob_nsect)
+				sb[8] |= 0x40;
+			if (tf->hob_lbal || tf->hob_lbam || tf->hob_lbah)
+				sb[8] |= 0x20;
+		}
+		sb[9] = tf->lbal;
+		sb[10] = tf->lbam;
+		sb[11] = tf->lbah;
+	}
+}
+
 static void ata_scsi_set_invalid_field(struct ata_device *dev,
 				       struct scsi_cmnd *cmd, u16 field, u8 bit)
 {
@@ -837,10 +911,8 @@ static void ata_to_sense_error(unsigned id, u8 drv_stat, u8 drv_err, u8 *sk,
  *	ata_gen_passthru_sense - Generate check condition sense block.
  *	@qc: Command that completed.
  *
- *	This function is specific to the ATA descriptor format sense
- *	block specified for the ATA pass through commands.  Regardless
- *	of whether the command errored or not, return a sense
- *	block. Copy all controller registers into the sense
+ *	This function is specific to the ATA pass through commands.
+ *	Regardless of whether the command errored or not, return a sense
  *	block. If there was no error, we get the request from an ATA
  *	passthrough command, so we use the following sense data:
  *	sk = RECOVERED ERROR
@@ -855,7 +927,6 @@ static void ata_gen_passthru_sense(struct ata_queued_cmd *qc)
 	struct scsi_cmnd *cmd = qc->scsicmd;
 	struct ata_taskfile *tf = &qc->result_tf;
 	unsigned char *sb = cmd->sense_buffer;
-	unsigned char *desc = sb + 8;
 	u8 sense_key, asc, ascq;
 
 	memset(sb, 0, SCSI_SENSE_BUFFERSIZE);
@@ -870,67 +941,8 @@ static void ata_gen_passthru_sense(struct ata_queued_cmd *qc)
 				   &sense_key, &asc, &ascq);
 		ata_scsi_set_sense(qc->dev, cmd, sense_key, asc, ascq);
 	} else {
-		/*
-		 * ATA PASS-THROUGH INFORMATION AVAILABLE
-		 * Always in descriptor format sense.
-		 */
-		scsi_build_sense(cmd, 1, RECOVERED_ERROR, 0, 0x1D);
-	}
-
-	if ((cmd->sense_buffer[0] & 0x7f) >= 0x72) {
-		u8 len;
-
-		/* descriptor format */
-		len = sb[7];
-		desc = (char *)scsi_sense_desc_find(sb, len + 8, 9);
-		if (!desc) {
-			if (SCSI_SENSE_BUFFERSIZE < len + 14)
-				return;
-			sb[7] = len + 14;
-			desc = sb + 8 + len;
-		}
-		desc[0] = 9;
-		desc[1] = 12;
-		/*
-		 * Copy registers into sense buffer.
-		 */
-		desc[2] = 0x00;
-		desc[3] = tf->error;
-		desc[5] = tf->nsect;
-		desc[7] = tf->lbal;
-		desc[9] = tf->lbam;
-		desc[11] = tf->lbah;
-		desc[12] = tf->device;
-		desc[13] = tf->status;
-
-		/*
-		 * Fill in Extend bit, and the high order bytes
-		 * if applicable.
-		 */
-		if (tf->flags & ATA_TFLAG_LBA48) {
-			desc[2] |= 0x01;
-			desc[4] = tf->hob_nsect;
-			desc[6] = tf->hob_lbal;
-			desc[8] = tf->hob_lbam;
-			desc[10] = tf->hob_lbah;
-		}
-	} else {
-		/* Fixed sense format */
-		desc[0] = tf->error;
-		desc[1] = tf->status;
-		desc[2] = tf->device;
-		desc[3] = tf->nsect;
-		desc[7] = 0;
-		if (tf->flags & ATA_TFLAG_LBA48)  {
-			desc[8] |= 0x80;
-			if (tf->hob_nsect)
-				desc[8] |= 0x40;
-			if (tf->hob_lbal || tf->hob_lbam || tf->hob_lbah)
-				desc[8] |= 0x20;
-		}
-		desc[9] = tf->lbal;
-		desc[10] = tf->lbam;
-		desc[11] = tf->lbah;
+		/* ATA PASS-THROUGH INFORMATION AVAILABLE */
+		ata_scsi_set_sense(qc->dev, cmd, RECOVERED_ERROR, 0, 0x1D);
 	}
 }
 
@@ -1664,26 +1676,32 @@ static void ata_scsi_qc_complete(struct ata_queued_cmd *qc)
 {
 	struct scsi_cmnd *cmd = qc->scsicmd;
 	u8 *cdb = cmd->cmnd;
-	int need_sense = (qc->err_mask != 0) &&
-		!(qc->flags & ATA_QCFLAG_SENSE_VALID);
+	bool have_sense = qc->flags & ATA_QCFLAG_SENSE_VALID;
+	bool is_ata_passthru = cdb[0] == ATA_16 || cdb[0] == ATA_12;
+	bool is_ck_cond_request = cdb[2] & 0x20;
+	bool is_error = qc->err_mask != 0;
 
 	/* For ATA pass thru (SAT) commands, generate a sense block if
 	 * user mandated it or if there's an error.  Note that if we
-	 * generate because the user forced us to [CK_COND =1], a check
+	 * generate because the user forced us to [CK_COND=1], a check
 	 * condition is generated and the ATA register values are returned
 	 * whether the command completed successfully or not. If there
-	 * was no error, we use the following sense data:
+	 * was no error, and CK_COND=1, we use the following sense data:
 	 * sk = RECOVERED ERROR
 	 * asc,ascq = ATA PASS-THROUGH INFORMATION AVAILABLE
 	 */
-	if (((cdb[0] == ATA_16) || (cdb[0] == ATA_12)) &&
-	    ((cdb[2] & 0x20) || need_sense))
-		ata_gen_passthru_sense(qc);
-	else if (need_sense)
+	if (is_ata_passthru && (is_ck_cond_request || is_error || have_sense)) {
+		if (!have_sense)
+			ata_gen_passthru_sense(qc);
+		ata_scsi_set_passthru_sense_fields(qc);
+		if (is_ck_cond_request)
+			set_status_byte(qc->scsicmd, SAM_STAT_CHECK_CONDITION);
+	} else if (is_error && !have_sense) {
 		ata_gen_ata_sense(qc);
-	else
+	} else {
 		/* Keep the SCSI ML and status byte, clear host byte. */
 		cmd->result &= 0x0000ffff;
+	}
 
 	ata_qc_done(qc);
 }
@@ -2622,14 +2640,8 @@ static void atapi_qc_complete(struct ata_queued_cmd *qc)
 	/* handle completion from EH */
 	if (unlikely(err_mask || qc->flags & ATA_QCFLAG_SENSE_VALID)) {
 
-		if (!(qc->flags & ATA_QCFLAG_SENSE_VALID)) {
-			/* FIXME: not quite right; we don't want the
-			 * translation of taskfile registers into a
-			 * sense descriptors, since that's only
-			 * correct for ATA, not ATAPI
-			 */
+		if (!(qc->flags & ATA_QCFLAG_SENSE_VALID))
 			ata_gen_passthru_sense(qc);
-		}
 
 		/* SCSI EH automatically locks door if sdev->locked is
 		 * set.  Sometimes door lock request continues to
diff --git a/drivers/auxdisplay/ht16k33.c b/drivers/auxdisplay/ht16k33.c
index 3a2d88387224..b360ddefc423 100644
--- a/drivers/auxdisplay/ht16k33.c
+++ b/drivers/auxdisplay/ht16k33.c
@@ -507,6 +507,7 @@ static int ht16k33_led_probe(struct device *dev, struct led_classdev *led,
 	led->max_brightness = MAX_BRIGHTNESS;
 
 	err = devm_led_classdev_register_ext(dev, led, &init_data);
+	fwnode_handle_put(init_data.fwnode);
 	if (err)
 		dev_err(dev, "Failed to register LED\n");
 
diff --git a/drivers/base/devres.c b/drivers/base/devres.c
index 3df0025d12aa..8d709dbd4e0c 100644
--- a/drivers/base/devres.c
+++ b/drivers/base/devres.c
@@ -896,9 +896,12 @@ void *devm_krealloc(struct device *dev, void *ptr, size_t new_size, gfp_t gfp)
 	/*
 	 * Otherwise: allocate new, larger chunk. We need to allocate before
 	 * taking the lock as most probably the caller uses GFP_KERNEL.
+	 * alloc_dr() will call check_dr_size() to reserve extra memory
+	 * for struct devres automatically, so size @new_size user request
+	 * is delivered to it directly as devm_kmalloc() does.
 	 */
 	new_dr = alloc_dr(devm_kmalloc_release,
-			  total_new_size, gfp, dev_to_node(dev));
+			  new_size, gfp, dev_to_node(dev));
 	if (!new_dr)
 		return NULL;
 
@@ -1222,7 +1225,11 @@ EXPORT_SYMBOL_GPL(__devm_alloc_percpu);
  */
 void devm_free_percpu(struct device *dev, void __percpu *pdata)
 {
-	WARN_ON(devres_destroy(dev, devm_percpu_release, devm_percpu_match,
+	/*
+	 * Use devres_release() to prevent memory leakage as
+	 * devm_free_pages() does.
+	 */
+	WARN_ON(devres_release(dev, devm_percpu_release, devm_percpu_match,
 			       (__force void *)pdata));
 }
 EXPORT_SYMBOL_GPL(devm_free_percpu);
diff --git a/drivers/block/rbd.c b/drivers/block/rbd.c
index 1e2596c5efd8..6fcd7f0fe4f0 100644
--- a/drivers/block/rbd.c
+++ b/drivers/block/rbd.c
@@ -362,7 +362,7 @@ enum rbd_watch_state {
 enum rbd_lock_state {
 	RBD_LOCK_STATE_UNLOCKED,
 	RBD_LOCK_STATE_LOCKED,
-	RBD_LOCK_STATE_RELEASING,
+	RBD_LOCK_STATE_QUIESCING,
 };
 
 /* WatchNotify::ClientId */
@@ -422,7 +422,7 @@ struct rbd_device {
 	struct list_head	running_list;
 	struct completion	acquire_wait;
 	int			acquire_err;
-	struct completion	releasing_wait;
+	struct completion	quiescing_wait;
 
 	spinlock_t		object_map_lock;
 	u8			*object_map;
@@ -525,7 +525,7 @@ static bool __rbd_is_lock_owner(struct rbd_device *rbd_dev)
 	lockdep_assert_held(&rbd_dev->lock_rwsem);
 
 	return rbd_dev->lock_state == RBD_LOCK_STATE_LOCKED ||
-	       rbd_dev->lock_state == RBD_LOCK_STATE_RELEASING;
+	       rbd_dev->lock_state == RBD_LOCK_STATE_QUIESCING;
 }
 
 static bool rbd_is_lock_owner(struct rbd_device *rbd_dev)
@@ -3457,13 +3457,14 @@ static void rbd_lock_del_request(struct rbd_img_request *img_req)
 	lockdep_assert_held(&rbd_dev->lock_rwsem);
 	spin_lock(&rbd_dev->lock_lists_lock);
 	if (!list_empty(&img_req->lock_item)) {
+		rbd_assert(!list_empty(&rbd_dev->running_list));
 		list_del_init(&img_req->lock_item);
-		need_wakeup = (rbd_dev->lock_state == RBD_LOCK_STATE_RELEASING &&
+		need_wakeup = (rbd_dev->lock_state == RBD_LOCK_STATE_QUIESCING &&
 			       list_empty(&rbd_dev->running_list));
 	}
 	spin_unlock(&rbd_dev->lock_lists_lock);
 	if (need_wakeup)
-		complete(&rbd_dev->releasing_wait);
+		complete(&rbd_dev->quiescing_wait);
 }
 
 static int rbd_img_exclusive_lock(struct rbd_img_request *img_req)
@@ -3476,11 +3477,6 @@ static int rbd_img_exclusive_lock(struct rbd_img_request *img_req)
 	if (rbd_lock_add_request(img_req))
 		return 1;
 
-	if (rbd_dev->opts->exclusive) {
-		WARN_ON(1); /* lock got released? */
-		return -EROFS;
-	}
-
 	/*
 	 * Note the use of mod_delayed_work() in rbd_acquire_lock()
 	 * and cancel_delayed_work() in wake_lock_waiters().
@@ -4181,16 +4177,16 @@ static bool rbd_quiesce_lock(struct rbd_device *rbd_dev)
 	/*
 	 * Ensure that all in-flight IO is flushed.
 	 */
-	rbd_dev->lock_state = RBD_LOCK_STATE_RELEASING;
-	rbd_assert(!completion_done(&rbd_dev->releasing_wait));
+	rbd_dev->lock_state = RBD_LOCK_STATE_QUIESCING;
+	rbd_assert(!completion_done(&rbd_dev->quiescing_wait));
 	if (list_empty(&rbd_dev->running_list))
 		return true;
 
 	up_write(&rbd_dev->lock_rwsem);
-	wait_for_completion(&rbd_dev->releasing_wait);
+	wait_for_completion(&rbd_dev->quiescing_wait);
 
 	down_write(&rbd_dev->lock_rwsem);
-	if (rbd_dev->lock_state != RBD_LOCK_STATE_RELEASING)
+	if (rbd_dev->lock_state != RBD_LOCK_STATE_QUIESCING)
 		return false;
 
 	rbd_assert(list_empty(&rbd_dev->running_list));
@@ -4601,6 +4597,10 @@ static void rbd_reacquire_lock(struct rbd_device *rbd_dev)
 			rbd_warn(rbd_dev, "failed to update lock cookie: %d",
 				 ret);
 
+		if (rbd_dev->opts->exclusive)
+			rbd_warn(rbd_dev,
+			     "temporarily releasing lock on exclusive mapping");
+
 		/*
 		 * Lock cookie cannot be updated on older OSDs, so do
 		 * a manual release and queue an acquire.
@@ -5382,7 +5382,7 @@ static struct rbd_device *__rbd_dev_create(struct rbd_spec *spec)
 	INIT_LIST_HEAD(&rbd_dev->acquiring_list);
 	INIT_LIST_HEAD(&rbd_dev->running_list);
 	init_completion(&rbd_dev->acquire_wait);
-	init_completion(&rbd_dev->releasing_wait);
+	init_completion(&rbd_dev->quiescing_wait);
 
 	spin_lock_init(&rbd_dev->object_map_lock);
 
@@ -6588,11 +6588,6 @@ static int rbd_add_acquire_lock(struct rbd_device *rbd_dev)
 	if (ret)
 		return ret;
 
-	/*
-	 * The lock may have been released by now, unless automatic lock
-	 * transitions are disabled.
-	 */
-	rbd_assert(!rbd_dev->opts->exclusive || rbd_is_lock_owner(rbd_dev));
 	return 0;
 }
 
diff --git a/drivers/bluetooth/btintel.c b/drivers/bluetooth/btintel.c
index ac1562d9ef26..3da3c266a66f 100644
--- a/drivers/bluetooth/btintel.c
+++ b/drivers/bluetooth/btintel.c
@@ -26,21 +26,11 @@
 #define ECDSA_OFFSET		644
 #define ECDSA_HEADER_LEN	320
 
-#define BTINTEL_PPAG_NAME   "PPAG"
-
 enum {
 	DSM_SET_WDISABLE2_DELAY = 1,
 	DSM_SET_RESET_METHOD = 3,
 };
 
-/* structure to store the PPAG data read from ACPI table */
-struct btintel_ppag {
-	u32	domain;
-	u32     mode;
-	acpi_status status;
-	struct hci_dev *hdev;
-};
-
 #define CMD_WRITE_BOOT_PARAMS	0xfc0e
 struct cmd_write_boot_params {
 	__le32 boot_addr;
@@ -1312,65 +1302,6 @@ static int btintel_read_debug_features(struct hci_dev *hdev,
 	return 0;
 }
 
-static acpi_status btintel_ppag_callback(acpi_handle handle, u32 lvl, void *data,
-					 void **ret)
-{
-	acpi_status status;
-	size_t len;
-	struct btintel_ppag *ppag = data;
-	union acpi_object *p, *elements;
-	struct acpi_buffer string = {ACPI_ALLOCATE_BUFFER, NULL};
-	struct acpi_buffer buffer = {ACPI_ALLOCATE_BUFFER, NULL};
-	struct hci_dev *hdev = ppag->hdev;
-
-	status = acpi_get_name(handle, ACPI_FULL_PATHNAME, &string);
-	if (ACPI_FAILURE(status)) {
-		bt_dev_warn(hdev, "PPAG-BT: ACPI Failure: %s", acpi_format_exception(status));
-		return status;
-	}
-
-	len = strlen(string.pointer);
-	if (len < strlen(BTINTEL_PPAG_NAME)) {
-		kfree(string.pointer);
-		return AE_OK;
-	}
-
-	if (strncmp((char *)string.pointer + len - 4, BTINTEL_PPAG_NAME, 4)) {
-		kfree(string.pointer);
-		return AE_OK;
-	}
-	kfree(string.pointer);
-
-	status = acpi_evaluate_object(handle, NULL, NULL, &buffer);
-	if (ACPI_FAILURE(status)) {
-		ppag->status = status;
-		bt_dev_warn(hdev, "PPAG-BT: ACPI Failure: %s", acpi_format_exception(status));
-		return status;
-	}
-
-	p = buffer.pointer;
-	ppag = (struct btintel_ppag *)data;
-
-	if (p->type != ACPI_TYPE_PACKAGE || p->package.count != 2) {
-		kfree(buffer.pointer);
-		bt_dev_warn(hdev, "PPAG-BT: Invalid object type: %d or package count: %d",
-			    p->type, p->package.count);
-		ppag->status = AE_ERROR;
-		return AE_ERROR;
-	}
-
-	elements = p->package.elements;
-
-	/* PPAG table is located at element[1] */
-	p = &elements[1];
-
-	ppag->domain = (u32)p->package.elements[0].integer.value;
-	ppag->mode = (u32)p->package.elements[1].integer.value;
-	ppag->status = AE_OK;
-	kfree(buffer.pointer);
-	return AE_CTRL_TERMINATE;
-}
-
 static int btintel_set_debug_features(struct hci_dev *hdev,
 			       const struct intel_debug_features *features)
 {
@@ -2399,10 +2330,13 @@ static int btintel_configure_offload(struct hci_dev *hdev)
 
 static void btintel_set_ppag(struct hci_dev *hdev, struct intel_version_tlv *ver)
 {
-	struct btintel_ppag ppag;
 	struct sk_buff *skb;
 	struct hci_ppag_enable_cmd ppag_cmd;
 	acpi_handle handle;
+	struct acpi_buffer buffer = {ACPI_ALLOCATE_BUFFER, NULL};
+	union acpi_object *p, *elements;
+	u32 domain, mode;
+	acpi_status status;
 
 	/* PPAG is not supported if CRF is HrP2, Jfp2, JfP1 */
 	switch (ver->cnvr_top & 0xFFF) {
@@ -2420,22 +2354,34 @@ static void btintel_set_ppag(struct hci_dev *hdev, struct intel_version_tlv *ver
 		return;
 	}
 
-	memset(&ppag, 0, sizeof(ppag));
-
-	ppag.hdev = hdev;
-	ppag.status = AE_NOT_FOUND;
-	acpi_walk_namespace(ACPI_TYPE_PACKAGE, handle, 1, NULL,
-			    btintel_ppag_callback, &ppag, NULL);
-
-	if (ACPI_FAILURE(ppag.status)) {
-		if (ppag.status == AE_NOT_FOUND) {
+	status = acpi_evaluate_object(handle, "PPAG", NULL, &buffer);
+	if (ACPI_FAILURE(status)) {
+		if (status == AE_NOT_FOUND) {
 			bt_dev_dbg(hdev, "PPAG-BT: ACPI entry not found");
 			return;
 		}
+		bt_dev_warn(hdev, "PPAG-BT: ACPI Failure: %s", acpi_format_exception(status));
+		return;
+	}
+
+	p = buffer.pointer;
+	if (p->type != ACPI_TYPE_PACKAGE || p->package.count != 2) {
+		bt_dev_warn(hdev, "PPAG-BT: Invalid object type: %d or package count: %d",
+			    p->type, p->package.count);
+		kfree(buffer.pointer);
 		return;
 	}
 
-	if (ppag.domain != 0x12) {
+	elements = p->package.elements;
+
+	/* PPAG table is located at element[1] */
+	p = &elements[1];
+
+	domain = (u32)p->package.elements[0].integer.value;
+	mode = (u32)p->package.elements[1].integer.value;
+	kfree(buffer.pointer);
+
+	if (domain != 0x12) {
 		bt_dev_dbg(hdev, "PPAG-BT: Bluetooth domain is disabled in ACPI firmware");
 		return;
 	}
@@ -2446,19 +2392,22 @@ static void btintel_set_ppag(struct hci_dev *hdev, struct intel_version_tlv *ver
 	 * BIT 1 : 0 Disabled in China
 	 *         1 Enabled in China
 	 */
-	if ((ppag.mode & 0x01) != BIT(0) && (ppag.mode & 0x02) != BIT(1)) {
-		bt_dev_dbg(hdev, "PPAG-BT: EU, China mode are disabled in CB/BIOS");
+	mode &= 0x03;
+
+	if (!mode) {
+		bt_dev_dbg(hdev, "PPAG-BT: EU, China mode are disabled in BIOS");
 		return;
 	}
 
-	ppag_cmd.ppag_enable_flags = cpu_to_le32(ppag.mode);
+	ppag_cmd.ppag_enable_flags = cpu_to_le32(mode);
 
-	skb = __hci_cmd_sync(hdev, INTEL_OP_PPAG_CMD, sizeof(ppag_cmd), &ppag_cmd, HCI_CMD_TIMEOUT);
+	skb = __hci_cmd_sync(hdev, INTEL_OP_PPAG_CMD, sizeof(ppag_cmd),
+			     &ppag_cmd, HCI_CMD_TIMEOUT);
 	if (IS_ERR(skb)) {
 		bt_dev_warn(hdev, "Failed to send PPAG Enable (%ld)", PTR_ERR(skb));
 		return;
 	}
-	bt_dev_info(hdev, "PPAG-BT: Enabled (Mode %d)", ppag.mode);
+	bt_dev_info(hdev, "PPAG-BT: Enabled (Mode %d)", mode);
 	kfree_skb(skb);
 }
 
diff --git a/drivers/bluetooth/btnxpuart.c b/drivers/bluetooth/btnxpuart.c
index 5c5a5b752419..83e8e27a5ece 100644
--- a/drivers/bluetooth/btnxpuart.c
+++ b/drivers/bluetooth/btnxpuart.c
@@ -186,6 +186,11 @@ struct btnxpuart_dev {
 #define NXP_NAK_V3		0x7b
 #define NXP_CRC_ERROR_V3	0x7c
 
+/* Bootloader signature error codes */
+#define NXP_ACK_RX_TIMEOUT	0x0002	/* ACK not received from host */
+#define NXP_HDR_RX_TIMEOUT	0x0003	/* FW Header chunk not received */
+#define NXP_DATA_RX_TIMEOUT	0x0004	/* FW Data chunk not received */
+
 #define HDR_LEN			16
 
 #define NXP_RECV_CHIP_VER_V1 \
@@ -276,6 +281,17 @@ struct nxp_bootloader_cmd {
 	__be32 crc;
 } __packed;
 
+struct nxp_v3_rx_timeout_nak {
+	u8 nak;
+	__le32 offset;
+	u8 crc;
+} __packed;
+
+union nxp_v3_rx_timeout_nak_u {
+	struct nxp_v3_rx_timeout_nak pkt;
+	u8 buf[6];
+};
+
 static u8 crc8_table[CRC8_TABLE_SIZE];
 
 /* Default configurations */
@@ -883,6 +899,32 @@ static int nxp_recv_chip_ver_v3(struct hci_dev *hdev, struct sk_buff *skb)
 	return 0;
 }
 
+static void nxp_handle_fw_download_error(struct hci_dev *hdev, struct v3_data_req *req)
+{
+	struct btnxpuart_dev *nxpdev = hci_get_drvdata(hdev);
+	__u32 offset = __le32_to_cpu(req->offset);
+	__u16 err = __le16_to_cpu(req->error);
+	union nxp_v3_rx_timeout_nak_u nak_tx_buf;
+
+	switch (err) {
+	case NXP_ACK_RX_TIMEOUT:
+	case NXP_HDR_RX_TIMEOUT:
+	case NXP_DATA_RX_TIMEOUT:
+		nak_tx_buf.pkt.nak = NXP_NAK_V3;
+		nak_tx_buf.pkt.offset = __cpu_to_le32(offset);
+		nak_tx_buf.pkt.crc = crc8(crc8_table, nak_tx_buf.buf,
+				      sizeof(nak_tx_buf) - 1, 0xff);
+		serdev_device_write_buf(nxpdev->serdev, nak_tx_buf.buf,
+					sizeof(nak_tx_buf));
+		break;
+	default:
+		bt_dev_dbg(hdev, "Unknown bootloader error code: %d", err);
+		break;
+
+	}
+
+}
+
 static int nxp_recv_fw_req_v3(struct hci_dev *hdev, struct sk_buff *skb)
 {
 	struct btnxpuart_dev *nxpdev = hci_get_drvdata(hdev);
@@ -897,7 +939,12 @@ static int nxp_recv_fw_req_v3(struct hci_dev *hdev, struct sk_buff *skb)
 	if (!req || !nxpdev->fw)
 		goto free_skb;
 
-	nxp_send_ack(NXP_ACK_V3, hdev);
+	if (!req->error) {
+		nxp_send_ack(NXP_ACK_V3, hdev);
+	} else {
+		nxp_handle_fw_download_error(hdev, req);
+		goto free_skb;
+	}
 
 	len = __le16_to_cpu(req->len);
 
@@ -924,9 +971,6 @@ static int nxp_recv_fw_req_v3(struct hci_dev *hdev, struct sk_buff *skb)
 		wake_up_interruptible(&nxpdev->fw_dnld_done_wait_q);
 		goto free_skb;
 	}
-	if (req->error)
-		bt_dev_dbg(hdev, "FW Download received err 0x%02x from chip",
-			   req->error);
 
 	offset = __le32_to_cpu(req->offset);
 	if (offset < nxpdev->fw_v3_offset_correction) {
diff --git a/drivers/bluetooth/btusb.c b/drivers/bluetooth/btusb.c
index 7c271f55a9b4..c495fceda20a 100644
--- a/drivers/bluetooth/btusb.c
+++ b/drivers/bluetooth/btusb.c
@@ -551,6 +551,10 @@ static const struct usb_device_id quirks_table[] = {
 						     BTUSB_WIDEBAND_SPEECH },
 	{ USB_DEVICE(0x13d3, 0x3571), .driver_info = BTUSB_REALTEK |
 						     BTUSB_WIDEBAND_SPEECH },
+	{ USB_DEVICE(0x13d3, 0x3591), .driver_info = BTUSB_REALTEK |
+						     BTUSB_WIDEBAND_SPEECH },
+	{ USB_DEVICE(0x0489, 0xe125), .driver_info = BTUSB_REALTEK |
+						     BTUSB_WIDEBAND_SPEECH },
 
 	/* Realtek Bluetooth devices */
 	{ USB_VENDOR_AND_INTERFACE_INFO(0x0bda, 0xe0, 0x01, 0x01),
diff --git a/drivers/bluetooth/hci_bcm4377.c b/drivers/bluetooth/hci_bcm4377.c
index cf36cdac652d..0dc3ca3d4107 100644
--- a/drivers/bluetooth/hci_bcm4377.c
+++ b/drivers/bluetooth/hci_bcm4377.c
@@ -32,7 +32,7 @@ enum bcm4377_chip {
 #define BCM4378_DEVICE_ID 0x5f69
 #define BCM4387_DEVICE_ID 0x5f71
 
-#define BCM4377_TIMEOUT 1000
+#define BCM4377_TIMEOUT msecs_to_jiffies(1000)
 
 /*
  * These devices only support DMA transactions inside a 32bit window
diff --git a/drivers/char/hw_random/amd-rng.c b/drivers/char/hw_random/amd-rng.c
index 86162a13681e..9a24d19236dc 100644
--- a/drivers/char/hw_random/amd-rng.c
+++ b/drivers/char/hw_random/amd-rng.c
@@ -143,8 +143,10 @@ static int __init amd_rng_mod_init(void)
 
 found:
 	err = pci_read_config_dword(pdev, 0x58, &pmbase);
-	if (err)
+	if (err) {
+		err = pcibios_err_to_errno(err);
 		goto put_dev;
+	}
 
 	pmbase &= 0x0000FF00;
 	if (pmbase == 0) {
diff --git a/drivers/char/hw_random/core.c b/drivers/char/hw_random/core.c
index a3bbdd6e60fc..a182fe794f98 100644
--- a/drivers/char/hw_random/core.c
+++ b/drivers/char/hw_random/core.c
@@ -174,7 +174,6 @@ static int hwrng_init(struct hwrng *rng)
 	reinit_completion(&rng->cleanup_done);
 
 skip_init:
-	rng->quality = min_t(u16, min_t(u16, default_quality, 1024), rng->quality ?: 1024);
 	current_quality = rng->quality; /* obsolete */
 
 	return 0;
@@ -563,6 +562,9 @@ int hwrng_register(struct hwrng *rng)
 	complete(&rng->cleanup_done);
 	init_completion(&rng->dying);
 
+	/* Adjust quality field to always have a proper value */
+	rng->quality = min_t(u16, min_t(u16, default_quality, 1024), rng->quality ?: 1024);
+
 	if (!current_rng ||
 	    (!cur_rng_set_by_user && rng->quality > current_rng->quality)) {
 		/*
diff --git a/drivers/char/ipmi/ssif_bmc.c b/drivers/char/ipmi/ssif_bmc.c
index 56346fb32872..ab4e87a99f08 100644
--- a/drivers/char/ipmi/ssif_bmc.c
+++ b/drivers/char/ipmi/ssif_bmc.c
@@ -177,13 +177,15 @@ static ssize_t ssif_bmc_write(struct file *file, const char __user *buf, size_t
 	unsigned long flags;
 	ssize_t ret;
 
-	if (count > sizeof(struct ipmi_ssif_msg))
+	if (count < sizeof(msg.len) ||
+	    count > sizeof(struct ipmi_ssif_msg))
 		return -EINVAL;
 
 	if (copy_from_user(&msg, buf, count))
 		return -EFAULT;
 
-	if (!msg.len || count < sizeof_field(struct ipmi_ssif_msg, len) + msg.len)
+	if (!msg.len || msg.len > IPMI_SSIF_PAYLOAD_MAX ||
+	    count < sizeof_field(struct ipmi_ssif_msg, len) + msg.len)
 		return -EINVAL;
 
 	spin_lock_irqsave(&ssif_bmc->lock, flags);
diff --git a/drivers/char/tpm/eventlog/common.c b/drivers/char/tpm/eventlog/common.c
index 639c3f395a5a..4c0bbba64ee5 100644
--- a/drivers/char/tpm/eventlog/common.c
+++ b/drivers/char/tpm/eventlog/common.c
@@ -47,6 +47,8 @@ static int tpm_bios_measurements_open(struct inode *inode,
 	if (!err) {
 		seq = file->private_data;
 		seq->private = chip;
+	} else {
+		put_device(&chip->dev);
 	}
 
 	return err;
diff --git a/drivers/clk/clk-en7523.c b/drivers/clk/clk-en7523.c
index 7cde328495e2..7914e60f3d6c 100644
--- a/drivers/clk/clk-en7523.c
+++ b/drivers/clk/clk-en7523.c
@@ -40,6 +40,7 @@ struct en_clk_desc {
 	u8 div_shift;
 	u16 div_val0;
 	u8 div_step;
+	u8 div_offset;
 };
 
 struct en_clk_gate {
@@ -67,6 +68,7 @@ static const struct en_clk_desc en7523_base_clks[] = {
 		.div_bits = 3,
 		.div_shift = 0,
 		.div_step = 1,
+		.div_offset = 1,
 	}, {
 		.id = EN7523_CLK_EMI,
 		.name = "emi",
@@ -80,6 +82,7 @@ static const struct en_clk_desc en7523_base_clks[] = {
 		.div_bits = 3,
 		.div_shift = 0,
 		.div_step = 1,
+		.div_offset = 1,
 	}, {
 		.id = EN7523_CLK_BUS,
 		.name = "bus",
@@ -93,6 +96,7 @@ static const struct en_clk_desc en7523_base_clks[] = {
 		.div_bits = 3,
 		.div_shift = 0,
 		.div_step = 1,
+		.div_offset = 1,
 	}, {
 		.id = EN7523_CLK_SLIC,
 		.name = "slic",
@@ -133,13 +137,14 @@ static const struct en_clk_desc en7523_base_clks[] = {
 		.div_bits = 3,
 		.div_shift = 0,
 		.div_step = 1,
+		.div_offset = 1,
 	}, {
 		.id = EN7523_CLK_CRYPTO,
 		.name = "crypto",
 
 		.base_reg = REG_CRYPTO_CLKSRC,
 		.base_bits = 1,
-		.base_shift = 8,
+		.base_shift = 0,
 		.base_values = emi_base,
 		.n_base_values = ARRAY_SIZE(emi_base),
 	}
@@ -184,7 +189,7 @@ static u32 en7523_get_div(void __iomem *base, int i)
 	if (!val && desc->div_val0)
 		return desc->div_val0;
 
-	return (val + 1) * desc->div_step;
+	return (val + desc->div_offset) * desc->div_step;
 }
 
 static int en7523_pci_is_enabled(struct clk_hw *hw)
diff --git a/drivers/clk/davinci/da8xx-cfgchip.c b/drivers/clk/davinci/da8xx-cfgchip.c
index e5b2cdfe88ce..dff7ca35536c 100644
--- a/drivers/clk/davinci/da8xx-cfgchip.c
+++ b/drivers/clk/davinci/da8xx-cfgchip.c
@@ -508,7 +508,7 @@ da8xx_cfgchip_register_usb0_clk48(struct device *dev,
 	const char * const parent_names[] = { "usb_refclkin", "pll0_auxclk" };
 	struct clk *fck_clk;
 	struct da8xx_usb0_clk48 *usb0;
-	struct clk_init_data init;
+	struct clk_init_data init = {};
 	int ret;
 
 	fck_clk = devm_clk_get(dev, "fck");
@@ -583,7 +583,7 @@ da8xx_cfgchip_register_usb1_clk48(struct device *dev,
 {
 	const char * const parent_names[] = { "usb0_clk48", "usb_refclkin" };
 	struct da8xx_usb1_clk48 *usb1;
-	struct clk_init_data init;
+	struct clk_init_data init = {};
 	int ret;
 
 	usb1 = devm_kzalloc(dev, sizeof(*usb1), GFP_KERNEL);
diff --git a/drivers/clk/qcom/camcc-sc7280.c b/drivers/clk/qcom/camcc-sc7280.c
index 49f046ea857c..c1551de51d40 100644
--- a/drivers/clk/qcom/camcc-sc7280.c
+++ b/drivers/clk/qcom/camcc-sc7280.c
@@ -2260,6 +2260,7 @@ static struct gdsc cam_cc_bps_gdsc = {
 		.name = "cam_cc_bps_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.parent = &cam_cc_titan_top_gdsc.pd,
 	.flags = HW_CTRL | RETAIN_FF_ENABLE,
 };
 
@@ -2269,6 +2270,7 @@ static struct gdsc cam_cc_ife_0_gdsc = {
 		.name = "cam_cc_ife_0_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.parent = &cam_cc_titan_top_gdsc.pd,
 	.flags = RETAIN_FF_ENABLE,
 };
 
@@ -2278,6 +2280,7 @@ static struct gdsc cam_cc_ife_1_gdsc = {
 		.name = "cam_cc_ife_1_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.parent = &cam_cc_titan_top_gdsc.pd,
 	.flags = RETAIN_FF_ENABLE,
 };
 
@@ -2287,6 +2290,7 @@ static struct gdsc cam_cc_ife_2_gdsc = {
 		.name = "cam_cc_ife_2_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.parent = &cam_cc_titan_top_gdsc.pd,
 	.flags = RETAIN_FF_ENABLE,
 };
 
@@ -2296,6 +2300,7 @@ static struct gdsc cam_cc_ipe_0_gdsc = {
 		.name = "cam_cc_ipe_0_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.parent = &cam_cc_titan_top_gdsc.pd,
 	.flags = HW_CTRL | RETAIN_FF_ENABLE,
 };
 
diff --git a/drivers/clk/qcom/clk-rcg2.c b/drivers/clk/qcom/clk-rcg2.c
index 5183c74b074f..b9f2a29be927 100644
--- a/drivers/clk/qcom/clk-rcg2.c
+++ b/drivers/clk/qcom/clk-rcg2.c
@@ -1138,7 +1138,39 @@ clk_rcg2_shared_recalc_rate(struct clk_hw *hw, unsigned long parent_rate)
 	return clk_rcg2_recalc_rate(hw, parent_rate);
 }
 
+static int clk_rcg2_shared_init(struct clk_hw *hw)
+{
+	/*
+	 * This does a few things:
+	 *
+	 *  1. Sets rcg->parked_cfg to reflect the value at probe so that the
+	 *     proper parent is reported from clk_rcg2_shared_get_parent().
+	 *
+	 *  2. Clears the force enable bit of the RCG because we rely on child
+	 *     clks (branches) to turn the RCG on/off with a hardware feedback
+	 *     mechanism and only set the force enable bit in the RCG when we
+	 *     want to make sure the clk stays on for parent switches or
+	 *     parking.
+	 *
+	 *  3. Parks shared RCGs on the safe source at registration because we
+	 *     can't be certain that the parent clk will stay on during boot,
+	 *     especially if the parent is shared. If this RCG is enabled at
+	 *     boot, and the parent is turned off, the RCG will get stuck on. A
+	 *     GDSC can wedge if is turned on and the RCG is stuck on because
+	 *     the GDSC's controller will hang waiting for the clk status to
+	 *     toggle on when it never does.
+	 *
+	 * The safest option here is to "park" the RCG at init so that the clk
+	 * can never get stuck on or off. This ensures the GDSC can't get
+	 * wedged.
+	 */
+	clk_rcg2_shared_disable(hw);
+
+	return 0;
+}
+
 const struct clk_ops clk_rcg2_shared_ops = {
+	.init = clk_rcg2_shared_init,
 	.enable = clk_rcg2_shared_enable,
 	.disable = clk_rcg2_shared_disable,
 	.get_parent = clk_rcg2_shared_get_parent,
diff --git a/drivers/clk/qcom/gcc-sa8775p.c b/drivers/clk/qcom/gcc-sa8775p.c
index 8171d23c96e6..a54438205698 100644
--- a/drivers/clk/qcom/gcc-sa8775p.c
+++ b/drivers/clk/qcom/gcc-sa8775p.c
@@ -4305,74 +4305,114 @@ static struct clk_branch gcc_video_axi1_clk = {
 
 static struct gdsc pcie_0_gdsc = {
 	.gdscr = 0xa9004,
+	.collapse_ctrl = 0x4b104,
+	.collapse_mask = BIT(0),
+	.en_rest_wait_val = 0x2,
+	.en_few_wait_val = 0x2,
+	.clk_dis_wait_val = 0xf,
 	.pd = {
 		.name = "pcie_0_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.flags = VOTABLE | RETAIN_FF_ENABLE | POLL_CFG_GDSCR,
 };
 
 static struct gdsc pcie_1_gdsc = {
 	.gdscr = 0x77004,
+	.collapse_ctrl = 0x4b104,
+	.collapse_mask = BIT(1),
+	.en_rest_wait_val = 0x2,
+	.en_few_wait_val = 0x2,
+	.clk_dis_wait_val = 0xf,
 	.pd = {
 		.name = "pcie_1_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.flags = VOTABLE | RETAIN_FF_ENABLE | POLL_CFG_GDSCR,
 };
 
 static struct gdsc ufs_card_gdsc = {
 	.gdscr = 0x81004,
+	.en_rest_wait_val = 0x2,
+	.en_few_wait_val = 0x2,
+	.clk_dis_wait_val = 0xf,
 	.pd = {
 		.name = "ufs_card_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.flags = RETAIN_FF_ENABLE | POLL_CFG_GDSCR,
 };
 
 static struct gdsc ufs_phy_gdsc = {
 	.gdscr = 0x83004,
+	.en_rest_wait_val = 0x2,
+	.en_few_wait_val = 0x2,
+	.clk_dis_wait_val = 0xf,
 	.pd = {
 		.name = "ufs_phy_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.flags = RETAIN_FF_ENABLE | POLL_CFG_GDSCR,
 };
 
 static struct gdsc usb20_prim_gdsc = {
 	.gdscr = 0x1c004,
+	.en_rest_wait_val = 0x2,
+	.en_few_wait_val = 0x2,
+	.clk_dis_wait_val = 0xf,
 	.pd = {
 		.name = "usb20_prim_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.flags = RETAIN_FF_ENABLE | POLL_CFG_GDSCR,
 };
 
 static struct gdsc usb30_prim_gdsc = {
 	.gdscr = 0x1b004,
+	.en_rest_wait_val = 0x2,
+	.en_few_wait_val = 0x2,
+	.clk_dis_wait_val = 0xf,
 	.pd = {
 		.name = "usb30_prim_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.flags = RETAIN_FF_ENABLE | POLL_CFG_GDSCR,
 };
 
 static struct gdsc usb30_sec_gdsc = {
 	.gdscr = 0x2f004,
+	.en_rest_wait_val = 0x2,
+	.en_few_wait_val = 0x2,
+	.clk_dis_wait_val = 0xf,
 	.pd = {
 		.name = "usb30_sec_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.flags = RETAIN_FF_ENABLE | POLL_CFG_GDSCR,
 };
 
 static struct gdsc emac0_gdsc = {
 	.gdscr = 0xb6004,
+	.en_rest_wait_val = 0x2,
+	.en_few_wait_val = 0x2,
+	.clk_dis_wait_val = 0xf,
 	.pd = {
 		.name = "emac0_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.flags = RETAIN_FF_ENABLE | POLL_CFG_GDSCR,
 };
 
 static struct gdsc emac1_gdsc = {
 	.gdscr = 0xb4004,
+	.en_rest_wait_val = 0x2,
+	.en_few_wait_val = 0x2,
+	.clk_dis_wait_val = 0xf,
 	.pd = {
 		.name = "emac1_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.flags = RETAIN_FF_ENABLE | POLL_CFG_GDSCR,
 };
 
 static struct clk_regmap *gcc_sa8775p_clocks[] = {
diff --git a/drivers/clk/qcom/gcc-sc7280.c b/drivers/clk/qcom/gcc-sc7280.c
index 2b661df5de26..bc81026292fc 100644
--- a/drivers/clk/qcom/gcc-sc7280.c
+++ b/drivers/clk/qcom/gcc-sc7280.c
@@ -3467,6 +3467,9 @@ static int gcc_sc7280_probe(struct platform_device *pdev)
 	regmap_update_bits(regmap, 0x71004, BIT(0), BIT(0));
 	regmap_update_bits(regmap, 0x7100C, BIT(13), BIT(13));
 
+	/* FORCE_MEM_CORE_ON for ufs phy ice core clocks */
+	qcom_branch_set_force_mem_core(regmap, gcc_ufs_phy_ice_core_clk, true);
+
 	ret = qcom_cc_register_rcg_dfs(regmap, gcc_dfs_clocks,
 			ARRAY_SIZE(gcc_dfs_clocks));
 	if (ret)
diff --git a/drivers/clk/qcom/gpucc-sa8775p.c b/drivers/clk/qcom/gpucc-sa8775p.c
index 26ecfa63be19..0d9a8379efaa 100644
--- a/drivers/clk/qcom/gpucc-sa8775p.c
+++ b/drivers/clk/qcom/gpucc-sa8775p.c
@@ -1,6 +1,6 @@
 // SPDX-License-Identifier: GPL-2.0-only
 /*
- * Copyright (c) 2021-2022, Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2022, 2024, Qualcomm Innovation Center, Inc. All rights reserved.
  * Copyright (c) 2023, Linaro Limited
  */
 
@@ -161,7 +161,7 @@ static struct clk_rcg2 gpu_cc_ff_clk_src = {
 		.name = "gpu_cc_ff_clk_src",
 		.parent_data = gpu_cc_parent_data_0,
 		.num_parents = ARRAY_SIZE(gpu_cc_parent_data_0),
-		.ops = &clk_rcg2_ops,
+		.ops = &clk_rcg2_shared_ops,
 	},
 };
 
@@ -181,7 +181,7 @@ static struct clk_rcg2 gpu_cc_gmu_clk_src = {
 		.parent_data = gpu_cc_parent_data_1,
 		.num_parents = ARRAY_SIZE(gpu_cc_parent_data_1),
 		.flags = CLK_SET_RATE_PARENT,
-		.ops = &clk_rcg2_ops,
+		.ops = &clk_rcg2_shared_ops,
 	},
 };
 
@@ -200,7 +200,7 @@ static struct clk_rcg2 gpu_cc_hub_clk_src = {
 		.name = "gpu_cc_hub_clk_src",
 		.parent_data = gpu_cc_parent_data_2,
 		.num_parents = ARRAY_SIZE(gpu_cc_parent_data_2),
-		.ops = &clk_rcg2_ops,
+		.ops = &clk_rcg2_shared_ops,
 	},
 };
 
@@ -280,7 +280,7 @@ static struct clk_branch gpu_cc_ahb_clk = {
 				&gpu_cc_hub_ahb_div_clk_src.clkr.hw,
 			},
 			.num_parents = 1,
-			.flags = CLK_SET_RATE_PARENT | CLK_IS_CRITICAL,
+			.flags = CLK_SET_RATE_PARENT,
 			.ops = &clk_branch2_ops,
 		},
 	},
@@ -294,8 +294,7 @@ static struct clk_branch gpu_cc_cb_clk = {
 		.enable_mask = BIT(0),
 		.hw.init = &(const struct clk_init_data){
 			.name = "gpu_cc_cb_clk",
-			.flags = CLK_IS_CRITICAL,
-			.ops = &clk_branch2_ops,
+			.ops = &clk_branch2_aon_ops,
 		},
 	},
 };
@@ -312,7 +311,7 @@ static struct clk_branch gpu_cc_crc_ahb_clk = {
 				&gpu_cc_hub_ahb_div_clk_src.clkr.hw,
 			},
 			.num_parents = 1,
-			.flags = CLK_SET_RATE_PARENT | CLK_IS_CRITICAL,
+			.flags = CLK_SET_RATE_PARENT,
 			.ops = &clk_branch2_ops,
 		},
 	},
@@ -330,7 +329,7 @@ static struct clk_branch gpu_cc_cx_ff_clk = {
 				&gpu_cc_ff_clk_src.clkr.hw,
 			},
 			.num_parents = 1,
-			.flags = CLK_SET_RATE_PARENT | CLK_IS_CRITICAL,
+			.flags = CLK_SET_RATE_PARENT,
 			.ops = &clk_branch2_ops,
 		},
 	},
@@ -348,7 +347,7 @@ static struct clk_branch gpu_cc_cx_gmu_clk = {
 				&gpu_cc_gmu_clk_src.clkr.hw,
 			},
 			.num_parents = 1,
-			.flags =  CLK_SET_RATE_PARENT | CLK_IS_CRITICAL,
+			.flags =  CLK_SET_RATE_PARENT,
 			.ops = &clk_branch2_aon_ops,
 		},
 	},
@@ -362,7 +361,6 @@ static struct clk_branch gpu_cc_cx_snoc_dvm_clk = {
 		.enable_mask = BIT(0),
 		.hw.init = &(const struct clk_init_data){
 			.name = "gpu_cc_cx_snoc_dvm_clk",
-			.flags = CLK_IS_CRITICAL,
 			.ops = &clk_branch2_ops,
 		},
 	},
@@ -380,7 +378,7 @@ static struct clk_branch gpu_cc_cxo_aon_clk = {
 				&gpu_cc_xo_clk_src.clkr.hw,
 			},
 			.num_parents = 1,
-			.flags = CLK_SET_RATE_PARENT | CLK_IS_CRITICAL,
+			.flags = CLK_SET_RATE_PARENT,
 			.ops = &clk_branch2_ops,
 		},
 	},
@@ -398,7 +396,7 @@ static struct clk_branch gpu_cc_cxo_clk = {
 				&gpu_cc_xo_clk_src.clkr.hw,
 			},
 			.num_parents = 1,
-			.flags =  CLK_SET_RATE_PARENT | CLK_IS_CRITICAL,
+			.flags =  CLK_SET_RATE_PARENT,
 			.ops = &clk_branch2_ops,
 		},
 	},
@@ -416,7 +414,7 @@ static struct clk_branch gpu_cc_demet_clk = {
 				&gpu_cc_demet_div_clk_src.clkr.hw,
 			},
 			.num_parents = 1,
-			.flags = CLK_SET_RATE_PARENT | CLK_IS_CRITICAL,
+			.flags = CLK_SET_RATE_PARENT,
 			.ops = &clk_branch2_aon_ops,
 		},
 	},
@@ -430,7 +428,6 @@ static struct clk_branch gpu_cc_hlos1_vote_gpu_smmu_clk = {
 		.enable_mask = BIT(0),
 		.hw.init = &(const struct clk_init_data){
 			.name = "gpu_cc_hlos1_vote_gpu_smmu_clk",
-			.flags = CLK_IS_CRITICAL,
 			.ops = &clk_branch2_ops,
 		},
 	},
@@ -448,7 +445,7 @@ static struct clk_branch gpu_cc_hub_aon_clk = {
 				&gpu_cc_hub_clk_src.clkr.hw,
 			},
 			.num_parents = 1,
-			.flags = CLK_SET_RATE_PARENT | CLK_IS_CRITICAL,
+			.flags = CLK_SET_RATE_PARENT,
 			.ops = &clk_branch2_aon_ops,
 		},
 	},
@@ -466,7 +463,7 @@ static struct clk_branch gpu_cc_hub_cx_int_clk = {
 				&gpu_cc_hub_cx_int_div_clk_src.clkr.hw,
 			},
 			.num_parents = 1,
-			.flags =  CLK_SET_RATE_PARENT | CLK_IS_CRITICAL,
+			.flags =  CLK_SET_RATE_PARENT,
 			.ops = &clk_branch2_aon_ops,
 		},
 	},
@@ -480,7 +477,6 @@ static struct clk_branch gpu_cc_memnoc_gfx_clk = {
 		.enable_mask = BIT(0),
 		.hw.init = &(const struct clk_init_data){
 			.name = "gpu_cc_memnoc_gfx_clk",
-			.flags = CLK_IS_CRITICAL,
 			.ops = &clk_branch2_ops,
 		},
 	},
@@ -494,7 +490,6 @@ static struct clk_branch gpu_cc_sleep_clk = {
 		.enable_mask = BIT(0),
 		.hw.init = &(const struct clk_init_data){
 			.name = "gpu_cc_sleep_clk",
-			.flags = CLK_IS_CRITICAL,
 			.ops = &clk_branch2_ops,
 		},
 	},
@@ -528,16 +523,22 @@ static struct clk_regmap *gpu_cc_sa8775p_clocks[] = {
 
 static struct gdsc cx_gdsc = {
 	.gdscr = 0x9108,
+	.en_rest_wait_val = 0x2,
+	.en_few_wait_val = 0x2,
+	.clk_dis_wait_val = 0xf,
 	.gds_hw_ctrl = 0x953c,
 	.pd = {
 		.name = "cx_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
-	.flags = VOTABLE | RETAIN_FF_ENABLE | ALWAYS_ON,
+	.flags = VOTABLE | RETAIN_FF_ENABLE,
 };
 
 static struct gdsc gx_gdsc = {
 	.gdscr = 0x905c,
+	.en_rest_wait_val = 0x2,
+	.en_few_wait_val = 0x2,
+	.clk_dis_wait_val = 0xf,
 	.pd = {
 		.name = "gx_gdsc",
 		.power_on = gdsc_gx_do_nothing_enable,
diff --git a/drivers/clk/qcom/gpucc-sm8350.c b/drivers/clk/qcom/gpucc-sm8350.c
index 8dc54dff983f..33c4fb8891ca 100644
--- a/drivers/clk/qcom/gpucc-sm8350.c
+++ b/drivers/clk/qcom/gpucc-sm8350.c
@@ -2,6 +2,7 @@
 /*
  * Copyright (c) 2019-2020, The Linux Foundation. All rights reserved.
  * Copyright (c) 2022, Linaro Limited
+ * Copyright (c) 2024, Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #include <linux/clk.h>
@@ -147,7 +148,7 @@ static struct clk_rcg2 gpu_cc_gmu_clk_src = {
 		.parent_data = gpu_cc_parent_data_0,
 		.num_parents = ARRAY_SIZE(gpu_cc_parent_data_0),
 		.flags = CLK_SET_RATE_PARENT,
-		.ops = &clk_rcg2_ops,
+		.ops = &clk_rcg2_shared_ops,
 	},
 };
 
@@ -169,7 +170,7 @@ static struct clk_rcg2 gpu_cc_hub_clk_src = {
 		.parent_data = gpu_cc_parent_data_1,
 		.num_parents = ARRAY_SIZE(gpu_cc_parent_data_1),
 		.flags = CLK_SET_RATE_PARENT,
-		.ops = &clk_rcg2_ops,
+		.ops = &clk_rcg2_shared_ops,
 	},
 };
 
diff --git a/drivers/clk/qcom/kpss-xcc.c b/drivers/clk/qcom/kpss-xcc.c
index 97358c98c6c9..d8c1f2b41eeb 100644
--- a/drivers/clk/qcom/kpss-xcc.c
+++ b/drivers/clk/qcom/kpss-xcc.c
@@ -63,9 +63,7 @@ static int kpss_xcc_driver_probe(struct platform_device *pdev)
 	if (IS_ERR(hw))
 		return PTR_ERR(hw);
 
-	of_clk_add_hw_provider(dev->of_node, of_clk_hw_simple_get, hw);
-
-	return 0;
+	return of_clk_add_hw_provider(dev->of_node, of_clk_hw_simple_get, hw);
 }
 
 static struct platform_driver kpss_xcc_driver = {
diff --git a/drivers/cpufreq/amd-pstate.c b/drivers/cpufreq/amd-pstate.c
index 3efc2aef31ce..23c74e9f04c4 100644
--- a/drivers/cpufreq/amd-pstate.c
+++ b/drivers/cpufreq/amd-pstate.c
@@ -175,6 +175,26 @@ static int amd_pstate_get_energy_pref_index(struct amd_cpudata *cpudata)
 	return index;
 }
 
+static void pstate_update_perf(struct amd_cpudata *cpudata, u32 min_perf,
+			       u32 des_perf, u32 max_perf, bool fast_switch)
+{
+	if (fast_switch)
+		wrmsrl(MSR_AMD_CPPC_REQ, READ_ONCE(cpudata->cppc_req_cached));
+	else
+		wrmsrl_on_cpu(cpudata->cpu, MSR_AMD_CPPC_REQ,
+			      READ_ONCE(cpudata->cppc_req_cached));
+}
+
+DEFINE_STATIC_CALL(amd_pstate_update_perf, pstate_update_perf);
+
+static inline void amd_pstate_update_perf(struct amd_cpudata *cpudata,
+					  u32 min_perf, u32 des_perf,
+					  u32 max_perf, bool fast_switch)
+{
+	static_call(amd_pstate_update_perf)(cpudata, min_perf, des_perf,
+					    max_perf, fast_switch);
+}
+
 static int amd_pstate_set_epp(struct amd_cpudata *cpudata, u32 epp)
 {
 	int ret;
@@ -191,6 +211,9 @@ static int amd_pstate_set_epp(struct amd_cpudata *cpudata, u32 epp)
 		if (!ret)
 			cpudata->epp_cached = epp;
 	} else {
+		amd_pstate_update_perf(cpudata, cpudata->min_limit_perf, 0U,
+					     cpudata->max_limit_perf, false);
+
 		perf_ctrls.energy_perf = epp;
 		ret = cppc_set_epp_perf(cpudata->cpu, &perf_ctrls, 1);
 		if (ret) {
@@ -361,16 +384,6 @@ static inline int amd_pstate_init_perf(struct amd_cpudata *cpudata)
 	return static_call(amd_pstate_init_perf)(cpudata);
 }
 
-static void pstate_update_perf(struct amd_cpudata *cpudata, u32 min_perf,
-			       u32 des_perf, u32 max_perf, bool fast_switch)
-{
-	if (fast_switch)
-		wrmsrl(MSR_AMD_CPPC_REQ, READ_ONCE(cpudata->cppc_req_cached));
-	else
-		wrmsrl_on_cpu(cpudata->cpu, MSR_AMD_CPPC_REQ,
-			      READ_ONCE(cpudata->cppc_req_cached));
-}
-
 static void cppc_update_perf(struct amd_cpudata *cpudata,
 			     u32 min_perf, u32 des_perf,
 			     u32 max_perf, bool fast_switch)
@@ -384,16 +397,6 @@ static void cppc_update_perf(struct amd_cpudata *cpudata,
 	cppc_set_perf(cpudata->cpu, &perf_ctrls);
 }
 
-DEFINE_STATIC_CALL(amd_pstate_update_perf, pstate_update_perf);
-
-static inline void amd_pstate_update_perf(struct amd_cpudata *cpudata,
-					  u32 min_perf, u32 des_perf,
-					  u32 max_perf, bool fast_switch)
-{
-	static_call(amd_pstate_update_perf)(cpudata, min_perf, des_perf,
-					    max_perf, fast_switch);
-}
-
 static inline bool amd_pstate_sample(struct amd_cpudata *cpudata)
 {
 	u64 aperf, mperf, tsc;
diff --git a/drivers/cpufreq/ti-cpufreq.c b/drivers/cpufreq/ti-cpufreq.c
index 3c37d7899660..d88ee87b1cd6 100644
--- a/drivers/cpufreq/ti-cpufreq.c
+++ b/drivers/cpufreq/ti-cpufreq.c
@@ -418,7 +418,7 @@ static int ti_cpufreq_probe(struct platform_device *pdev)
 
 	ret = dev_pm_opp_set_config(opp_data->cpu_dev, &config);
 	if (ret < 0) {
-		dev_err(opp_data->cpu_dev, "Failed to set OPP config\n");
+		dev_err_probe(opp_data->cpu_dev, ret, "Failed to set OPP config\n");
 		goto fail_put_node;
 	}
 
diff --git a/drivers/crypto/intel/qat/qat_common/adf_cfg.c b/drivers/crypto/intel/qat/qat_common/adf_cfg.c
index 8836f015c39c..2cf102ad4ca8 100644
--- a/drivers/crypto/intel/qat/qat_common/adf_cfg.c
+++ b/drivers/crypto/intel/qat/qat_common/adf_cfg.c
@@ -290,17 +290,19 @@ int adf_cfg_add_key_value_param(struct adf_accel_dev *accel_dev,
 	 * 3. if the key exists with the same value, then return without doing
 	 *    anything (the newly created key_val is freed).
 	 */
+	down_write(&cfg->lock);
 	if (!adf_cfg_key_val_get(accel_dev, section_name, key, temp_val)) {
 		if (strncmp(temp_val, key_val->val, sizeof(temp_val))) {
 			adf_cfg_keyval_remove(key, section);
 		} else {
 			kfree(key_val);
-			return 0;
+			goto out;
 		}
 	}
 
-	down_write(&cfg->lock);
 	adf_cfg_keyval_add(key_val, section);
+
+out:
 	up_write(&cfg->lock);
 	return 0;
 }
diff --git a/drivers/dma/ti/k3-udma.c b/drivers/dma/ti/k3-udma.c
index 037f1408e798..02a1ab04f498 100644
--- a/drivers/dma/ti/k3-udma.c
+++ b/drivers/dma/ti/k3-udma.c
@@ -4470,7 +4470,9 @@ static int udma_get_mmrs(struct platform_device *pdev, struct udma_dev *ud)
 		ud->rchan_cnt = UDMA_CAP2_RCHAN_CNT(cap2);
 		break;
 	case DMA_TYPE_BCDMA:
-		ud->bchan_cnt = BCDMA_CAP2_BCHAN_CNT(cap2);
+		ud->bchan_cnt = BCDMA_CAP2_BCHAN_CNT(cap2) +
+				BCDMA_CAP3_HBCHAN_CNT(cap3) +
+				BCDMA_CAP3_UBCHAN_CNT(cap3);
 		ud->tchan_cnt = BCDMA_CAP2_TCHAN_CNT(cap2);
 		ud->rchan_cnt = BCDMA_CAP2_RCHAN_CNT(cap2);
 		ud->rflow_cnt = ud->rchan_cnt;
diff --git a/drivers/edac/Makefile b/drivers/edac/Makefile
index 61945d3113cc..446364264e2b 100644
--- a/drivers/edac/Makefile
+++ b/drivers/edac/Makefile
@@ -54,11 +54,13 @@ obj-$(CONFIG_EDAC_MPC85XX)		+= mpc85xx_edac_mod.o
 layerscape_edac_mod-y			:= fsl_ddr_edac.o layerscape_edac.o
 obj-$(CONFIG_EDAC_LAYERSCAPE)		+= layerscape_edac_mod.o
 
-skx_edac-y				:= skx_common.o skx_base.o
-obj-$(CONFIG_EDAC_SKX)			+= skx_edac.o
+skx_edac_common-y			:= skx_common.o
 
-i10nm_edac-y				:= skx_common.o i10nm_base.o
-obj-$(CONFIG_EDAC_I10NM)		+= i10nm_edac.o
+skx_edac-y				:= skx_base.o
+obj-$(CONFIG_EDAC_SKX)			+= skx_edac.o skx_edac_common.o
+
+i10nm_edac-y				:= i10nm_base.o
+obj-$(CONFIG_EDAC_I10NM)		+= i10nm_edac.o skx_edac_common.o
 
 obj-$(CONFIG_EDAC_CELL)			+= cell_edac.o
 obj-$(CONFIG_EDAC_PPC4XX)		+= ppc4xx_edac.o
diff --git a/drivers/edac/skx_common.c b/drivers/edac/skx_common.c
index ce3e0069e028..03d7a74ca22d 100644
--- a/drivers/edac/skx_common.c
+++ b/drivers/edac/skx_common.c
@@ -48,7 +48,7 @@ static u64 skx_tolm, skx_tohm;
 static LIST_HEAD(dev_edac_list);
 static bool skx_mem_cfg_2lm;
 
-int __init skx_adxl_get(void)
+int skx_adxl_get(void)
 {
 	const char * const *names;
 	int i, j;
@@ -110,12 +110,14 @@ int __init skx_adxl_get(void)
 
 	return -ENODEV;
 }
+EXPORT_SYMBOL_GPL(skx_adxl_get);
 
-void __exit skx_adxl_put(void)
+void skx_adxl_put(void)
 {
 	kfree(adxl_values);
 	kfree(adxl_msg);
 }
+EXPORT_SYMBOL_GPL(skx_adxl_put);
 
 static bool skx_adxl_decode(struct decoded_addr *res, bool error_in_1st_level_mem)
 {
@@ -187,12 +189,14 @@ void skx_set_mem_cfg(bool mem_cfg_2lm)
 {
 	skx_mem_cfg_2lm = mem_cfg_2lm;
 }
+EXPORT_SYMBOL_GPL(skx_set_mem_cfg);
 
 void skx_set_decode(skx_decode_f decode, skx_show_retry_log_f show_retry_log)
 {
 	driver_decode = decode;
 	skx_show_retry_rd_err_log = show_retry_log;
 }
+EXPORT_SYMBOL_GPL(skx_set_decode);
 
 int skx_get_src_id(struct skx_dev *d, int off, u8 *id)
 {
@@ -206,6 +210,7 @@ int skx_get_src_id(struct skx_dev *d, int off, u8 *id)
 	*id = GET_BITFIELD(reg, 12, 14);
 	return 0;
 }
+EXPORT_SYMBOL_GPL(skx_get_src_id);
 
 int skx_get_node_id(struct skx_dev *d, u8 *id)
 {
@@ -219,6 +224,7 @@ int skx_get_node_id(struct skx_dev *d, u8 *id)
 	*id = GET_BITFIELD(reg, 0, 2);
 	return 0;
 }
+EXPORT_SYMBOL_GPL(skx_get_node_id);
 
 static int get_width(u32 mtr)
 {
@@ -284,6 +290,7 @@ int skx_get_all_bus_mappings(struct res_config *cfg, struct list_head **list)
 		*list = &dev_edac_list;
 	return ndev;
 }
+EXPORT_SYMBOL_GPL(skx_get_all_bus_mappings);
 
 int skx_get_hi_lo(unsigned int did, int off[], u64 *tolm, u64 *tohm)
 {
@@ -323,6 +330,7 @@ int skx_get_hi_lo(unsigned int did, int off[], u64 *tolm, u64 *tohm)
 	pci_dev_put(pdev);
 	return -ENODEV;
 }
+EXPORT_SYMBOL_GPL(skx_get_hi_lo);
 
 static int skx_get_dimm_attr(u32 reg, int lobit, int hibit, int add,
 			     int minval, int maxval, const char *name)
@@ -394,6 +402,7 @@ int skx_get_dimm_info(u32 mtr, u32 mcmtr, u32 amap, struct dimm_info *dimm,
 
 	return 1;
 }
+EXPORT_SYMBOL_GPL(skx_get_dimm_info);
 
 int skx_get_nvdimm_info(struct dimm_info *dimm, struct skx_imc *imc,
 			int chan, int dimmno, const char *mod_str)
@@ -442,6 +451,7 @@ int skx_get_nvdimm_info(struct dimm_info *dimm, struct skx_imc *imc,
 
 	return (size == 0 || size == ~0ull) ? 0 : 1;
 }
+EXPORT_SYMBOL_GPL(skx_get_nvdimm_info);
 
 int skx_register_mci(struct skx_imc *imc, struct pci_dev *pdev,
 		     const char *ctl_name, const char *mod_str,
@@ -512,6 +522,7 @@ int skx_register_mci(struct skx_imc *imc, struct pci_dev *pdev,
 	imc->mci = NULL;
 	return rc;
 }
+EXPORT_SYMBOL_GPL(skx_register_mci);
 
 static void skx_unregister_mci(struct skx_imc *imc)
 {
@@ -684,6 +695,7 @@ int skx_mce_check_error(struct notifier_block *nb, unsigned long val,
 	mce->kflags |= MCE_HANDLED_EDAC;
 	return NOTIFY_DONE;
 }
+EXPORT_SYMBOL_GPL(skx_mce_check_error);
 
 void skx_remove(void)
 {
@@ -721,3 +733,8 @@ void skx_remove(void)
 		kfree(d);
 	}
 }
+EXPORT_SYMBOL_GPL(skx_remove);
+
+MODULE_LICENSE("GPL v2");
+MODULE_AUTHOR("Tony Luck");
+MODULE_DESCRIPTION("MC Driver for Intel server processors");
diff --git a/drivers/edac/skx_common.h b/drivers/edac/skx_common.h
index b6d3607dffe2..11faf1db4fa4 100644
--- a/drivers/edac/skx_common.h
+++ b/drivers/edac/skx_common.h
@@ -231,8 +231,8 @@ typedef int (*get_dimm_config_f)(struct mem_ctl_info *mci,
 typedef bool (*skx_decode_f)(struct decoded_addr *res);
 typedef void (*skx_show_retry_log_f)(struct decoded_addr *res, char *msg, int len, bool scrub_err);
 
-int __init skx_adxl_get(void);
-void __exit skx_adxl_put(void);
+int skx_adxl_get(void);
+void skx_adxl_put(void);
 void skx_set_decode(skx_decode_f decode, skx_show_retry_log_f show_retry_log);
 void skx_set_mem_cfg(bool mem_cfg_2lm);
 
diff --git a/drivers/firmware/efi/libstub/screen_info.c b/drivers/firmware/efi/libstub/screen_info.c
index a51ec201ca3c..5d3a1e32d177 100644
--- a/drivers/firmware/efi/libstub/screen_info.c
+++ b/drivers/firmware/efi/libstub/screen_info.c
@@ -32,6 +32,8 @@ struct screen_info *__alloc_screen_info(void)
 	if (status != EFI_SUCCESS)
 		return NULL;
 
+	memset(si, 0, sizeof(*si));
+
 	status = efi_bs_call(install_configuration_table,
 			     &screen_info_guid, si);
 	if (status == EFI_SUCCESS)
diff --git a/drivers/firmware/efi/libstub/x86-stub.c b/drivers/firmware/efi/libstub/x86-stub.c
index 8e9f2ddfbe46..b2b06d18b7b4 100644
--- a/drivers/firmware/efi/libstub/x86-stub.c
+++ b/drivers/firmware/efi/libstub/x86-stub.c
@@ -469,11 +469,12 @@ void __noreturn efi_stub_entry(efi_handle_t handle,
 efi_status_t __efiapi efi_pe_entry(efi_handle_t handle,
 				   efi_system_table_t *sys_table_arg)
 {
-	static struct boot_params boot_params __page_aligned_bss;
-	struct setup_header *hdr = &boot_params.hdr;
 	efi_guid_t proto = LOADED_IMAGE_PROTOCOL_GUID;
+	struct boot_params *boot_params;
+	struct setup_header *hdr;
 	int options_size = 0;
 	efi_status_t status;
+	unsigned long alloc;
 	char *cmdline_ptr;
 
 	if (efi_is_native())
@@ -491,6 +492,13 @@ efi_status_t __efiapi efi_pe_entry(efi_handle_t handle,
 		efi_exit(handle, status);
 	}
 
+	status = efi_allocate_pages(PARAM_SIZE, &alloc, ULONG_MAX);
+	if (status != EFI_SUCCESS)
+		efi_exit(handle, status);
+
+	boot_params = memset((void *)alloc, 0x0, PARAM_SIZE);
+	hdr	    = &boot_params->hdr;
+
 	/* Assign the setup_header fields that the kernel actually cares about */
 	hdr->root_flags	= 1;
 	hdr->vid_mode	= 0xffff;
@@ -500,17 +508,16 @@ efi_status_t __efiapi efi_pe_entry(efi_handle_t handle,
 
 	/* Convert unicode cmdline to ascii */
 	cmdline_ptr = efi_convert_cmdline(image, &options_size);
-	if (!cmdline_ptr)
-		goto fail;
+	if (!cmdline_ptr) {
+		efi_free(PARAM_SIZE, alloc);
+		efi_exit(handle, EFI_OUT_OF_RESOURCES);
+	}
 
 	efi_set_u64_split((unsigned long)cmdline_ptr, &hdr->cmd_line_ptr,
-			  &boot_params.ext_cmd_line_ptr);
+			  &boot_params->ext_cmd_line_ptr);
 
-	efi_stub_entry(handle, sys_table_arg, &boot_params);
+	efi_stub_entry(handle, sys_table_arg, boot_params);
 	/* not reached */
-
-fail:
-	efi_exit(handle, status);
 }
 
 static void add_e820ext(struct boot_params *params,
diff --git a/drivers/firmware/turris-mox-rwtm.c b/drivers/firmware/turris-mox-rwtm.c
index 2de0fb139ce1..3d354ebd38c2 100644
--- a/drivers/firmware/turris-mox-rwtm.c
+++ b/drivers/firmware/turris-mox-rwtm.c
@@ -2,7 +2,7 @@
 /*
  * Turris Mox rWTM firmware driver
  *
- * Copyright (C) 2019 Marek Behún <kabel@...nel.org>
+ * Copyright (C) 2019, 2024 Marek Behún <kabel@...nel.org>
  */
 
 #include <linux/armada-37xx-rwtm-mailbox.h>
@@ -174,6 +174,9 @@ static void mox_rwtm_rx_callback(struct mbox_client *cl, void *data)
 	struct mox_rwtm *rwtm = dev_get_drvdata(cl->dev);
 	struct armada_37xx_rwtm_rx_msg *msg = data;
 
+	if (completion_done(&rwtm->cmd_done))
+		return;
+
 	rwtm->reply = *msg;
 	complete(&rwtm->cmd_done);
 }
@@ -199,9 +202,8 @@ static int mox_get_board_info(struct mox_rwtm *rwtm)
 	if (ret < 0)
 		return ret;
 
-	ret = wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2);
-	if (ret < 0)
-		return ret;
+	if (!wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2))
+		return -ETIMEDOUT;
 
 	ret = mox_get_status(MBOX_CMD_BOARD_INFO, reply->retval);
 	if (ret == -ENODATA) {
@@ -235,9 +237,8 @@ static int mox_get_board_info(struct mox_rwtm *rwtm)
 	if (ret < 0)
 		return ret;
 
-	ret = wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2);
-	if (ret < 0)
-		return ret;
+	if (!wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2))
+		return -ETIMEDOUT;
 
 	ret = mox_get_status(MBOX_CMD_ECDSA_PUB_KEY, reply->retval);
 	if (ret == -ENODATA) {
@@ -274,9 +275,8 @@ static int check_get_random_support(struct mox_rwtm *rwtm)
 	if (ret < 0)
 		return ret;
 
-	ret = wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2);
-	if (ret < 0)
-		return ret;
+	if (!wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2))
+		return -ETIMEDOUT;
 
 	return mox_get_status(MBOX_CMD_GET_RANDOM, rwtm->reply.retval);
 }
@@ -499,6 +499,7 @@ static int turris_mox_rwtm_probe(struct platform_device *pdev)
 	platform_set_drvdata(pdev, rwtm);
 
 	mutex_init(&rwtm->busy);
+	init_completion(&rwtm->cmd_done);
 
 	rwtm->mbox_client.dev = dev;
 	rwtm->mbox_client.rx_callback = mox_rwtm_rx_callback;
@@ -512,8 +513,6 @@ static int turris_mox_rwtm_probe(struct platform_device *pdev)
 		goto remove_files;
 	}
 
-	init_completion(&rwtm->cmd_done);
-
 	ret = mox_get_board_info(rwtm);
 	if (ret < 0)
 		dev_warn(dev, "Cannot read board information: %i\n", ret);
diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c
index e1227b7c71b1..ea1bce13db94 100644
--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c
+++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c
@@ -5645,7 +5645,7 @@ int amdgpu_device_baco_exit(struct drm_device *dev)
 	    adev->nbio.funcs->enable_doorbell_interrupt)
 		adev->nbio.funcs->enable_doorbell_interrupt(adev, true);
 
-	if (amdgpu_passthrough(adev) &&
+	if (amdgpu_passthrough(adev) && adev->nbio.funcs &&
 	    adev->nbio.funcs->clear_doorbell_interrupt)
 		adev->nbio.funcs->clear_doorbell_interrupt(adev);
 
diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c
index bc0eda1a729c..0b6a0e149f1c 100644
--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c
+++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c
@@ -650,7 +650,6 @@ void amdgpu_gmc_noretry_set(struct amdgpu_device *adev)
 	struct amdgpu_gmc *gmc = &adev->gmc;
 	uint32_t gc_ver = adev->ip_versions[GC_HWIP][0];
 	bool noretry_default = (gc_ver == IP_VERSION(9, 0, 1) ||
-				gc_ver == IP_VERSION(9, 3, 0) ||
 				gc_ver == IP_VERSION(9, 4, 0) ||
 				gc_ver == IP_VERSION(9, 4, 1) ||
 				gc_ver == IP_VERSION(9, 4, 2) ||
diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_vm.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_vm.c
index f5e78b0c08f7..f02b6232680f 100644
--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_vm.c
+++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_vm.c
@@ -418,7 +418,7 @@ uint64_t amdgpu_vm_generation(struct amdgpu_device *adev, struct amdgpu_vm *vm)
 	if (!vm)
 		return result;
 
-	result += vm->generation;
+	result += lower_32_bits(vm->generation);
 	/* Add one if the page tables will be re-generated on next CS */
 	if (drm_sched_entity_error(&vm->delayed))
 		++result;
@@ -443,13 +443,14 @@ int amdgpu_vm_validate_pt_bos(struct amdgpu_device *adev, struct amdgpu_vm *vm,
 			      int (*validate)(void *p, struct amdgpu_bo *bo),
 			      void *param)
 {
+	uint64_t new_vm_generation = amdgpu_vm_generation(adev, vm);
 	struct amdgpu_vm_bo_base *bo_base;
 	struct amdgpu_bo *shadow;
 	struct amdgpu_bo *bo;
 	int r;
 
-	if (drm_sched_entity_error(&vm->delayed)) {
-		++vm->generation;
+	if (vm->generation != new_vm_generation) {
+		vm->generation = new_vm_generation;
 		amdgpu_vm_bo_reset_state_machine(vm);
 		amdgpu_vm_fini_entities(vm);
 		r = amdgpu_vm_init_entities(adev, vm);
@@ -2192,7 +2193,7 @@ int amdgpu_vm_init(struct amdgpu_device *adev, struct amdgpu_vm *vm,
 	vm->last_update = dma_fence_get_stub();
 	vm->last_unlocked = dma_fence_get_stub();
 	vm->last_tlb_flush = dma_fence_get_stub();
-	vm->generation = 0;
+	vm->generation = amdgpu_vm_generation(adev, NULL);
 
 	mutex_init(&vm->eviction_lock);
 	vm->evicting = false;
diff --git a/drivers/gpu/drm/amd/amdgpu/gmc_v9_0.c b/drivers/gpu/drm/amd/amdgpu/gmc_v9_0.c
index 8ace3f6210d3..6d2b9d260d92 100644
--- a/drivers/gpu/drm/amd/amdgpu/gmc_v9_0.c
+++ b/drivers/gpu/drm/amd/amdgpu/gmc_v9_0.c
@@ -1949,7 +1949,7 @@ gmc_v9_0_init_sw_mem_ranges(struct amdgpu_device *adev,
 		break;
 	}
 
-	size = adev->gmc.real_vram_size >> AMDGPU_GPU_PAGE_SHIFT;
+	size = (adev->gmc.real_vram_size + SZ_16M) >> AMDGPU_GPU_PAGE_SHIFT;
 	size /= adev->gmc.num_mem_partitions;
 
 	for (i = 0; i < adev->gmc.num_mem_partitions; ++i) {
diff --git a/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c b/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c
index 72b18156debb..47d4840c6275 100644
--- a/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c
+++ b/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c
@@ -188,6 +188,14 @@ static void sdma_v5_2_ring_set_wptr(struct amdgpu_ring *ring)
 		DRM_DEBUG("calling WDOORBELL64(0x%08x, 0x%016llx)\n",
 				ring->doorbell_index, ring->wptr << 2);
 		WDOORBELL64(ring->doorbell_index, ring->wptr << 2);
+		/* SDMA seems to miss doorbells sometimes when powergating kicks in.
+		 * Updating the wptr directly will wake it. This is only safe because
+		 * we disallow gfxoff in begin_use() and then allow it again in end_use().
+		 */
+		WREG32(sdma_v5_2_get_reg_offset(adev, ring->me, mmSDMA0_GFX_RB_WPTR),
+		       lower_32_bits(ring->wptr << 2));
+		WREG32(sdma_v5_2_get_reg_offset(adev, ring->me, mmSDMA0_GFX_RB_WPTR_HI),
+		       upper_32_bits(ring->wptr << 2));
 	} else {
 		DRM_DEBUG("Not using doorbell -- "
 				"mmSDMA%i_GFX_RB_WPTR == 0x%08x "
@@ -1666,6 +1674,10 @@ static void sdma_v5_2_ring_begin_use(struct amdgpu_ring *ring)
 	 * but it shouldn't hurt for other parts since
 	 * this GFXOFF will be disallowed anyway when SDMA is
 	 * active, this just makes it explicit.
+	 * sdma_v5_2_ring_set_wptr() takes advantage of this
+	 * to update the wptr because sometimes SDMA seems to miss
+	 * doorbells when entering PG.  If you remove this, update
+	 * sdma_v5_2_ring_set_wptr() as well!
 	 */
 	amdgpu_gfx_off_ctrl(adev, false);
 }
diff --git a/drivers/gpu/drm/amd/amdgpu/smu_v13_0_10.c b/drivers/gpu/drm/amd/amdgpu/smu_v13_0_10.c
index ae29620b1ea4..a7cef33a2a3d 100644
--- a/drivers/gpu/drm/amd/amdgpu/smu_v13_0_10.c
+++ b/drivers/gpu/drm/amd/amdgpu/smu_v13_0_10.c
@@ -92,7 +92,7 @@ static int smu_v13_0_10_mode2_suspend_ip(struct amdgpu_device *adev)
 		adev->ip_blocks[i].status.hw = false;
 	}
 
-	return r;
+	return 0;
 }
 
 static int
diff --git a/drivers/gpu/drm/amd/amdkfd/kfd_mqd_manager_v9.c b/drivers/gpu/drm/amd/amdkfd/kfd_mqd_manager_v9.c
index 42d881809dc7..1ac66c5337df 100644
--- a/drivers/gpu/drm/amd/amdkfd/kfd_mqd_manager_v9.c
+++ b/drivers/gpu/drm/amd/amdkfd/kfd_mqd_manager_v9.c
@@ -686,7 +686,7 @@ static void update_mqd_v9_4_3(struct mqd_manager *mm, void *mqd,
 		m = get_mqd(mqd + size * xcc);
 		update_mqd(mm, m, q, minfo);
 
-		update_cu_mask(mm, mqd, minfo, xcc);
+		update_cu_mask(mm, m, minfo, xcc);
 
 		if (q->format == KFD_QUEUE_FORMAT_AQL) {
 			switch (xcc) {
diff --git a/drivers/gpu/drm/amd/display/dc/core/dc_surface.c b/drivers/gpu/drm/amd/display/dc/core/dc_surface.c
index a80e45300783..f4f3ca7aad60 100644
--- a/drivers/gpu/drm/amd/display/dc/core/dc_surface.c
+++ b/drivers/gpu/drm/amd/display/dc/core/dc_surface.c
@@ -154,7 +154,8 @@ const struct dc_plane_status *dc_plane_get_status(
 		if (pipe_ctx->plane_state != plane_state)
 			continue;
 
-		pipe_ctx->plane_state->status.is_flip_pending = false;
+		if (pipe_ctx->plane_state)
+			pipe_ctx->plane_state->status.is_flip_pending = false;
 
 		break;
 	}
diff --git a/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c b/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c
index c097aed4722b..c0adfa46ac78 100644
--- a/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c
+++ b/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c
@@ -79,8 +79,8 @@ MODULE_FIRMWARE("amdgpu/smu_13_0_10.bin");
 #define PCIE_LC_LINK_WIDTH_CNTL__LC_LINK_WIDTH_RD_MASK 0x00000070L
 #define PCIE_LC_LINK_WIDTH_CNTL__LC_LINK_WIDTH_RD__SHIFT 0x4
 #define smnPCIE_LC_SPEED_CNTL			0x11140290
-#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE_MASK 0xC000
-#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE__SHIFT 0xE
+#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE_MASK 0xE0
+#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE__SHIFT 0x5
 
 static const int link_width[] = {0, 1, 2, 4, 8, 12, 16};
 
diff --git a/drivers/gpu/drm/arm/display/komeda/komeda_crtc.c b/drivers/gpu/drm/arm/display/komeda/komeda_crtc.c
index 2c661f28410e..b645c5998230 100644
--- a/drivers/gpu/drm/arm/display/komeda/komeda_crtc.c
+++ b/drivers/gpu/drm/arm/display/komeda/komeda_crtc.c
@@ -5,6 +5,7 @@
  *
  */
 #include <linux/clk.h>
+#include <linux/of.h>
 #include <linux/pm_runtime.h>
 #include <linux/spinlock.h>
 
@@ -610,12 +611,34 @@ get_crtc_primary(struct komeda_kms_dev *kms, struct komeda_crtc *crtc)
 	return NULL;
 }
 
+static int komeda_attach_bridge(struct device *dev,
+				struct komeda_pipeline *pipe,
+				struct drm_encoder *encoder)
+{
+	struct drm_bridge *bridge;
+	int err;
+
+	bridge = devm_drm_of_get_bridge(dev, pipe->of_node,
+					KOMEDA_OF_PORT_OUTPUT, 0);
+	if (IS_ERR(bridge))
+		return dev_err_probe(dev, PTR_ERR(bridge), "remote bridge not found for pipe: %s\n",
+				     of_node_full_name(pipe->of_node));
+
+	err = drm_bridge_attach(encoder, bridge, NULL, 0);
+	if (err)
+		dev_err(dev, "bridge_attach() failed for pipe: %s\n",
+			of_node_full_name(pipe->of_node));
+
+	return err;
+}
+
 static int komeda_crtc_add(struct komeda_kms_dev *kms,
 			   struct komeda_crtc *kcrtc)
 {
 	struct drm_crtc *crtc = &kcrtc->base;
 	struct drm_device *base = &kms->base;
-	struct drm_bridge *bridge;
+	struct komeda_pipeline *pipe = kcrtc->master;
+	struct drm_encoder *encoder = &kcrtc->encoder;
 	int err;
 
 	err = drm_crtc_init_with_planes(base, crtc,
@@ -626,27 +649,25 @@ static int komeda_crtc_add(struct komeda_kms_dev *kms,
 
 	drm_crtc_helper_add(crtc, &komeda_crtc_helper_funcs);
 
-	crtc->port = kcrtc->master->of_output_port;
+	crtc->port = pipe->of_output_port;
 
 	/* Construct an encoder for each pipeline and attach it to the remote
 	 * bridge
 	 */
 	kcrtc->encoder.possible_crtcs = drm_crtc_mask(crtc);
-	err = drm_simple_encoder_init(base, &kcrtc->encoder,
-				      DRM_MODE_ENCODER_TMDS);
+	err = drm_simple_encoder_init(base, encoder, DRM_MODE_ENCODER_TMDS);
 	if (err)
 		return err;
 
-	bridge = devm_drm_of_get_bridge(base->dev, kcrtc->master->of_node,
-					KOMEDA_OF_PORT_OUTPUT, 0);
-	if (IS_ERR(bridge))
-		return PTR_ERR(bridge);
-
-	err = drm_bridge_attach(&kcrtc->encoder, bridge, NULL, 0);
+	if (pipe->of_output_links[0]) {
+		err = komeda_attach_bridge(base->dev, pipe, encoder);
+		if (err)
+			return err;
+	}
 
 	drm_crtc_enable_color_mgmt(crtc, 0, true, KOMEDA_COLOR_LUT_SIZE);
 
-	return err;
+	return 0;
 }
 
 int komeda_kms_add_crtcs(struct komeda_kms_dev *kms, struct komeda_dev *mdev)
diff --git a/drivers/gpu/drm/bridge/ite-it6505.c b/drivers/gpu/drm/bridge/ite-it6505.c
index 2f300f5ca051..4ad527fe04f2 100644
--- a/drivers/gpu/drm/bridge/ite-it6505.c
+++ b/drivers/gpu/drm/bridge/ite-it6505.c
@@ -1306,9 +1306,15 @@ static void it6505_video_reset(struct it6505 *it6505)
 	it6505_link_reset_step_train(it6505);
 	it6505_set_bits(it6505, REG_DATA_MUTE_CTRL, EN_VID_MUTE, EN_VID_MUTE);
 	it6505_set_bits(it6505, REG_INFOFRAME_CTRL, EN_VID_CTRL_PKT, 0x00);
-	it6505_set_bits(it6505, REG_RESET_CTRL, VIDEO_RESET, VIDEO_RESET);
+
+	it6505_set_bits(it6505, REG_VID_BUS_CTRL1, TX_FIFO_RESET, TX_FIFO_RESET);
+	it6505_set_bits(it6505, REG_VID_BUS_CTRL1, TX_FIFO_RESET, 0x00);
+
 	it6505_set_bits(it6505, REG_501_FIFO_CTRL, RST_501_FIFO, RST_501_FIFO);
 	it6505_set_bits(it6505, REG_501_FIFO_CTRL, RST_501_FIFO, 0x00);
+
+	it6505_set_bits(it6505, REG_RESET_CTRL, VIDEO_RESET, VIDEO_RESET);
+	usleep_range(1000, 2000);
 	it6505_set_bits(it6505, REG_RESET_CTRL, VIDEO_RESET, 0x00);
 }
 
@@ -2240,14 +2246,15 @@ static void it6505_link_training_work(struct work_struct *work)
 	ret = it6505_link_start_auto_train(it6505);
 	DRM_DEV_DEBUG_DRIVER(dev, "auto train %s, auto_train_retry: %d",
 			     ret ? "pass" : "failed", it6505->auto_train_retry);
-	it6505->auto_train_retry--;
 
 	if (ret) {
+		it6505->auto_train_retry = AUTO_TRAIN_RETRY;
 		it6505_link_train_ok(it6505);
-		return;
+	} else {
+		it6505->auto_train_retry--;
+		it6505_dump(it6505);
 	}
 
-	it6505_dump(it6505);
 }
 
 static void it6505_plugged_status_to_codec(struct it6505 *it6505)
@@ -2468,31 +2475,53 @@ static void it6505_irq_link_train_fail(struct it6505 *it6505)
 	schedule_work(&it6505->link_works);
 }
 
-static void it6505_irq_video_fifo_error(struct it6505 *it6505)
+static bool it6505_test_bit(unsigned int bit, const unsigned int *addr)
 {
-	struct device *dev = it6505->dev;
-
-	DRM_DEV_DEBUG_DRIVER(dev, "video fifo overflow interrupt");
-	it6505->auto_train_retry = AUTO_TRAIN_RETRY;
-	flush_work(&it6505->link_works);
-	it6505_stop_hdcp(it6505);
-	it6505_video_reset(it6505);
+	return 1 & (addr[bit / BITS_PER_BYTE] >> (bit % BITS_PER_BYTE));
 }
 
-static void it6505_irq_io_latch_fifo_overflow(struct it6505 *it6505)
+static void it6505_irq_video_handler(struct it6505 *it6505, const int *int_status)
 {
 	struct device *dev = it6505->dev;
+	int reg_0d, reg_int03;
 
-	DRM_DEV_DEBUG_DRIVER(dev, "IO latch fifo overflow interrupt");
-	it6505->auto_train_retry = AUTO_TRAIN_RETRY;
-	flush_work(&it6505->link_works);
-	it6505_stop_hdcp(it6505);
-	it6505_video_reset(it6505);
-}
+	/*
+	 * When video SCDT change with video not stable,
+	 * Or video FIFO error, need video reset
+	 */
 
-static bool it6505_test_bit(unsigned int bit, const unsigned int *addr)
-{
-	return 1 & (addr[bit / BITS_PER_BYTE] >> (bit % BITS_PER_BYTE));
+	if ((!it6505_get_video_status(it6505) &&
+	     (it6505_test_bit(INT_SCDT_CHANGE, (unsigned int *)int_status))) ||
+	    (it6505_test_bit(BIT_INT_IO_FIFO_OVERFLOW,
+			     (unsigned int *)int_status)) ||
+	    (it6505_test_bit(BIT_INT_VID_FIFO_ERROR,
+			     (unsigned int *)int_status))) {
+		it6505->auto_train_retry = AUTO_TRAIN_RETRY;
+		flush_work(&it6505->link_works);
+		it6505_stop_hdcp(it6505);
+		it6505_video_reset(it6505);
+
+		usleep_range(10000, 11000);
+
+		/*
+		 * Clear FIFO error IRQ to prevent fifo error -> reset loop
+		 * HW will trigger SCDT change IRQ again when video stable
+		 */
+
+		reg_int03 = it6505_read(it6505, INT_STATUS_03);
+		reg_0d = it6505_read(it6505, REG_SYSTEM_STS);
+
+		reg_int03 &= (BIT(INT_VID_FIFO_ERROR) | BIT(INT_IO_LATCH_FIFO_OVERFLOW));
+		it6505_write(it6505, INT_STATUS_03, reg_int03);
+
+		DRM_DEV_DEBUG_DRIVER(dev, "reg08 = 0x%02x", reg_int03);
+		DRM_DEV_DEBUG_DRIVER(dev, "reg0D = 0x%02x", reg_0d);
+
+		return;
+	}
+
+	if (it6505_test_bit(INT_SCDT_CHANGE, (unsigned int *)int_status))
+		it6505_irq_scdt(it6505);
 }
 
 static irqreturn_t it6505_int_threaded_handler(int unused, void *data)
@@ -2505,15 +2534,12 @@ static irqreturn_t it6505_int_threaded_handler(int unused, void *data)
 	} irq_vec[] = {
 		{ BIT_INT_HPD, it6505_irq_hpd },
 		{ BIT_INT_HPD_IRQ, it6505_irq_hpd_irq },
-		{ BIT_INT_SCDT, it6505_irq_scdt },
 		{ BIT_INT_HDCP_FAIL, it6505_irq_hdcp_fail },
 		{ BIT_INT_HDCP_DONE, it6505_irq_hdcp_done },
 		{ BIT_INT_AUX_CMD_FAIL, it6505_irq_aux_cmd_fail },
 		{ BIT_INT_HDCP_KSV_CHECK, it6505_irq_hdcp_ksv_check },
 		{ BIT_INT_AUDIO_FIFO_ERROR, it6505_irq_audio_fifo_error },
 		{ BIT_INT_LINK_TRAIN_FAIL, it6505_irq_link_train_fail },
-		{ BIT_INT_VID_FIFO_ERROR, it6505_irq_video_fifo_error },
-		{ BIT_INT_IO_FIFO_OVERFLOW, it6505_irq_io_latch_fifo_overflow },
 	};
 	int int_status[3], i;
 
@@ -2543,6 +2569,7 @@ static irqreturn_t it6505_int_threaded_handler(int unused, void *data)
 			if (it6505_test_bit(irq_vec[i].bit, (unsigned int *)int_status))
 				irq_vec[i].handler(it6505);
 		}
+		it6505_irq_video_handler(it6505, (unsigned int *)int_status);
 	}
 
 	pm_runtime_put_sync(dev);
diff --git a/drivers/gpu/drm/display/drm_dp_mst_topology.c b/drivers/gpu/drm/display/drm_dp_mst_topology.c
index 6d169c83b062..9023c0216a8a 100644
--- a/drivers/gpu/drm/display/drm_dp_mst_topology.c
+++ b/drivers/gpu/drm/display/drm_dp_mst_topology.c
@@ -2923,7 +2923,7 @@ static int drm_dp_send_link_address(struct drm_dp_mst_topology_mgr *mgr,
 
 	/* FIXME: Actually do some real error handling here */
 	ret = drm_dp_mst_wait_tx_reply(mstb, txmsg);
-	if (ret <= 0) {
+	if (ret < 0) {
 		drm_err(mgr->dev, "Sending link address failed with %d\n", ret);
 		goto out;
 	}
@@ -2975,7 +2975,7 @@ static int drm_dp_send_link_address(struct drm_dp_mst_topology_mgr *mgr,
 	mutex_unlock(&mgr->lock);
 
 out:
-	if (ret <= 0)
+	if (ret < 0)
 		mstb->link_address_sent = false;
 	kfree(txmsg);
 	return ret < 0 ? ret : changed;
diff --git a/drivers/gpu/drm/etnaviv/etnaviv_gem.c b/drivers/gpu/drm/etnaviv/etnaviv_gem.c
index b5f73502e3dd..69fccbcd92c6 100644
--- a/drivers/gpu/drm/etnaviv/etnaviv_gem.c
+++ b/drivers/gpu/drm/etnaviv/etnaviv_gem.c
@@ -356,9 +356,11 @@ static void *etnaviv_gem_vmap_impl(struct etnaviv_gem_object *obj)
 
 static inline enum dma_data_direction etnaviv_op_to_dma_dir(u32 op)
 {
-	if (op & ETNA_PREP_READ)
+	op &= ETNA_PREP_READ | ETNA_PREP_WRITE;
+
+	if (op == ETNA_PREP_READ)
 		return DMA_FROM_DEVICE;
-	else if (op & ETNA_PREP_WRITE)
+	else if (op == ETNA_PREP_WRITE)
 		return DMA_TO_DEVICE;
 	else
 		return DMA_BIDIRECTIONAL;
diff --git a/drivers/gpu/drm/etnaviv/etnaviv_sched.c b/drivers/gpu/drm/etnaviv/etnaviv_sched.c
index 345fec6cb1a4..97e406d9ac06 100644
--- a/drivers/gpu/drm/etnaviv/etnaviv_sched.c
+++ b/drivers/gpu/drm/etnaviv/etnaviv_sched.c
@@ -38,9 +38,6 @@ static enum drm_gpu_sched_stat etnaviv_sched_timedout_job(struct drm_sched_job
 	u32 dma_addr;
 	int change;
 
-	/* block scheduler */
-	drm_sched_stop(&gpu->sched, sched_job);
-
 	/*
 	 * If the GPU managed to complete this jobs fence, the timout is
 	 * spurious. Bail out.
@@ -63,6 +60,9 @@ static enum drm_gpu_sched_stat etnaviv_sched_timedout_job(struct drm_sched_job
 		goto out_no_timeout;
 	}
 
+	/* block scheduler */
+	drm_sched_stop(&gpu->sched, sched_job);
+
 	if(sched_job)
 		drm_sched_increase_karma(sched_job);
 
@@ -76,8 +76,7 @@ static enum drm_gpu_sched_stat etnaviv_sched_timedout_job(struct drm_sched_job
 	return DRM_GPU_SCHED_STAT_NOMINAL;
 
 out_no_timeout:
-	/* restart scheduler after GPU is usable again */
-	drm_sched_start(&gpu->sched, true);
+	list_add(&sched_job->list, &sched_job->sched->pending_list);
 	return DRM_GPU_SCHED_STAT_NOMINAL;
 }
 
diff --git a/drivers/gpu/drm/gma500/cdv_intel_lvds.c b/drivers/gpu/drm/gma500/cdv_intel_lvds.c
index f08a6803dc18..3adc2c9ab72d 100644
--- a/drivers/gpu/drm/gma500/cdv_intel_lvds.c
+++ b/drivers/gpu/drm/gma500/cdv_intel_lvds.c
@@ -311,6 +311,9 @@ static int cdv_intel_lvds_get_modes(struct drm_connector *connector)
 	if (mode_dev->panel_fixed_mode != NULL) {
 		struct drm_display_mode *mode =
 		    drm_mode_duplicate(dev, mode_dev->panel_fixed_mode);
+		if (!mode)
+			return 0;
+
 		drm_mode_probed_add(connector, mode);
 		return 1;
 	}
diff --git a/drivers/gpu/drm/gma500/psb_intel_lvds.c b/drivers/gpu/drm/gma500/psb_intel_lvds.c
index 8486de230ec9..8d1be94a443b 100644
--- a/drivers/gpu/drm/gma500/psb_intel_lvds.c
+++ b/drivers/gpu/drm/gma500/psb_intel_lvds.c
@@ -504,6 +504,9 @@ static int psb_intel_lvds_get_modes(struct drm_connector *connector)
 	if (mode_dev->panel_fixed_mode != NULL) {
 		struct drm_display_mode *mode =
 		    drm_mode_duplicate(dev, mode_dev->panel_fixed_mode);
+		if (!mode)
+			return 0;
+
 		drm_mode_probed_add(connector, mode);
 		return 1;
 	}
diff --git a/drivers/gpu/drm/i915/display/intel_dp.c b/drivers/gpu/drm/i915/display/intel_dp.c
index 2936a6c02d6a..c8b6d0f79c9b 100644
--- a/drivers/gpu/drm/i915/display/intel_dp.c
+++ b/drivers/gpu/drm/i915/display/intel_dp.c
@@ -4374,6 +4374,8 @@ int intel_dp_retrain_link(struct intel_encoder *encoder,
 		    !intel_dp_mst_is_master_trans(crtc_state))
 			continue;
 
+		intel_dp->link_trained = false;
+
 		intel_dp_check_frl_training(intel_dp);
 		intel_dp_pcon_dsc_configure(intel_dp, crtc_state);
 		intel_dp_start_link_train(intel_dp, crtc_state);
diff --git a/drivers/gpu/drm/i915/display/intel_dp_link_training.c b/drivers/gpu/drm/i915/display/intel_dp_link_training.c
index a62bca622b0a..eb5559e1a200 100644
--- a/drivers/gpu/drm/i915/display/intel_dp_link_training.c
+++ b/drivers/gpu/drm/i915/display/intel_dp_link_training.c
@@ -114,10 +114,24 @@ intel_dp_set_lttpr_transparent_mode(struct intel_dp *intel_dp, bool enable)
 	return drm_dp_dpcd_write(&intel_dp->aux, DP_PHY_REPEATER_MODE, &val, 1) == 1;
 }
 
-static int intel_dp_init_lttpr(struct intel_dp *intel_dp, const u8 dpcd[DP_RECEIVER_CAP_SIZE])
+static bool intel_dp_lttpr_transparent_mode_enabled(struct intel_dp *intel_dp)
+{
+	return intel_dp->lttpr_common_caps[DP_PHY_REPEATER_MODE -
+					   DP_LT_TUNABLE_PHY_REPEATER_FIELD_DATA_STRUCTURE_REV] ==
+		DP_PHY_REPEATER_MODE_TRANSPARENT;
+}
+
+/*
+ * Read the LTTPR common capabilities and switch the LTTPR PHYs to
+ * non-transparent mode if this is supported. Preserve the
+ * transparent/non-transparent mode on an active link.
+ *
+ * Return the number of detected LTTPRs in non-transparent mode or 0 if the
+ * LTTPRs are in transparent mode or the detection failed.
+ */
+static int intel_dp_init_lttpr_phys(struct intel_dp *intel_dp, const u8 dpcd[DP_RECEIVER_CAP_SIZE])
 {
 	int lttpr_count;
-	int i;
 
 	if (!intel_dp_read_lttpr_common_caps(intel_dp, dpcd))
 		return 0;
@@ -131,6 +145,19 @@ static int intel_dp_init_lttpr(struct intel_dp *intel_dp, const u8 dpcd[DP_RECEI
 	if (lttpr_count == 0)
 		return 0;
 
+	/*
+	 * Don't change the mode on an active link, to prevent a loss of link
+	 * synchronization. See DP Standard v2.0 3.6.7. about the LTTPR
+	 * resetting its internal state when the mode is changed from
+	 * non-transparent to transparent.
+	 */
+	if (intel_dp->link_trained) {
+		if (lttpr_count < 0 || intel_dp_lttpr_transparent_mode_enabled(intel_dp))
+			goto out_reset_lttpr_count;
+
+		return lttpr_count;
+	}
+
 	/*
 	 * See DP Standard v2.0 3.6.6.1. about the explicit disabling of
 	 * non-transparent mode and the disable->enable non-transparent mode
@@ -151,11 +178,25 @@ static int intel_dp_init_lttpr(struct intel_dp *intel_dp, const u8 dpcd[DP_RECEI
 		       "Switching to LTTPR non-transparent LT mode failed, fall-back to transparent mode\n");
 
 		intel_dp_set_lttpr_transparent_mode(intel_dp, true);
-		intel_dp_reset_lttpr_count(intel_dp);
 
-		return 0;
+		goto out_reset_lttpr_count;
 	}
 
+	return lttpr_count;
+
+out_reset_lttpr_count:
+	intel_dp_reset_lttpr_count(intel_dp);
+
+	return 0;
+}
+
+static int intel_dp_init_lttpr(struct intel_dp *intel_dp, const u8 dpcd[DP_RECEIVER_CAP_SIZE])
+{
+	int lttpr_count;
+	int i;
+
+	lttpr_count = intel_dp_init_lttpr_phys(intel_dp, dpcd);
+
 	for (i = 0; i < lttpr_count; i++)
 		intel_dp_read_lttpr_phy_caps(intel_dp, dpcd, DP_PHY_LTTPR(i));
 
@@ -1353,10 +1394,10 @@ void intel_dp_start_link_train(struct intel_dp *intel_dp,
 {
 	struct drm_i915_private *i915 = dp_to_i915(intel_dp);
 	bool passed;
-
 	/*
-	 * TODO: Reiniting LTTPRs here won't be needed once proper connector
-	 * HW state readout is added.
+	 * Reinit the LTTPRs here to ensure that they are switched to
+	 * non-transparent mode. During an earlier LTTPR detection this
+	 * could've been prevented by an active link.
 	 */
 	int lttpr_count = intel_dp_init_lttpr_and_dprx_caps(intel_dp);
 
diff --git a/drivers/gpu/drm/i915/gt/intel_execlists_submission.c b/drivers/gpu/drm/i915/gt/intel_execlists_submission.c
index 42e09f158920..2065be5a196b 100644
--- a/drivers/gpu/drm/i915/gt/intel_execlists_submission.c
+++ b/drivers/gpu/drm/i915/gt/intel_execlists_submission.c
@@ -3315,11 +3315,7 @@ static void remove_from_engine(struct i915_request *rq)
 
 static bool can_preempt(struct intel_engine_cs *engine)
 {
-	if (GRAPHICS_VER(engine->i915) > 8)
-		return true;
-
-	/* GPGPU on bdw requires extra w/a; not implemented */
-	return engine->class != RENDER_CLASS;
+	return GRAPHICS_VER(engine->i915) > 8;
 }
 
 static void kick_execlists(const struct i915_request *rq, int prio)
diff --git a/drivers/gpu/drm/mediatek/mtk_disp_ovl.c b/drivers/gpu/drm/mediatek/mtk_disp_ovl.c
index 2bffe4245466..6f15069da8b0 100644
--- a/drivers/gpu/drm/mediatek/mtk_disp_ovl.c
+++ b/drivers/gpu/drm/mediatek/mtk_disp_ovl.c
@@ -38,6 +38,7 @@
 #define DISP_REG_OVL_PITCH_MSB(n)		(0x0040 + 0x20 * (n))
 #define OVL_PITCH_MSB_2ND_SUBBUF			BIT(16)
 #define DISP_REG_OVL_PITCH(n)			(0x0044 + 0x20 * (n))
+#define OVL_CONST_BLEND					BIT(28)
 #define DISP_REG_OVL_RDMA_CTRL(n)		(0x00c0 + 0x20 * (n))
 #define DISP_REG_OVL_RDMA_GMC(n)		(0x00c8 + 0x20 * (n))
 #define DISP_REG_OVL_ADDR_MT2701		0x0040
@@ -71,6 +72,8 @@
 #define	OVL_CON_VIRT_FLIP	BIT(9)
 #define	OVL_CON_HORZ_FLIP	BIT(10)
 
+#define OVL_COLOR_ALPHA		GENMASK(31, 24)
+
 static const u32 mt8173_formats[] = {
 	DRM_FORMAT_XRGB8888,
 	DRM_FORMAT_ARGB8888,
@@ -273,7 +276,13 @@ void mtk_ovl_config(struct device *dev, unsigned int w,
 	if (w != 0 && h != 0)
 		mtk_ddp_write_relaxed(cmdq_pkt, h << 16 | w, &ovl->cmdq_reg, ovl->regs,
 				      DISP_REG_OVL_ROI_SIZE);
-	mtk_ddp_write_relaxed(cmdq_pkt, 0x0, &ovl->cmdq_reg, ovl->regs, DISP_REG_OVL_ROI_BGCLR);
+
+	/*
+	 * The background color must be opaque black (ARGB),
+	 * otherwise the alpha blending will have no effect
+	 */
+	mtk_ddp_write_relaxed(cmdq_pkt, OVL_COLOR_ALPHA, &ovl->cmdq_reg,
+			      ovl->regs, DISP_REG_OVL_ROI_BGCLR);
 
 	mtk_ddp_write(cmdq_pkt, 0x1, &ovl->cmdq_reg, ovl->regs, DISP_REG_OVL_RST);
 	mtk_ddp_write(cmdq_pkt, 0x0, &ovl->cmdq_reg, ovl->regs, DISP_REG_OVL_RST);
@@ -407,6 +416,7 @@ void mtk_ovl_layer_config(struct device *dev, unsigned int idx,
 	unsigned int fmt = pending->format;
 	unsigned int offset = (pending->y << 16) | pending->x;
 	unsigned int src_size = (pending->height << 16) | pending->width;
+	unsigned int ignore_pixel_alpha = 0;
 	unsigned int con;
 	bool is_afbc = pending->modifier != DRM_FORMAT_MOD_LINEAR;
 	union overlay_pitch {
@@ -428,6 +438,14 @@ void mtk_ovl_layer_config(struct device *dev, unsigned int idx,
 	if (state->base.fb && state->base.fb->format->has_alpha)
 		con |= OVL_CON_AEN | OVL_CON_ALPHA;
 
+	/* CONST_BLD must be enabled for XRGB formats although the alpha channel
+	 * can be ignored, or OVL will still read the value from memory.
+	 * For RGB888 related formats, whether CONST_BLD is enabled or not won't
+	 * affect the result. Therefore we use !has_alpha as the condition.
+	 */
+	if (state->base.fb && !state->base.fb->format->has_alpha)
+		ignore_pixel_alpha = OVL_CONST_BLEND;
+
 	if (pending->rotation & DRM_MODE_REFLECT_Y) {
 		con |= OVL_CON_VIRT_FLIP;
 		addr += (pending->height - 1) * pending->pitch;
@@ -443,8 +461,8 @@ void mtk_ovl_layer_config(struct device *dev, unsigned int idx,
 
 	mtk_ddp_write_relaxed(cmdq_pkt, con, &ovl->cmdq_reg, ovl->regs,
 			      DISP_REG_OVL_CON(idx));
-	mtk_ddp_write_relaxed(cmdq_pkt, overlay_pitch.split_pitch.lsb, &ovl->cmdq_reg, ovl->regs,
-			      DISP_REG_OVL_PITCH(idx));
+	mtk_ddp_write_relaxed(cmdq_pkt, overlay_pitch.split_pitch.lsb | ignore_pixel_alpha,
+			      &ovl->cmdq_reg, ovl->regs, DISP_REG_OVL_PITCH(idx));
 	mtk_ddp_write_relaxed(cmdq_pkt, src_size, &ovl->cmdq_reg, ovl->regs,
 			      DISP_REG_OVL_SRC_SIZE(idx));
 	mtk_ddp_write_relaxed(cmdq_pkt, offset, &ovl->cmdq_reg, ovl->regs,
diff --git a/drivers/gpu/drm/mediatek/mtk_disp_ovl_adaptor.c b/drivers/gpu/drm/mediatek/mtk_disp_ovl_adaptor.c
index 6bf6367853fb..8f0c47e86874 100644
--- a/drivers/gpu/drm/mediatek/mtk_disp_ovl_adaptor.c
+++ b/drivers/gpu/drm/mediatek/mtk_disp_ovl_adaptor.c
@@ -111,7 +111,7 @@ void mtk_ovl_adaptor_layer_config(struct device *dev, unsigned int idx,
 	merge = ovl_adaptor->ovl_adaptor_comp[OVL_ADAPTOR_MERGE0 + idx];
 	ethdr = ovl_adaptor->ovl_adaptor_comp[OVL_ADAPTOR_ETHDR0];
 
-	if (!pending->enable) {
+	if (!pending->enable || !pending->width || !pending->height) {
 		mtk_merge_stop_cmdq(merge, cmdq_pkt);
 		mtk_mdp_rdma_stop(rdma_l, cmdq_pkt);
 		mtk_mdp_rdma_stop(rdma_r, cmdq_pkt);
diff --git a/drivers/gpu/drm/mediatek/mtk_dp.c b/drivers/gpu/drm/mediatek/mtk_dp.c
index af03a22772fe..48a4defbc66c 100644
--- a/drivers/gpu/drm/mediatek/mtk_dp.c
+++ b/drivers/gpu/drm/mediatek/mtk_dp.c
@@ -2027,12 +2027,12 @@ static enum drm_connector_status mtk_dp_bdg_detect(struct drm_bridge *bridge)
 	return ret;
 }
 
-static struct edid *mtk_dp_get_edid(struct drm_bridge *bridge,
-				    struct drm_connector *connector)
+static const struct drm_edid *mtk_dp_edid_read(struct drm_bridge *bridge,
+					       struct drm_connector *connector)
 {
 	struct mtk_dp *mtk_dp = mtk_dp_from_bridge(bridge);
 	bool enabled = mtk_dp->enabled;
-	struct edid *new_edid = NULL;
+	const struct drm_edid *drm_edid;
 	struct mtk_dp_audio_cfg *audio_caps = &mtk_dp->info.audio_cur_cfg;
 
 	if (!enabled) {
@@ -2040,7 +2040,7 @@ static struct edid *mtk_dp_get_edid(struct drm_bridge *bridge,
 		mtk_dp_aux_panel_poweron(mtk_dp, true);
 	}
 
-	new_edid = drm_get_edid(connector, &mtk_dp->aux.ddc);
+	drm_edid = drm_edid_read_ddc(connector, &mtk_dp->aux.ddc);
 
 	/*
 	 * Parse capability here to let atomic_get_input_bus_fmts and
@@ -2048,17 +2048,32 @@ static struct edid *mtk_dp_get_edid(struct drm_bridge *bridge,
 	 */
 	if (mtk_dp_parse_capabilities(mtk_dp)) {
 		drm_err(mtk_dp->drm_dev, "Can't parse capabilities\n");
-		kfree(new_edid);
-		new_edid = NULL;
+		drm_edid_free(drm_edid);
+		drm_edid = NULL;
 	}
 
-	if (new_edid) {
+	if (drm_edid) {
+		/*
+		 * FIXME: get rid of drm_edid_raw()
+		 */
+		const struct edid *edid = drm_edid_raw(drm_edid);
 		struct cea_sad *sads;
+		int ret;
 
-		audio_caps->sad_count = drm_edid_to_sad(new_edid, &sads);
-		kfree(sads);
+		ret = drm_edid_to_sad(edid, &sads);
+		/* Ignore any errors */
+		if (ret < 0)
+			ret = 0;
+		if (ret)
+			kfree(sads);
+		audio_caps->sad_count = ret;
 
-		audio_caps->detect_monitor = drm_detect_monitor_audio(new_edid);
+		/*
+		 * FIXME: This should use connector->display_info.has_audio from
+		 * a path that has read the EDID and called
+		 * drm_edid_connector_update().
+		 */
+		audio_caps->detect_monitor = drm_detect_monitor_audio(edid);
 	}
 
 	if (!enabled) {
@@ -2066,7 +2081,7 @@ static struct edid *mtk_dp_get_edid(struct drm_bridge *bridge,
 		drm_atomic_bridge_chain_post_disable(bridge, connector->state->state);
 	}
 
-	return new_edid;
+	return drm_edid;
 }
 
 static ssize_t mtk_dp_aux_transfer(struct drm_dp_aux *mtk_aux,
@@ -2418,7 +2433,7 @@ static const struct drm_bridge_funcs mtk_dp_bridge_funcs = {
 	.atomic_enable = mtk_dp_bridge_atomic_enable,
 	.atomic_disable = mtk_dp_bridge_atomic_disable,
 	.mode_valid = mtk_dp_bridge_mode_valid,
-	.get_edid = mtk_dp_get_edid,
+	.edid_read = mtk_dp_edid_read,
 	.detect = mtk_dp_bdg_detect,
 };
 
diff --git a/drivers/gpu/drm/mediatek/mtk_drm_ddp_comp.c b/drivers/gpu/drm/mediatek/mtk_drm_ddp_comp.c
index 771f4e173353..66ccde966e3c 100644
--- a/drivers/gpu/drm/mediatek/mtk_drm_ddp_comp.c
+++ b/drivers/gpu/drm/mediatek/mtk_drm_ddp_comp.c
@@ -553,7 +553,7 @@ int mtk_ddp_comp_init(struct device_node *node, struct mtk_ddp_comp *comp,
 	int ret;
 #endif
 
-	if (comp_id < 0 || comp_id >= DDP_COMPONENT_DRM_ID_MAX)
+	if (comp_id >= DDP_COMPONENT_DRM_ID_MAX)
 		return -EINVAL;
 
 	type = mtk_ddp_matches[comp_id].type;
diff --git a/drivers/gpu/drm/mediatek/mtk_drm_drv.c b/drivers/gpu/drm/mediatek/mtk_drm_drv.c
index 37d8113ba92f..ffe016d6cbcf 100644
--- a/drivers/gpu/drm/mediatek/mtk_drm_drv.c
+++ b/drivers/gpu/drm/mediatek/mtk_drm_drv.c
@@ -719,6 +719,8 @@ static const struct of_device_id mtk_ddp_comp_dt_ids[] = {
 	  .data = (void *)MTK_DISP_OVL },
 	{ .compatible = "mediatek,mt8192-disp-ovl",
 	  .data = (void *)MTK_DISP_OVL },
+	{ .compatible = "mediatek,mt8195-disp-ovl",
+	  .data = (void *)MTK_DISP_OVL },
 	{ .compatible = "mediatek,mt8183-disp-ovl-2l",
 	  .data = (void *)MTK_DISP_OVL_2L },
 	{ .compatible = "mediatek,mt8192-disp-ovl-2l",
diff --git a/drivers/gpu/drm/mediatek/mtk_drm_plane.c b/drivers/gpu/drm/mediatek/mtk_drm_plane.c
index ddc9355b06d5..f10d4cc6c223 100644
--- a/drivers/gpu/drm/mediatek/mtk_drm_plane.c
+++ b/drivers/gpu/drm/mediatek/mtk_drm_plane.c
@@ -227,6 +227,8 @@ static void mtk_plane_atomic_async_update(struct drm_plane *plane,
 	plane->state->src_y = new_state->src_y;
 	plane->state->src_h = new_state->src_h;
 	plane->state->src_w = new_state->src_w;
+	plane->state->dst.x1 = new_state->dst.x1;
+	plane->state->dst.y1 = new_state->dst.y1;
 
 	mtk_plane_update_new_state(new_state, new_plane_state);
 	swap(plane->state->fb, new_state->fb);
diff --git a/drivers/gpu/drm/mediatek/mtk_ethdr.c b/drivers/gpu/drm/mediatek/mtk_ethdr.c
index db7ac666ec5e..0cf8c8899415 100644
--- a/drivers/gpu/drm/mediatek/mtk_ethdr.c
+++ b/drivers/gpu/drm/mediatek/mtk_ethdr.c
@@ -50,7 +50,6 @@
 
 #define MIXER_INX_MODE_BYPASS			0
 #define MIXER_INX_MODE_EVEN_EXTEND		1
-#define DEFAULT_9BIT_ALPHA			0x100
 #define	MIXER_ALPHA_AEN				BIT(8)
 #define	MIXER_ALPHA				0xff
 #define ETHDR_CLK_NUM				13
@@ -154,13 +153,19 @@ void mtk_ethdr_layer_config(struct device *dev, unsigned int idx,
 	unsigned int offset = (pending->x & 1) << 31 | pending->y << 16 | pending->x;
 	unsigned int align_width = ALIGN_DOWN(pending->width, 2);
 	unsigned int alpha_con = 0;
+	bool replace_src_a = false;
 
 	dev_dbg(dev, "%s+ idx:%d", __func__, idx);
 
 	if (idx >= 4)
 		return;
 
-	if (!pending->enable) {
+	if (!pending->enable || !pending->width || !pending->height) {
+		/*
+		 * instead of disabling layer with MIX_SRC_CON directly
+		 * set the size to 0 to avoid screen shift due to mixer
+		 * mode switch (hardware behavior)
+		 */
 		mtk_ddp_write(cmdq_pkt, 0, &mixer->cmdq_base, mixer->regs, MIX_L_SRC_SIZE(idx));
 		return;
 	}
@@ -168,8 +173,16 @@ void mtk_ethdr_layer_config(struct device *dev, unsigned int idx,
 	if (state->base.fb && state->base.fb->format->has_alpha)
 		alpha_con = MIXER_ALPHA_AEN | MIXER_ALPHA;
 
-	mtk_mmsys_mixer_in_config(priv->mmsys_dev, idx + 1, alpha_con ? false : true,
-				  DEFAULT_9BIT_ALPHA,
+	if (state->base.fb && !state->base.fb->format->has_alpha) {
+		/*
+		 * Mixer doesn't support CONST_BLD mode,
+		 * use a trick to make the output equivalent
+		 */
+		replace_src_a = true;
+	}
+
+	mtk_mmsys_mixer_in_config(priv->mmsys_dev, idx + 1, replace_src_a,
+				  MIXER_ALPHA,
 				  pending->x & 1 ? MIXER_INX_MODE_EVEN_EXTEND :
 				  MIXER_INX_MODE_BYPASS, align_width / 2 - 1, cmdq_pkt);
 
diff --git a/drivers/gpu/drm/meson/meson_drv.c b/drivers/gpu/drm/meson/meson_drv.c
index cb674966e9ac..095f634ff7c7 100644
--- a/drivers/gpu/drm/meson/meson_drv.c
+++ b/drivers/gpu/drm/meson/meson_drv.c
@@ -250,29 +250,20 @@ static int meson_drv_bind_master(struct device *dev, bool has_components)
 	if (ret)
 		goto free_drm;
 	ret = meson_canvas_alloc(priv->canvas, &priv->canvas_id_vd1_0);
-	if (ret) {
-		meson_canvas_free(priv->canvas, priv->canvas_id_osd1);
-		goto free_drm;
-	}
+	if (ret)
+		goto free_canvas_osd1;
 	ret = meson_canvas_alloc(priv->canvas, &priv->canvas_id_vd1_1);
-	if (ret) {
-		meson_canvas_free(priv->canvas, priv->canvas_id_osd1);
-		meson_canvas_free(priv->canvas, priv->canvas_id_vd1_0);
-		goto free_drm;
-	}
+	if (ret)
+		goto free_canvas_vd1_0;
 	ret = meson_canvas_alloc(priv->canvas, &priv->canvas_id_vd1_2);
-	if (ret) {
-		meson_canvas_free(priv->canvas, priv->canvas_id_osd1);
-		meson_canvas_free(priv->canvas, priv->canvas_id_vd1_0);
-		meson_canvas_free(priv->canvas, priv->canvas_id_vd1_1);
-		goto free_drm;
-	}
+	if (ret)
+		goto free_canvas_vd1_1;
 
 	priv->vsync_irq = platform_get_irq(pdev, 0);
 
 	ret = drm_vblank_init(drm, 1);
 	if (ret)
-		goto free_drm;
+		goto free_canvas_vd1_2;
 
 	/* Assign limits per soc revision/package */
 	for (i = 0 ; i < ARRAY_SIZE(meson_drm_soc_attrs) ; ++i) {
@@ -288,11 +279,11 @@ static int meson_drv_bind_master(struct device *dev, bool has_components)
 	 */
 	ret = drm_aperture_remove_framebuffers(&meson_driver);
 	if (ret)
-		goto free_drm;
+		goto free_canvas_vd1_2;
 
 	ret = drmm_mode_config_init(drm);
 	if (ret)
-		goto free_drm;
+		goto free_canvas_vd1_2;
 	drm->mode_config.max_width = 3840;
 	drm->mode_config.max_height = 2160;
 	drm->mode_config.funcs = &meson_mode_config_funcs;
@@ -307,7 +298,7 @@ static int meson_drv_bind_master(struct device *dev, bool has_components)
 	if (priv->afbcd.ops) {
 		ret = priv->afbcd.ops->init(priv);
 		if (ret)
-			goto free_drm;
+			goto free_canvas_vd1_2;
 	}
 
 	/* Encoder Initialization */
@@ -371,6 +362,14 @@ static int meson_drv_bind_master(struct device *dev, bool has_components)
 exit_afbcd:
 	if (priv->afbcd.ops)
 		priv->afbcd.ops->exit(priv);
+free_canvas_vd1_2:
+	meson_canvas_free(priv->canvas, priv->canvas_id_vd1_2);
+free_canvas_vd1_1:
+	meson_canvas_free(priv->canvas, priv->canvas_id_vd1_1);
+free_canvas_vd1_0:
+	meson_canvas_free(priv->canvas, priv->canvas_id_vd1_0);
+free_canvas_osd1:
+	meson_canvas_free(priv->canvas, priv->canvas_id_osd1);
 free_drm:
 	drm_dev_put(drm);
 
diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
index 5fb7e2e10801..e454b8090712 100644
--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
+++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
@@ -1672,8 +1672,7 @@ void dpu_encoder_trigger_kickoff_pending(struct drm_encoder *drm_enc)
 		phys = dpu_enc->phys_encs[i];
 
 		ctl = phys->hw_ctl;
-		if (ctl->ops.clear_pending_flush)
-			ctl->ops.clear_pending_flush(ctl);
+		ctl->ops.clear_pending_flush(ctl);
 
 		/* update only for command mode primary ctl */
 		if ((phys == dpu_enc->cur_master) &&
diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c
index 870a1f5060e3..a81a9ee71a86 100644
--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c
+++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c
@@ -528,8 +528,7 @@ static void dpu_encoder_phys_wb_disable(struct dpu_encoder_phys *phys_enc)
 	}
 
 	/* reset h/w before final flush */
-	if (phys_enc->hw_ctl->ops.clear_pending_flush)
-		phys_enc->hw_ctl->ops.clear_pending_flush(phys_enc->hw_ctl);
+	phys_enc->hw_ctl->ops.clear_pending_flush(phys_enc->hw_ctl);
 
 	/*
 	 * New CTL reset sequence from 5.0 MDP onwards.
diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h b/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h
index 1c242298ff2e..dca87ea78e25 100644
--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h
+++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h
@@ -81,7 +81,8 @@ struct dpu_hw_ctl_ops {
 
 	/**
 	 * Clear the value of the cached pending_flush_mask
-	 * No effect on hardware
+	 * No effect on hardware.
+	 * Required to be implemented.
 	 * @ctx       : ctl path ctx pointer
 	 */
 	void (*clear_pending_flush)(struct dpu_hw_ctl *ctx);
diff --git a/drivers/gpu/drm/msm/dsi/dsi_host.c b/drivers/gpu/drm/msm/dsi/dsi_host.c
index ab393bdaba6c..77b805eacb1b 100644
--- a/drivers/gpu/drm/msm/dsi/dsi_host.c
+++ b/drivers/gpu/drm/msm/dsi/dsi_host.c
@@ -832,6 +832,7 @@ static void dsi_update_dsc_timing(struct msm_dsi_host *msm_host, bool is_cmd_mod
 	u32 slice_per_intf, total_bytes_per_intf;
 	u32 pkt_per_line;
 	u32 eol_byte_num;
+	u32 bytes_per_pkt;
 
 	/* first calculate dsc parameters and then program
 	 * compress mode registers
@@ -839,6 +840,7 @@ static void dsi_update_dsc_timing(struct msm_dsi_host *msm_host, bool is_cmd_mod
 	slice_per_intf = msm_dsc_get_slices_per_intf(dsc, hdisplay);
 
 	total_bytes_per_intf = dsc->slice_chunk_size * slice_per_intf;
+	bytes_per_pkt = dsc->slice_chunk_size; /* * slice_per_pkt; */
 
 	eol_byte_num = total_bytes_per_intf % 3;
 
@@ -876,6 +878,7 @@ static void dsi_update_dsc_timing(struct msm_dsi_host *msm_host, bool is_cmd_mod
 		dsi_write(msm_host, REG_DSI_COMMAND_COMPRESSION_MODE_CTRL, reg_ctrl);
 		dsi_write(msm_host, REG_DSI_COMMAND_COMPRESSION_MODE_CTRL2, reg_ctrl2);
 	} else {
+		reg |= DSI_VIDEO_COMPRESSION_MODE_CTRL_WC(bytes_per_pkt);
 		dsi_write(msm_host, REG_DSI_VIDEO_COMPRESSION_MODE_CTRL, reg);
 	}
 }
diff --git a/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c b/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c
index 7990c519a56b..cfa5b54ed6fe 100644
--- a/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c
+++ b/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c
@@ -1847,7 +1847,11 @@ static int boe_panel_prepare(struct drm_panel *panel)
 	usleep_range(10000, 11000);
 
 	if (boe->desc->lp11_before_reset) {
-		mipi_dsi_dcs_nop(boe->dsi);
+		ret = mipi_dsi_dcs_nop(boe->dsi);
+		if (ret < 0) {
+			dev_err(&boe->dsi->dev, "Failed to send NOP: %d\n", ret);
+			goto poweroff;
+		}
 		usleep_range(1000, 2000);
 	}
 	gpiod_set_value(boe->enable_gpio, 1);
@@ -1868,13 +1872,13 @@ static int boe_panel_prepare(struct drm_panel *panel)
 	return 0;
 
 poweroff:
+	gpiod_set_value(boe->enable_gpio, 0);
 	regulator_disable(boe->avee);
 poweroffavdd:
 	regulator_disable(boe->avdd);
 poweroff1v8:
 	usleep_range(5000, 7000);
 	regulator_disable(boe->pp1800);
-	gpiod_set_value(boe->enable_gpio, 0);
 
 	return ret;
 }
diff --git a/drivers/gpu/drm/panel/panel-himax-hx8394.c b/drivers/gpu/drm/panel/panel-himax-hx8394.c
index c73243d85de7..631420d28be4 100644
--- a/drivers/gpu/drm/panel/panel-himax-hx8394.c
+++ b/drivers/gpu/drm/panel/panel-himax-hx8394.c
@@ -234,8 +234,7 @@ static int hx8394_enable(struct drm_panel *panel)
 
 sleep_in:
 	/* This will probably fail, but let's try orderly power off anyway. */
-	ret = mipi_dsi_dcs_enter_sleep_mode(dsi);
-	if (!ret)
+	if (!mipi_dsi_dcs_enter_sleep_mode(dsi))
 		msleep(50);
 
 	return ret;
diff --git a/drivers/gpu/drm/panfrost/panfrost_drv.c b/drivers/gpu/drm/panfrost/panfrost_drv.c
index a2ab99698ca8..ddcc8259061b 100644
--- a/drivers/gpu/drm/panfrost/panfrost_drv.c
+++ b/drivers/gpu/drm/panfrost/panfrost_drv.c
@@ -731,3 +731,4 @@ module_platform_driver(panfrost_driver);
 MODULE_AUTHOR("Panfrost Project Developers");
 MODULE_DESCRIPTION("Panfrost DRM Driver");
 MODULE_LICENSE("GPL v2");
+MODULE_SOFTDEP("pre: governor_simpleondemand");
diff --git a/drivers/gpu/drm/qxl/qxl_display.c b/drivers/gpu/drm/qxl/qxl_display.c
index 404b0483bb7c..8ee614be9adf 100644
--- a/drivers/gpu/drm/qxl/qxl_display.c
+++ b/drivers/gpu/drm/qxl/qxl_display.c
@@ -236,6 +236,9 @@ static int qxl_add_mode(struct drm_connector *connector,
 		return 0;
 
 	mode = drm_cvt_mode(dev, width, height, 60, false, false, false);
+	if (!mode)
+		return 0;
+
 	if (preferred)
 		mode->type |= DRM_MODE_TYPE_PREFERRED;
 	mode->hdisplay = width;
diff --git a/drivers/gpu/drm/rockchip/rockchip_drm_vop2.c b/drivers/gpu/drm/rockchip/rockchip_drm_vop2.c
index c5ec4169616d..f2a956f97361 100644
--- a/drivers/gpu/drm/rockchip/rockchip_drm_vop2.c
+++ b/drivers/gpu/drm/rockchip/rockchip_drm_vop2.c
@@ -1927,7 +1927,7 @@ static void vop2_setup_layer_mixer(struct vop2_video_port *vp)
 		port_sel |= FIELD_PREP(RK3568_OVL_PORT_SET__PORT2_MUX,
 			(vp2->nlayers + vp1->nlayers + vp0->nlayers - 1));
 	else
-		port_sel |= FIELD_PREP(RK3568_OVL_PORT_SET__PORT1_MUX, 8);
+		port_sel |= FIELD_PREP(RK3568_OVL_PORT_SET__PORT2_MUX, 8);
 
 	layer_sel = vop2_readl(vop2, RK3568_OVL_LAYER_SEL);
 
diff --git a/drivers/gpu/drm/udl/udl_modeset.c b/drivers/gpu/drm/udl/udl_modeset.c
index 40876bcdd79a..5a1539914ce8 100644
--- a/drivers/gpu/drm/udl/udl_modeset.c
+++ b/drivers/gpu/drm/udl/udl_modeset.c
@@ -512,8 +512,7 @@ struct drm_connector *udl_connector_init(struct drm_device *dev)
 
 	drm_connector_helper_add(connector, &udl_connector_helper_funcs);
 
-	connector->polled = DRM_CONNECTOR_POLL_HPD |
-			    DRM_CONNECTOR_POLL_CONNECT |
+	connector->polled = DRM_CONNECTOR_POLL_CONNECT |
 			    DRM_CONNECTOR_POLL_DISCONNECT;
 
 	return connector;
diff --git a/drivers/gpu/drm/xlnx/zynqmp_dpsub.c b/drivers/gpu/drm/xlnx/zynqmp_dpsub.c
index face8d6b2a6f..f5781939de9c 100644
--- a/drivers/gpu/drm/xlnx/zynqmp_dpsub.c
+++ b/drivers/gpu/drm/xlnx/zynqmp_dpsub.c
@@ -269,6 +269,7 @@ static int zynqmp_dpsub_probe(struct platform_device *pdev)
 	return 0;
 
 err_disp:
+	drm_bridge_remove(dpsub->bridge);
 	zynqmp_disp_remove(dpsub);
 err_dp:
 	zynqmp_dp_remove(dpsub);
diff --git a/drivers/gpu/drm/xlnx/zynqmp_kms.c b/drivers/gpu/drm/xlnx/zynqmp_kms.c
index a7f8611be6f4..44d4a510ad7d 100644
--- a/drivers/gpu/drm/xlnx/zynqmp_kms.c
+++ b/drivers/gpu/drm/xlnx/zynqmp_kms.c
@@ -434,23 +434,28 @@ static int zynqmp_dpsub_kms_init(struct zynqmp_dpsub *dpsub)
 				DRM_BRIDGE_ATTACH_NO_CONNECTOR);
 	if (ret) {
 		dev_err(dpsub->dev, "failed to attach bridge to encoder\n");
-		return ret;
+		goto err_encoder;
 	}
 
 	/* Create the connector for the chain of bridges. */
 	connector = drm_bridge_connector_init(&dpsub->drm->dev, encoder);
 	if (IS_ERR(connector)) {
 		dev_err(dpsub->dev, "failed to created connector\n");
-		return PTR_ERR(connector);
+		ret = PTR_ERR(connector);
+		goto err_encoder;
 	}
 
 	ret = drm_connector_attach_encoder(connector, encoder);
 	if (ret < 0) {
 		dev_err(dpsub->dev, "failed to attach connector to encoder\n");
-		return ret;
+		goto err_encoder;
 	}
 
 	return 0;
+
+err_encoder:
+	drm_encoder_cleanup(encoder);
+	return ret;
 }
 
 static void zynqmp_dpsub_drm_release(struct drm_device *drm, void *res)
@@ -530,5 +535,6 @@ void zynqmp_dpsub_drm_cleanup(struct zynqmp_dpsub *dpsub)
 
 	drm_dev_unregister(drm);
 	drm_atomic_helper_shutdown(drm);
+	drm_encoder_cleanup(&dpsub->drm->encoder);
 	drm_kms_helper_poll_fini(drm);
 }
diff --git a/drivers/hwmon/adt7475.c b/drivers/hwmon/adt7475.c
index 03acadc3a6cb..14b2547adae8 100644
--- a/drivers/hwmon/adt7475.c
+++ b/drivers/hwmon/adt7475.c
@@ -1862,7 +1862,7 @@ static void adt7475_read_pwm(struct i2c_client *client, int index)
 		data->pwm[CONTROL][index] &= ~0xE0;
 		data->pwm[CONTROL][index] |= (7 << 5);
 
-		i2c_smbus_write_byte_data(client, PWM_CONFIG_REG(index),
+		i2c_smbus_write_byte_data(client, PWM_REG(index),
 					  data->pwm[INPUT][index]);
 
 		i2c_smbus_write_byte_data(client, PWM_CONFIG_REG(index),
diff --git a/drivers/hwmon/max6697.c b/drivers/hwmon/max6697.c
index 7d10dd434f2e..a338dd4e990d 100644
--- a/drivers/hwmon/max6697.c
+++ b/drivers/hwmon/max6697.c
@@ -311,6 +311,7 @@ static ssize_t temp_store(struct device *dev,
 		return ret;
 
 	mutex_lock(&data->update_lock);
+	temp = clamp_val(temp, -1000000, 1000000);	/* prevent underflow */
 	temp = DIV_ROUND_CLOSEST(temp, 1000) + data->temp_offset;
 	temp = clamp_val(temp, 0, data->type == max6581 ? 255 : 127);
 	data->temp[nr][index] = temp;
@@ -428,14 +429,14 @@ static SENSOR_DEVICE_ATTR_RO(temp6_max_alarm, alarm, 20);
 static SENSOR_DEVICE_ATTR_RO(temp7_max_alarm, alarm, 21);
 static SENSOR_DEVICE_ATTR_RO(temp8_max_alarm, alarm, 23);
 
-static SENSOR_DEVICE_ATTR_RO(temp1_crit_alarm, alarm, 14);
+static SENSOR_DEVICE_ATTR_RO(temp1_crit_alarm, alarm, 15);
 static SENSOR_DEVICE_ATTR_RO(temp2_crit_alarm, alarm, 8);
 static SENSOR_DEVICE_ATTR_RO(temp3_crit_alarm, alarm, 9);
 static SENSOR_DEVICE_ATTR_RO(temp4_crit_alarm, alarm, 10);
 static SENSOR_DEVICE_ATTR_RO(temp5_crit_alarm, alarm, 11);
 static SENSOR_DEVICE_ATTR_RO(temp6_crit_alarm, alarm, 12);
 static SENSOR_DEVICE_ATTR_RO(temp7_crit_alarm, alarm, 13);
-static SENSOR_DEVICE_ATTR_RO(temp8_crit_alarm, alarm, 15);
+static SENSOR_DEVICE_ATTR_RO(temp8_crit_alarm, alarm, 14);
 
 static SENSOR_DEVICE_ATTR_RO(temp2_fault, alarm, 1);
 static SENSOR_DEVICE_ATTR_RO(temp3_fault, alarm, 2);
diff --git a/drivers/hwtracing/coresight/coresight-platform.c b/drivers/hwtracing/coresight/coresight-platform.c
index 9d550f5697fa..57a009552cc5 100644
--- a/drivers/hwtracing/coresight/coresight-platform.c
+++ b/drivers/hwtracing/coresight/coresight-platform.c
@@ -297,8 +297,10 @@ static int of_get_coresight_platform_data(struct device *dev,
 			continue;
 
 		ret = of_coresight_parse_endpoint(dev, ep, pdata);
-		if (ret)
+		if (ret) {
+			of_node_put(ep);
 			return ret;
+		}
 	}
 
 	return 0;
diff --git a/drivers/iio/frequency/adrf6780.c b/drivers/iio/frequency/adrf6780.c
index b4defb82f37e..3f46032c9275 100644
--- a/drivers/iio/frequency/adrf6780.c
+++ b/drivers/iio/frequency/adrf6780.c
@@ -9,7 +9,6 @@
 #include <linux/bits.h>
 #include <linux/clk.h>
 #include <linux/clkdev.h>
-#include <linux/clk-provider.h>
 #include <linux/delay.h>
 #include <linux/device.h>
 #include <linux/iio/iio.h>
diff --git a/drivers/iio/industrialio-gts-helper.c b/drivers/iio/industrialio-gts-helper.c
index b51eb6cb766f..59d7615c0f56 100644
--- a/drivers/iio/industrialio-gts-helper.c
+++ b/drivers/iio/industrialio-gts-helper.c
@@ -362,17 +362,20 @@ static int iio_gts_build_avail_time_table(struct iio_gts *gts)
 	for (i = gts->num_itime - 1; i >= 0; i--) {
 		int new = gts->itime_table[i].time_us;
 
-		if (times[idx] < new) {
+		if (idx == 0 || times[idx - 1] < new) {
 			times[idx++] = new;
 			continue;
 		}
 
-		for (j = 0; j <= idx; j++) {
+		for (j = 0; j < idx; j++) {
+			if (times[j] == new)
+				break;
 			if (times[j] > new) {
 				memmove(&times[j + 1], &times[j],
 					(idx - j) * sizeof(int));
 				times[j] = new;
 				idx++;
+				break;
 			}
 		}
 	}
diff --git a/drivers/infiniband/core/cache.c b/drivers/infiniband/core/cache.c
index 7acc0f936dad..b7251ed7a8df 100644
--- a/drivers/infiniband/core/cache.c
+++ b/drivers/infiniband/core/cache.c
@@ -794,7 +794,6 @@ static struct ib_gid_table *alloc_gid_table(int sz)
 static void release_gid_table(struct ib_device *device,
 			      struct ib_gid_table *table)
 {
-	bool leak = false;
 	int i;
 
 	if (!table)
@@ -803,15 +802,12 @@ static void release_gid_table(struct ib_device *device,
 	for (i = 0; i < table->sz; i++) {
 		if (is_gid_entry_free(table->data_vec[i]))
 			continue;
-		if (kref_read(&table->data_vec[i]->kref) > 1) {
-			dev_err(&device->dev,
-				"GID entry ref leak for index %d ref=%u\n", i,
-				kref_read(&table->data_vec[i]->kref));
-			leak = true;
-		}
+
+		WARN_ONCE(true,
+			  "GID entry ref leak for dev %s index %d ref=%u\n",
+			  dev_name(&device->dev), i,
+			  kref_read(&table->data_vec[i]->kref));
 	}
-	if (leak)
-		return;
 
 	mutex_destroy(&table->lock);
 	kfree(table->data_vec);
diff --git a/drivers/infiniband/core/device.c b/drivers/infiniband/core/device.c
index db0a58c82838..56dd030045a2 100644
--- a/drivers/infiniband/core/device.c
+++ b/drivers/infiniband/core/device.c
@@ -2146,6 +2146,9 @@ int ib_device_set_netdev(struct ib_device *ib_dev, struct net_device *ndev,
 	unsigned long flags;
 	int ret;
 
+	if (!rdma_is_port_valid(ib_dev, port))
+		return -EINVAL;
+
 	/*
 	 * Drivers wish to call this before ib_register_driver, so we have to
 	 * setup the port data early.
@@ -2154,9 +2157,6 @@ int ib_device_set_netdev(struct ib_device *ib_dev, struct net_device *ndev,
 	if (ret)
 		return ret;
 
-	if (!rdma_is_port_valid(ib_dev, port))
-		return -EINVAL;
-
 	pdata = &ib_dev->port_data[port];
 	spin_lock_irqsave(&pdata->netdev_lock, flags);
 	old_ndev = rcu_dereference_protected(
@@ -2166,17 +2166,12 @@ int ib_device_set_netdev(struct ib_device *ib_dev, struct net_device *ndev,
 		return 0;
 	}
 
-	if (old_ndev)
-		netdev_tracker_free(ndev, &pdata->netdev_tracker);
-	if (ndev)
-		netdev_hold(ndev, &pdata->netdev_tracker, GFP_ATOMIC);
 	rcu_assign_pointer(pdata->netdev, ndev);
+	netdev_put(old_ndev, &pdata->netdev_tracker);
+	netdev_hold(ndev, &pdata->netdev_tracker, GFP_ATOMIC);
 	spin_unlock_irqrestore(&pdata->netdev_lock, flags);
 
 	add_ndev_hash(pdata);
-	if (old_ndev)
-		__dev_put(old_ndev);
-
 	return 0;
 }
 EXPORT_SYMBOL(ib_device_set_netdev);
@@ -2235,8 +2230,7 @@ struct net_device *ib_device_get_netdev(struct ib_device *ib_dev,
 		spin_lock(&pdata->netdev_lock);
 		res = rcu_dereference_protected(
 			pdata->netdev, lockdep_is_held(&pdata->netdev_lock));
-		if (res)
-			dev_hold(res);
+		dev_hold(res);
 		spin_unlock(&pdata->netdev_lock);
 	}
 
@@ -2311,9 +2305,7 @@ void ib_enum_roce_netdev(struct ib_device *ib_dev,
 
 			if (filter(ib_dev, port, idev, filter_cookie))
 				cb(ib_dev, port, idev, cookie);
-
-			if (idev)
-				dev_put(idev);
+			dev_put(idev);
 		}
 }
 
diff --git a/drivers/infiniband/core/iwcm.c b/drivers/infiniband/core/iwcm.c
index 2b47073c61a6..2d09d1be38f1 100644
--- a/drivers/infiniband/core/iwcm.c
+++ b/drivers/infiniband/core/iwcm.c
@@ -369,8 +369,10 @@ EXPORT_SYMBOL(iw_cm_disconnect);
  *
  * Clean up all resources associated with the connection and release
  * the initial reference taken by iw_create_cm_id.
+ *
+ * Returns true if and only if the last cm_id_priv reference has been dropped.
  */
-static void destroy_cm_id(struct iw_cm_id *cm_id)
+static bool destroy_cm_id(struct iw_cm_id *cm_id)
 {
 	struct iwcm_id_private *cm_id_priv;
 	struct ib_qp *qp;
@@ -440,7 +442,7 @@ static void destroy_cm_id(struct iw_cm_id *cm_id)
 		iwpm_remove_mapping(&cm_id->local_addr, RDMA_NL_IWCM);
 	}
 
-	(void)iwcm_deref_id(cm_id_priv);
+	return iwcm_deref_id(cm_id_priv);
 }
 
 /*
@@ -451,7 +453,8 @@ static void destroy_cm_id(struct iw_cm_id *cm_id)
  */
 void iw_destroy_cm_id(struct iw_cm_id *cm_id)
 {
-	destroy_cm_id(cm_id);
+	if (!destroy_cm_id(cm_id))
+		flush_workqueue(iwcm_wq);
 }
 EXPORT_SYMBOL(iw_destroy_cm_id);
 
@@ -1035,7 +1038,7 @@ static void cm_work_handler(struct work_struct *_work)
 		if (!test_bit(IWCM_F_DROP_EVENTS, &cm_id_priv->flags)) {
 			ret = process_event(cm_id_priv, &levent);
 			if (ret)
-				destroy_cm_id(&cm_id_priv->id);
+				WARN_ON_ONCE(destroy_cm_id(&cm_id_priv->id));
 		} else
 			pr_debug("dropping event %d\n", levent.event);
 		if (iwcm_deref_id(cm_id_priv))
diff --git a/drivers/infiniband/core/lag.c b/drivers/infiniband/core/lag.c
index c77d7d2559a1..66c7e1e6600d 100644
--- a/drivers/infiniband/core/lag.c
+++ b/drivers/infiniband/core/lag.c
@@ -93,8 +93,7 @@ static struct net_device *rdma_get_xmit_slave_udp(struct ib_device *device,
 	slave = netdev_get_xmit_slave(master, skb,
 				      !!(device->lag_flags &
 					 RDMA_LAG_FLAGS_HASH_ALL_SLAVES));
-	if (slave)
-		dev_hold(slave);
+	dev_hold(slave);
 	rcu_read_unlock();
 	kfree_skb(skb);
 	return slave;
diff --git a/drivers/infiniband/core/roce_gid_mgmt.c b/drivers/infiniband/core/roce_gid_mgmt.c
index e958c43dd28f..d5131b3ba8ab 100644
--- a/drivers/infiniband/core/roce_gid_mgmt.c
+++ b/drivers/infiniband/core/roce_gid_mgmt.c
@@ -601,8 +601,7 @@ static void del_netdev_default_ips_join(struct ib_device *ib_dev, u32 port,
 
 	rcu_read_lock();
 	master_ndev = netdev_master_upper_dev_get_rcu(rdma_ndev);
-	if (master_ndev)
-		dev_hold(master_ndev);
+	dev_hold(master_ndev);
 	rcu_read_unlock();
 
 	if (master_ndev) {
diff --git a/drivers/infiniband/hw/bnxt_re/ib_verbs.c b/drivers/infiniband/hw/bnxt_re/ib_verbs.c
index fd69be982ce0..b4d3e7dfc939 100644
--- a/drivers/infiniband/hw/bnxt_re/ib_verbs.c
+++ b/drivers/infiniband/hw/bnxt_re/ib_verbs.c
@@ -2467,7 +2467,7 @@ static int bnxt_re_build_send_wqe(struct bnxt_re_qp *qp,
 		break;
 	case IB_WR_SEND_WITH_IMM:
 		wqe->type = BNXT_QPLIB_SWQE_TYPE_SEND_WITH_IMM;
-		wqe->send.imm_data = wr->ex.imm_data;
+		wqe->send.imm_data = be32_to_cpu(wr->ex.imm_data);
 		break;
 	case IB_WR_SEND_WITH_INV:
 		wqe->type = BNXT_QPLIB_SWQE_TYPE_SEND_WITH_INV;
@@ -2497,7 +2497,7 @@ static int bnxt_re_build_rdma_wqe(const struct ib_send_wr *wr,
 		break;
 	case IB_WR_RDMA_WRITE_WITH_IMM:
 		wqe->type = BNXT_QPLIB_SWQE_TYPE_RDMA_WRITE_WITH_IMM;
-		wqe->rdma.imm_data = wr->ex.imm_data;
+		wqe->rdma.imm_data = be32_to_cpu(wr->ex.imm_data);
 		break;
 	case IB_WR_RDMA_READ:
 		wqe->type = BNXT_QPLIB_SWQE_TYPE_RDMA_READ;
@@ -3545,7 +3545,7 @@ static void bnxt_re_process_res_shadow_qp_wc(struct bnxt_re_qp *gsi_sqp,
 	wc->byte_len = orig_cqe->length;
 	wc->qp = &gsi_qp->ib_qp;
 
-	wc->ex.imm_data = orig_cqe->immdata;
+	wc->ex.imm_data = cpu_to_be32(le32_to_cpu(orig_cqe->immdata));
 	wc->src_qp = orig_cqe->src_qp;
 	memcpy(wc->smac, orig_cqe->smac, ETH_ALEN);
 	if (bnxt_re_is_vlan_pkt(orig_cqe, &vlan_id, &sl)) {
@@ -3690,7 +3690,7 @@ int bnxt_re_poll_cq(struct ib_cq *ib_cq, int num_entries, struct ib_wc *wc)
 				 (unsigned long)(cqe->qp_handle),
 				 struct bnxt_re_qp, qplib_qp);
 			wc->qp = &qp->ib_qp;
-			wc->ex.imm_data = cqe->immdata;
+			wc->ex.imm_data = cpu_to_be32(le32_to_cpu(cqe->immdata));
 			wc->src_qp = cqe->src_qp;
 			memcpy(wc->smac, cqe->smac, ETH_ALEN);
 			wc->port_num = 1;
diff --git a/drivers/infiniband/hw/bnxt_re/qplib_fp.h b/drivers/infiniband/hw/bnxt_re/qplib_fp.h
index 113be429f0aa..a6f38d8f12ef 100644
--- a/drivers/infiniband/hw/bnxt_re/qplib_fp.h
+++ b/drivers/infiniband/hw/bnxt_re/qplib_fp.h
@@ -164,7 +164,7 @@ struct bnxt_qplib_swqe {
 		/* Send, with imm, inval key */
 		struct {
 			union {
-				__be32	imm_data;
+				u32	imm_data;
 				u32	inv_key;
 			};
 			u32		q_key;
@@ -182,7 +182,7 @@ struct bnxt_qplib_swqe {
 		/* RDMA write, with imm, read */
 		struct {
 			union {
-				__be32	imm_data;
+				u32	imm_data;
 				u32	inv_key;
 			};
 			u64		remote_va;
@@ -389,7 +389,7 @@ struct bnxt_qplib_cqe {
 	u16				cfa_meta;
 	u64				wr_id;
 	union {
-		__be32			immdata;
+		__le32			immdata;
 		u32			invrkey;
 	};
 	u64				qp_handle;
diff --git a/drivers/infiniband/hw/hns/hns_roce_device.h b/drivers/infiniband/hw/hns/hns_roce_device.h
index 82066859cc11..cd593d651e4c 100644
--- a/drivers/infiniband/hw/hns/hns_roce_device.h
+++ b/drivers/infiniband/hw/hns/hns_roce_device.h
@@ -82,6 +82,7 @@
 #define MR_TYPE_DMA				0x03
 
 #define HNS_ROCE_FRMR_MAX_PA			512
+#define HNS_ROCE_FRMR_ALIGN_SIZE		128
 
 #define PKEY_ID					0xffff
 #define NODE_DESC_SIZE				64
@@ -90,6 +91,8 @@
 /* Configure to HW for PAGE_SIZE larger than 4KB */
 #define PG_SHIFT_OFFSET				(PAGE_SHIFT - 12)
 
+#define ATOMIC_WR_LEN				8
+
 #define HNS_ROCE_IDX_QUE_ENTRY_SZ		4
 #define SRQ_DB_REG				0x230
 
@@ -181,6 +184,9 @@ enum {
 #define HNS_HW_PAGE_SHIFT			12
 #define HNS_HW_PAGE_SIZE			(1 << HNS_HW_PAGE_SHIFT)
 
+#define HNS_HW_MAX_PAGE_SHIFT			27
+#define HNS_HW_MAX_PAGE_SIZE			(1 << HNS_HW_MAX_PAGE_SHIFT)
+
 struct hns_roce_uar {
 	u64		pfn;
 	unsigned long	index;
diff --git a/drivers/infiniband/hw/hns/hns_roce_hw_v2.c b/drivers/infiniband/hw/hns/hns_roce_hw_v2.c
index 32fb2c00a8f2..a49280e2df8c 100644
--- a/drivers/infiniband/hw/hns/hns_roce_hw_v2.c
+++ b/drivers/infiniband/hw/hns/hns_roce_hw_v2.c
@@ -595,11 +595,16 @@ static inline int set_rc_wqe(struct hns_roce_qp *qp,
 		     (wr->send_flags & IB_SEND_SIGNALED) ? 1 : 0);
 
 	if (wr->opcode == IB_WR_ATOMIC_CMP_AND_SWP ||
-	    wr->opcode == IB_WR_ATOMIC_FETCH_AND_ADD)
+	    wr->opcode == IB_WR_ATOMIC_FETCH_AND_ADD) {
+		if (msg_len != ATOMIC_WR_LEN)
+			return -EINVAL;
 		set_atomic_seg(wr, rc_sq_wqe, valid_num_sge);
-	else if (wr->opcode != IB_WR_REG_MR)
+	} else if (wr->opcode != IB_WR_REG_MR) {
 		ret = set_rwqe_data_seg(&qp->ibqp, wr, rc_sq_wqe,
 					&curr_idx, valid_num_sge);
+		if (ret)
+			return ret;
+	}
 
 	/*
 	 * The pipeline can sequentially post all valid WQEs into WQ buffer,
@@ -2443,14 +2448,16 @@ static int set_llm_cfg_to_hw(struct hns_roce_dev *hr_dev,
 static struct hns_roce_link_table *
 alloc_link_table_buf(struct hns_roce_dev *hr_dev)
 {
+	u16 total_sl = hr_dev->caps.sl_num * hr_dev->func_num;
 	struct hns_roce_v2_priv *priv = hr_dev->priv;
 	struct hns_roce_link_table *link_tbl;
 	u32 pg_shift, size, min_size;
 
 	link_tbl = &priv->ext_llm;
 	pg_shift = hr_dev->caps.llm_buf_pg_sz + PAGE_SHIFT;
-	size = hr_dev->caps.num_qps * HNS_ROCE_V2_EXT_LLM_ENTRY_SZ;
-	min_size = HNS_ROCE_EXT_LLM_MIN_PAGES(hr_dev->caps.sl_num) << pg_shift;
+	size = hr_dev->caps.num_qps * hr_dev->func_num *
+	       HNS_ROCE_V2_EXT_LLM_ENTRY_SZ;
+	min_size = HNS_ROCE_EXT_LLM_MIN_PAGES(total_sl) << pg_shift;
 
 	/* Alloc data table */
 	size = max(size, min_size);
@@ -6256,9 +6263,16 @@ static void hns_roce_v2_int_mask_enable(struct hns_roce_dev *hr_dev,
 	roce_write(hr_dev, ROCEE_VF_ABN_INT_CFG_REG, enable_flag);
 }
 
-static void hns_roce_v2_destroy_eqc(struct hns_roce_dev *hr_dev, u32 eqn)
+static void free_eq_buf(struct hns_roce_dev *hr_dev, struct hns_roce_eq *eq)
+{
+	hns_roce_mtr_destroy(hr_dev, &eq->mtr);
+}
+
+static void hns_roce_v2_destroy_eqc(struct hns_roce_dev *hr_dev,
+				    struct hns_roce_eq *eq)
 {
 	struct device *dev = hr_dev->dev;
+	int eqn = eq->eqn;
 	int ret;
 	u8 cmd;
 
@@ -6269,12 +6283,9 @@ static void hns_roce_v2_destroy_eqc(struct hns_roce_dev *hr_dev, u32 eqn)
 
 	ret = hns_roce_destroy_hw_ctx(hr_dev, cmd, eqn & HNS_ROCE_V2_EQN_M);
 	if (ret)
-		dev_err(dev, "[mailbox cmd] destroy eqc(%u) failed.\n", eqn);
-}
+		dev_err(dev, "[mailbox cmd] destroy eqc(%d) failed.\n", eqn);
 
-static void free_eq_buf(struct hns_roce_dev *hr_dev, struct hns_roce_eq *eq)
-{
-	hns_roce_mtr_destroy(hr_dev, &eq->mtr);
+	free_eq_buf(hr_dev, eq);
 }
 
 static void init_eq_config(struct hns_roce_dev *hr_dev, struct hns_roce_eq *eq)
@@ -6580,7 +6591,7 @@ static int hns_roce_v2_init_eq_table(struct hns_roce_dev *hr_dev)
 
 err_create_eq_fail:
 	for (i -= 1; i >= 0; i--)
-		free_eq_buf(hr_dev, &eq_table->eq[i]);
+		hns_roce_v2_destroy_eqc(hr_dev, &eq_table->eq[i]);
 	kfree(eq_table->eq);
 
 	return ret;
@@ -6600,11 +6611,8 @@ static void hns_roce_v2_cleanup_eq_table(struct hns_roce_dev *hr_dev)
 	__hns_roce_free_irq(hr_dev);
 	destroy_workqueue(hr_dev->irq_workq);
 
-	for (i = 0; i < eq_num; i++) {
-		hns_roce_v2_destroy_eqc(hr_dev, i);
-
-		free_eq_buf(hr_dev, &eq_table->eq[i]);
-	}
+	for (i = 0; i < eq_num; i++)
+		hns_roce_v2_destroy_eqc(hr_dev, &eq_table->eq[i]);
 
 	kfree(eq_table->eq);
 }
diff --git a/drivers/infiniband/hw/hns/hns_roce_mr.c b/drivers/infiniband/hw/hns/hns_roce_mr.c
index 190e62da98e4..980261969b0c 100644
--- a/drivers/infiniband/hw/hns/hns_roce_mr.c
+++ b/drivers/infiniband/hw/hns/hns_roce_mr.c
@@ -423,6 +423,11 @@ int hns_roce_map_mr_sg(struct ib_mr *ibmr, struct scatterlist *sg, int sg_nents,
 	struct hns_roce_mtr *mtr = &mr->pbl_mtr;
 	int ret, sg_num = 0;
 
+	if (!IS_ALIGNED(*sg_offset, HNS_ROCE_FRMR_ALIGN_SIZE) ||
+	    ibmr->page_size < HNS_HW_PAGE_SIZE ||
+	    ibmr->page_size > HNS_HW_MAX_PAGE_SIZE)
+		return sg_num;
+
 	mr->npages = 0;
 	mr->page_list = kvcalloc(mr->pbl_mtr.hem_cfg.buf_pg_count,
 				 sizeof(dma_addr_t), GFP_KERNEL);
diff --git a/drivers/infiniband/hw/hns/hns_roce_qp.c b/drivers/infiniband/hw/hns/hns_roce_qp.c
index 828b58534aa9..bff00b3af41f 100644
--- a/drivers/infiniband/hw/hns/hns_roce_qp.c
+++ b/drivers/infiniband/hw/hns/hns_roce_qp.c
@@ -531,13 +531,15 @@ static unsigned int get_sge_num_from_max_inl_data(bool is_ud_or_gsi,
 {
 	unsigned int inline_sge;
 
-	inline_sge = roundup_pow_of_two(max_inline_data) / HNS_ROCE_SGE_SIZE;
+	if (!max_inline_data)
+		return 0;
 
 	/*
 	 * if max_inline_data less than
 	 * HNS_ROCE_SGE_IN_WQE * HNS_ROCE_SGE_SIZE,
 	 * In addition to ud's mode, no need to extend sge.
 	 */
+	inline_sge = roundup_pow_of_two(max_inline_data) / HNS_ROCE_SGE_SIZE;
 	if (!is_ud_or_gsi && inline_sge <= HNS_ROCE_SGE_IN_WQE)
 		inline_sge = 0;
 
diff --git a/drivers/infiniband/hw/hns/hns_roce_srq.c b/drivers/infiniband/hw/hns/hns_roce_srq.c
index 6a4923c21cbc..727f92650071 100644
--- a/drivers/infiniband/hw/hns/hns_roce_srq.c
+++ b/drivers/infiniband/hw/hns/hns_roce_srq.c
@@ -296,7 +296,7 @@ static int set_srq_basic_param(struct hns_roce_srq *srq,
 
 	max_sge = proc_srq_sge(hr_dev, srq, !!udata);
 	if (attr->max_wr > hr_dev->caps.max_srq_wrs ||
-	    attr->max_sge > max_sge) {
+	    attr->max_sge > max_sge || !attr->max_sge) {
 		ibdev_err(&hr_dev->ib_dev,
 			  "invalid SRQ attr, depth = %u, sge = %u.\n",
 			  attr->max_wr, attr->max_sge);
diff --git a/drivers/infiniband/hw/mlx4/alias_GUID.c b/drivers/infiniband/hw/mlx4/alias_GUID.c
index 111fa88a3be4..9a439569ffcf 100644
--- a/drivers/infiniband/hw/mlx4/alias_GUID.c
+++ b/drivers/infiniband/hw/mlx4/alias_GUID.c
@@ -829,7 +829,7 @@ void mlx4_ib_destroy_alias_guid_service(struct mlx4_ib_dev *dev)
 
 int mlx4_ib_init_alias_guid_service(struct mlx4_ib_dev *dev)
 {
-	char alias_wq_name[15];
+	char alias_wq_name[22];
 	int ret = 0;
 	int i, j;
 	union ib_gid gid;
diff --git a/drivers/infiniband/hw/mlx4/mad.c b/drivers/infiniband/hw/mlx4/mad.c
index a37cfac5e23f..dc9cf45d2d32 100644
--- a/drivers/infiniband/hw/mlx4/mad.c
+++ b/drivers/infiniband/hw/mlx4/mad.c
@@ -2158,7 +2158,7 @@ static int mlx4_ib_alloc_demux_ctx(struct mlx4_ib_dev *dev,
 				       struct mlx4_ib_demux_ctx *ctx,
 				       int port)
 {
-	char name[12];
+	char name[21];
 	int ret = 0;
 	int i;
 
diff --git a/drivers/infiniband/hw/mlx5/mlx5_ib.h b/drivers/infiniband/hw/mlx5/mlx5_ib.h
index 6a57af8fa231..43a963e205eb 100644
--- a/drivers/infiniband/hw/mlx5/mlx5_ib.h
+++ b/drivers/infiniband/hw/mlx5/mlx5_ib.h
@@ -115,6 +115,19 @@ unsigned long __mlx5_umem_find_best_quantized_pgoff(
 		__mlx5_bit_sz(typ, page_offset_fld), 0, scale,                 \
 		page_offset_quantized)
 
+static inline unsigned long
+mlx5_umem_dmabuf_find_best_pgsz(struct ib_umem_dmabuf *umem_dmabuf)
+{
+	/*
+	 * mkeys used for dmabuf are fixed at PAGE_SIZE because we must be able
+	 * to hold any sgl after a move operation. Ideally the mkc page size
+	 * could be changed at runtime to be optimal, but right now the driver
+	 * cannot do that.
+	 */
+	return ib_umem_find_best_pgsz(&umem_dmabuf->umem, PAGE_SIZE,
+				      umem_dmabuf->umem.iova);
+}
+
 enum {
 	MLX5_IB_MMAP_OFFSET_START = 9,
 	MLX5_IB_MMAP_OFFSET_END = 255,
diff --git a/drivers/infiniband/hw/mlx5/odp.c b/drivers/infiniband/hw/mlx5/odp.c
index 4a04cbc5b78a..a524181f34df 100644
--- a/drivers/infiniband/hw/mlx5/odp.c
+++ b/drivers/infiniband/hw/mlx5/odp.c
@@ -705,10 +705,8 @@ static int pagefault_dmabuf_mr(struct mlx5_ib_mr *mr, size_t bcnt,
 		return err;
 	}
 
-	page_size = mlx5_umem_find_best_pgsz(&umem_dmabuf->umem, mkc,
-					     log_page_size, 0,
-					     umem_dmabuf->umem.iova);
-	if (unlikely(page_size < PAGE_SIZE)) {
+	page_size = mlx5_umem_dmabuf_find_best_pgsz(umem_dmabuf);
+	if (!page_size) {
 		ib_umem_dmabuf_unmap_pages(umem_dmabuf);
 		err = -EINVAL;
 	} else {
diff --git a/drivers/infiniband/sw/rxe/rxe_req.c b/drivers/infiniband/sw/rxe/rxe_req.c
index d8c41fd626a9..7a36080d2bae 100644
--- a/drivers/infiniband/sw/rxe/rxe_req.c
+++ b/drivers/infiniband/sw/rxe/rxe_req.c
@@ -424,7 +424,7 @@ static struct sk_buff *init_req_packet(struct rxe_qp *qp,
 	int			paylen;
 	int			solicited;
 	u32			qp_num;
-	int			ack_req;
+	int			ack_req = 0;
 
 	/* length from start of bth to end of icrc */
 	paylen = rxe_opcode[opcode].length + payload + pad + RXE_ICRC_SIZE;
@@ -445,8 +445,9 @@ static struct sk_buff *init_req_packet(struct rxe_qp *qp,
 	qp_num = (pkt->mask & RXE_DETH_MASK) ? ibwr->wr.ud.remote_qpn :
 					 qp->attr.dest_qp_num;
 
-	ack_req = ((pkt->mask & RXE_END_MASK) ||
-		(qp->req.noack_pkts++ > RXE_MAX_PKT_PER_ACK));
+	if (qp_type(qp) != IB_QPT_UD && qp_type(qp) != IB_QPT_UC)
+		ack_req = ((pkt->mask & RXE_END_MASK) ||
+			   (qp->req.noack_pkts++ > RXE_MAX_PKT_PER_ACK));
 	if (ack_req)
 		qp->req.noack_pkts = 0;
 
diff --git a/drivers/input/keyboard/qt1050.c b/drivers/input/keyboard/qt1050.c
index 6953097db445..cd2f4216daf8 100644
--- a/drivers/input/keyboard/qt1050.c
+++ b/drivers/input/keyboard/qt1050.c
@@ -226,7 +226,12 @@ static bool qt1050_identify(struct qt1050_priv *ts)
 	int err;
 
 	/* Read Chip ID */
-	regmap_read(ts->regmap, QT1050_CHIP_ID, &val);
+	err = regmap_read(ts->regmap, QT1050_CHIP_ID, &val);
+	if (err) {
+		dev_err(&ts->client->dev, "Failed to read chip ID: %d\n", err);
+		return false;
+	}
+
 	if (val != QT1050_CHIP_ID_VER) {
 		dev_err(&ts->client->dev, "ID %d not supported\n", val);
 		return false;
diff --git a/drivers/input/mouse/elan_i2c_core.c b/drivers/input/mouse/elan_i2c_core.c
index 148a601396f9..dc80e407fb86 100644
--- a/drivers/input/mouse/elan_i2c_core.c
+++ b/drivers/input/mouse/elan_i2c_core.c
@@ -1356,6 +1356,8 @@ static int elan_suspend(struct device *dev)
 	}
 
 err:
+	if (ret)
+		enable_irq(client->irq);
 	mutex_unlock(&data->sysfs_mutex);
 	return ret;
 }
diff --git a/drivers/interconnect/qcom/qcm2290.c b/drivers/interconnect/qcom/qcm2290.c
index 52346f7319ac..69960a357a68 100644
--- a/drivers/interconnect/qcom/qcm2290.c
+++ b/drivers/interconnect/qcom/qcm2290.c
@@ -163,7 +163,7 @@ static struct qcom_icc_node mas_snoc_bimc = {
 	.qos.ap_owned = true,
 	.qos.qos_port = 6,
 	.qos.qos_mode = NOC_QOS_MODE_BYPASS,
-	.mas_rpm_id = 164,
+	.mas_rpm_id = 3,
 	.slv_rpm_id = -1,
 	.num_links = ARRAY_SIZE(mas_snoc_bimc_links),
 	.links = mas_snoc_bimc_links,
diff --git a/drivers/iommu/intel/iommu.c b/drivers/iommu/intel/iommu.c
index 744e4e6b8d72..9918af222c51 100644
--- a/drivers/iommu/intel/iommu.c
+++ b/drivers/iommu/intel/iommu.c
@@ -2411,7 +2411,7 @@ static int __init si_domain_init(int hw)
 		for_each_mem_pfn_range(i, nid, &start_pfn, &end_pfn, NULL) {
 			ret = iommu_domain_identity_map(si_domain,
 					mm_to_dma_pfn_start(start_pfn),
-					mm_to_dma_pfn_end(end_pfn));
+					mm_to_dma_pfn_end(end_pfn-1));
 			if (ret)
 				return ret;
 		}
diff --git a/drivers/iommu/sprd-iommu.c b/drivers/iommu/sprd-iommu.c
index 2fa9afebd4f5..c8e79a2d8b4c 100644
--- a/drivers/iommu/sprd-iommu.c
+++ b/drivers/iommu/sprd-iommu.c
@@ -236,8 +236,8 @@ static void sprd_iommu_cleanup(struct sprd_iommu_domain *dom)
 
 	pgt_size = sprd_iommu_pgt_size(&dom->domain);
 	dma_free_coherent(dom->sdev->dev, pgt_size, dom->pgt_va, dom->pgt_pa);
-	dom->sdev = NULL;
 	sprd_iommu_hw_en(dom->sdev, false);
+	dom->sdev = NULL;
 }
 
 static void sprd_iommu_domain_free(struct iommu_domain *domain)
diff --git a/drivers/irqchip/irq-imx-irqsteer.c b/drivers/irqchip/irq-imx-irqsteer.c
index bd9543314539..7df53b4532b4 100644
--- a/drivers/irqchip/irq-imx-irqsteer.c
+++ b/drivers/irqchip/irq-imx-irqsteer.c
@@ -36,6 +36,7 @@ struct irqsteer_data {
 	int			channel;
 	struct irq_domain	*domain;
 	u32			*saved_reg;
+	struct device		*dev;
 };
 
 static int imx_irqsteer_get_reg_index(struct irqsteer_data *data,
@@ -72,10 +73,26 @@ static void imx_irqsteer_irq_mask(struct irq_data *d)
 	raw_spin_unlock_irqrestore(&data->lock, flags);
 }
 
+static void imx_irqsteer_irq_bus_lock(struct irq_data *d)
+{
+	struct irqsteer_data *data = d->chip_data;
+
+	pm_runtime_get_sync(data->dev);
+}
+
+static void imx_irqsteer_irq_bus_sync_unlock(struct irq_data *d)
+{
+	struct irqsteer_data *data = d->chip_data;
+
+	pm_runtime_put_autosuspend(data->dev);
+}
+
 static const struct irq_chip imx_irqsteer_irq_chip = {
-	.name		= "irqsteer",
-	.irq_mask	= imx_irqsteer_irq_mask,
-	.irq_unmask	= imx_irqsteer_irq_unmask,
+	.name			= "irqsteer",
+	.irq_mask		= imx_irqsteer_irq_mask,
+	.irq_unmask		= imx_irqsteer_irq_unmask,
+	.irq_bus_lock		= imx_irqsteer_irq_bus_lock,
+	.irq_bus_sync_unlock	= imx_irqsteer_irq_bus_sync_unlock,
 };
 
 static int imx_irqsteer_irq_map(struct irq_domain *h, unsigned int irq,
@@ -150,6 +167,7 @@ static int imx_irqsteer_probe(struct platform_device *pdev)
 	if (!data)
 		return -ENOMEM;
 
+	data->dev = &pdev->dev;
 	data->regs = devm_platform_ioremap_resource(pdev, 0);
 	if (IS_ERR(data->regs)) {
 		dev_err(&pdev->dev, "failed to initialize reg\n");
diff --git a/drivers/isdn/hardware/mISDN/hfcmulti.c b/drivers/isdn/hardware/mISDN/hfcmulti.c
index 2e5cb9dde3ec..44383cec1f47 100644
--- a/drivers/isdn/hardware/mISDN/hfcmulti.c
+++ b/drivers/isdn/hardware/mISDN/hfcmulti.c
@@ -1900,7 +1900,7 @@ hfcmulti_dtmf(struct hfc_multi *hc)
 static void
 hfcmulti_tx(struct hfc_multi *hc, int ch)
 {
-	int i, ii, temp, len = 0;
+	int i, ii, temp, tmp_len, len = 0;
 	int Zspace, z1, z2; /* must be int for calculation */
 	int Fspace, f1, f2;
 	u_char *d;
@@ -2121,14 +2121,15 @@ hfcmulti_tx(struct hfc_multi *hc, int ch)
 		HFC_wait_nodebug(hc);
 	}
 
+	tmp_len = (*sp)->len;
 	dev_kfree_skb(*sp);
 	/* check for next frame */
 	if (bch && get_next_bframe(bch)) {
-		len = (*sp)->len;
+		len = tmp_len;
 		goto next_frame;
 	}
 	if (dch && get_next_dframe(dch)) {
-		len = (*sp)->len;
+		len = tmp_len;
 		goto next_frame;
 	}
 
diff --git a/drivers/leds/flash/leds-mt6360.c b/drivers/leds/flash/leds-mt6360.c
index 1af6c5898343..fdf0812774ce 100644
--- a/drivers/leds/flash/leds-mt6360.c
+++ b/drivers/leds/flash/leds-mt6360.c
@@ -633,14 +633,17 @@ static int mt6360_init_isnk_properties(struct mt6360_led *led,
 
 			ret = fwnode_property_read_u32(child, "reg", &reg);
 			if (ret || reg > MT6360_LED_ISNK3 ||
-			    priv->leds_active & BIT(reg))
+			    priv->leds_active & BIT(reg)) {
+				fwnode_handle_put(child);
 				return -EINVAL;
+			}
 
 			ret = fwnode_property_read_u32(child, "color", &color);
 			if (ret) {
 				dev_err(priv->dev,
 					"led %d, no color specified\n",
 					led->led_no);
+				fwnode_handle_put(child);
 				return ret;
 			}
 
diff --git a/drivers/leds/flash/leds-qcom-flash.c b/drivers/leds/flash/leds-qcom-flash.c
index a73d3ea5c97a..17391aefeb94 100644
--- a/drivers/leds/flash/leds-qcom-flash.c
+++ b/drivers/leds/flash/leds-qcom-flash.c
@@ -505,6 +505,7 @@ qcom_flash_v4l2_init(struct device *dev, struct qcom_flash_led *led, struct fwno
 	struct qcom_flash_data *flash_data = led->flash_data;
 	struct v4l2_flash_config v4l2_cfg = { 0 };
 	struct led_flash_setting *intensity = &v4l2_cfg.intensity;
+	struct v4l2_flash *v4l2_flash;
 
 	if (!(led->flash.led_cdev.flags & LED_DEV_CAP_FLASH))
 		return 0;
@@ -523,9 +524,12 @@ qcom_flash_v4l2_init(struct device *dev, struct qcom_flash_led *led, struct fwno
 				LED_FAULT_OVER_TEMPERATURE |
 				LED_FAULT_TIMEOUT;
 
-	flash_data->v4l2_flash[flash_data->leds_count] =
-		v4l2_flash_init(dev, fwnode, &led->flash, &qcom_v4l2_flash_ops, &v4l2_cfg);
-	return PTR_ERR_OR_ZERO(flash_data->v4l2_flash);
+	v4l2_flash = v4l2_flash_init(dev, fwnode, &led->flash, &qcom_v4l2_flash_ops, &v4l2_cfg);
+	if (IS_ERR(v4l2_flash))
+		return PTR_ERR(v4l2_flash);
+
+	flash_data->v4l2_flash[flash_data->leds_count] = v4l2_flash;
+	return 0;
 }
 # else
 static int
diff --git a/drivers/leds/led-class.c b/drivers/leds/led-class.c
index ba1be15cfd8e..c66d1bead0a4 100644
--- a/drivers/leds/led-class.c
+++ b/drivers/leds/led-class.c
@@ -258,7 +258,6 @@ struct led_classdev *of_led_get(struct device_node *np, int index)
 
 	led_dev = class_find_device_by_of_node(&leds_class, led_node);
 	of_node_put(led_node);
-	put_device(led_dev);
 
 	return led_module_get(led_dev);
 }
diff --git a/drivers/leds/led-triggers.c b/drivers/leds/led-triggers.c
index 6a5e1f41f9a4..4f5829b726a7 100644
--- a/drivers/leds/led-triggers.c
+++ b/drivers/leds/led-triggers.c
@@ -179,9 +179,9 @@ int led_trigger_set(struct led_classdev *led_cdev, struct led_trigger *trig)
 
 		cancel_work_sync(&led_cdev->set_brightness_work);
 		led_stop_software_blink(led_cdev);
+		device_remove_groups(led_cdev->dev, led_cdev->trigger->groups);
 		if (led_cdev->trigger->deactivate)
 			led_cdev->trigger->deactivate(led_cdev);
-		device_remove_groups(led_cdev->dev, led_cdev->trigger->groups);
 		led_cdev->trigger = NULL;
 		led_cdev->trigger_data = NULL;
 		led_cdev->activated = false;
diff --git a/drivers/leds/leds-ss4200.c b/drivers/leds/leds-ss4200.c
index fcaa34706b6c..2ef9fc7371bd 100644
--- a/drivers/leds/leds-ss4200.c
+++ b/drivers/leds/leds-ss4200.c
@@ -356,8 +356,10 @@ static int ich7_lpc_probe(struct pci_dev *dev,
 
 	nas_gpio_pci_dev = dev;
 	status = pci_read_config_dword(dev, PMBASE, &g_pm_io_base);
-	if (status)
+	if (status) {
+		status = pcibios_err_to_errno(status);
 		goto out;
+	}
 	g_pm_io_base &= 0x00000ff80;
 
 	status = pci_read_config_dword(dev, GPIO_CTRL, &gc);
@@ -369,8 +371,9 @@ static int ich7_lpc_probe(struct pci_dev *dev,
 	}
 
 	status = pci_read_config_dword(dev, GPIO_BASE, &nas_gpio_io_base);
-	if (0 > status) {
+	if (status) {
 		dev_info(&dev->dev, "Unable to read GPIOBASE.\n");
+		status = pcibios_err_to_errno(status);
 		goto out;
 	}
 	dev_dbg(&dev->dev, ": GPIOBASE = 0x%08x\n", nas_gpio_io_base);
diff --git a/drivers/macintosh/therm_windtunnel.c b/drivers/macintosh/therm_windtunnel.c
index 3c1b29476ce2..5c001105cdd9 100644
--- a/drivers/macintosh/therm_windtunnel.c
+++ b/drivers/macintosh/therm_windtunnel.c
@@ -551,7 +551,7 @@ g4fan_exit( void )
 	platform_driver_unregister( &therm_of_driver );
 
 	if( x.of_dev )
-		of_device_unregister( x.of_dev );
+		of_platform_device_destroy(&x.of_dev->dev, NULL);
 }
 
 module_init(g4fan_init);
diff --git a/drivers/md/dm-verity-target.c b/drivers/md/dm-verity-target.c
index 49e4a35d7019..3636387ce565 100644
--- a/drivers/md/dm-verity-target.c
+++ b/drivers/md/dm-verity-target.c
@@ -1511,14 +1511,6 @@ static int verity_ctr(struct dm_target *ti, unsigned int argc, char **argv)
 	return r;
 }
 
-/*
- * Check whether a DM target is a verity target.
- */
-bool dm_is_verity_target(struct dm_target *ti)
-{
-	return ti->type->module == THIS_MODULE;
-}
-
 /*
  * Get the verity mode (error behavior) of a verity target.
  *
@@ -1572,6 +1564,14 @@ static struct target_type verity_target = {
 };
 module_dm(verity);
 
+/*
+ * Check whether a DM target is a verity target.
+ */
+bool dm_is_verity_target(struct dm_target *ti)
+{
+	return ti->type == &verity_target;
+}
+
 MODULE_AUTHOR("Mikulas Patocka <mpatocka@...hat.com>");
 MODULE_AUTHOR("Mandeep Baines <msb@...omium.org>");
 MODULE_AUTHOR("Will Drewry <wad@...omium.org>");
diff --git a/drivers/md/md-bitmap.c b/drivers/md/md-bitmap.c
index d9235ee7dcc4..be65472d8f8b 100644
--- a/drivers/md/md-bitmap.c
+++ b/drivers/md/md-bitmap.c
@@ -227,6 +227,8 @@ static int __write_sb_page(struct md_rdev *rdev, struct bitmap *bitmap,
 	struct block_device *bdev;
 	struct mddev *mddev = bitmap->mddev;
 	struct bitmap_storage *store = &bitmap->storage;
+	unsigned int bitmap_limit = (bitmap->storage.file_pages - pg_index) <<
+		PAGE_SHIFT;
 	loff_t sboff, offset = mddev->bitmap_info.offset;
 	sector_t ps = pg_index * PAGE_SIZE / SECTOR_SIZE;
 	unsigned int size = PAGE_SIZE;
@@ -269,11 +271,9 @@ static int __write_sb_page(struct md_rdev *rdev, struct bitmap *bitmap,
 		if (size == 0)
 			/* bitmap runs in to data */
 			return -EINVAL;
-	} else {
-		/* DATA METADATA BITMAP - no problems */
 	}
 
-	md_super_write(mddev, rdev, sboff + ps, (int) size, page);
+	md_super_write(mddev, rdev, sboff + ps, (int)min(size, bitmap_limit), page);
 	return 0;
 }
 
diff --git a/drivers/md/md.c b/drivers/md/md.c
index e4d3741234d9..b5dea664f946 100644
--- a/drivers/md/md.c
+++ b/drivers/md/md.c
@@ -493,13 +493,9 @@ static void md_end_flush(struct bio *bio)
 
 	rdev_dec_pending(rdev, mddev);
 
-	if (atomic_dec_and_test(&mddev->flush_pending)) {
-		/* The pair is percpu_ref_get() from md_flush_request() */
-		percpu_ref_put(&mddev->active_io);
-
+	if (atomic_dec_and_test(&mddev->flush_pending))
 		/* The pre-request flush has finished */
 		queue_work(md_wq, &mddev->flush_work);
-	}
 }
 
 static void md_submit_flush_data(struct work_struct *ws);
@@ -530,12 +526,8 @@ static void submit_flushes(struct work_struct *ws)
 			rcu_read_lock();
 		}
 	rcu_read_unlock();
-	if (atomic_dec_and_test(&mddev->flush_pending)) {
-		/* The pair is percpu_ref_get() from md_flush_request() */
-		percpu_ref_put(&mddev->active_io);
-
+	if (atomic_dec_and_test(&mddev->flush_pending))
 		queue_work(md_wq, &mddev->flush_work);
-	}
 }
 
 static void md_submit_flush_data(struct work_struct *ws)
@@ -560,8 +552,20 @@ static void md_submit_flush_data(struct work_struct *ws)
 		bio_endio(bio);
 	} else {
 		bio->bi_opf &= ~REQ_PREFLUSH;
-		md_handle_request(mddev, bio);
+
+		/*
+		 * make_requst() will never return error here, it only
+		 * returns error in raid5_make_request() by dm-raid.
+		 * Since dm always splits data and flush operation into
+		 * two separate io, io size of flush submitted by dm
+		 * always is 0, make_request() will not be called here.
+		 */
+		if (WARN_ON_ONCE(!mddev->pers->make_request(mddev, bio)))
+			bio_io_error(bio);;
 	}
+
+	/* The pair is percpu_ref_get() from md_flush_request() */
+	percpu_ref_put(&mddev->active_io);
 }
 
 /*
@@ -7680,12 +7684,6 @@ static int md_ioctl(struct block_device *bdev, blk_mode_t mode,
 
 	}
 
-	if (cmd == HOT_REMOVE_DISK)
-		/* need to ensure recovery thread has run */
-		wait_event_interruptible_timeout(mddev->sb_wait,
-						 !test_bit(MD_RECOVERY_NEEDED,
-							   &mddev->recovery),
-						 msecs_to_jiffies(5000));
 	if (cmd == STOP_ARRAY || cmd == STOP_ARRAY_RO) {
 		/* Need to flush page cache, and ensure no-one else opens
 		 * and writes
diff --git a/drivers/media/i2c/imx219.c b/drivers/media/i2c/imx219.c
index 3afa3f79c8a2..a9a8cd148f4f 100644
--- a/drivers/media/i2c/imx219.c
+++ b/drivers/media/i2c/imx219.c
@@ -188,8 +188,8 @@ static const struct cci_reg_sequence imx219_common_regs[] = {
 	{ IMX219_REG_MODE_SELECT, 0x00 },	/* Mode Select */
 
 	/* To Access Addresses 3000-5fff, send the following commands */
-	{ CCI_REG8(0x30eb), 0x0c },
 	{ CCI_REG8(0x30eb), 0x05 },
+	{ CCI_REG8(0x30eb), 0x0c },
 	{ CCI_REG8(0x300a), 0xff },
 	{ CCI_REG8(0x300b), 0xff },
 	{ CCI_REG8(0x30eb), 0x05 },
diff --git a/drivers/media/i2c/imx412.c b/drivers/media/i2c/imx412.c
index c7e862ae4040..8597f98a8dcf 100644
--- a/drivers/media/i2c/imx412.c
+++ b/drivers/media/i2c/imx412.c
@@ -544,14 +544,13 @@ static int imx412_update_controls(struct imx412 *imx412,
  */
 static int imx412_update_exp_gain(struct imx412 *imx412, u32 exposure, u32 gain)
 {
-	u32 lpfr, shutter;
+	u32 lpfr;
 	int ret;
 
 	lpfr = imx412->vblank + imx412->cur_mode->height;
-	shutter = lpfr - exposure;
 
-	dev_dbg(imx412->dev, "Set exp %u, analog gain %u, shutter %u, lpfr %u",
-		exposure, gain, shutter, lpfr);
+	dev_dbg(imx412->dev, "Set exp %u, analog gain %u, lpfr %u",
+		exposure, gain, lpfr);
 
 	ret = imx412_write_reg(imx412, IMX412_REG_HOLD, 1, 1);
 	if (ret)
@@ -561,7 +560,7 @@ static int imx412_update_exp_gain(struct imx412 *imx412, u32 exposure, u32 gain)
 	if (ret)
 		goto error_release_group_hold;
 
-	ret = imx412_write_reg(imx412, IMX412_REG_EXPOSURE_CIT, 2, shutter);
+	ret = imx412_write_reg(imx412, IMX412_REG_EXPOSURE_CIT, 2, exposure);
 	if (ret)
 		goto error_release_group_hold;
 
diff --git a/drivers/media/pci/intel/ivsc/mei_csi.c b/drivers/media/pci/intel/ivsc/mei_csi.c
index 5132a7527feb..685b2ec96071 100644
--- a/drivers/media/pci/intel/ivsc/mei_csi.c
+++ b/drivers/media/pci/intel/ivsc/mei_csi.c
@@ -124,6 +124,8 @@ struct mei_csi {
 	struct v4l2_ctrl_handler ctrl_handler;
 	struct v4l2_ctrl *freq_ctrl;
 	struct v4l2_ctrl *privacy_ctrl;
+	/* lock for v4l2 controls */
+	struct mutex ctrl_lock;
 	unsigned int remote_pad;
 	/* start streaming or not */
 	int streaming;
@@ -189,7 +191,11 @@ static int mei_csi_send(struct mei_csi *csi, u8 *buf, size_t len)
 
 	/* command response status */
 	ret = csi->cmd_response.status;
-	if (ret) {
+	if (ret == -1) {
+		/* notify privacy on instead of reporting error */
+		ret = 0;
+		v4l2_ctrl_s_ctrl(csi->privacy_ctrl, 1);
+	} else if (ret) {
 		ret = -EINVAL;
 		goto out;
 	}
@@ -609,11 +615,13 @@ static int mei_csi_init_controls(struct mei_csi *csi)
 	u32 max;
 	int ret;
 
+	mutex_init(&csi->ctrl_lock);
+
 	ret = v4l2_ctrl_handler_init(&csi->ctrl_handler, 2);
 	if (ret)
 		return ret;
 
-	csi->ctrl_handler.lock = &csi->lock;
+	csi->ctrl_handler.lock = &csi->ctrl_lock;
 
 	max = ARRAY_SIZE(link_freq_menu_items) - 1;
 	csi->freq_ctrl = v4l2_ctrl_new_int_menu(&csi->ctrl_handler,
@@ -772,6 +780,7 @@ static int mei_csi_probe(struct mei_cl_device *cldev,
 
 err_ctrl_handler:
 	v4l2_ctrl_handler_free(&csi->ctrl_handler);
+	mutex_destroy(&csi->ctrl_lock);
 	v4l2_async_nf_unregister(&csi->notifier);
 	v4l2_async_nf_cleanup(&csi->notifier);
 
@@ -791,6 +800,7 @@ static void mei_csi_remove(struct mei_cl_device *cldev)
 	v4l2_async_nf_unregister(&csi->notifier);
 	v4l2_async_nf_cleanup(&csi->notifier);
 	v4l2_ctrl_handler_free(&csi->ctrl_handler);
+	mutex_destroy(&csi->ctrl_lock);
 	v4l2_async_unregister_subdev(&csi->subdev);
 	v4l2_subdev_cleanup(&csi->subdev);
 	media_entity_cleanup(&csi->subdev.entity);
diff --git a/drivers/media/pci/ivtv/ivtv-udma.c b/drivers/media/pci/ivtv/ivtv-udma.c
index 99b9f55ca829..f467a00492f4 100644
--- a/drivers/media/pci/ivtv/ivtv-udma.c
+++ b/drivers/media/pci/ivtv/ivtv-udma.c
@@ -131,6 +131,8 @@ int ivtv_udma_setup(struct ivtv *itv, unsigned long ivtv_dest_addr,
 
 	/* Fill SG List with new values */
 	if (ivtv_udma_fill_sg_list(dma, &user_dma, 0) < 0) {
+		IVTV_DEBUG_WARN("%s: could not allocate bounce buffers for highmem userspace buffers\n",
+				__func__);
 		unpin_user_pages(dma->map, dma->page_count);
 		dma->page_count = 0;
 		return -ENOMEM;
@@ -139,6 +141,12 @@ int ivtv_udma_setup(struct ivtv *itv, unsigned long ivtv_dest_addr,
 	/* Map SG List */
 	dma->SG_length = dma_map_sg(&itv->pdev->dev, dma->SGlist,
 				    dma->page_count, DMA_TO_DEVICE);
+	if (!dma->SG_length) {
+		IVTV_DEBUG_WARN("%s: DMA map error, SG_length is 0\n", __func__);
+		unpin_user_pages(dma->map, dma->page_count);
+		dma->page_count = 0;
+		return -EINVAL;
+	}
 
 	/* Fill SG Array with new values */
 	ivtv_udma_fill_sg_array (dma, ivtv_dest_addr, 0, -1);
diff --git a/drivers/media/pci/ivtv/ivtv-yuv.c b/drivers/media/pci/ivtv/ivtv-yuv.c
index 582146f8d70d..2d9274537725 100644
--- a/drivers/media/pci/ivtv/ivtv-yuv.c
+++ b/drivers/media/pci/ivtv/ivtv-yuv.c
@@ -114,6 +114,12 @@ static int ivtv_yuv_prep_user_dma(struct ivtv *itv, struct ivtv_user_dma *dma,
 	}
 	dma->SG_length = dma_map_sg(&itv->pdev->dev, dma->SGlist,
 				    dma->page_count, DMA_TO_DEVICE);
+	if (!dma->SG_length) {
+		IVTV_DEBUG_WARN("%s: DMA map error, SG_length is 0\n", __func__);
+		unpin_user_pages(dma->map, dma->page_count);
+		dma->page_count = 0;
+		return -EINVAL;
+	}
 
 	/* Fill SG Array with new values */
 	ivtv_udma_fill_sg_array(dma, y_buffer_offset, uv_buffer_offset, y_size);
diff --git a/drivers/media/pci/ivtv/ivtvfb.c b/drivers/media/pci/ivtv/ivtvfb.c
index 23c8c094e791..9cdd14a3033c 100644
--- a/drivers/media/pci/ivtv/ivtvfb.c
+++ b/drivers/media/pci/ivtv/ivtvfb.c
@@ -281,10 +281,10 @@ static int ivtvfb_prep_dec_dma_to_device(struct ivtv *itv,
 	/* Map User DMA */
 	if (ivtv_udma_setup(itv, ivtv_dest_addr, userbuf, size_in_bytes) <= 0) {
 		mutex_unlock(&itv->udma.lock);
-		IVTVFB_WARN("ivtvfb_prep_dec_dma_to_device, Error with pin_user_pages: %d bytes, %d pages returned\n",
-			       size_in_bytes, itv->udma.page_count);
+		IVTVFB_WARN("%s, Error in ivtv_udma_setup: %d bytes, %d pages returned\n",
+			       __func__, size_in_bytes, itv->udma.page_count);
 
-		/* pin_user_pages must have failed completely */
+		/* pin_user_pages or DMA must have failed completely */
 		return -EIO;
 	}
 
diff --git a/drivers/media/pci/saa7134/saa7134-dvb.c b/drivers/media/pci/saa7134/saa7134-dvb.c
index 9c6cfef03331..a66df6adfaad 100644
--- a/drivers/media/pci/saa7134/saa7134-dvb.c
+++ b/drivers/media/pci/saa7134/saa7134-dvb.c
@@ -466,7 +466,9 @@ static int philips_europa_tuner_sleep(struct dvb_frontend *fe)
 	/* switch the board to analog mode */
 	if (fe->ops.i2c_gate_ctrl)
 		fe->ops.i2c_gate_ctrl(fe, 1);
-	i2c_transfer(&dev->i2c_adap, &analog_msg, 1);
+	if (i2c_transfer(&dev->i2c_adap, &analog_msg, 1) != 1)
+		return -EIO;
+
 	return 0;
 }
 
@@ -1018,7 +1020,9 @@ static int md8800_set_voltage2(struct dvb_frontend *fe,
 	else
 		wbuf[1] = rbuf & 0xef;
 	msg[0].len = 2;
-	i2c_transfer(&dev->i2c_adap, msg, 1);
+	if (i2c_transfer(&dev->i2c_adap, msg, 1) != 1)
+		return -EIO;
+
 	return 0;
 }
 
diff --git a/drivers/media/platform/mediatek/vcodec/decoder/vdec_vpu_if.c b/drivers/media/platform/mediatek/vcodec/decoder/vdec_vpu_if.c
index da6be556727b..145958206e38 100644
--- a/drivers/media/platform/mediatek/vcodec/decoder/vdec_vpu_if.c
+++ b/drivers/media/platform/mediatek/vcodec/decoder/vdec_vpu_if.c
@@ -233,6 +233,12 @@ int vpu_dec_init(struct vdec_vpu_inst *vpu)
 	mtk_vdec_debug(vpu->ctx, "vdec_inst=%p", vpu);
 
 	err = vcodec_vpu_send_msg(vpu, (void *)&msg, sizeof(msg));
+
+	if (IS_ERR_OR_NULL(vpu->vsi)) {
+		mtk_vdec_err(vpu->ctx, "invalid vdec vsi, status=%d", err);
+		return -EINVAL;
+	}
+
 	mtk_vdec_debug(vpu->ctx, "- ret=%d", err);
 	return err;
 }
diff --git a/drivers/media/platform/nxp/imx-jpeg/mxc-jpeg.c b/drivers/media/platform/nxp/imx-jpeg/mxc-jpeg.c
index 0c8b204535ff..2007152cd7a4 100644
--- a/drivers/media/platform/nxp/imx-jpeg/mxc-jpeg.c
+++ b/drivers/media/platform/nxp/imx-jpeg/mxc-jpeg.c
@@ -1632,6 +1632,9 @@ static int mxc_jpeg_start_streaming(struct vb2_queue *q, unsigned int count)
 	dev_dbg(ctx->mxc_jpeg->dev, "Start streaming ctx=%p", ctx);
 	q_data->sequence = 0;
 
+	if (V4L2_TYPE_IS_CAPTURE(q->type))
+		ctx->need_initial_source_change_evt = false;
+
 	ret = pm_runtime_resume_and_get(ctx->mxc_jpeg->dev);
 	if (ret < 0) {
 		dev_err(ctx->mxc_jpeg->dev, "Failed to power up jpeg\n");
diff --git a/drivers/media/platform/nxp/imx-pxp.c b/drivers/media/platform/nxp/imx-pxp.c
index e62dc5c1a4ae..e4427e6487fb 100644
--- a/drivers/media/platform/nxp/imx-pxp.c
+++ b/drivers/media/platform/nxp/imx-pxp.c
@@ -1805,6 +1805,9 @@ static int pxp_probe(struct platform_device *pdev)
 		return PTR_ERR(mmio);
 	dev->regmap = devm_regmap_init_mmio(&pdev->dev, mmio,
 					    &pxp_regmap_config);
+	if (IS_ERR(dev->regmap))
+		return dev_err_probe(&pdev->dev, PTR_ERR(dev->regmap),
+				     "Failed to init regmap\n");
 
 	irq = platform_get_irq(pdev, 0);
 	if (irq < 0)
diff --git a/drivers/media/platform/qcom/venus/vdec.c b/drivers/media/platform/qcom/venus/vdec.c
index dbf305cec120..884ee6e9d4bd 100644
--- a/drivers/media/platform/qcom/venus/vdec.c
+++ b/drivers/media/platform/qcom/venus/vdec.c
@@ -1255,7 +1255,7 @@ static int vdec_stop_output(struct venus_inst *inst)
 		break;
 	case VENUS_DEC_STATE_INIT:
 	case VENUS_DEC_STATE_CAPTURE_SETUP:
-		ret = hfi_session_flush(inst, HFI_FLUSH_INPUT, true);
+		ret = hfi_session_flush(inst, HFI_FLUSH_ALL, true);
 		break;
 	default:
 		break;
@@ -1747,6 +1747,7 @@ static int vdec_close(struct file *file)
 
 	vdec_pm_get(inst);
 
+	cancel_work_sync(&inst->delayed_process_work);
 	v4l2_m2m_ctx_release(inst->m2m_ctx);
 	v4l2_m2m_release(inst->m2m_dev);
 	vdec_ctrl_deinit(inst);
diff --git a/drivers/media/platform/renesas/rcar-vin/rcar-csi2.c b/drivers/media/platform/renesas/rcar-vin/rcar-csi2.c
index f6326df0b09b..109cca91f733 100644
--- a/drivers/media/platform/renesas/rcar-vin/rcar-csi2.c
+++ b/drivers/media/platform/renesas/rcar-vin/rcar-csi2.c
@@ -1914,12 +1914,14 @@ static int rcsi2_probe(struct platform_device *pdev)
 
 	ret = v4l2_async_register_subdev(&priv->subdev);
 	if (ret < 0)
-		goto error_async;
+		goto error_pm_runtime;
 
 	dev_info(priv->dev, "%d lanes found\n", priv->lanes);
 
 	return 0;
 
+error_pm_runtime:
+	pm_runtime_disable(&pdev->dev);
 error_async:
 	v4l2_async_nf_unregister(&priv->notifier);
 	v4l2_async_nf_cleanup(&priv->notifier);
@@ -1936,6 +1938,7 @@ static void rcsi2_remove(struct platform_device *pdev)
 	v4l2_async_nf_unregister(&priv->notifier);
 	v4l2_async_nf_cleanup(&priv->notifier);
 	v4l2_async_unregister_subdev(&priv->subdev);
+	v4l2_subdev_cleanup(&priv->subdev);
 
 	pm_runtime_disable(&pdev->dev);
 
diff --git a/drivers/media/platform/renesas/rcar-vin/rcar-dma.c b/drivers/media/platform/renesas/rcar-vin/rcar-dma.c
index 2a77353f10b5..bb4774e2f335 100644
--- a/drivers/media/platform/renesas/rcar-vin/rcar-dma.c
+++ b/drivers/media/platform/renesas/rcar-vin/rcar-dma.c
@@ -742,12 +742,22 @@ static int rvin_setup(struct rvin_dev *vin)
 	 */
 	switch (vin->mbus_code) {
 	case MEDIA_BUS_FMT_YUYV8_1X16:
-		/* BT.601/BT.1358 16bit YCbCr422 */
-		vnmc |= VNMC_INF_YUV16;
+		if (vin->is_csi)
+			/* YCbCr422 8-bit */
+			vnmc |= VNMC_INF_YUV8_BT601;
+		else
+			/* BT.601/BT.1358 16bit YCbCr422 */
+			vnmc |= VNMC_INF_YUV16;
 		input_is_yuv = true;
 		break;
 	case MEDIA_BUS_FMT_UYVY8_1X16:
-		vnmc |= VNMC_INF_YUV16 | VNMC_YCAL;
+		if (vin->is_csi)
+			/* YCbCr422 8-bit */
+			vnmc |= VNMC_INF_YUV8_BT601;
+		else
+			/* BT.601/BT.1358 16bit YCbCr422 */
+			vnmc |= VNMC_INF_YUV16;
+		vnmc |= VNMC_YCAL;
 		input_is_yuv = true;
 		break;
 	case MEDIA_BUS_FMT_UYVY8_2X8:
diff --git a/drivers/media/platform/renesas/vsp1/vsp1_histo.c b/drivers/media/platform/renesas/vsp1/vsp1_histo.c
index f22449dd654c..c0f1002f4ecf 100644
--- a/drivers/media/platform/renesas/vsp1/vsp1_histo.c
+++ b/drivers/media/platform/renesas/vsp1/vsp1_histo.c
@@ -36,9 +36,8 @@ struct vsp1_histogram_buffer *
 vsp1_histogram_buffer_get(struct vsp1_histogram *histo)
 {
 	struct vsp1_histogram_buffer *buf = NULL;
-	unsigned long flags;
 
-	spin_lock_irqsave(&histo->irqlock, flags);
+	spin_lock(&histo->irqlock);
 
 	if (list_empty(&histo->irqqueue))
 		goto done;
@@ -49,7 +48,7 @@ vsp1_histogram_buffer_get(struct vsp1_histogram *histo)
 	histo->readout = true;
 
 done:
-	spin_unlock_irqrestore(&histo->irqlock, flags);
+	spin_unlock(&histo->irqlock);
 	return buf;
 }
 
@@ -58,7 +57,6 @@ void vsp1_histogram_buffer_complete(struct vsp1_histogram *histo,
 				    size_t size)
 {
 	struct vsp1_pipeline *pipe = histo->entity.pipe;
-	unsigned long flags;
 
 	/*
 	 * The pipeline pointer is guaranteed to be valid as this function is
@@ -70,10 +68,10 @@ void vsp1_histogram_buffer_complete(struct vsp1_histogram *histo,
 	vb2_set_plane_payload(&buf->buf.vb2_buf, 0, size);
 	vb2_buffer_done(&buf->buf.vb2_buf, VB2_BUF_STATE_DONE);
 
-	spin_lock_irqsave(&histo->irqlock, flags);
+	spin_lock(&histo->irqlock);
 	histo->readout = false;
 	wake_up(&histo->wait_queue);
-	spin_unlock_irqrestore(&histo->irqlock, flags);
+	spin_unlock(&histo->irqlock);
 }
 
 /* -----------------------------------------------------------------------------
@@ -124,11 +122,10 @@ static void histo_buffer_queue(struct vb2_buffer *vb)
 	struct vb2_v4l2_buffer *vbuf = to_vb2_v4l2_buffer(vb);
 	struct vsp1_histogram *histo = vb2_get_drv_priv(vb->vb2_queue);
 	struct vsp1_histogram_buffer *buf = to_vsp1_histogram_buffer(vbuf);
-	unsigned long flags;
 
-	spin_lock_irqsave(&histo->irqlock, flags);
+	spin_lock_irq(&histo->irqlock);
 	list_add_tail(&buf->queue, &histo->irqqueue);
-	spin_unlock_irqrestore(&histo->irqlock, flags);
+	spin_unlock_irq(&histo->irqlock);
 }
 
 static int histo_start_streaming(struct vb2_queue *vq, unsigned int count)
@@ -140,9 +137,8 @@ static void histo_stop_streaming(struct vb2_queue *vq)
 {
 	struct vsp1_histogram *histo = vb2_get_drv_priv(vq);
 	struct vsp1_histogram_buffer *buffer;
-	unsigned long flags;
 
-	spin_lock_irqsave(&histo->irqlock, flags);
+	spin_lock_irq(&histo->irqlock);
 
 	/* Remove all buffers from the IRQ queue. */
 	list_for_each_entry(buffer, &histo->irqqueue, queue)
@@ -152,7 +148,7 @@ static void histo_stop_streaming(struct vb2_queue *vq)
 	/* Wait for the buffer being read out (if any) to complete. */
 	wait_event_lock_irq(histo->wait_queue, !histo->readout, histo->irqlock);
 
-	spin_unlock_irqrestore(&histo->irqlock, flags);
+	spin_unlock_irq(&histo->irqlock);
 }
 
 static const struct vb2_ops histo_video_queue_qops = {
diff --git a/drivers/media/platform/renesas/vsp1/vsp1_pipe.h b/drivers/media/platform/renesas/vsp1/vsp1_pipe.h
index 674b5748d929..85ecd53cda49 100644
--- a/drivers/media/platform/renesas/vsp1/vsp1_pipe.h
+++ b/drivers/media/platform/renesas/vsp1/vsp1_pipe.h
@@ -73,7 +73,7 @@ struct vsp1_partition_window {
  * @wpf: The WPF partition window configuration
  */
 struct vsp1_partition {
-	struct vsp1_partition_window rpf;
+	struct vsp1_partition_window rpf[VSP1_MAX_RPF];
 	struct vsp1_partition_window uds_sink;
 	struct vsp1_partition_window uds_source;
 	struct vsp1_partition_window sru;
diff --git a/drivers/media/platform/renesas/vsp1/vsp1_rpf.c b/drivers/media/platform/renesas/vsp1/vsp1_rpf.c
index ea12c3f12c92..78b6cefc5a01 100644
--- a/drivers/media/platform/renesas/vsp1/vsp1_rpf.c
+++ b/drivers/media/platform/renesas/vsp1/vsp1_rpf.c
@@ -315,8 +315,8 @@ static void rpf_configure_partition(struct vsp1_entity *entity,
 	 * 'width' need to be adjusted.
 	 */
 	if (pipe->partitions > 1) {
-		crop.width = pipe->partition->rpf.width;
-		crop.left += pipe->partition->rpf.left;
+		crop.width = pipe->partition->rpf[rpf->entity.index].width;
+		crop.left += pipe->partition->rpf[rpf->entity.index].left;
 	}
 
 	if (pipe->interlaced) {
@@ -371,7 +371,9 @@ static void rpf_partition(struct vsp1_entity *entity,
 			  unsigned int partition_idx,
 			  struct vsp1_partition_window *window)
 {
-	partition->rpf = *window;
+	struct vsp1_rwpf *rpf = to_rwpf(&entity->subdev);
+
+	partition->rpf[rpf->entity.index] = *window;
 }
 
 static const struct vsp1_entity_operations rpf_entity_ops = {
diff --git a/drivers/media/rc/imon.c b/drivers/media/rc/imon.c
index 5719dda6e0f0..e5590a708f1c 100644
--- a/drivers/media/rc/imon.c
+++ b/drivers/media/rc/imon.c
@@ -1148,10 +1148,7 @@ static int imon_ir_change_protocol(struct rc_dev *rc, u64 *rc_proto)
 
 	memcpy(ictx->usb_tx_buf, &ir_proto_packet, sizeof(ir_proto_packet));
 
-	if (!mutex_is_locked(&ictx->lock)) {
-		unlock = true;
-		mutex_lock(&ictx->lock);
-	}
+	unlock = mutex_trylock(&ictx->lock);
 
 	retval = send_packet(ictx);
 	if (retval)
diff --git a/drivers/media/rc/lirc_dev.c b/drivers/media/rc/lirc_dev.c
index caad59f76793..f8901d6fbe9b 100644
--- a/drivers/media/rc/lirc_dev.c
+++ b/drivers/media/rc/lirc_dev.c
@@ -828,8 +828,10 @@ struct rc_dev *rc_dev_get_from_fd(int fd, bool write)
 		return ERR_PTR(-EINVAL);
 	}
 
-	if (write && !(f.file->f_mode & FMODE_WRITE))
+	if (write && !(f.file->f_mode & FMODE_WRITE)) {
+		fdput(f);
 		return ERR_PTR(-EPERM);
+	}
 
 	fh = f.file->private_data;
 	dev = fh->rc;
diff --git a/drivers/media/usb/dvb-usb/dvb-usb-init.c b/drivers/media/usb/dvb-usb/dvb-usb-init.c
index fbf58012becd..22d83ac18eb7 100644
--- a/drivers/media/usb/dvb-usb/dvb-usb-init.c
+++ b/drivers/media/usb/dvb-usb/dvb-usb-init.c
@@ -23,11 +23,40 @@ static int dvb_usb_force_pid_filter_usage;
 module_param_named(force_pid_filter_usage, dvb_usb_force_pid_filter_usage, int, 0444);
 MODULE_PARM_DESC(force_pid_filter_usage, "force all dvb-usb-devices to use a PID filter, if any (default: 0).");
 
+static int dvb_usb_check_bulk_endpoint(struct dvb_usb_device *d, u8 endpoint)
+{
+	if (endpoint) {
+		int ret;
+
+		ret = usb_pipe_type_check(d->udev, usb_sndbulkpipe(d->udev, endpoint));
+		if (ret)
+			return ret;
+		ret = usb_pipe_type_check(d->udev, usb_rcvbulkpipe(d->udev, endpoint));
+		if (ret)
+			return ret;
+	}
+	return 0;
+}
+
+static void dvb_usb_clear_halt(struct dvb_usb_device *d, u8 endpoint)
+{
+	if (endpoint) {
+		usb_clear_halt(d->udev, usb_sndbulkpipe(d->udev, endpoint));
+		usb_clear_halt(d->udev, usb_rcvbulkpipe(d->udev, endpoint));
+	}
+}
+
 static int dvb_usb_adapter_init(struct dvb_usb_device *d, short *adapter_nrs)
 {
 	struct dvb_usb_adapter *adap;
 	int ret, n, o;
 
+	ret = dvb_usb_check_bulk_endpoint(d, d->props.generic_bulk_ctrl_endpoint);
+	if (ret)
+		return ret;
+	ret = dvb_usb_check_bulk_endpoint(d, d->props.generic_bulk_ctrl_endpoint_response);
+	if (ret)
+		return ret;
 	for (n = 0; n < d->props.num_adapters; n++) {
 		adap = &d->adapter[n];
 		adap->dev = d;
@@ -103,10 +132,8 @@ static int dvb_usb_adapter_init(struct dvb_usb_device *d, short *adapter_nrs)
 	 * when reloading the driver w/o replugging the device
 	 * sometimes a timeout occurs, this helps
 	 */
-	if (d->props.generic_bulk_ctrl_endpoint != 0) {
-		usb_clear_halt(d->udev, usb_sndbulkpipe(d->udev, d->props.generic_bulk_ctrl_endpoint));
-		usb_clear_halt(d->udev, usb_rcvbulkpipe(d->udev, d->props.generic_bulk_ctrl_endpoint));
-	}
+	dvb_usb_clear_halt(d, d->props.generic_bulk_ctrl_endpoint);
+	dvb_usb_clear_halt(d, d->props.generic_bulk_ctrl_endpoint_response);
 
 	return 0;
 
diff --git a/drivers/media/usb/uvc/uvc_ctrl.c b/drivers/media/usb/uvc/uvc_ctrl.c
index e59a463c2761..07158e9451fe 100644
--- a/drivers/media/usb/uvc/uvc_ctrl.c
+++ b/drivers/media/usb/uvc/uvc_ctrl.c
@@ -2029,7 +2029,13 @@ static int uvc_ctrl_get_flags(struct uvc_device *dev,
 	else
 		ret = uvc_query_ctrl(dev, UVC_GET_INFO, ctrl->entity->id,
 				     dev->intfnum, info->selector, data, 1);
-	if (!ret)
+
+	if (!ret) {
+		info->flags &= ~(UVC_CTRL_FLAG_GET_CUR |
+				 UVC_CTRL_FLAG_SET_CUR |
+				 UVC_CTRL_FLAG_AUTO_UPDATE |
+				 UVC_CTRL_FLAG_ASYNCHRONOUS);
+
 		info->flags |= (data[0] & UVC_CONTROL_CAP_GET ?
 				UVC_CTRL_FLAG_GET_CUR : 0)
 			    |  (data[0] & UVC_CONTROL_CAP_SET ?
@@ -2038,6 +2044,7 @@ static int uvc_ctrl_get_flags(struct uvc_device *dev,
 				UVC_CTRL_FLAG_AUTO_UPDATE : 0)
 			    |  (data[0] & UVC_CONTROL_CAP_ASYNCHRONOUS ?
 				UVC_CTRL_FLAG_ASYNCHRONOUS : 0);
+	}
 
 	kfree(data);
 	return ret;
diff --git a/drivers/media/usb/uvc/uvc_driver.c b/drivers/media/usb/uvc/uvc_driver.c
index 91a41aa3ced2..68bf41147a61 100644
--- a/drivers/media/usb/uvc/uvc_driver.c
+++ b/drivers/media/usb/uvc/uvc_driver.c
@@ -2236,8 +2236,11 @@ static int uvc_probe(struct usb_interface *intf,
 	if (dev->quirks & UVC_QUIRK_NO_RESET_RESUME)
 		udev->quirks &= ~USB_QUIRK_RESET_RESUME;
 
+	if (!(dev->quirks & UVC_QUIRK_DISABLE_AUTOSUSPEND))
+		usb_enable_autosuspend(udev);
+
 	uvc_dbg(dev, PROBE, "UVC device initialized\n");
-	usb_enable_autosuspend(udev);
+
 	return 0;
 
 error:
@@ -2577,7 +2580,17 @@ static const struct usb_device_id uvc_ids[] = {
 	  .bInterfaceClass	= USB_CLASS_VIDEO,
 	  .bInterfaceSubClass	= 1,
 	  .bInterfaceProtocol	= 0,
-	  .driver_info		= UVC_INFO_QUIRK(UVC_QUIRK_RESTORE_CTRLS_ON_INIT) },
+	  .driver_info		= UVC_INFO_QUIRK(UVC_QUIRK_RESTORE_CTRLS_ON_INIT
+					       | UVC_QUIRK_INVALID_DEVICE_SOF) },
+	/* Logitech HD Pro Webcam C922 */
+	{ .match_flags		= USB_DEVICE_ID_MATCH_DEVICE
+				| USB_DEVICE_ID_MATCH_INT_INFO,
+	  .idVendor		= 0x046d,
+	  .idProduct		= 0x085c,
+	  .bInterfaceClass	= USB_CLASS_VIDEO,
+	  .bInterfaceSubClass	= 1,
+	  .bInterfaceProtocol	= 0,
+	  .driver_info		= UVC_INFO_QUIRK(UVC_QUIRK_INVALID_DEVICE_SOF) },
 	/* Logitech Rally Bar Huddle */
 	{ .match_flags		= USB_DEVICE_ID_MATCH_DEVICE
 				| USB_DEVICE_ID_MATCH_INT_INFO,
@@ -3043,6 +3056,15 @@ static const struct usb_device_id uvc_ids[] = {
 	  .bInterfaceSubClass	= 1,
 	  .bInterfaceProtocol	= UVC_PC_PROTOCOL_15,
 	  .driver_info		= (kernel_ulong_t)&uvc_ctrl_power_line_uvc11 },
+	/* Insta360 Link */
+	{ .match_flags		= USB_DEVICE_ID_MATCH_DEVICE
+				| USB_DEVICE_ID_MATCH_INT_INFO,
+	  .idVendor		= 0x2e1a,
+	  .idProduct		= 0x4c01,
+	  .bInterfaceClass	= USB_CLASS_VIDEO,
+	  .bInterfaceSubClass	= 1,
+	  .bInterfaceProtocol	= 0,
+	  .driver_info		= UVC_INFO_QUIRK(UVC_QUIRK_DISABLE_AUTOSUSPEND) },
 	/* Lenovo Integrated Camera */
 	{ .match_flags		= USB_DEVICE_ID_MATCH_DEVICE
 				| USB_DEVICE_ID_MATCH_INT_INFO,
diff --git a/drivers/media/usb/uvc/uvc_video.c b/drivers/media/usb/uvc/uvc_video.c
index 28dde08ec6c5..5eef560bc8cd 100644
--- a/drivers/media/usb/uvc/uvc_video.c
+++ b/drivers/media/usb/uvc/uvc_video.c
@@ -529,6 +529,17 @@ uvc_video_clock_decode(struct uvc_streaming *stream, struct uvc_buffer *buf,
 	stream->clock.last_sof = dev_sof;
 
 	host_sof = usb_get_current_frame_number(stream->dev->udev);
+
+	/*
+	 * On some devices, like the Logitech C922, the device SOF does not run
+	 * at a stable rate of 1kHz. For those devices use the host SOF instead.
+	 * In the tests performed so far, this improves the timestamp precision.
+	 * This is probably explained by a small packet handling jitter from the
+	 * host, but the exact reason hasn't been fully determined.
+	 */
+	if (stream->dev->quirks & UVC_QUIRK_INVALID_DEVICE_SOF)
+		dev_sof = host_sof;
+
 	time = uvc_video_get_time();
 
 	/*
@@ -709,11 +720,11 @@ void uvc_video_clock_update(struct uvc_streaming *stream,
 	unsigned long flags;
 	u64 timestamp;
 	u32 delta_stc;
-	u32 y1, y2;
+	u32 y1;
 	u32 x1, x2;
 	u32 mean;
 	u32 sof;
-	u64 y;
+	u64 y, y2;
 
 	if (!uvc_hw_timestamps_param)
 		return;
@@ -753,7 +764,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream,
 	sof = y;
 
 	uvc_dbg(stream->dev, CLOCK,
-		"%s: PTS %u y %llu.%06llu SOF %u.%06llu (x1 %u x2 %u y1 %u y2 %u SOF offset %u)\n",
+		"%s: PTS %u y %llu.%06llu SOF %u.%06llu (x1 %u x2 %u y1 %u y2 %llu SOF offset %u)\n",
 		stream->dev->name, buf->pts,
 		y >> 16, div_u64((y & 0xffff) * 1000000, 65536),
 		sof >> 16, div_u64(((u64)sof & 0xffff) * 1000000LLU, 65536),
@@ -768,7 +779,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream,
 		goto done;
 
 	y1 = NSEC_PER_SEC;
-	y2 = (u32)ktime_to_ns(ktime_sub(last->host_time, first->host_time)) + y1;
+	y2 = ktime_to_ns(ktime_sub(last->host_time, first->host_time)) + y1;
 
 	/*
 	 * Interpolated and host SOF timestamps can wrap around at slightly
@@ -789,7 +800,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream,
 	timestamp = ktime_to_ns(first->host_time) + y - y1;
 
 	uvc_dbg(stream->dev, CLOCK,
-		"%s: SOF %u.%06llu y %llu ts %llu buf ts %llu (x1 %u/%u/%u x2 %u/%u/%u y1 %u y2 %u)\n",
+		"%s: SOF %u.%06llu y %llu ts %llu buf ts %llu (x1 %u/%u/%u x2 %u/%u/%u y1 %u y2 %llu)\n",
 		stream->dev->name,
 		sof >> 16, div_u64(((u64)sof & 0xffff) * 1000000LLU, 65536),
 		y, timestamp, vbuf->vb2_buf.timestamp,
diff --git a/drivers/media/usb/uvc/uvcvideo.h b/drivers/media/usb/uvc/uvcvideo.h
index 88218693f6f0..e5b12717016f 100644
--- a/drivers/media/usb/uvc/uvcvideo.h
+++ b/drivers/media/usb/uvc/uvcvideo.h
@@ -74,6 +74,8 @@
 #define UVC_QUIRK_FORCE_BPP		0x00001000
 #define UVC_QUIRK_WAKE_AUTOSUSPEND	0x00002000
 #define UVC_QUIRK_NO_RESET_RESUME	0x00004000
+#define UVC_QUIRK_DISABLE_AUTOSUSPEND	0x00008000
+#define UVC_QUIRK_INVALID_DEVICE_SOF	0x00010000
 
 /* Format flags */
 #define UVC_FMT_FLAG_COMPRESSED		0x00000001
diff --git a/drivers/media/v4l2-core/v4l2-async.c b/drivers/media/v4l2-core/v4l2-async.c
index eaa15b8df76d..ac4d987bba25 100644
--- a/drivers/media/v4l2-core/v4l2-async.c
+++ b/drivers/media/v4l2-core/v4l2-async.c
@@ -324,6 +324,9 @@ static int v4l2_async_create_ancillary_links(struct v4l2_async_notifier *n,
 	    sd->entity.function != MEDIA_ENT_F_FLASH)
 		return 0;
 
+	if (!n->sd)
+		return 0;
+
 	link = media_create_ancillary_link(&n->sd->entity, &sd->entity);
 
 #endif
diff --git a/drivers/memory/Kconfig b/drivers/memory/Kconfig
index 8efdd1f97139..c82d8d8a16ea 100644
--- a/drivers/memory/Kconfig
+++ b/drivers/memory/Kconfig
@@ -167,7 +167,7 @@ config FSL_CORENET_CF
 	  represents a coherency violation.
 
 config FSL_IFC
-	bool "Freescale IFC driver" if COMPILE_TEST
+	bool "Freescale IFC driver"
 	depends on FSL_SOC || ARCH_LAYERSCAPE || SOC_LS1021A || COMPILE_TEST
 	depends on HAS_IOMEM
 
diff --git a/drivers/mfd/Makefile b/drivers/mfd/Makefile
index c66f07edcd0e..db1ba39de3b5 100644
--- a/drivers/mfd/Makefile
+++ b/drivers/mfd/Makefile
@@ -280,7 +280,5 @@ obj-$(CONFIG_MFD_INTEL_M10_BMC_PMCI)   += intel-m10-bmc-pmci.o
 obj-$(CONFIG_MFD_ATC260X)	+= atc260x-core.o
 obj-$(CONFIG_MFD_ATC260X_I2C)	+= atc260x-i2c.o
 
-rsmu-i2c-objs			:= rsmu_core.o rsmu_i2c.o
-rsmu-spi-objs			:= rsmu_core.o rsmu_spi.o
-obj-$(CONFIG_MFD_RSMU_I2C)	+= rsmu-i2c.o
-obj-$(CONFIG_MFD_RSMU_SPI)	+= rsmu-spi.o
+obj-$(CONFIG_MFD_RSMU_I2C)	+= rsmu_i2c.o rsmu_core.o
+obj-$(CONFIG_MFD_RSMU_SPI)	+= rsmu_spi.o rsmu_core.o
diff --git a/drivers/mfd/omap-usb-tll.c b/drivers/mfd/omap-usb-tll.c
index 906353735c78..5ba2b2352749 100644
--- a/drivers/mfd/omap-usb-tll.c
+++ b/drivers/mfd/omap-usb-tll.c
@@ -230,8 +230,7 @@ static int usbtll_omap_probe(struct platform_device *pdev)
 		break;
 	}
 
-	tll = devm_kzalloc(dev, sizeof(*tll) + sizeof(tll->ch_clk[nch]),
-			   GFP_KERNEL);
+	tll = devm_kzalloc(dev, struct_size(tll, ch_clk, nch), GFP_KERNEL);
 	if (!tll) {
 		pm_runtime_put_sync(dev);
 		pm_runtime_disable(dev);
diff --git a/drivers/mfd/rsmu_core.c b/drivers/mfd/rsmu_core.c
index 29437fd0bd5b..fd04a6e5dfa3 100644
--- a/drivers/mfd/rsmu_core.c
+++ b/drivers/mfd/rsmu_core.c
@@ -78,11 +78,13 @@ int rsmu_core_init(struct rsmu_ddata *rsmu)
 
 	return ret;
 }
+EXPORT_SYMBOL_GPL(rsmu_core_init);
 
 void rsmu_core_exit(struct rsmu_ddata *rsmu)
 {
 	mutex_destroy(&rsmu->lock);
 }
+EXPORT_SYMBOL_GPL(rsmu_core_exit);
 
 MODULE_DESCRIPTION("Renesas SMU core driver");
 MODULE_LICENSE("GPL");
diff --git a/drivers/mtd/nand/raw/Kconfig b/drivers/mtd/nand/raw/Kconfig
index cbf8ae85e1ae..614257308516 100644
--- a/drivers/mtd/nand/raw/Kconfig
+++ b/drivers/mtd/nand/raw/Kconfig
@@ -234,8 +234,7 @@ config MTD_NAND_FSL_IFC
 	tristate "Freescale IFC NAND controller"
 	depends on FSL_SOC || ARCH_LAYERSCAPE || SOC_LS1021A || COMPILE_TEST
 	depends on HAS_IOMEM
-	select FSL_IFC
-	select MEMORY
+	depends on FSL_IFC
 	help
 	  Various Freescale chips e.g P1010, include a NAND Flash machine
 	  with built-in hardware ECC capabilities.
diff --git a/drivers/mtd/tests/Makefile b/drivers/mtd/tests/Makefile
index 5de0378f90db..7dae831ee8b6 100644
--- a/drivers/mtd/tests/Makefile
+++ b/drivers/mtd/tests/Makefile
@@ -1,19 +1,19 @@
 # SPDX-License-Identifier: GPL-2.0
-obj-$(CONFIG_MTD_TESTS) += mtd_oobtest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_pagetest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_readtest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_speedtest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_stresstest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_subpagetest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_torturetest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_nandecctest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_nandbiterrs.o
+obj-$(CONFIG_MTD_TESTS) += mtd_oobtest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_pagetest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_readtest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_speedtest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_stresstest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_subpagetest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_torturetest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_nandecctest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_nandbiterrs.o mtd_test.o
 
-mtd_oobtest-objs := oobtest.o mtd_test.o
-mtd_pagetest-objs := pagetest.o mtd_test.o
-mtd_readtest-objs := readtest.o mtd_test.o
-mtd_speedtest-objs := speedtest.o mtd_test.o
-mtd_stresstest-objs := stresstest.o mtd_test.o
-mtd_subpagetest-objs := subpagetest.o mtd_test.o
-mtd_torturetest-objs := torturetest.o mtd_test.o
-mtd_nandbiterrs-objs := nandbiterrs.o mtd_test.o
+mtd_oobtest-objs := oobtest.o
+mtd_pagetest-objs := pagetest.o
+mtd_readtest-objs := readtest.o
+mtd_speedtest-objs := speedtest.o
+mtd_stresstest-objs := stresstest.o
+mtd_subpagetest-objs := subpagetest.o
+mtd_torturetest-objs := torturetest.o
+mtd_nandbiterrs-objs := nandbiterrs.o
diff --git a/drivers/mtd/tests/mtd_test.c b/drivers/mtd/tests/mtd_test.c
index c84250beffdc..f391e0300cdc 100644
--- a/drivers/mtd/tests/mtd_test.c
+++ b/drivers/mtd/tests/mtd_test.c
@@ -25,6 +25,7 @@ int mtdtest_erase_eraseblock(struct mtd_info *mtd, unsigned int ebnum)
 
 	return 0;
 }
+EXPORT_SYMBOL_GPL(mtdtest_erase_eraseblock);
 
 static int is_block_bad(struct mtd_info *mtd, unsigned int ebnum)
 {
@@ -57,6 +58,7 @@ int mtdtest_scan_for_bad_eraseblocks(struct mtd_info *mtd, unsigned char *bbt,
 
 	return 0;
 }
+EXPORT_SYMBOL_GPL(mtdtest_scan_for_bad_eraseblocks);
 
 int mtdtest_erase_good_eraseblocks(struct mtd_info *mtd, unsigned char *bbt,
 				unsigned int eb, int ebcnt)
@@ -75,6 +77,7 @@ int mtdtest_erase_good_eraseblocks(struct mtd_info *mtd, unsigned char *bbt,
 
 	return 0;
 }
+EXPORT_SYMBOL_GPL(mtdtest_erase_good_eraseblocks);
 
 int mtdtest_read(struct mtd_info *mtd, loff_t addr, size_t size, void *buf)
 {
@@ -92,6 +95,7 @@ int mtdtest_read(struct mtd_info *mtd, loff_t addr, size_t size, void *buf)
 
 	return err;
 }
+EXPORT_SYMBOL_GPL(mtdtest_read);
 
 int mtdtest_write(struct mtd_info *mtd, loff_t addr, size_t size,
 		const void *buf)
@@ -107,3 +111,8 @@ int mtdtest_write(struct mtd_info *mtd, loff_t addr, size_t size,
 
 	return err;
 }
+EXPORT_SYMBOL_GPL(mtdtest_write);
+
+MODULE_LICENSE("GPL");
+MODULE_DESCRIPTION("MTD function test helpers");
+MODULE_AUTHOR("Akinobu Mita");
diff --git a/drivers/mtd/ubi/eba.c b/drivers/mtd/ubi/eba.c
index 655ff41863e2..3b71924f4920 100644
--- a/drivers/mtd/ubi/eba.c
+++ b/drivers/mtd/ubi/eba.c
@@ -1560,6 +1560,7 @@ int self_check_eba(struct ubi_device *ubi, struct ubi_attach_info *ai_fastmap,
 					  GFP_KERNEL);
 		if (!fm_eba[i]) {
 			ret = -ENOMEM;
+			kfree(scan_eba[i]);
 			goto out_free;
 		}
 
@@ -1595,7 +1596,7 @@ int self_check_eba(struct ubi_device *ubi, struct ubi_attach_info *ai_fastmap,
 	}
 
 out_free:
-	for (i = 0; i < num_volumes; i++) {
+	while (--i >= 0) {
 		if (!ubi->volumes[i])
 			continue;
 
diff --git a/drivers/net/bonding/bond_main.c b/drivers/net/bonding/bond_main.c
index 34880b2db805..722ac5c4992c 100644
--- a/drivers/net/bonding/bond_main.c
+++ b/drivers/net/bonding/bond_main.c
@@ -1121,13 +1121,10 @@ static struct slave *bond_find_best_slave(struct bonding *bond)
 	return bestslave;
 }
 
+/* must be called in RCU critical section or with RTNL held */
 static bool bond_should_notify_peers(struct bonding *bond)
 {
-	struct slave *slave;
-
-	rcu_read_lock();
-	slave = rcu_dereference(bond->curr_active_slave);
-	rcu_read_unlock();
+	struct slave *slave = rcu_dereference_rtnl(bond->curr_active_slave);
 
 	if (!slave || !bond->send_peer_notif ||
 	    bond->send_peer_notif %
diff --git a/drivers/net/dsa/b53/b53_common.c b/drivers/net/dsa/b53/b53_common.c
index 4e27dc913cf7..ae1c4dc35fe3 100644
--- a/drivers/net/dsa/b53/b53_common.c
+++ b/drivers/net/dsa/b53/b53_common.c
@@ -2265,6 +2265,9 @@ static int b53_change_mtu(struct dsa_switch *ds, int port, int mtu)
 	if (is5325(dev) || is5365(dev))
 		return -EOPNOTSUPP;
 
+	if (!dsa_is_cpu_port(ds, port))
+		return 0;
+
 	enable_jumbo = (mtu >= JMS_MIN_SIZE);
 	allow_10_100 = (dev->chip_id == BCM583XX_DEVICE_ID);
 
diff --git a/drivers/net/dsa/mv88e6xxx/chip.c b/drivers/net/dsa/mv88e6xxx/chip.c
index 354d4af13456..3877744193e2 100644
--- a/drivers/net/dsa/mv88e6xxx/chip.c
+++ b/drivers/net/dsa/mv88e6xxx/chip.c
@@ -3490,7 +3490,8 @@ static int mv88e6xxx_change_mtu(struct dsa_switch *ds, int port, int new_mtu)
 	mv88e6xxx_reg_lock(chip);
 	if (chip->info->ops->port_set_jumbo_size)
 		ret = chip->info->ops->port_set_jumbo_size(chip, port, new_mtu);
-	else if (chip->info->ops->set_max_frame_size)
+	else if (chip->info->ops->set_max_frame_size &&
+		 dsa_is_cpu_port(ds, port))
 		ret = chip->info->ops->set_max_frame_size(chip, new_mtu);
 	mv88e6xxx_reg_unlock(chip);
 
diff --git a/drivers/net/ethernet/brocade/bna/bna_types.h b/drivers/net/ethernet/brocade/bna/bna_types.h
index a5ebd7110e07..986f43d27711 100644
--- a/drivers/net/ethernet/brocade/bna/bna_types.h
+++ b/drivers/net/ethernet/brocade/bna/bna_types.h
@@ -416,7 +416,7 @@ struct bna_ib {
 /* Tx object */
 
 /* Tx datapath control structure */
-#define BNA_Q_NAME_SIZE		16
+#define BNA_Q_NAME_SIZE		(IFNAMSIZ + 6)
 struct bna_tcb {
 	/* Fast path */
 	void			**sw_qpt;
diff --git a/drivers/net/ethernet/brocade/bna/bnad.c b/drivers/net/ethernet/brocade/bna/bnad.c
index 31191b520b58..6cf06a93bedf 100644
--- a/drivers/net/ethernet/brocade/bna/bnad.c
+++ b/drivers/net/ethernet/brocade/bna/bnad.c
@@ -1534,8 +1534,9 @@ bnad_tx_msix_register(struct bnad *bnad, struct bnad_tx_info *tx_info,
 
 	for (i = 0; i < num_txqs; i++) {
 		vector_num = tx_info->tcb[i]->intr_vector;
-		sprintf(tx_info->tcb[i]->name, "%s TXQ %d", bnad->netdev->name,
-				tx_id + tx_info->tcb[i]->id);
+		snprintf(tx_info->tcb[i]->name, BNA_Q_NAME_SIZE, "%s TXQ %d",
+			 bnad->netdev->name,
+			 tx_id + tx_info->tcb[i]->id);
 		err = request_irq(bnad->msix_table[vector_num].vector,
 				  (irq_handler_t)bnad_msix_tx, 0,
 				  tx_info->tcb[i]->name,
@@ -1585,9 +1586,9 @@ bnad_rx_msix_register(struct bnad *bnad, struct bnad_rx_info *rx_info,
 
 	for (i = 0; i < num_rxps; i++) {
 		vector_num = rx_info->rx_ctrl[i].ccb->intr_vector;
-		sprintf(rx_info->rx_ctrl[i].ccb->name, "%s CQ %d",
-			bnad->netdev->name,
-			rx_id + rx_info->rx_ctrl[i].ccb->id);
+		snprintf(rx_info->rx_ctrl[i].ccb->name, BNA_Q_NAME_SIZE,
+			 "%s CQ %d", bnad->netdev->name,
+			 rx_id + rx_info->rx_ctrl[i].ccb->id);
 		err = request_irq(bnad->msix_table[vector_num].vector,
 				  (irq_handler_t)bnad_msix_rx, 0,
 				  rx_info->rx_ctrl[i].ccb->name,
diff --git a/drivers/net/ethernet/freescale/fec_main.c b/drivers/net/ethernet/freescale/fec_main.c
index d675f9d5f361..5604a47b35b2 100644
--- a/drivers/net/ethernet/freescale/fec_main.c
+++ b/drivers/net/ethernet/freescale/fec_main.c
@@ -283,8 +283,8 @@ MODULE_PARM_DESC(macaddr, "FEC Ethernet MAC address");
 #define PKT_MINBUF_SIZE		64
 
 /* FEC receive acceleration */
-#define FEC_RACC_IPDIS		(1 << 1)
-#define FEC_RACC_PRODIS		(1 << 2)
+#define FEC_RACC_IPDIS		BIT(1)
+#define FEC_RACC_PRODIS		BIT(2)
 #define FEC_RACC_SHIFT16	BIT(7)
 #define FEC_RACC_OPTIONS	(FEC_RACC_IPDIS | FEC_RACC_PRODIS)
 
@@ -316,8 +316,23 @@ MODULE_PARM_DESC(macaddr, "FEC Ethernet MAC address");
 #define FEC_MMFR_TA		(2 << 16)
 #define FEC_MMFR_DATA(v)	(v & 0xffff)
 /* FEC ECR bits definition */
-#define FEC_ECR_MAGICEN		(1 << 2)
-#define FEC_ECR_SLEEP		(1 << 3)
+#define FEC_ECR_RESET           BIT(0)
+#define FEC_ECR_ETHEREN         BIT(1)
+#define FEC_ECR_MAGICEN         BIT(2)
+#define FEC_ECR_SLEEP           BIT(3)
+#define FEC_ECR_EN1588          BIT(4)
+#define FEC_ECR_BYTESWP         BIT(8)
+/* FEC RCR bits definition */
+#define FEC_RCR_LOOP            BIT(0)
+#define FEC_RCR_HALFDPX         BIT(1)
+#define FEC_RCR_MII             BIT(2)
+#define FEC_RCR_PROMISC         BIT(3)
+#define FEC_RCR_BC_REJ          BIT(4)
+#define FEC_RCR_FLOWCTL         BIT(5)
+#define FEC_RCR_RMII            BIT(8)
+#define FEC_RCR_10BASET         BIT(9)
+/* TX WMARK bits */
+#define FEC_TXWMRK_STRFWD       BIT(8)
 
 #define FEC_MII_TIMEOUT		30000 /* us */
 
@@ -1041,7 +1056,7 @@ fec_restart(struct net_device *ndev)
 	struct fec_enet_private *fep = netdev_priv(ndev);
 	u32 temp_mac[2];
 	u32 rcntl = OPT_FRAME_SIZE | 0x04;
-	u32 ecntl = 0x2; /* ETHEREN */
+	u32 ecntl = FEC_ECR_ETHEREN;
 
 	/* Whack a reset.  We should wait for this.
 	 * For i.MX6SX SOC, enet use AXI bus, we use disable MAC
@@ -1116,18 +1131,18 @@ fec_restart(struct net_device *ndev)
 		    fep->phy_interface == PHY_INTERFACE_MODE_RGMII_TXID)
 			rcntl |= (1 << 6);
 		else if (fep->phy_interface == PHY_INTERFACE_MODE_RMII)
-			rcntl |= (1 << 8);
+			rcntl |= FEC_RCR_RMII;
 		else
-			rcntl &= ~(1 << 8);
+			rcntl &= ~FEC_RCR_RMII;
 
 		/* 1G, 100M or 10M */
 		if (ndev->phydev) {
 			if (ndev->phydev->speed == SPEED_1000)
 				ecntl |= (1 << 5);
 			else if (ndev->phydev->speed == SPEED_100)
-				rcntl &= ~(1 << 9);
+				rcntl &= ~FEC_RCR_10BASET;
 			else
-				rcntl |= (1 << 9);
+				rcntl |= FEC_RCR_10BASET;
 		}
 	} else {
 #ifdef FEC_MIIGSK_ENR
@@ -1186,13 +1201,13 @@ fec_restart(struct net_device *ndev)
 
 	if (fep->quirks & FEC_QUIRK_ENET_MAC) {
 		/* enable ENET endian swap */
-		ecntl |= (1 << 8);
+		ecntl |= FEC_ECR_BYTESWP;
 		/* enable ENET store and forward mode */
-		writel(1 << 8, fep->hwp + FEC_X_WMRK);
+		writel(FEC_TXWMRK_STRFWD, fep->hwp + FEC_X_WMRK);
 	}
 
 	if (fep->bufdesc_ex)
-		ecntl |= (1 << 4);
+		ecntl |= FEC_ECR_EN1588;
 
 	if (fep->quirks & FEC_QUIRK_DELAYED_CLKS_SUPPORT &&
 	    fep->rgmii_txc_dly)
@@ -1291,7 +1306,7 @@ static void
 fec_stop(struct net_device *ndev)
 {
 	struct fec_enet_private *fep = netdev_priv(ndev);
-	u32 rmii_mode = readl(fep->hwp + FEC_R_CNTRL) & (1 << 8);
+	u32 rmii_mode = readl(fep->hwp + FEC_R_CNTRL) & FEC_RCR_RMII;
 	u32 val;
 
 	/* We cannot expect a graceful transmit stop without link !!! */
@@ -1310,7 +1325,7 @@ fec_stop(struct net_device *ndev)
 		if (fep->quirks & FEC_QUIRK_HAS_MULTI_QUEUES) {
 			writel(0, fep->hwp + FEC_ECNTRL);
 		} else {
-			writel(1, fep->hwp + FEC_ECNTRL);
+			writel(FEC_ECR_RESET, fep->hwp + FEC_ECNTRL);
 			udelay(10);
 		}
 	} else {
@@ -1324,11 +1339,16 @@ fec_stop(struct net_device *ndev)
 	/* We have to keep ENET enabled to have MII interrupt stay working */
 	if (fep->quirks & FEC_QUIRK_ENET_MAC &&
 		!(fep->wol_flag & FEC_WOL_FLAG_SLEEP_ON)) {
-		writel(2, fep->hwp + FEC_ECNTRL);
+		writel(FEC_ECR_ETHEREN, fep->hwp + FEC_ECNTRL);
 		writel(rmii_mode, fep->hwp + FEC_R_CNTRL);
 	}
-}
 
+	if (fep->bufdesc_ex) {
+		val = readl(fep->hwp + FEC_ECNTRL);
+		val |= FEC_ECR_EN1588;
+		writel(val, fep->hwp + FEC_ECNTRL);
+	}
+}
 
 static void
 fec_timeout(struct net_device *ndev, unsigned int txqueue)
diff --git a/drivers/net/ethernet/google/gve/gve_tx.c b/drivers/net/ethernet/google/gve/gve_tx.c
index 9f6ffc4a54f0..2ae891a62875 100644
--- a/drivers/net/ethernet/google/gve/gve_tx.c
+++ b/drivers/net/ethernet/google/gve/gve_tx.c
@@ -158,15 +158,16 @@ static int gve_clean_xdp_done(struct gve_priv *priv, struct gve_tx_ring *tx,
 			      u32 to_do)
 {
 	struct gve_tx_buffer_state *info;
-	u32 clean_end = tx->done + to_do;
 	u64 pkts = 0, bytes = 0;
 	size_t space_freed = 0;
 	u32 xsk_complete = 0;
 	u32 idx;
+	int i;
 
-	for (; tx->done < clean_end; tx->done++) {
+	for (i = 0; i < to_do; i++) {
 		idx = tx->done & tx->mask;
 		info = &tx->info[idx];
+		tx->done++;
 
 		if (unlikely(!info->xdp.size))
 			continue;
diff --git a/drivers/net/ethernet/google/gve/gve_tx_dqo.c b/drivers/net/ethernet/google/gve/gve_tx_dqo.c
index 5a44354bbdfd..89b62b8d16e1 100644
--- a/drivers/net/ethernet/google/gve/gve_tx_dqo.c
+++ b/drivers/net/ethernet/google/gve/gve_tx_dqo.c
@@ -812,22 +812,42 @@ static bool gve_can_send_tso(const struct sk_buff *skb)
 	const int header_len = skb_tcp_all_headers(skb);
 	const int gso_size = shinfo->gso_size;
 	int cur_seg_num_bufs;
+	int prev_frag_size;
 	int cur_seg_size;
 	int i;
 
 	cur_seg_size = skb_headlen(skb) - header_len;
+	prev_frag_size = skb_headlen(skb);
 	cur_seg_num_bufs = cur_seg_size > 0;
 
 	for (i = 0; i < shinfo->nr_frags; i++) {
 		if (cur_seg_size >= gso_size) {
 			cur_seg_size %= gso_size;
 			cur_seg_num_bufs = cur_seg_size > 0;
+
+			if (prev_frag_size > GVE_TX_MAX_BUF_SIZE_DQO) {
+				int prev_frag_remain = prev_frag_size %
+					GVE_TX_MAX_BUF_SIZE_DQO;
+
+				/* If the last descriptor of the previous frag
+				 * is less than cur_seg_size, the segment will
+				 * span two descriptors in the previous frag.
+				 * Since max gso size (9728) is less than
+				 * GVE_TX_MAX_BUF_SIZE_DQO, it is impossible
+				 * for the segment to span more than two
+				 * descriptors.
+				 */
+				if (prev_frag_remain &&
+				    cur_seg_size > prev_frag_remain)
+					cur_seg_num_bufs++;
+			}
 		}
 
 		if (unlikely(++cur_seg_num_bufs > max_bufs_per_seg))
 			return false;
 
-		cur_seg_size += skb_frag_size(&shinfo->frags[i]);
+		prev_frag_size = skb_frag_size(&shinfo->frags[i]);
+		cur_seg_size += prev_frag_size;
 	}
 
 	return true;
diff --git a/drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c b/drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c
index 8c6e13f87b7d..1839a37139dc 100644
--- a/drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c
+++ b/drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c
@@ -531,7 +531,7 @@ ice_parse_rx_flow_user_data(struct ethtool_rx_flow_spec *fsp,
  *
  * Returns the number of available flow director filters to this VSI
  */
-static int ice_fdir_num_avail_fltr(struct ice_hw *hw, struct ice_vsi *vsi)
+int ice_fdir_num_avail_fltr(struct ice_hw *hw, struct ice_vsi *vsi)
 {
 	u16 vsi_num = ice_get_hw_vsi_num(hw, vsi->idx);
 	u16 num_guar;
diff --git a/drivers/net/ethernet/intel/ice/ice_fdir.h b/drivers/net/ethernet/intel/ice/ice_fdir.h
index 1b9b84490689..b384d2a4ab19 100644
--- a/drivers/net/ethernet/intel/ice/ice_fdir.h
+++ b/drivers/net/ethernet/intel/ice/ice_fdir.h
@@ -202,6 +202,8 @@ struct ice_fdir_base_pkt {
 	const u8 *tun_pkt;
 };
 
+struct ice_vsi;
+
 int ice_alloc_fd_res_cntr(struct ice_hw *hw, u16 *cntr_id);
 int ice_free_fd_res_cntr(struct ice_hw *hw, u16 cntr_id);
 int ice_alloc_fd_guar_item(struct ice_hw *hw, u16 *cntr_id, u16 num_fltr);
@@ -213,6 +215,7 @@ int
 ice_fdir_get_gen_prgm_pkt(struct ice_hw *hw, struct ice_fdir_fltr *input,
 			  u8 *pkt, bool frag, bool tun);
 int ice_get_fdir_cnt_all(struct ice_hw *hw);
+int ice_fdir_num_avail_fltr(struct ice_hw *hw, struct ice_vsi *vsi);
 bool ice_fdir_is_dup_fltr(struct ice_hw *hw, struct ice_fdir_fltr *input);
 bool ice_fdir_has_frag(enum ice_fltr_ptype flow);
 struct ice_fdir_fltr *
diff --git a/drivers/net/ethernet/intel/ice/ice_switch.c b/drivers/net/ethernet/intel/ice/ice_switch.c
index d2a2388d4fa0..88ee2491312a 100644
--- a/drivers/net/ethernet/intel/ice/ice_switch.c
+++ b/drivers/net/ethernet/intel/ice/ice_switch.c
@@ -2271,10 +2271,10 @@ ice_get_recp_frm_fw(struct ice_hw *hw, struct ice_sw_recipe *recps, u8 rid,
 		/* Propagate some data to the recipe database */
 		recps[idx].is_root = !!is_root;
 		recps[idx].priority = root_bufs.content.act_ctrl_fwd_priority;
-		recps[idx].need_pass_l2 = root_bufs.content.act_ctrl &
-					  ICE_AQ_RECIPE_ACT_NEED_PASS_L2;
-		recps[idx].allow_pass_l2 = root_bufs.content.act_ctrl &
-					   ICE_AQ_RECIPE_ACT_ALLOW_PASS_L2;
+		recps[idx].need_pass_l2 = !!(root_bufs.content.act_ctrl &
+					     ICE_AQ_RECIPE_ACT_NEED_PASS_L2);
+		recps[idx].allow_pass_l2 = !!(root_bufs.content.act_ctrl &
+					      ICE_AQ_RECIPE_ACT_ALLOW_PASS_L2);
 		bitmap_zero(recps[idx].res_idxs, ICE_MAX_FV_WORDS);
 		if (root_bufs.content.result_indx & ICE_AQ_RECIPE_RESULT_EN) {
 			recps[idx].chain_idx = root_bufs.content.result_indx &
diff --git a/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c b/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c
index 6fdbd73804d1..974c71490d97 100644
--- a/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c
+++ b/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c
@@ -551,6 +551,8 @@ static void ice_vc_fdir_reset_cnt_all(struct ice_vf_fdir *fdir)
 		fdir->fdir_fltr_cnt[flow][0] = 0;
 		fdir->fdir_fltr_cnt[flow][1] = 0;
 	}
+
+	fdir->fdir_fltr_cnt_total = 0;
 }
 
 /**
@@ -1567,6 +1569,7 @@ ice_vc_add_fdir_fltr_post(struct ice_vf *vf, struct ice_vf_fdir_ctx *ctx,
 	resp->status = status;
 	resp->flow_id = conf->flow_id;
 	vf->fdir.fdir_fltr_cnt[conf->input.flow_type][is_tun]++;
+	vf->fdir.fdir_fltr_cnt_total++;
 
 	ret = ice_vc_send_msg_to_vf(vf, ctx->v_opcode, v_ret,
 				    (u8 *)resp, len);
@@ -1631,6 +1634,7 @@ ice_vc_del_fdir_fltr_post(struct ice_vf *vf, struct ice_vf_fdir_ctx *ctx,
 	resp->status = status;
 	ice_vc_fdir_remove_entry(vf, conf, conf->flow_id);
 	vf->fdir.fdir_fltr_cnt[conf->input.flow_type][is_tun]--;
+	vf->fdir.fdir_fltr_cnt_total--;
 
 	ret = ice_vc_send_msg_to_vf(vf, ctx->v_opcode, v_ret,
 				    (u8 *)resp, len);
@@ -1797,6 +1801,7 @@ int ice_vc_add_fdir_fltr(struct ice_vf *vf, u8 *msg)
 	struct virtchnl_fdir_add *stat = NULL;
 	struct virtchnl_fdir_fltr_conf *conf;
 	enum virtchnl_status_code v_ret;
+	struct ice_vsi *vf_vsi;
 	struct device *dev;
 	struct ice_pf *pf;
 	int is_tun = 0;
@@ -1805,6 +1810,17 @@ int ice_vc_add_fdir_fltr(struct ice_vf *vf, u8 *msg)
 
 	pf = vf->pf;
 	dev = ice_pf_to_dev(pf);
+	vf_vsi = ice_get_vf_vsi(vf);
+
+#define ICE_VF_MAX_FDIR_FILTERS	128
+	if (!ice_fdir_num_avail_fltr(&pf->hw, vf_vsi) ||
+	    vf->fdir.fdir_fltr_cnt_total >= ICE_VF_MAX_FDIR_FILTERS) {
+		v_ret = VIRTCHNL_STATUS_ERR_PARAM;
+		dev_err(dev, "Max number of FDIR filters for VF %d is reached\n",
+			vf->vf_id);
+		goto err_exit;
+	}
+
 	ret = ice_vc_fdir_param_check(vf, fltr->vsi_id);
 	if (ret) {
 		v_ret = VIRTCHNL_STATUS_ERR_PARAM;
diff --git a/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h b/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h
index c5bcc8d7481c..ac6dcab454b4 100644
--- a/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h
+++ b/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h
@@ -29,6 +29,7 @@ struct ice_vf_fdir_ctx {
 struct ice_vf_fdir {
 	u16 fdir_fltr_cnt[ICE_FLTR_PTYPE_MAX][ICE_FD_HW_SEG_MAX];
 	int prof_entry_cnt[ICE_FLTR_PTYPE_MAX][ICE_FD_HW_SEG_MAX];
+	u16 fdir_fltr_cnt_total;
 	struct ice_fd_hw_prof **fdir_prof;
 
 	struct idr fdir_rule_idr;
diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c
index 4b713832fdd5..f5c0a4214c4e 100644
--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c
+++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c
@@ -391,7 +391,8 @@ mlxsw_sp_acl_atcam_region_entry_insert(struct mlxsw_sp *mlxsw_sp,
 	if (err)
 		return err;
 
-	lkey_id = aregion->ops->lkey_id_get(aregion, aentry->enc_key, erp_id);
+	lkey_id = aregion->ops->lkey_id_get(aregion, aentry->ht_key.enc_key,
+					    erp_id);
 	if (IS_ERR(lkey_id))
 		return PTR_ERR(lkey_id);
 	aentry->lkey_id = lkey_id;
@@ -399,7 +400,7 @@ mlxsw_sp_acl_atcam_region_entry_insert(struct mlxsw_sp *mlxsw_sp,
 	kvdl_index = mlxsw_afa_block_first_kvdl_index(rulei->act_block);
 	mlxsw_reg_ptce3_pack(ptce3_pl, true, MLXSW_REG_PTCE3_OP_WRITE_WRITE,
 			     priority, region->tcam_region_info,
-			     aentry->enc_key, erp_id,
+			     aentry->ht_key.enc_key, erp_id,
 			     aentry->delta_info.start,
 			     aentry->delta_info.mask,
 			     aentry->delta_info.value,
@@ -428,7 +429,7 @@ mlxsw_sp_acl_atcam_region_entry_remove(struct mlxsw_sp *mlxsw_sp,
 
 	mlxsw_reg_ptce3_pack(ptce3_pl, false, MLXSW_REG_PTCE3_OP_WRITE_WRITE, 0,
 			     region->tcam_region_info,
-			     aentry->enc_key, erp_id,
+			     aentry->ht_key.enc_key, erp_id,
 			     aentry->delta_info.start,
 			     aentry->delta_info.mask,
 			     aentry->delta_info.value,
@@ -457,7 +458,7 @@ mlxsw_sp_acl_atcam_region_entry_action_replace(struct mlxsw_sp *mlxsw_sp,
 	kvdl_index = mlxsw_afa_block_first_kvdl_index(rulei->act_block);
 	mlxsw_reg_ptce3_pack(ptce3_pl, true, MLXSW_REG_PTCE3_OP_WRITE_UPDATE,
 			     priority, region->tcam_region_info,
-			     aentry->enc_key, erp_id,
+			     aentry->ht_key.enc_key, erp_id,
 			     aentry->delta_info.start,
 			     aentry->delta_info.mask,
 			     aentry->delta_info.value,
@@ -480,15 +481,13 @@ __mlxsw_sp_acl_atcam_entry_add(struct mlxsw_sp *mlxsw_sp,
 	int err;
 
 	mlxsw_afk_encode(afk, region->key_info, &rulei->values,
-			 aentry->ht_key.full_enc_key, mask);
+			 aentry->ht_key.enc_key, mask);
 
 	erp_mask = mlxsw_sp_acl_erp_mask_get(aregion, mask, false);
 	if (IS_ERR(erp_mask))
 		return PTR_ERR(erp_mask);
 	aentry->erp_mask = erp_mask;
 	aentry->ht_key.erp_id = mlxsw_sp_acl_erp_mask_erp_id(erp_mask);
-	memcpy(aentry->enc_key, aentry->ht_key.full_enc_key,
-	       sizeof(aentry->enc_key));
 
 	/* Compute all needed delta information and clear the delta bits
 	 * from the encrypted key.
@@ -497,9 +496,8 @@ __mlxsw_sp_acl_atcam_entry_add(struct mlxsw_sp *mlxsw_sp,
 	aentry->delta_info.start = mlxsw_sp_acl_erp_delta_start(delta);
 	aentry->delta_info.mask = mlxsw_sp_acl_erp_delta_mask(delta);
 	aentry->delta_info.value =
-		mlxsw_sp_acl_erp_delta_value(delta,
-					     aentry->ht_key.full_enc_key);
-	mlxsw_sp_acl_erp_delta_clear(delta, aentry->enc_key);
+		mlxsw_sp_acl_erp_delta_value(delta, aentry->ht_key.enc_key);
+	mlxsw_sp_acl_erp_delta_clear(delta, aentry->ht_key.enc_key);
 
 	/* Add rule to the list of A-TCAM rules, assuming this
 	 * rule is intended to A-TCAM. In case this rule does
diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c
index 95f63fcf4ba1..a54eedb69a3f 100644
--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c
+++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c
@@ -249,7 +249,7 @@ __mlxsw_sp_acl_bf_key_encode(struct mlxsw_sp_acl_atcam_region *aregion,
 		memcpy(chunk + pad_bytes, &erp_region_id,
 		       sizeof(erp_region_id));
 		memcpy(chunk + key_offset,
-		       &aentry->enc_key[chunk_key_offsets[chunk_index]],
+		       &aentry->ht_key.enc_key[chunk_key_offsets[chunk_index]],
 		       chunk_key_len);
 		chunk += chunk_len;
 	}
diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c
index d231f4d2888b..9eee229303cc 100644
--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c
+++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c
@@ -1217,18 +1217,6 @@ static bool mlxsw_sp_acl_erp_delta_check(void *priv, const void *parent_obj,
 	return err ? false : true;
 }
 
-static int mlxsw_sp_acl_erp_hints_obj_cmp(const void *obj1, const void *obj2)
-{
-	const struct mlxsw_sp_acl_erp_key *key1 = obj1;
-	const struct mlxsw_sp_acl_erp_key *key2 = obj2;
-
-	/* For hints purposes, two objects are considered equal
-	 * in case the masks are the same. Does not matter what
-	 * the "ctcam" value is.
-	 */
-	return memcmp(key1->mask, key2->mask, sizeof(key1->mask));
-}
-
 static void *mlxsw_sp_acl_erp_delta_create(void *priv, void *parent_obj,
 					   void *obj)
 {
@@ -1308,7 +1296,6 @@ static void mlxsw_sp_acl_erp_root_destroy(void *priv, void *root_priv)
 static const struct objagg_ops mlxsw_sp_acl_erp_objagg_ops = {
 	.obj_size = sizeof(struct mlxsw_sp_acl_erp_key),
 	.delta_check = mlxsw_sp_acl_erp_delta_check,
-	.hints_obj_cmp = mlxsw_sp_acl_erp_hints_obj_cmp,
 	.delta_create = mlxsw_sp_acl_erp_delta_create,
 	.delta_destroy = mlxsw_sp_acl_erp_delta_destroy,
 	.root_create = mlxsw_sp_acl_erp_root_create,
diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h
index 79a1d8606512..010204f73ea4 100644
--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h
+++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h
@@ -167,9 +167,9 @@ struct mlxsw_sp_acl_atcam_region {
 };
 
 struct mlxsw_sp_acl_atcam_entry_ht_key {
-	char full_enc_key[MLXSW_REG_PTCEX_FLEX_KEY_BLOCKS_LEN]; /* Encoded
-								 * key.
-								 */
+	char enc_key[MLXSW_REG_PTCEX_FLEX_KEY_BLOCKS_LEN]; /* Encoded key, minus
+							    * delta bits.
+							    */
 	u8 erp_id;
 };
 
@@ -181,9 +181,6 @@ struct mlxsw_sp_acl_atcam_entry {
 	struct rhash_head ht_node;
 	struct list_head list; /* Member in entries_list */
 	struct mlxsw_sp_acl_atcam_entry_ht_key ht_key;
-	char enc_key[MLXSW_REG_PTCEX_FLEX_KEY_BLOCKS_LEN]; /* Encoded key,
-							    * minus delta bits.
-							    */
 	struct {
 		u16 start;
 		u8 mask;
diff --git a/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c b/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c
index 4ead0ddf43a7..bf99495b51a9 100644
--- a/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c
+++ b/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c
@@ -982,7 +982,7 @@ static void dwmac4_set_mac_loopback(void __iomem *ioaddr, bool enable)
 }
 
 static void dwmac4_update_vlan_hash(struct mac_device_info *hw, u32 hash,
-				    __le16 perfect_match, bool is_double)
+				    u16 perfect_match, bool is_double)
 {
 	void __iomem *ioaddr = hw->pcsr;
 	u32 value;
diff --git a/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c b/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c
index 8bc317d2f7a6..052566f5b7f3 100644
--- a/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c
+++ b/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c
@@ -615,7 +615,7 @@ static int dwxgmac2_rss_configure(struct mac_device_info *hw,
 }
 
 static void dwxgmac2_update_vlan_hash(struct mac_device_info *hw, u32 hash,
-				      __le16 perfect_match, bool is_double)
+				      u16 perfect_match, bool is_double)
 {
 	void __iomem *ioaddr = hw->pcsr;
 
diff --git a/drivers/net/ethernet/stmicro/stmmac/hwif.h b/drivers/net/ethernet/stmicro/stmmac/hwif.h
index 68aa2d5ca6e5..47fb8e1646c2 100644
--- a/drivers/net/ethernet/stmicro/stmmac/hwif.h
+++ b/drivers/net/ethernet/stmicro/stmmac/hwif.h
@@ -386,7 +386,7 @@ struct stmmac_ops {
 			     struct stmmac_rss *cfg, u32 num_rxq);
 	/* VLAN */
 	void (*update_vlan_hash)(struct mac_device_info *hw, u32 hash,
-				 __le16 perfect_match, bool is_double);
+				 u16 perfect_match, bool is_double);
 	void (*enable_vlan)(struct mac_device_info *hw, u32 type);
 	int (*add_hw_vlan_rx_fltr)(struct net_device *dev,
 				   struct mac_device_info *hw,
diff --git a/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c b/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c
index 19c58ad8df34..d6167a7b19f2 100644
--- a/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c
+++ b/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c
@@ -6473,7 +6473,7 @@ static u32 stmmac_vid_crc32_le(__le16 vid_le)
 static int stmmac_vlan_update(struct stmmac_priv *priv, bool is_double)
 {
 	u32 crc, hash = 0;
-	__le16 pmatch = 0;
+	u16 pmatch = 0;
 	int count = 0;
 	u16 vid = 0;
 
@@ -6488,7 +6488,7 @@ static int stmmac_vlan_update(struct stmmac_priv *priv, bool is_double)
 		if (count > 2) /* VID = 0 always passes filter */
 			return -EOPNOTSUPP;
 
-		pmatch = cpu_to_le16(vid);
+		pmatch = vid;
 		hash = 0;
 	}
 
diff --git a/drivers/net/netconsole.c b/drivers/net/netconsole.c
index 3111e1648592..9c2e71b9c032 100644
--- a/drivers/net/netconsole.c
+++ b/drivers/net/netconsole.c
@@ -770,6 +770,7 @@ static int netconsole_netdev_event(struct notifier_block *this,
 				/* rtnl_lock already held
 				 * we might sleep in __netpoll_cleanup()
 				 */
+				nt->enabled = false;
 				spin_unlock_irqrestore(&target_list_lock, flags);
 
 				__netpoll_cleanup(&nt->np);
@@ -777,7 +778,6 @@ static int netconsole_netdev_event(struct notifier_block *this,
 				spin_lock_irqsave(&target_list_lock, flags);
 				netdev_put(nt->np.dev, &nt->np.dev_tracker);
 				nt->np.dev = NULL;
-				nt->enabled = false;
 				stopped = true;
 				netconsole_target_put(nt);
 				goto restart;
diff --git a/drivers/net/wireless/ath/ath11k/ce.c b/drivers/net/wireless/ath/ath11k/ce.c
index 289d47ae92af..e66e86bdec20 100644
--- a/drivers/net/wireless/ath/ath11k/ce.c
+++ b/drivers/net/wireless/ath/ath11k/ce.c
@@ -1,7 +1,7 @@
 // SPDX-License-Identifier: BSD-3-Clause-Clear
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2021, Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #include "dp_rx.h"
diff --git a/drivers/net/wireless/ath/ath11k/ce.h b/drivers/net/wireless/ath/ath11k/ce.h
index c0f6a0ba86df..bcde2fcf02cf 100644
--- a/drivers/net/wireless/ath/ath11k/ce.h
+++ b/drivers/net/wireless/ath/ath11k/ce.h
@@ -1,6 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2022, 2024 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef ATH11K_CE_H
@@ -145,7 +146,7 @@ struct ath11k_ce_ring {
 	/* Host address space */
 	void *base_addr_owner_space_unaligned;
 	/* CE address space */
-	u32 base_addr_ce_space_unaligned;
+	dma_addr_t base_addr_ce_space_unaligned;
 
 	/* Actual start of descriptors.
 	 * Aligned to descriptor-size boundary.
@@ -155,7 +156,7 @@ struct ath11k_ce_ring {
 	void *base_addr_owner_space;
 
 	/* CE address space */
-	u32 base_addr_ce_space;
+	dma_addr_t base_addr_ce_space;
 
 	/* HAL ring id */
 	u32 hal_ring_id;
diff --git a/drivers/net/wireless/ath/ath11k/dbring.c b/drivers/net/wireless/ath/ath11k/dbring.c
index 5536e8642331..fbb6e8d8a476 100644
--- a/drivers/net/wireless/ath/ath11k/dbring.c
+++ b/drivers/net/wireless/ath/ath11k/dbring.c
@@ -1,6 +1,7 @@
 // SPDX-License-Identifier: BSD-3-Clause-Clear
 /*
  * Copyright (c) 2019-2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #include "core.h"
diff --git a/drivers/net/wireless/ath/ath11k/dbring.h b/drivers/net/wireless/ath/ath11k/dbring.h
index ef906c687b8c..2f93b78a50df 100644
--- a/drivers/net/wireless/ath/ath11k/dbring.h
+++ b/drivers/net/wireless/ath/ath11k/dbring.h
@@ -1,6 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2019-2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef ATH11K_DBRING_H
diff --git a/drivers/net/wireless/ath/ath11k/debug.c b/drivers/net/wireless/ath/ath11k/debug.c
index f5c8a34c8802..2b8544355fc1 100644
--- a/drivers/net/wireless/ath/ath11k/debug.c
+++ b/drivers/net/wireless/ath/ath11k/debug.c
@@ -1,6 +1,7 @@
 // SPDX-License-Identifier: BSD-3-Clause-Clear
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #include <linux/vmalloc.h>
diff --git a/drivers/net/wireless/ath/ath11k/debug.h b/drivers/net/wireless/ath/ath11k/debug.h
index 9c52804ef8ac..cc8934d15697 100644
--- a/drivers/net/wireless/ath/ath11k/debug.h
+++ b/drivers/net/wireless/ath/ath11k/debug.h
@@ -1,7 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2023 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2022-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef _ATH11K_DEBUG_H_
diff --git a/drivers/net/wireless/ath/ath11k/debugfs.c b/drivers/net/wireless/ath/ath11k/debugfs.c
index 5bb6fd17fdf6..8cda73b78ebf 100644
--- a/drivers/net/wireless/ath/ath11k/debugfs.c
+++ b/drivers/net/wireless/ath/ath11k/debugfs.c
@@ -1,6 +1,7 @@
 // SPDX-License-Identifier: BSD-3-Clause-Clear
 /*
  * Copyright (c) 2018-2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #include <linux/vmalloc.h>
diff --git a/drivers/net/wireless/ath/ath11k/debugfs.h b/drivers/net/wireless/ath/ath11k/debugfs.h
index 3af0169f6cf2..44d15845f39a 100644
--- a/drivers/net/wireless/ath/ath11k/debugfs.h
+++ b/drivers/net/wireless/ath/ath11k/debugfs.h
@@ -1,6 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2022 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef _ATH11K_DEBUGFS_H_
diff --git a/drivers/net/wireless/ath/ath11k/debugfs_htt_stats.c b/drivers/net/wireless/ath/ath11k/debugfs_htt_stats.c
index 0207fc4910f3..870e86a31bf8 100644
--- a/drivers/net/wireless/ath/ath11k/debugfs_htt_stats.c
+++ b/drivers/net/wireless/ath/ath11k/debugfs_htt_stats.c
@@ -1,7 +1,7 @@
 // SPDX-License-Identifier: BSD-3-Clause-Clear
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2022 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2022-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #include <linux/vmalloc.h>
diff --git a/drivers/net/wireless/ath/ath11k/debugfs_htt_stats.h b/drivers/net/wireless/ath/ath11k/debugfs_htt_stats.h
index 96219301f05b..476689bbd4da 100644
--- a/drivers/net/wireless/ath/ath11k/debugfs_htt_stats.h
+++ b/drivers/net/wireless/ath/ath11k/debugfs_htt_stats.h
@@ -1,7 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2022 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2022-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef DEBUG_HTT_STATS_H
diff --git a/drivers/net/wireless/ath/ath11k/debugfs_sta.c b/drivers/net/wireless/ath/ath11k/debugfs_sta.c
index 9cc4ef28e751..168879a380cb 100644
--- a/drivers/net/wireless/ath/ath11k/debugfs_sta.c
+++ b/drivers/net/wireless/ath/ath11k/debugfs_sta.c
@@ -1,6 +1,7 @@
 // SPDX-License-Identifier: BSD-3-Clause-Clear
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #include <linux/vmalloc.h>
diff --git a/drivers/net/wireless/ath/ath11k/debugfs_sta.h b/drivers/net/wireless/ath/ath11k/debugfs_sta.h
index e6c11b3a40aa..ace877e19275 100644
--- a/drivers/net/wireless/ath/ath11k/debugfs_sta.h
+++ b/drivers/net/wireless/ath/ath11k/debugfs_sta.h
@@ -1,6 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2018-2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef _ATH11K_DEBUGFS_STA_H_
diff --git a/drivers/net/wireless/ath/ath11k/dp.c b/drivers/net/wireless/ath/ath11k/dp.c
index d070bcb3fe24..be0beb6bae8f 100644
--- a/drivers/net/wireless/ath/ath11k/dp.c
+++ b/drivers/net/wireless/ath/ath11k/dp.c
@@ -1,7 +1,7 @@
 // SPDX-License-Identifier: BSD-3-Clause-Clear
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2022 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #include <crypto/hash.h>
diff --git a/drivers/net/wireless/ath/ath11k/dp.h b/drivers/net/wireless/ath/ath11k/dp.h
index 15815af453b2..2f6dd69d3be2 100644
--- a/drivers/net/wireless/ath/ath11k/dp.h
+++ b/drivers/net/wireless/ath/ath11k/dp.h
@@ -1,7 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2022 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef ATH11K_DP_H
diff --git a/drivers/net/wireless/ath/ath11k/dp_rx.c b/drivers/net/wireless/ath/ath11k/dp_rx.c
index a993e74bbae8..b3499f966a9d 100644
--- a/drivers/net/wireless/ath/ath11k/dp_rx.c
+++ b/drivers/net/wireless/ath/ath11k/dp_rx.c
@@ -1,6 +1,7 @@
 // SPDX-License-Identifier: BSD-3-Clause-Clear
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #include <linux/ieee80211.h>
@@ -1879,8 +1880,7 @@ static void ath11k_dp_rx_h_csum_offload(struct ath11k *ar, struct sk_buff *msdu)
 			  CHECKSUM_NONE : CHECKSUM_UNNECESSARY;
 }
 
-static int ath11k_dp_rx_crypto_mic_len(struct ath11k *ar,
-				       enum hal_encrypt_type enctype)
+int ath11k_dp_rx_crypto_mic_len(struct ath11k *ar, enum hal_encrypt_type enctype)
 {
 	switch (enctype) {
 	case HAL_ENCRYPT_TYPE_OPEN:
diff --git a/drivers/net/wireless/ath/ath11k/dp_rx.h b/drivers/net/wireless/ath/ath11k/dp_rx.h
index 623da3bf9dc8..c322e30caa96 100644
--- a/drivers/net/wireless/ath/ath11k/dp_rx.h
+++ b/drivers/net/wireless/ath/ath11k/dp_rx.h
@@ -1,6 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2024 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 #ifndef ATH11K_DP_RX_H
 #define ATH11K_DP_RX_H
@@ -95,4 +96,6 @@ int ath11k_peer_rx_frag_setup(struct ath11k *ar, const u8 *peer_mac, int vdev_id
 int ath11k_dp_rx_pktlog_start(struct ath11k_base *ab);
 int ath11k_dp_rx_pktlog_stop(struct ath11k_base *ab, bool stop_timer);
 
+int ath11k_dp_rx_crypto_mic_len(struct ath11k *ar, enum hal_encrypt_type enctype);
+
 #endif /* ATH11K_DP_RX_H */
diff --git a/drivers/net/wireless/ath/ath11k/dp_tx.c b/drivers/net/wireless/ath/ath11k/dp_tx.c
index 0dda76f7a4b5..7dd1ee589801 100644
--- a/drivers/net/wireless/ath/ath11k/dp_tx.c
+++ b/drivers/net/wireless/ath/ath11k/dp_tx.c
@@ -1,7 +1,7 @@
 // SPDX-License-Identifier: BSD-3-Clause-Clear
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2022 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #include "core.h"
diff --git a/drivers/net/wireless/ath/ath11k/dp_tx.h b/drivers/net/wireless/ath/ath11k/dp_tx.h
index 68a21ea9b934..61be2265e09f 100644
--- a/drivers/net/wireless/ath/ath11k/dp_tx.h
+++ b/drivers/net/wireless/ath/ath11k/dp_tx.h
@@ -1,6 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021, 2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef ATH11K_DP_TX_H
diff --git a/drivers/net/wireless/ath/ath11k/hal.c b/drivers/net/wireless/ath/ath11k/hal.c
index 0a99aa7ddbf4..ae5f7e401e21 100644
--- a/drivers/net/wireless/ath/ath11k/hal.c
+++ b/drivers/net/wireless/ath/ath11k/hal.c
@@ -1,7 +1,7 @@
 // SPDX-License-Identifier: BSD-3-Clause-Clear
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2022, Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 #include <linux/dma-mapping.h>
 #include "hal_tx.h"
diff --git a/drivers/net/wireless/ath/ath11k/hal.h b/drivers/net/wireless/ath/ath11k/hal.h
index 1942d41d6de5..80447f488954 100644
--- a/drivers/net/wireless/ath/ath11k/hal.h
+++ b/drivers/net/wireless/ath/ath11k/hal.h
@@ -1,7 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2022, Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2022 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef ATH11K_HAL_H
diff --git a/drivers/net/wireless/ath/ath11k/hal_desc.h b/drivers/net/wireless/ath/ath11k/hal_desc.h
index d895ea878d9f..b2fd180bd28e 100644
--- a/drivers/net/wireless/ath/ath11k/hal_desc.h
+++ b/drivers/net/wireless/ath/ath11k/hal_desc.h
@@ -1,6 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2022 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 #include "core.h"
 
diff --git a/drivers/net/wireless/ath/ath11k/hal_rx.c b/drivers/net/wireless/ath/ath11k/hal_rx.c
index e5ed5efb139e..363adac84a87 100644
--- a/drivers/net/wireless/ath/ath11k/hal_rx.c
+++ b/drivers/net/wireless/ath/ath11k/hal_rx.c
@@ -1,6 +1,7 @@
 // SPDX-License-Identifier: BSD-3-Clause-Clear
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #include "debug.h"
diff --git a/drivers/net/wireless/ath/ath11k/hal_rx.h b/drivers/net/wireless/ath/ath11k/hal_rx.h
index 61bd8416c4fd..e05411005fc6 100644
--- a/drivers/net/wireless/ath/ath11k/hal_rx.h
+++ b/drivers/net/wireless/ath/ath11k/hal_rx.h
@@ -1,6 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef ATH11K_HAL_RX_H
diff --git a/drivers/net/wireless/ath/ath11k/hif.h b/drivers/net/wireless/ath/ath11k/hif.h
index 659b80d2abd4..e0952c062929 100644
--- a/drivers/net/wireless/ath/ath11k/hif.h
+++ b/drivers/net/wireless/ath/ath11k/hif.h
@@ -1,6 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2019-2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2022-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef _HIF_H_
diff --git a/drivers/net/wireless/ath/ath11k/htc.c b/drivers/net/wireless/ath/ath11k/htc.c
index 2c2e425c8665..23054ab29a5e 100644
--- a/drivers/net/wireless/ath/ath11k/htc.c
+++ b/drivers/net/wireless/ath/ath11k/htc.c
@@ -1,6 +1,7 @@
 // SPDX-License-Identifier: BSD-3-Clause-Clear
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2022-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 #include <linux/skbuff.h>
 #include <linux/ctype.h>
diff --git a/drivers/net/wireless/ath/ath11k/htc.h b/drivers/net/wireless/ath/ath11k/htc.h
index f429b37cfdf7..e9b123a50b5d 100644
--- a/drivers/net/wireless/ath/ath11k/htc.h
+++ b/drivers/net/wireless/ath/ath11k/htc.h
@@ -1,6 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef ATH11K_HTC_H
diff --git a/drivers/net/wireless/ath/ath11k/hw.c b/drivers/net/wireless/ath/ath11k/hw.c
index d7b5ec6e6904..77d8f9237680 100644
--- a/drivers/net/wireless/ath/ath11k/hw.c
+++ b/drivers/net/wireless/ath/ath11k/hw.c
@@ -1,7 +1,7 @@
 // SPDX-License-Identifier: BSD-3-Clause-Clear
 /*
  * Copyright (c) 2018-2020 The Linux Foundation. All rights reserved.
- * Copyright (c) 2022, Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #include <linux/types.h>
diff --git a/drivers/net/wireless/ath/ath11k/hw.h b/drivers/net/wireless/ath/ath11k/hw.h
index d51a99669dd6..1b070747a5db 100644
--- a/drivers/net/wireless/ath/ath11k/hw.h
+++ b/drivers/net/wireless/ath/ath11k/hw.h
@@ -1,7 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2021-2022, Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef ATH11K_HW_H
diff --git a/drivers/net/wireless/ath/ath11k/mac.c b/drivers/net/wireless/ath/ath11k/mac.c
index 445f59ad1fc0..33f2c189b4d8 100644
--- a/drivers/net/wireless/ath/ath11k/mac.c
+++ b/drivers/net/wireless/ath/ath11k/mac.c
@@ -4130,6 +4130,7 @@ static int ath11k_install_key(struct ath11k_vif *arvif,
 
 	switch (key->cipher) {
 	case WLAN_CIPHER_SUITE_CCMP:
+	case WLAN_CIPHER_SUITE_CCMP_256:
 		arg.key_cipher = WMI_CIPHER_AES_CCM;
 		/* TODO: Re-check if flag is valid */
 		key->flags |= IEEE80211_KEY_FLAG_GENERATE_IV_MGMT;
@@ -4139,12 +4140,10 @@ static int ath11k_install_key(struct ath11k_vif *arvif,
 		arg.key_txmic_len = 8;
 		arg.key_rxmic_len = 8;
 		break;
-	case WLAN_CIPHER_SUITE_CCMP_256:
-		arg.key_cipher = WMI_CIPHER_AES_CCM;
-		break;
 	case WLAN_CIPHER_SUITE_GCMP:
 	case WLAN_CIPHER_SUITE_GCMP_256:
 		arg.key_cipher = WMI_CIPHER_AES_GCM;
+		key->flags |= IEEE80211_KEY_FLAG_GENERATE_IV_MGMT;
 		break;
 	default:
 		ath11k_warn(ar->ab, "cipher %d is not supported\n", key->cipher);
@@ -6023,7 +6022,10 @@ static int ath11k_mac_mgmt_tx_wmi(struct ath11k *ar, struct ath11k_vif *arvif,
 {
 	struct ath11k_base *ab = ar->ab;
 	struct ieee80211_hdr *hdr = (struct ieee80211_hdr *)skb->data;
+	struct ath11k_skb_cb *skb_cb = ATH11K_SKB_CB(skb);
 	struct ieee80211_tx_info *info;
+	enum hal_encrypt_type enctype;
+	unsigned int mic_len;
 	dma_addr_t paddr;
 	int buf_id;
 	int ret;
@@ -6047,7 +6049,12 @@ static int ath11k_mac_mgmt_tx_wmi(struct ath11k *ar, struct ath11k_vif *arvif,
 		     ieee80211_is_deauth(hdr->frame_control) ||
 		     ieee80211_is_disassoc(hdr->frame_control)) &&
 		     ieee80211_has_protected(hdr->frame_control)) {
-			skb_put(skb, IEEE80211_CCMP_MIC_LEN);
+			if (!(skb_cb->flags & ATH11K_SKB_CIPHER_SET))
+				ath11k_warn(ab, "WMI management tx frame without ATH11K_SKB_CIPHER_SET");
+
+			enctype = ath11k_dp_tx_get_encrypt_type(skb_cb->cipher);
+			mic_len = ath11k_dp_rx_crypto_mic_len(ar, enctype);
+			skb_put(skb, mic_len);
 		}
 	}
 
diff --git a/drivers/net/wireless/ath/ath11k/mac.h b/drivers/net/wireless/ath/ath11k/mac.h
index 0231783ad754..0dfdeed5177b 100644
--- a/drivers/net/wireless/ath/ath11k/mac.h
+++ b/drivers/net/wireless/ath/ath11k/mac.h
@@ -1,6 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2022 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef ATH11K_MAC_H
diff --git a/drivers/net/wireless/ath/ath11k/mhi.c b/drivers/net/wireless/ath/ath11k/mhi.c
index 76de891d6c0f..48ae81efc269 100644
--- a/drivers/net/wireless/ath/ath11k/mhi.c
+++ b/drivers/net/wireless/ath/ath11k/mhi.c
@@ -1,7 +1,7 @@
 // SPDX-License-Identifier: BSD-3-Clause-Clear
 /*
  * Copyright (c) 2020 The Linux Foundation. All rights reserved.
- * Copyright (c) 2021-2022, Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #include <linux/msi.h>
diff --git a/drivers/net/wireless/ath/ath11k/mhi.h b/drivers/net/wireless/ath/ath11k/mhi.h
index 8d9f852da695..f81fba2644a4 100644
--- a/drivers/net/wireless/ath/ath11k/mhi.h
+++ b/drivers/net/wireless/ath/ath11k/mhi.h
@@ -1,6 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2022 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 #ifndef _ATH11K_MHI_H
 #define _ATH11K_MHI_H
diff --git a/drivers/net/wireless/ath/ath11k/pcic.c b/drivers/net/wireless/ath/ath11k/pcic.c
index 011cf5fb8023..803ee9dd7967 100644
--- a/drivers/net/wireless/ath/ath11k/pcic.c
+++ b/drivers/net/wireless/ath/ath11k/pcic.c
@@ -1,7 +1,7 @@
 // SPDX-License-Identifier: BSD-3-Clause-Clear
 /*
  * Copyright (c) 2019-2021 The Linux Foundation. All rights reserved.
- * Copyright (c) 2021-2022, Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #include "core.h"
diff --git a/drivers/net/wireless/ath/ath11k/peer.c b/drivers/net/wireless/ath/ath11k/peer.c
index 114aa3a9a339..ca719eb3f7f8 100644
--- a/drivers/net/wireless/ath/ath11k/peer.c
+++ b/drivers/net/wireless/ath/ath11k/peer.c
@@ -1,7 +1,7 @@
 // SPDX-License-Identifier: BSD-3-Clause-Clear
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2021-2022 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #include "core.h"
diff --git a/drivers/net/wireless/ath/ath11k/peer.h b/drivers/net/wireless/ath/ath11k/peer.h
index 9bd385d0a38c..3ad2f3355b14 100644
--- a/drivers/net/wireless/ath/ath11k/peer.h
+++ b/drivers/net/wireless/ath/ath11k/peer.h
@@ -1,7 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2021-2022 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef ATH11K_PEER_H
diff --git a/drivers/net/wireless/ath/ath11k/qmi.c b/drivers/net/wireless/ath/ath11k/qmi.c
index 41fad03a3025..a831d9474e9e 100644
--- a/drivers/net/wireless/ath/ath11k/qmi.c
+++ b/drivers/net/wireless/ath/ath11k/qmi.c
@@ -1,7 +1,7 @@
 // SPDX-License-Identifier: BSD-3-Clause-Clear
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2022-2023 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #include <linux/elf.h>
diff --git a/drivers/net/wireless/ath/ath11k/qmi.h b/drivers/net/wireless/ath/ath11k/qmi.h
index d477e2be814b..7e06d100af57 100644
--- a/drivers/net/wireless/ath/ath11k/qmi.h
+++ b/drivers/net/wireless/ath/ath11k/qmi.h
@@ -1,7 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2022, Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef ATH11K_QMI_H
diff --git a/drivers/net/wireless/ath/ath11k/reg.c b/drivers/net/wireless/ath/ath11k/reg.c
index 7f9fb968dac6..c9e8bbc4896f 100644
--- a/drivers/net/wireless/ath/ath11k/reg.c
+++ b/drivers/net/wireless/ath/ath11k/reg.c
@@ -1,6 +1,7 @@
 // SPDX-License-Identifier: BSD-3-Clause-Clear
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 #include <linux/rtnetlink.h>
 
diff --git a/drivers/net/wireless/ath/ath11k/reg.h b/drivers/net/wireless/ath/ath11k/reg.h
index 2f284f26378d..d873b9cf7fc4 100644
--- a/drivers/net/wireless/ath/ath11k/reg.h
+++ b/drivers/net/wireless/ath/ath11k/reg.h
@@ -1,6 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2022-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef ATH11K_REG_H
diff --git a/drivers/net/wireless/ath/ath11k/rx_desc.h b/drivers/net/wireless/ath/ath11k/rx_desc.h
index 786d5f36f5e5..2da6da727278 100644
--- a/drivers/net/wireless/ath/ath11k/rx_desc.h
+++ b/drivers/net/wireless/ath/ath11k/rx_desc.h
@@ -1,6 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2022 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 #ifndef ATH11K_RX_DESC_H
 #define ATH11K_RX_DESC_H
diff --git a/drivers/net/wireless/ath/ath11k/spectral.c b/drivers/net/wireless/ath/ath11k/spectral.c
index 705868198df4..ae2abe8ae992 100644
--- a/drivers/net/wireless/ath/ath11k/spectral.c
+++ b/drivers/net/wireless/ath/ath11k/spectral.c
@@ -1,6 +1,7 @@
 // SPDX-License-Identifier: BSD-3-Clause-Clear
 /*
  * Copyright (c) 2019-2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2022 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #include <linux/relay.h>
diff --git a/drivers/net/wireless/ath/ath11k/spectral.h b/drivers/net/wireless/ath/ath11k/spectral.h
index 96bfa16e18e9..789cff7c64a7 100644
--- a/drivers/net/wireless/ath/ath11k/spectral.h
+++ b/drivers/net/wireless/ath/ath11k/spectral.h
@@ -1,6 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2019-2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2022 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef ATH11K_SPECTRAL_H
diff --git a/drivers/net/wireless/ath/ath11k/thermal.c b/drivers/net/wireless/ath/ath11k/thermal.c
index 23ed01bd44f9..d39acc03be5b 100644
--- a/drivers/net/wireless/ath/ath11k/thermal.c
+++ b/drivers/net/wireless/ath/ath11k/thermal.c
@@ -1,6 +1,7 @@
 // SPDX-License-Identifier: BSD-3-Clause-Clear
 /*
  * Copyright (c) 2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2022-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #include <linux/device.h>
diff --git a/drivers/net/wireless/ath/ath11k/thermal.h b/drivers/net/wireless/ath/ath11k/thermal.h
index 3e39675ef7f5..40c1a9563e0c 100644
--- a/drivers/net/wireless/ath/ath11k/thermal.h
+++ b/drivers/net/wireless/ath/ath11k/thermal.h
@@ -1,6 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2022-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef _ATH11K_THERMAL_
diff --git a/drivers/net/wireless/ath/ath11k/trace.h b/drivers/net/wireless/ath/ath11k/trace.h
index 9535745fe026..235ab8ea715f 100644
--- a/drivers/net/wireless/ath/ath11k/trace.h
+++ b/drivers/net/wireless/ath/ath11k/trace.h
@@ -1,6 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2022 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #if !defined(_TRACE_H_) || defined(TRACE_HEADER_MULTI_READ)
diff --git a/drivers/net/wireless/ath/ath11k/wmi.c b/drivers/net/wireless/ath/ath11k/wmi.c
index 1c07f55c25e6..2cc13e60f422 100644
--- a/drivers/net/wireless/ath/ath11k/wmi.c
+++ b/drivers/net/wireless/ath/ath11k/wmi.c
@@ -1,7 +1,7 @@
 // SPDX-License-Identifier: BSD-3-Clause-Clear
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2021, 2023 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 #include <linux/skbuff.h>
 #include <linux/ctype.h>
diff --git a/drivers/net/wireless/ath/ath11k/wmi.h b/drivers/net/wireless/ath/ath11k/wmi.h
index 100bb816b592..fa3b480b9d24 100644
--- a/drivers/net/wireless/ath/ath11k/wmi.h
+++ b/drivers/net/wireless/ath/ath11k/wmi.h
@@ -1,7 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2023 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef ATH11K_WMI_H
diff --git a/drivers/net/wireless/ath/ath11k/wow.h b/drivers/net/wireless/ath/ath11k/wow.h
index 553ba850d910..c85811e3f42b 100644
--- a/drivers/net/wireless/ath/ath11k/wow.h
+++ b/drivers/net/wireless/ath/ath11k/wow.h
@@ -1,6 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2022 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef _WOW_H_
diff --git a/drivers/net/wireless/ath/ath12k/ce.h b/drivers/net/wireless/ath/ath12k/ce.h
index 79af3b6159f1..857bc5f9e946 100644
--- a/drivers/net/wireless/ath/ath12k/ce.h
+++ b/drivers/net/wireless/ath/ath12k/ce.h
@@ -1,7 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2018-2021 The Linux Foundation. All rights reserved.
- * Copyright (c) 2021-2022 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2022, 2024 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #ifndef ATH12K_CE_H
@@ -119,7 +119,7 @@ struct ath12k_ce_ring {
 	/* Host address space */
 	void *base_addr_owner_space_unaligned;
 	/* CE address space */
-	u32 base_addr_ce_space_unaligned;
+	dma_addr_t base_addr_ce_space_unaligned;
 
 	/* Actual start of descriptors.
 	 * Aligned to descriptor-size boundary.
@@ -129,7 +129,7 @@ struct ath12k_ce_ring {
 	void *base_addr_owner_space;
 
 	/* CE address space */
-	u32 base_addr_ce_space;
+	dma_addr_t base_addr_ce_space;
 
 	/* HAL ring id */
 	u32 hal_ring_id;
diff --git a/drivers/net/wireless/ath/ath12k/dp.c b/drivers/net/wireless/ath/ath12k/dp.c
index 6893466f61f0..907655c45a4b 100644
--- a/drivers/net/wireless/ath/ath12k/dp.c
+++ b/drivers/net/wireless/ath/ath12k/dp.c
@@ -127,7 +127,9 @@ static int ath12k_dp_srng_find_ring_in_mask(int ring_num, const u8 *grp_mask)
 static int ath12k_dp_srng_calculate_msi_group(struct ath12k_base *ab,
 					      enum hal_ring_type type, int ring_num)
 {
+	const struct ath12k_hal_tcl_to_wbm_rbm_map *map;
 	const u8 *grp_mask;
+	int i;
 
 	switch (type) {
 	case HAL_WBM2SW_RELEASE:
@@ -135,6 +137,14 @@ static int ath12k_dp_srng_calculate_msi_group(struct ath12k_base *ab,
 			grp_mask = &ab->hw_params->ring_mask->rx_wbm_rel[0];
 			ring_num = 0;
 		} else {
+			map = ab->hw_params->hal_ops->tcl_to_wbm_rbm_map;
+			for (i = 0; i < ab->hw_params->max_tx_ring; i++) {
+				if (ring_num == map[i].wbm_ring_num) {
+					ring_num = i;
+					break;
+				}
+			}
+
 			grp_mask = &ab->hw_params->ring_mask->tx[0];
 		}
 		break;
@@ -876,11 +886,9 @@ int ath12k_dp_service_srng(struct ath12k_base *ab,
 	enum dp_monitor_mode monitor_mode;
 	u8 ring_mask;
 
-	while (i < ab->hw_params->max_tx_ring) {
-		if (ab->hw_params->ring_mask->tx[grp_id] &
-			BIT(ab->hw_params->hal_ops->tcl_to_wbm_rbm_map[i].wbm_ring_num))
-			ath12k_dp_tx_completion_handler(ab, i);
-		i++;
+	if (ab->hw_params->ring_mask->tx[grp_id]) {
+		i = fls(ab->hw_params->ring_mask->tx[grp_id]) - 1;
+		ath12k_dp_tx_completion_handler(ab, i);
 	}
 
 	if (ab->hw_params->ring_mask->rx_err[grp_id]) {
diff --git a/drivers/net/wireless/ath/ath12k/dp_rx.c b/drivers/net/wireless/ath/ath12k/dp_rx.c
index dbcbe7e0cd2a..2c17b1e7681a 100644
--- a/drivers/net/wireless/ath/ath12k/dp_rx.c
+++ b/drivers/net/wireless/ath/ath12k/dp_rx.c
@@ -2376,8 +2376,10 @@ void ath12k_dp_rx_h_ppdu(struct ath12k *ar, struct hal_rx_desc *rx_desc,
 	channel_num = meta_data;
 	center_freq = meta_data >> 16;
 
-	if (center_freq >= 5935 && center_freq <= 7105) {
+	if (center_freq >= ATH12K_MIN_6G_FREQ &&
+	    center_freq <= ATH12K_MAX_6G_FREQ) {
 		rx_status->band = NL80211_BAND_6GHZ;
+		rx_status->freq = center_freq;
 	} else if (channel_num >= 1 && channel_num <= 14) {
 		rx_status->band = NL80211_BAND_2GHZ;
 	} else if (channel_num >= 36 && channel_num <= 173) {
@@ -2395,8 +2397,9 @@ void ath12k_dp_rx_h_ppdu(struct ath12k *ar, struct hal_rx_desc *rx_desc,
 				rx_desc, sizeof(*rx_desc));
 	}
 
-	rx_status->freq = ieee80211_channel_to_frequency(channel_num,
-							 rx_status->band);
+	if (rx_status->band != NL80211_BAND_6GHZ)
+		rx_status->freq = ieee80211_channel_to_frequency(channel_num,
+								 rx_status->band);
 
 	ath12k_dp_rx_h_rate(ar, rx_desc, rx_status);
 }
@@ -2985,7 +2988,7 @@ static int ath12k_dp_rx_h_defrag_reo_reinject(struct ath12k *ar,
 	struct hal_srng *srng;
 	dma_addr_t link_paddr, buf_paddr;
 	u32 desc_bank, msdu_info, msdu_ext_info, mpdu_info;
-	u32 cookie, hal_rx_desc_sz, dest_ring_info0;
+	u32 cookie, hal_rx_desc_sz, dest_ring_info0, queue_addr_hi;
 	int ret;
 	struct ath12k_rx_desc_info *desc_info;
 	u8 dst_ind;
@@ -3021,7 +3024,7 @@ static int ath12k_dp_rx_h_defrag_reo_reinject(struct ath12k *ar,
 
 	buf_paddr = dma_map_single(ab->dev, defrag_skb->data,
 				   defrag_skb->len + skb_tailroom(defrag_skb),
-				   DMA_FROM_DEVICE);
+				   DMA_TO_DEVICE);
 	if (dma_mapping_error(ab->dev, buf_paddr))
 		return -ENOMEM;
 
@@ -3077,13 +3080,11 @@ static int ath12k_dp_rx_h_defrag_reo_reinject(struct ath12k *ar,
 	reo_ent_ring->rx_mpdu_info.peer_meta_data =
 		reo_dest_ring->rx_mpdu_info.peer_meta_data;
 
-	/* Firmware expects physical address to be filled in queue_addr_lo in
-	 * the MLO scenario and in case of non MLO peer meta data needs to be
-	 * filled.
-	 * TODO: Need to handle for MLO scenario.
-	 */
-	reo_ent_ring->queue_addr_lo = reo_dest_ring->rx_mpdu_info.peer_meta_data;
-	reo_ent_ring->info0 = le32_encode_bits(dst_ind,
+	reo_ent_ring->queue_addr_lo = cpu_to_le32(lower_32_bits(rx_tid->paddr));
+	queue_addr_hi = upper_32_bits(rx_tid->paddr);
+	reo_ent_ring->info0 = le32_encode_bits(queue_addr_hi,
+					       HAL_REO_ENTR_RING_INFO0_QUEUE_ADDR_HI) |
+			      le32_encode_bits(dst_ind,
 					       HAL_REO_ENTR_RING_INFO0_DEST_IND);
 
 	reo_ent_ring->info1 = le32_encode_bits(rx_tid->cur_sn,
@@ -3107,7 +3108,7 @@ static int ath12k_dp_rx_h_defrag_reo_reinject(struct ath12k *ar,
 	spin_unlock_bh(&dp->rx_desc_lock);
 err_unmap_dma:
 	dma_unmap_single(ab->dev, buf_paddr, defrag_skb->len + skb_tailroom(defrag_skb),
-			 DMA_FROM_DEVICE);
+			 DMA_TO_DEVICE);
 	return ret;
 }
 
diff --git a/drivers/net/wireless/ath/ath12k/hw.c b/drivers/net/wireless/ath/ath12k/hw.c
index ba7720f760c5..dafd7c34d746 100644
--- a/drivers/net/wireless/ath/ath12k/hw.c
+++ b/drivers/net/wireless/ath/ath12k/hw.c
@@ -540,9 +540,6 @@ static const struct ath12k_hw_ring_mask ath12k_hw_ring_mask_qcn9274 = {
 	},
 	.rx_mon_dest = {
 		0, 0, 0,
-		ATH12K_RX_MON_RING_MASK_0,
-		ATH12K_RX_MON_RING_MASK_1,
-		ATH12K_RX_MON_RING_MASK_2,
 	},
 	.rx = {
 		0, 0, 0, 0,
@@ -568,16 +565,15 @@ static const struct ath12k_hw_ring_mask ath12k_hw_ring_mask_qcn9274 = {
 		ATH12K_HOST2RXDMA_RING_MASK_0,
 	},
 	.tx_mon_dest = {
-		ATH12K_TX_MON_RING_MASK_0,
-		ATH12K_TX_MON_RING_MASK_1,
+		0, 0, 0,
 	},
 };
 
 static const struct ath12k_hw_ring_mask ath12k_hw_ring_mask_wcn7850 = {
 	.tx  = {
 		ATH12K_TX_RING_MASK_0,
+		ATH12K_TX_RING_MASK_1,
 		ATH12K_TX_RING_MASK_2,
-		ATH12K_TX_RING_MASK_4,
 	},
 	.rx_mon_dest = {
 	},
diff --git a/drivers/net/wireless/ath/ath12k/wmi.c b/drivers/net/wireless/ath/ath12k/wmi.c
index cd89032fa25e..21399ad233c0 100644
--- a/drivers/net/wireless/ath/ath12k/wmi.c
+++ b/drivers/net/wireless/ath/ath12k/wmi.c
@@ -5772,8 +5772,10 @@ static void ath12k_mgmt_rx_event(struct ath12k_base *ab, struct sk_buff *skb)
 	if (rx_ev.status & WMI_RX_STATUS_ERR_MIC)
 		status->flag |= RX_FLAG_MMIC_ERROR;
 
-	if (rx_ev.chan_freq >= ATH12K_MIN_6G_FREQ) {
+	if (rx_ev.chan_freq >= ATH12K_MIN_6G_FREQ &&
+	    rx_ev.chan_freq <= ATH12K_MAX_6G_FREQ) {
 		status->band = NL80211_BAND_6GHZ;
+		status->freq = rx_ev.chan_freq;
 	} else if (rx_ev.channel >= 1 && rx_ev.channel <= 14) {
 		status->band = NL80211_BAND_2GHZ;
 	} else if (rx_ev.channel >= 36 && rx_ev.channel <= ATH12K_MAX_5G_CHAN) {
@@ -5794,8 +5796,10 @@ static void ath12k_mgmt_rx_event(struct ath12k_base *ab, struct sk_buff *skb)
 
 	sband = &ar->mac.sbands[status->band];
 
-	status->freq = ieee80211_channel_to_frequency(rx_ev.channel,
-						      status->band);
+	if (status->band != NL80211_BAND_6GHZ)
+		status->freq = ieee80211_channel_to_frequency(rx_ev.channel,
+							      status->band);
+
 	status->signal = rx_ev.snr + ATH12K_DEFAULT_NOISE_FLOOR;
 	status->rate_idx = ath12k_mac_bitrate_to_idx(sband, rx_ev.rate / 100);
 
diff --git a/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c b/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c
index 7717eb85a1db..47c0e8e429e5 100644
--- a/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c
+++ b/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c
@@ -2567,7 +2567,6 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi,
 
 	struct lcnphy_txgains cal_gains, temp_gains;
 	u16 hash;
-	u8 band_idx;
 	int j;
 	u16 ncorr_override[5];
 	u16 syst_coeffs[] = { 0x0000, 0x0000, 0x0000, 0x0000, 0x0000, 0x0000,
@@ -2599,6 +2598,9 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi,
 	u16 *values_to_save;
 	struct brcms_phy_lcnphy *pi_lcn = pi->u.pi_lcnphy;
 
+	if (WARN_ON(CHSPEC_IS5G(pi->radio_chanspec)))
+		return;
+
 	values_to_save = kmalloc_array(20, sizeof(u16), GFP_ATOMIC);
 	if (NULL == values_to_save)
 		return;
@@ -2662,20 +2664,18 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi,
 	hash = (target_gains->gm_gain << 8) |
 	       (target_gains->pga_gain << 4) | (target_gains->pad_gain);
 
-	band_idx = (CHSPEC_IS5G(pi->radio_chanspec) ? 1 : 0);
-
 	cal_gains = *target_gains;
 	memset(ncorr_override, 0, sizeof(ncorr_override));
-	for (j = 0; j < iqcal_gainparams_numgains_lcnphy[band_idx]; j++) {
-		if (hash == tbl_iqcal_gainparams_lcnphy[band_idx][j][0]) {
+	for (j = 0; j < iqcal_gainparams_numgains_lcnphy[0]; j++) {
+		if (hash == tbl_iqcal_gainparams_lcnphy[0][j][0]) {
 			cal_gains.gm_gain =
-				tbl_iqcal_gainparams_lcnphy[band_idx][j][1];
+				tbl_iqcal_gainparams_lcnphy[0][j][1];
 			cal_gains.pga_gain =
-				tbl_iqcal_gainparams_lcnphy[band_idx][j][2];
+				tbl_iqcal_gainparams_lcnphy[0][j][2];
 			cal_gains.pad_gain =
-				tbl_iqcal_gainparams_lcnphy[band_idx][j][3];
+				tbl_iqcal_gainparams_lcnphy[0][j][3];
 			memcpy(ncorr_override,
-			       &tbl_iqcal_gainparams_lcnphy[band_idx][j][3],
+			       &tbl_iqcal_gainparams_lcnphy[0][j][3],
 			       sizeof(ncorr_override));
 			break;
 		}
diff --git a/drivers/net/wireless/marvell/mwifiex/cfg80211.c b/drivers/net/wireless/marvell/mwifiex/cfg80211.c
index 4389cf3f889f..6f01b7573b23 100644
--- a/drivers/net/wireless/marvell/mwifiex/cfg80211.c
+++ b/drivers/net/wireless/marvell/mwifiex/cfg80211.c
@@ -926,6 +926,8 @@ mwifiex_init_new_priv_params(struct mwifiex_private *priv,
 		return -EOPNOTSUPP;
 	}
 
+	priv->bss_num = mwifiex_get_unused_bss_num(adapter, priv->bss_type);
+
 	spin_lock_irqsave(&adapter->main_proc_lock, flags);
 	adapter->main_locked = false;
 	spin_unlock_irqrestore(&adapter->main_proc_lock, flags);
diff --git a/drivers/net/wireless/realtek/rtl8xxxu/rtl8xxxu_8188f.c b/drivers/net/wireless/realtek/rtl8xxxu/rtl8xxxu_8188f.c
index 1e1c8fa194cb..0466b8be5df0 100644
--- a/drivers/net/wireless/realtek/rtl8xxxu/rtl8xxxu_8188f.c
+++ b/drivers/net/wireless/realtek/rtl8xxxu/rtl8xxxu_8188f.c
@@ -713,9 +713,14 @@ static void rtl8188fu_init_statistics(struct rtl8xxxu_priv *priv)
 	rtl8xxxu_write32(priv, REG_OFDM0_FA_RSTC, val32);
 }
 
+#define TX_POWER_INDEX_MAX 0x3F
+#define TX_POWER_INDEX_DEFAULT_CCK 0x22
+#define TX_POWER_INDEX_DEFAULT_HT40 0x27
+
 static int rtl8188fu_parse_efuse(struct rtl8xxxu_priv *priv)
 {
 	struct rtl8188fu_efuse *efuse = &priv->efuse_wifi.efuse8188fu;
+	int i;
 
 	if (efuse->rtl_id != cpu_to_le16(0x8129))
 		return -EINVAL;
@@ -729,6 +734,16 @@ static int rtl8188fu_parse_efuse(struct rtl8xxxu_priv *priv)
 	       efuse->tx_power_index_A.ht40_base,
 	       sizeof(efuse->tx_power_index_A.ht40_base));
 
+	for (i = 0; i < ARRAY_SIZE(priv->cck_tx_power_index_A); i++) {
+		if (priv->cck_tx_power_index_A[i] > TX_POWER_INDEX_MAX)
+			priv->cck_tx_power_index_A[i] = TX_POWER_INDEX_DEFAULT_CCK;
+	}
+
+	for (i = 0; i < ARRAY_SIZE(priv->ht40_1s_tx_power_index_A); i++) {
+		if (priv->ht40_1s_tx_power_index_A[i] > TX_POWER_INDEX_MAX)
+			priv->ht40_1s_tx_power_index_A[i] = TX_POWER_INDEX_DEFAULT_HT40;
+	}
+
 	priv->ofdm_tx_power_diff[0].a = efuse->tx_power_index_A.ht20_ofdm_1s_diff.a;
 	priv->ht20_tx_power_diff[0].a = efuse->tx_power_index_A.ht20_ofdm_1s_diff.b;
 
diff --git a/drivers/net/wireless/realtek/rtw88/usb.c b/drivers/net/wireless/realtek/rtw88/usb.c
index a0188511099a..efd0c2915a05 100644
--- a/drivers/net/wireless/realtek/rtw88/usb.c
+++ b/drivers/net/wireless/realtek/rtw88/usb.c
@@ -273,6 +273,8 @@ static void rtw_usb_write_port_tx_complete(struct urb *urb)
 		info = IEEE80211_SKB_CB(skb);
 		tx_data = rtw_usb_get_tx_data(skb);
 
+		skb_pull(skb, rtwdev->chip->tx_pkt_desc_sz);
+
 		/* enqueue to wait for tx report */
 		if (info->flags & IEEE80211_TX_CTL_REQ_TX_STATUS) {
 			rtw_tx_report_enqueue(rtwdev, skb, tx_data->sn);
diff --git a/drivers/net/wireless/realtek/rtw89/debug.c b/drivers/net/wireless/realtek/rtw89/debug.c
index d162e64f6064..94fe921e9ff2 100644
--- a/drivers/net/wireless/realtek/rtw89/debug.c
+++ b/drivers/net/wireless/realtek/rtw89/debug.c
@@ -3292,7 +3292,7 @@ static void rtw89_sta_info_get_iter(void *data, struct ieee80211_sta *sta)
 	case RX_ENC_HE:
 		seq_printf(m, "HE %dSS MCS-%d GI:%s", status->nss, status->rate_idx,
 			   status->he_gi <= NL80211_RATE_INFO_HE_GI_3_2 ?
-			   he_gi_str[rate->he_gi] : "N/A");
+			   he_gi_str[status->he_gi] : "N/A");
 		break;
 	}
 	seq_printf(m, " BW:%u", rtw89_rate_info_bw_to_mhz(status->bw));
diff --git a/drivers/net/wireless/realtek/rtw89/rtw8852b_rfk.c b/drivers/net/wireless/realtek/rtw89/rtw8852b_rfk.c
index 259df67836a0..a2fa1d339bc2 100644
--- a/drivers/net/wireless/realtek/rtw89/rtw8852b_rfk.c
+++ b/drivers/net/wireless/realtek/rtw89/rtw8852b_rfk.c
@@ -20,7 +20,7 @@
 #define RTW8852B_RF_REL_VERSION 34
 #define RTW8852B_DPK_VER 0x0d
 #define RTW8852B_DPK_RF_PATH 2
-#define RTW8852B_DPK_KIP_REG_NUM 2
+#define RTW8852B_DPK_KIP_REG_NUM 3
 
 #define _TSSI_DE_MASK GENMASK(21, 12)
 #define ADDC_T_AVG 100
diff --git a/drivers/net/wireless/virtual/virt_wifi.c b/drivers/net/wireless/virtual/virt_wifi.c
index ba14d83353a4..fb4d95a027fe 100644
--- a/drivers/net/wireless/virtual/virt_wifi.c
+++ b/drivers/net/wireless/virtual/virt_wifi.c
@@ -136,6 +136,9 @@ static struct ieee80211_supported_band band_5ghz = {
 /* Assigned at module init. Guaranteed locally-administered and unicast. */
 static u8 fake_router_bssid[ETH_ALEN] __ro_after_init = {};
 
+#define VIRT_WIFI_SSID "VirtWifi"
+#define VIRT_WIFI_SSID_LEN 8
+
 static void virt_wifi_inform_bss(struct wiphy *wiphy)
 {
 	u64 tsf = div_u64(ktime_get_boottime_ns(), 1000);
@@ -146,8 +149,8 @@ static void virt_wifi_inform_bss(struct wiphy *wiphy)
 		u8 ssid[8];
 	} __packed ssid = {
 		.tag = WLAN_EID_SSID,
-		.len = 8,
-		.ssid = "VirtWifi",
+		.len = VIRT_WIFI_SSID_LEN,
+		.ssid = VIRT_WIFI_SSID,
 	};
 
 	informed_bss = cfg80211_inform_bss(wiphy, &channel_5ghz,
@@ -213,6 +216,8 @@ struct virt_wifi_netdev_priv {
 	struct net_device *upperdev;
 	u32 tx_packets;
 	u32 tx_failed;
+	u32 connect_requested_ssid_len;
+	u8 connect_requested_ssid[IEEE80211_MAX_SSID_LEN];
 	u8 connect_requested_bss[ETH_ALEN];
 	bool is_up;
 	bool is_connected;
@@ -229,6 +234,12 @@ static int virt_wifi_connect(struct wiphy *wiphy, struct net_device *netdev,
 	if (priv->being_deleted || !priv->is_up)
 		return -EBUSY;
 
+	if (!sme->ssid)
+		return -EINVAL;
+
+	priv->connect_requested_ssid_len = sme->ssid_len;
+	memcpy(priv->connect_requested_ssid, sme->ssid, sme->ssid_len);
+
 	could_schedule = schedule_delayed_work(&priv->connect, HZ * 2);
 	if (!could_schedule)
 		return -EBUSY;
@@ -252,12 +263,15 @@ static void virt_wifi_connect_complete(struct work_struct *work)
 		container_of(work, struct virt_wifi_netdev_priv, connect.work);
 	u8 *requested_bss = priv->connect_requested_bss;
 	bool right_addr = ether_addr_equal(requested_bss, fake_router_bssid);
+	bool right_ssid = priv->connect_requested_ssid_len == VIRT_WIFI_SSID_LEN &&
+			  !memcmp(priv->connect_requested_ssid, VIRT_WIFI_SSID,
+				  priv->connect_requested_ssid_len);
 	u16 status = WLAN_STATUS_SUCCESS;
 
 	if (is_zero_ether_addr(requested_bss))
 		requested_bss = NULL;
 
-	if (!priv->is_up || (requested_bss && !right_addr))
+	if (!priv->is_up || (requested_bss && !right_addr) || !right_ssid)
 		status = WLAN_STATUS_UNSPECIFIED_FAILURE;
 	else
 		priv->is_connected = true;
diff --git a/drivers/nvme/host/pci.c b/drivers/nvme/host/pci.c
index 710fd4d86252..796c2a00fea4 100644
--- a/drivers/nvme/host/pci.c
+++ b/drivers/nvme/host/pci.c
@@ -863,7 +863,8 @@ static blk_status_t nvme_prep_rq(struct nvme_dev *dev, struct request *req)
 	nvme_start_request(req);
 	return BLK_STS_OK;
 out_unmap_data:
-	nvme_unmap_data(dev, req);
+	if (blk_rq_nr_phys_segments(req))
+		nvme_unmap_data(dev, req);
 out_free_cmd:
 	nvme_cleanup_cmd(req);
 	return ret;
@@ -1275,7 +1276,7 @@ static void nvme_warn_reset(struct nvme_dev *dev, u32 csts)
 	dev_warn(dev->ctrl.device,
 		 "Does your device have a faulty power saving mode enabled?\n");
 	dev_warn(dev->ctrl.device,
-		 "Try \"nvme_core.default_ps_max_latency_us=0 pcie_aspm=off\" and report a bug\n");
+		 "Try \"nvme_core.default_ps_max_latency_us=0 pcie_aspm=off pcie_port_pm=off\" and report a bug\n");
 }
 
 static enum blk_eh_timer_return nvme_timeout(struct request *req)
diff --git a/drivers/nvme/target/auth.c b/drivers/nvme/target/auth.c
index e900525b7866..aacc05ec00c2 100644
--- a/drivers/nvme/target/auth.c
+++ b/drivers/nvme/target/auth.c
@@ -314,7 +314,7 @@ int nvmet_auth_host_hash(struct nvmet_req *req, u8 *response,
 						    req->sq->dhchap_c1,
 						    challenge, shash_len);
 		if (ret)
-			goto out_free_response;
+			goto out_free_challenge;
 	}
 
 	pr_debug("ctrl %d qid %d host response seq %u transaction %d\n",
@@ -325,7 +325,7 @@ int nvmet_auth_host_hash(struct nvmet_req *req, u8 *response,
 			GFP_KERNEL);
 	if (!shash) {
 		ret = -ENOMEM;
-		goto out_free_response;
+		goto out_free_challenge;
 	}
 	shash->tfm = shash_tfm;
 	ret = crypto_shash_init(shash);
@@ -361,9 +361,10 @@ int nvmet_auth_host_hash(struct nvmet_req *req, u8 *response,
 		goto out;
 	ret = crypto_shash_final(shash, response);
 out:
+	kfree(shash);
+out_free_challenge:
 	if (challenge != req->sq->dhchap_c1)
 		kfree(challenge);
-	kfree(shash);
 out_free_response:
 	kfree_sensitive(host_response);
 out_free_tfm:
@@ -426,14 +427,14 @@ int nvmet_auth_ctrl_hash(struct nvmet_req *req, u8 *response,
 						    req->sq->dhchap_c2,
 						    challenge, shash_len);
 		if (ret)
-			goto out_free_response;
+			goto out_free_challenge;
 	}
 
 	shash = kzalloc(sizeof(*shash) + crypto_shash_descsize(shash_tfm),
 			GFP_KERNEL);
 	if (!shash) {
 		ret = -ENOMEM;
-		goto out_free_response;
+		goto out_free_challenge;
 	}
 	shash->tfm = shash_tfm;
 
@@ -470,9 +471,10 @@ int nvmet_auth_ctrl_hash(struct nvmet_req *req, u8 *response,
 		goto out;
 	ret = crypto_shash_final(shash, response);
 out:
+	kfree(shash);
+out_free_challenge:
 	if (challenge != req->sq->dhchap_c2)
 		kfree(challenge);
-	kfree(shash);
 out_free_response:
 	kfree_sensitive(ctrl_response);
 out_free_tfm:
diff --git a/drivers/nvmem/rockchip-otp.c b/drivers/nvmem/rockchip-otp.c
index cb9aa5428350..7107d68a2f8c 100644
--- a/drivers/nvmem/rockchip-otp.c
+++ b/drivers/nvmem/rockchip-otp.c
@@ -255,6 +255,7 @@ static int rockchip_otp_read(void *context, unsigned int offset,
 static struct nvmem_config otp_config = {
 	.name = "rockchip-otp",
 	.owner = THIS_MODULE,
+	.add_legacy_fixed_of_cells = true,
 	.read_only = true,
 	.stride = 1,
 	.word_size = 1,
diff --git a/drivers/opp/ti-opp-supply.c b/drivers/opp/ti-opp-supply.c
index 8f3f13fbbb25..a8a696d2e03a 100644
--- a/drivers/opp/ti-opp-supply.c
+++ b/drivers/opp/ti-opp-supply.c
@@ -400,10 +400,12 @@ static int ti_opp_supply_probe(struct platform_device *pdev)
 	}
 
 	ret = dev_pm_opp_set_config_regulators(cpu_dev, ti_opp_config_regulators);
-	if (ret < 0)
+	if (ret < 0) {
 		_free_optimized_voltages(dev, &opp_data);
+		return ret;
+	}
 
-	return ret;
+	return 0;
 }
 
 static struct platform_driver ti_opp_supply_driver = {
diff --git a/drivers/parport/procfs.c b/drivers/parport/procfs.c
index 4e5b972c3e26..c334ef6e3b3f 100644
--- a/drivers/parport/procfs.c
+++ b/drivers/parport/procfs.c
@@ -58,12 +58,12 @@ static int do_active_device(struct ctl_table *table, int write,
 	
 	for (dev = port->devices; dev ; dev = dev->next) {
 		if(dev == port->cad) {
-			len += sprintf(buffer, "%s\n", dev->name);
+			len += snprintf(buffer, sizeof(buffer), "%s\n", dev->name);
 		}
 	}
 
 	if(!len) {
-		len += sprintf(buffer, "%s\n", "none");
+		len += snprintf(buffer, sizeof(buffer), "%s\n", "none");
 	}
 
 	if (len > *lenp)
@@ -94,19 +94,19 @@ static int do_autoprobe(struct ctl_table *table, int write,
 	}
 	
 	if ((str = info->class_name) != NULL)
-		len += sprintf (buffer + len, "CLASS:%s;\n", str);
+		len += snprintf (buffer + len, sizeof(buffer) - len, "CLASS:%s;\n", str);
 
 	if ((str = info->model) != NULL)
-		len += sprintf (buffer + len, "MODEL:%s;\n", str);
+		len += snprintf (buffer + len, sizeof(buffer) - len, "MODEL:%s;\n", str);
 
 	if ((str = info->mfr) != NULL)
-		len += sprintf (buffer + len, "MANUFACTURER:%s;\n", str);
+		len += snprintf (buffer + len, sizeof(buffer) - len, "MANUFACTURER:%s;\n", str);
 
 	if ((str = info->description) != NULL)
-		len += sprintf (buffer + len, "DESCRIPTION:%s;\n", str);
+		len += snprintf (buffer + len, sizeof(buffer) - len, "DESCRIPTION:%s;\n", str);
 
 	if ((str = info->cmdset) != NULL)
-		len += sprintf (buffer + len, "COMMAND SET:%s;\n", str);
+		len += snprintf (buffer + len, sizeof(buffer) - len, "COMMAND SET:%s;\n", str);
 
 	if (len > *lenp)
 		len = *lenp;
@@ -124,7 +124,7 @@ static int do_hardware_base_addr(struct ctl_table *table, int write,
 				 void *result, size_t *lenp, loff_t *ppos)
 {
 	struct parport *port = (struct parport *)table->extra1;
-	char buffer[20];
+	char buffer[64];
 	int len = 0;
 
 	if (*ppos) {
@@ -135,7 +135,7 @@ static int do_hardware_base_addr(struct ctl_table *table, int write,
 	if (write) /* permissions prevent this anyway */
 		return -EACCES;
 
-	len += sprintf (buffer, "%lu\t%lu\n", port->base, port->base_hi);
+	len += snprintf (buffer, sizeof(buffer), "%lu\t%lu\n", port->base, port->base_hi);
 
 	if (len > *lenp)
 		len = *lenp;
@@ -162,7 +162,7 @@ static int do_hardware_irq(struct ctl_table *table, int write,
 	if (write) /* permissions prevent this anyway */
 		return -EACCES;
 
-	len += sprintf (buffer, "%d\n", port->irq);
+	len += snprintf (buffer, sizeof(buffer), "%d\n", port->irq);
 
 	if (len > *lenp)
 		len = *lenp;
@@ -189,7 +189,7 @@ static int do_hardware_dma(struct ctl_table *table, int write,
 	if (write) /* permissions prevent this anyway */
 		return -EACCES;
 
-	len += sprintf (buffer, "%d\n", port->dma);
+	len += snprintf (buffer, sizeof(buffer), "%d\n", port->dma);
 
 	if (len > *lenp)
 		len = *lenp;
@@ -220,7 +220,7 @@ static int do_hardware_modes(struct ctl_table *table, int write,
 #define printmode(x)							\
 do {									\
 	if (port->modes & PARPORT_MODE_##x)				\
-		len += sprintf(buffer + len, "%s%s", f++ ? "," : "", #x); \
+		len += snprintf(buffer + len, sizeof(buffer) - len, "%s%s", f++ ? "," : "", #x); \
 } while (0)
 		int f = 0;
 		printmode(PCSPP);
diff --git a/drivers/pci/controller/dwc/pci-keystone.c b/drivers/pci/controller/dwc/pci-keystone.c
index cf3836561316..54a3c7f29f78 100644
--- a/drivers/pci/controller/dwc/pci-keystone.c
+++ b/drivers/pci/controller/dwc/pci-keystone.c
@@ -246,8 +246,68 @@ static struct irq_chip ks_pcie_msi_irq_chip = {
 	.irq_unmask = ks_pcie_msi_unmask,
 };
 
+/**
+ * ks_pcie_set_dbi_mode() - Set DBI mode to access overlaid BAR mask registers
+ * @ks_pcie: A pointer to the keystone_pcie structure which holds the KeyStone
+ *	     PCIe host controller driver information.
+ *
+ * Since modification of dbi_cs2 involves different clock domain, read the
+ * status back to ensure the transition is complete.
+ */
+static void ks_pcie_set_dbi_mode(struct keystone_pcie *ks_pcie)
+{
+	u32 val;
+
+	val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
+	val |= DBI_CS2;
+	ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
+
+	do {
+		val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
+	} while (!(val & DBI_CS2));
+}
+
+/**
+ * ks_pcie_clear_dbi_mode() - Disable DBI mode
+ * @ks_pcie: A pointer to the keystone_pcie structure which holds the KeyStone
+ *	     PCIe host controller driver information.
+ *
+ * Since modification of dbi_cs2 involves different clock domain, read the
+ * status back to ensure the transition is complete.
+ */
+static void ks_pcie_clear_dbi_mode(struct keystone_pcie *ks_pcie)
+{
+	u32 val;
+
+	val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
+	val &= ~DBI_CS2;
+	ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
+
+	do {
+		val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
+	} while (val & DBI_CS2);
+}
+
 static int ks_pcie_msi_host_init(struct dw_pcie_rp *pp)
 {
+	struct dw_pcie *pci = to_dw_pcie_from_pp(pp);
+	struct keystone_pcie *ks_pcie = to_keystone_pcie(pci);
+
+	/* Configure and set up BAR0 */
+	ks_pcie_set_dbi_mode(ks_pcie);
+
+	/* Enable BAR0 */
+	dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, 1);
+	dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, SZ_4K - 1);
+
+	ks_pcie_clear_dbi_mode(ks_pcie);
+
+	/*
+	 * For BAR0, just setting bus address for inbound writes (MSI) should
+	 * be sufficient.  Use physical address to avoid any conflicts.
+	 */
+	dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, ks_pcie->app.start);
+
 	pp->msi_irq_chip = &ks_pcie_msi_irq_chip;
 	return dw_pcie_allocate_domains(pp);
 }
@@ -342,59 +402,22 @@ static const struct irq_domain_ops ks_pcie_legacy_irq_domain_ops = {
 	.xlate = irq_domain_xlate_onetwocell,
 };
 
-/**
- * ks_pcie_set_dbi_mode() - Set DBI mode to access overlaid BAR mask registers
- * @ks_pcie: A pointer to the keystone_pcie structure which holds the KeyStone
- *	     PCIe host controller driver information.
- *
- * Since modification of dbi_cs2 involves different clock domain, read the
- * status back to ensure the transition is complete.
- */
-static void ks_pcie_set_dbi_mode(struct keystone_pcie *ks_pcie)
-{
-	u32 val;
-
-	val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
-	val |= DBI_CS2;
-	ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
-
-	do {
-		val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
-	} while (!(val & DBI_CS2));
-}
-
-/**
- * ks_pcie_clear_dbi_mode() - Disable DBI mode
- * @ks_pcie: A pointer to the keystone_pcie structure which holds the KeyStone
- *	     PCIe host controller driver information.
- *
- * Since modification of dbi_cs2 involves different clock domain, read the
- * status back to ensure the transition is complete.
- */
-static void ks_pcie_clear_dbi_mode(struct keystone_pcie *ks_pcie)
-{
-	u32 val;
-
-	val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
-	val &= ~DBI_CS2;
-	ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
-
-	do {
-		val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
-	} while (val & DBI_CS2);
-}
-
-static void ks_pcie_setup_rc_app_regs(struct keystone_pcie *ks_pcie)
+static int ks_pcie_setup_rc_app_regs(struct keystone_pcie *ks_pcie)
 {
 	u32 val;
 	u32 num_viewport = ks_pcie->num_viewport;
 	struct dw_pcie *pci = ks_pcie->pci;
 	struct dw_pcie_rp *pp = &pci->pp;
-	u64 start, end;
+	struct resource_entry *entry;
 	struct resource *mem;
+	u64 start, end;
 	int i;
 
-	mem = resource_list_first_type(&pp->bridge->windows, IORESOURCE_MEM)->res;
+	entry = resource_list_first_type(&pp->bridge->windows, IORESOURCE_MEM);
+	if (!entry)
+		return -ENODEV;
+
+	mem = entry->res;
 	start = mem->start;
 	end = mem->end;
 
@@ -405,7 +428,7 @@ static void ks_pcie_setup_rc_app_regs(struct keystone_pcie *ks_pcie)
 	ks_pcie_clear_dbi_mode(ks_pcie);
 
 	if (ks_pcie->is_am6)
-		return;
+		return 0;
 
 	val = ilog2(OB_WIN_SIZE);
 	ks_pcie_app_writel(ks_pcie, OB_SIZE, val);
@@ -422,6 +445,8 @@ static void ks_pcie_setup_rc_app_regs(struct keystone_pcie *ks_pcie)
 	val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
 	val |= OB_XLAT_EN_VAL;
 	ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
+
+	return 0;
 }
 
 static void __iomem *ks_pcie_other_map_bus(struct pci_bus *bus,
@@ -447,44 +472,10 @@ static struct pci_ops ks_child_pcie_ops = {
 	.write = pci_generic_config_write,
 };
 
-/**
- * ks_pcie_v3_65_add_bus() - keystone add_bus post initialization
- * @bus: A pointer to the PCI bus structure.
- *
- * This sets BAR0 to enable inbound access for MSI_IRQ register
- */
-static int ks_pcie_v3_65_add_bus(struct pci_bus *bus)
-{
-	struct dw_pcie_rp *pp = bus->sysdata;
-	struct dw_pcie *pci = to_dw_pcie_from_pp(pp);
-	struct keystone_pcie *ks_pcie = to_keystone_pcie(pci);
-
-	if (!pci_is_root_bus(bus))
-		return 0;
-
-	/* Configure and set up BAR0 */
-	ks_pcie_set_dbi_mode(ks_pcie);
-
-	/* Enable BAR0 */
-	dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, 1);
-	dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, SZ_4K - 1);
-
-	ks_pcie_clear_dbi_mode(ks_pcie);
-
-	 /*
-	  * For BAR0, just setting bus address for inbound writes (MSI) should
-	  * be sufficient.  Use physical address to avoid any conflicts.
-	  */
-	dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, ks_pcie->app.start);
-
-	return 0;
-}
-
 static struct pci_ops ks_pcie_ops = {
 	.map_bus = dw_pcie_own_conf_map_bus,
 	.read = pci_generic_config_read,
 	.write = pci_generic_config_write,
-	.add_bus = ks_pcie_v3_65_add_bus,
 };
 
 /**
@@ -817,7 +808,10 @@ static int __init ks_pcie_host_init(struct dw_pcie_rp *pp)
 		return ret;
 
 	ks_pcie_stop_link(pci);
-	ks_pcie_setup_rc_app_regs(ks_pcie);
+	ret = ks_pcie_setup_rc_app_regs(ks_pcie);
+	if (ret)
+		return ret;
+
 	writew(PCI_IO_RANGE_TYPE_32 | (PCI_IO_RANGE_TYPE_32 << 8),
 			pci->dbi_base + PCI_IO_BASE);
 
diff --git a/drivers/pci/controller/dwc/pcie-designware-ep.c b/drivers/pci/controller/dwc/pcie-designware-ep.c
index ad6516a3ae6e..f2e5feba5526 100644
--- a/drivers/pci/controller/dwc/pcie-designware-ep.c
+++ b/drivers/pci/controller/dwc/pcie-designware-ep.c
@@ -163,7 +163,7 @@ static int dw_pcie_ep_inbound_atu(struct dw_pcie_ep *ep, u8 func_no, int type,
 	if (!ep->bar_to_atu[bar])
 		free_win = find_first_zero_bit(ep->ib_window_map, pci->num_ib_windows);
 	else
-		free_win = ep->bar_to_atu[bar];
+		free_win = ep->bar_to_atu[bar] - 1;
 
 	if (free_win >= pci->num_ib_windows) {
 		dev_err(pci->dev, "No free inbound window\n");
@@ -177,7 +177,11 @@ static int dw_pcie_ep_inbound_atu(struct dw_pcie_ep *ep, u8 func_no, int type,
 		return ret;
 	}
 
-	ep->bar_to_atu[bar] = free_win;
+	/*
+	 * Always increment free_win before assignment, since value 0 is used to identify
+	 * unallocated mapping.
+	 */
+	ep->bar_to_atu[bar] = free_win + 1;
 	set_bit(free_win, ep->ib_window_map);
 
 	return 0;
@@ -214,7 +218,10 @@ static void dw_pcie_ep_clear_bar(struct pci_epc *epc, u8 func_no, u8 vfunc_no,
 	struct dw_pcie_ep *ep = epc_get_drvdata(epc);
 	struct dw_pcie *pci = to_dw_pcie_from_ep(ep);
 	enum pci_barno bar = epf_bar->barno;
-	u32 atu_index = ep->bar_to_atu[bar];
+	u32 atu_index = ep->bar_to_atu[bar] - 1;
+
+	if (!ep->bar_to_atu[bar])
+		return;
 
 	__dw_pcie_ep_reset_bar(pci, func_no, bar, epf_bar->flags);
 
diff --git a/drivers/pci/controller/dwc/pcie-dw-rockchip.c b/drivers/pci/controller/dwc/pcie-dw-rockchip.c
index 2fe42c70097f..9b1256da096c 100644
--- a/drivers/pci/controller/dwc/pcie-dw-rockchip.c
+++ b/drivers/pci/controller/dwc/pcie-dw-rockchip.c
@@ -240,7 +240,7 @@ static int rockchip_pcie_resource_get(struct platform_device *pdev,
 		return PTR_ERR(rockchip->apb_base);
 
 	rockchip->rst_gpio = devm_gpiod_get_optional(&pdev->dev, "reset",
-						     GPIOD_OUT_HIGH);
+						     GPIOD_OUT_LOW);
 	if (IS_ERR(rockchip->rst_gpio))
 		return PTR_ERR(rockchip->rst_gpio);
 
diff --git a/drivers/pci/controller/dwc/pcie-qcom-ep.c b/drivers/pci/controller/dwc/pcie-qcom-ep.c
index 9b62ee6992f0..66e080c99d5d 100644
--- a/drivers/pci/controller/dwc/pcie-qcom-ep.c
+++ b/drivers/pci/controller/dwc/pcie-qcom-ep.c
@@ -519,12 +519,6 @@ static int qcom_pcie_perst_deassert(struct dw_pcie *pci)
 static void qcom_pcie_perst_assert(struct dw_pcie *pci)
 {
 	struct qcom_pcie_ep *pcie_ep = to_pcie_ep(pci);
-	struct device *dev = pci->dev;
-
-	if (pcie_ep->link_status == QCOM_PCIE_EP_LINK_DISABLED) {
-		dev_dbg(dev, "Link is already disabled\n");
-		return;
-	}
 
 	qcom_pcie_disable_resources(pcie_ep);
 	pcie_ep->link_status = QCOM_PCIE_EP_LINK_DISABLED;
diff --git a/drivers/pci/controller/pci-hyperv.c b/drivers/pci/controller/pci-hyperv.c
index 5ab1a035c496..4c34909810d8 100644
--- a/drivers/pci/controller/pci-hyperv.c
+++ b/drivers/pci/controller/pci-hyperv.c
@@ -1137,8 +1137,8 @@ static void _hv_pcifront_read_config(struct hv_pci_dev *hpdev, int where,
 		   PCI_CAPABILITY_LIST) {
 		/* ROM BARs are unimplemented */
 		*val = 0;
-	} else if (where >= PCI_INTERRUPT_LINE && where + size <=
-		   PCI_INTERRUPT_PIN) {
+	} else if ((where >= PCI_INTERRUPT_LINE && where + size <= PCI_INTERRUPT_PIN) ||
+		   (where >= PCI_INTERRUPT_PIN && where + size <= PCI_MIN_GNT)) {
 		/*
 		 * Interrupt Line and Interrupt PIN are hard-wired to zero
 		 * because this front-end only supports message-signaled
diff --git a/drivers/pci/controller/pci-loongson.c b/drivers/pci/controller/pci-loongson.c
index 8b34ccff073a..bc630ab8a283 100644
--- a/drivers/pci/controller/pci-loongson.c
+++ b/drivers/pci/controller/pci-loongson.c
@@ -163,6 +163,19 @@ DECLARE_PCI_FIXUP_FINAL(PCI_VENDOR_ID_LOONGSON,
 DECLARE_PCI_FIXUP_FINAL(PCI_VENDOR_ID_LOONGSON,
 			DEV_LS7A_HDMI, loongson_pci_pin_quirk);
 
+static void loongson_pci_msi_quirk(struct pci_dev *dev)
+{
+	u16 val, class = dev->class >> 8;
+
+	if (class != PCI_CLASS_BRIDGE_HOST)
+		return;
+
+	pci_read_config_word(dev, dev->msi_cap + PCI_MSI_FLAGS, &val);
+	val |= PCI_MSI_FLAGS_ENABLE;
+	pci_write_config_word(dev, dev->msi_cap + PCI_MSI_FLAGS, val);
+}
+DECLARE_PCI_FIXUP_FINAL(PCI_VENDOR_ID_LOONGSON, DEV_LS7A_PCIE_PORT5, loongson_pci_msi_quirk);
+
 static struct loongson_pci *pci_bus_to_loongson_pci(struct pci_bus *bus)
 {
 	struct pci_config_window *cfg;
diff --git a/drivers/pci/controller/pcie-rcar-host.c b/drivers/pci/controller/pcie-rcar-host.c
index 88975e40ee2f..704ab5d723a9 100644
--- a/drivers/pci/controller/pcie-rcar-host.c
+++ b/drivers/pci/controller/pcie-rcar-host.c
@@ -77,7 +77,11 @@ static int rcar_pcie_wakeup(struct device *pcie_dev, void __iomem *pcie_base)
 		writel(L1IATN, pcie_base + PMCTLR);
 		ret = readl_poll_timeout_atomic(pcie_base + PMSR, val,
 						val & L1FAEG, 10, 1000);
-		WARN(ret, "Timeout waiting for L1 link state, ret=%d\n", ret);
+		if (ret) {
+			dev_warn_ratelimited(pcie_dev,
+					     "Timeout waiting for L1 link state, ret=%d\n",
+					     ret);
+		}
 		writel(L1FAEG | PMEL1RX, pcie_base + PMSR);
 	}
 
diff --git a/drivers/pci/controller/pcie-rockchip.c b/drivers/pci/controller/pcie-rockchip.c
index 0ef2e622d36e..c07d7129f1c7 100644
--- a/drivers/pci/controller/pcie-rockchip.c
+++ b/drivers/pci/controller/pcie-rockchip.c
@@ -121,7 +121,7 @@ int rockchip_pcie_parse_dt(struct rockchip_pcie *rockchip)
 
 	if (rockchip->is_rc) {
 		rockchip->ep_gpio = devm_gpiod_get_optional(dev, "ep",
-							    GPIOD_OUT_HIGH);
+							    GPIOD_OUT_LOW);
 		if (IS_ERR(rockchip->ep_gpio))
 			return dev_err_probe(dev, PTR_ERR(rockchip->ep_gpio),
 					     "failed to get ep GPIO\n");
diff --git a/drivers/pci/endpoint/functions/pci-epf-vntb.c b/drivers/pci/endpoint/functions/pci-epf-vntb.c
index 2b7bc5a731dd..3368f483f818 100644
--- a/drivers/pci/endpoint/functions/pci-epf-vntb.c
+++ b/drivers/pci/endpoint/functions/pci-epf-vntb.c
@@ -810,8 +810,9 @@ static int epf_ntb_epc_init(struct epf_ntb *ntb)
  */
 static void epf_ntb_epc_cleanup(struct epf_ntb *ntb)
 {
-	epf_ntb_db_bar_clear(ntb);
 	epf_ntb_mw_bar_clear(ntb, ntb->num_mws);
+	epf_ntb_db_bar_clear(ntb);
+	epf_ntb_config_sspad_bar_clear(ntb);
 }
 
 #define EPF_NTB_R(_name)						\
@@ -1029,8 +1030,10 @@ static int vpci_scan_bus(void *sysdata)
 	struct epf_ntb *ndev = sysdata;
 
 	vpci_bus = pci_scan_bus(ndev->vbus_number, &vpci_ops, sysdata);
-	if (vpci_bus)
-		pr_err("create pci bus\n");
+	if (!vpci_bus) {
+		pr_err("create pci bus failed\n");
+		return -EINVAL;
+	}
 
 	pci_bus_add_devices(vpci_bus);
 
@@ -1349,13 +1352,19 @@ static int epf_ntb_bind(struct pci_epf *epf)
 	ret = pci_register_driver(&vntb_pci_driver);
 	if (ret) {
 		dev_err(dev, "failure register vntb pci driver\n");
-		goto err_bar_alloc;
+		goto err_epc_cleanup;
 	}
 
-	vpci_scan_bus(ntb);
+	ret = vpci_scan_bus(ntb);
+	if (ret)
+		goto err_unregister;
 
 	return 0;
 
+err_unregister:
+	pci_unregister_driver(&vntb_pci_driver);
+err_epc_cleanup:
+	epf_ntb_epc_cleanup(ntb);
 err_bar_alloc:
 	epf_ntb_config_spad_bar_free(ntb);
 
diff --git a/drivers/pci/pci.c b/drivers/pci/pci.c
index cd759e19cc18..a0f961a380fa 100644
--- a/drivers/pci/pci.c
+++ b/drivers/pci/pci.c
@@ -5123,7 +5123,7 @@ static int pci_bus_max_d3cold_delay(const struct pci_bus *bus)
  */
 int pci_bridge_wait_for_secondary_bus(struct pci_dev *dev, char *reset_type)
 {
-	struct pci_dev *child;
+	struct pci_dev *child __free(pci_dev_put) = NULL;
 	int delay;
 
 	if (pci_dev_is_disconnected(dev))
@@ -5152,8 +5152,8 @@ int pci_bridge_wait_for_secondary_bus(struct pci_dev *dev, char *reset_type)
 		return 0;
 	}
 
-	child = list_first_entry(&dev->subordinate->devices, struct pci_dev,
-				 bus_list);
+	child = pci_dev_get(list_first_entry(&dev->subordinate->devices,
+					     struct pci_dev, bus_list));
 	up_read(&pci_bus_sem);
 
 	/*
diff --git a/drivers/pci/setup-bus.c b/drivers/pci/setup-bus.c
index dae490f25641..5a143ad5fca2 100644
--- a/drivers/pci/setup-bus.c
+++ b/drivers/pci/setup-bus.c
@@ -820,11 +820,9 @@ static resource_size_t calculate_memsize(resource_size_t size,
 		size = min_size;
 	if (old_size == 1)
 		old_size = 0;
-	if (size < old_size)
-		size = old_size;
 
-	size = ALIGN(max(size, add_size) + children_add_size, align);
-	return size;
+	size = max(size, add_size) + children_add_size;
+	return ALIGN(max(size, old_size), align);
 }
 
 resource_size_t __weak pcibios_window_alignment(struct pci_bus *bus,
diff --git a/drivers/phy/cadence/phy-cadence-torrent.c b/drivers/phy/cadence/phy-cadence-torrent.c
index a75c96385c57..a23d7f9b7d10 100644
--- a/drivers/phy/cadence/phy-cadence-torrent.c
+++ b/drivers/phy/cadence/phy-cadence-torrent.c
@@ -1154,6 +1154,9 @@ static int cdns_torrent_dp_set_power_state(struct cdns_torrent_phy *cdns_phy,
 	ret = regmap_read_poll_timeout(regmap, PHY_PMA_XCVR_POWER_STATE_ACK,
 				       read_val, (read_val & mask) == value, 0,
 				       POLL_TIMEOUT_US);
+	if (ret)
+		return ret;
+
 	cdns_torrent_dp_write(regmap, PHY_PMA_XCVR_POWER_STATE_REQ, 0x00000000);
 	ndelay(100);
 
diff --git a/drivers/phy/xilinx/phy-zynqmp.c b/drivers/phy/xilinx/phy-zynqmp.c
index 2559c6594cea..0cb5088e460b 100644
--- a/drivers/phy/xilinx/phy-zynqmp.c
+++ b/drivers/phy/xilinx/phy-zynqmp.c
@@ -80,7 +80,8 @@
 
 /* Reference clock selection parameters */
 #define L0_Ln_REF_CLK_SEL(n)		(0x2860 + (n) * 4)
-#define L0_REF_CLK_SEL_MASK		0x8f
+#define L0_REF_CLK_LCL_SEL		BIT(7)
+#define L0_REF_CLK_SEL_MASK		0x9f
 
 /* Calibration digital logic parameters */
 #define L3_TM_CALIB_DIG19		0xec4c
@@ -349,11 +350,12 @@ static void xpsgtr_configure_pll(struct xpsgtr_phy *gtr_phy)
 		       PLL_FREQ_MASK, ssc->pll_ref_clk);
 
 	/* Enable lane clock sharing, if required */
-	if (gtr_phy->refclk != gtr_phy->lane) {
-		/* Lane3 Ref Clock Selection Register */
+	if (gtr_phy->refclk == gtr_phy->lane)
+		xpsgtr_clr_set(gtr_phy->dev, L0_Ln_REF_CLK_SEL(gtr_phy->lane),
+			       L0_REF_CLK_SEL_MASK, L0_REF_CLK_LCL_SEL);
+	else
 		xpsgtr_clr_set(gtr_phy->dev, L0_Ln_REF_CLK_SEL(gtr_phy->lane),
 			       L0_REF_CLK_SEL_MASK, 1 << gtr_phy->refclk);
-	}
 
 	/* SSC step size [7:0] */
 	xpsgtr_clr_set_phy(gtr_phy, L0_PLL_SS_STEP_SIZE_0_LSB,
@@ -573,7 +575,7 @@ static int xpsgtr_phy_init(struct phy *phy)
 	mutex_lock(&gtr_dev->gtr_mutex);
 
 	/* Configure and enable the clock when peripheral phy_init call */
-	if (clk_prepare_enable(gtr_dev->clk[gtr_phy->lane]))
+	if (clk_prepare_enable(gtr_dev->clk[gtr_phy->refclk]))
 		goto out;
 
 	/* Skip initialization if not required. */
@@ -625,7 +627,7 @@ static int xpsgtr_phy_exit(struct phy *phy)
 	gtr_phy->skip_phy_init = false;
 
 	/* Ensure that disable clock only, which configure for lane */
-	clk_disable_unprepare(gtr_dev->clk[gtr_phy->lane]);
+	clk_disable_unprepare(gtr_dev->clk[gtr_phy->refclk]);
 
 	return 0;
 }
diff --git a/drivers/pinctrl/core.c b/drivers/pinctrl/core.c
index e19ee66e027b..88ee086e1376 100644
--- a/drivers/pinctrl/core.c
+++ b/drivers/pinctrl/core.c
@@ -2072,6 +2072,14 @@ pinctrl_init_controller(struct pinctrl_desc *pctldesc, struct device *dev,
 	return ERR_PTR(ret);
 }
 
+static void pinctrl_uninit_controller(struct pinctrl_dev *pctldev, struct pinctrl_desc *pctldesc)
+{
+	pinctrl_free_pindescs(pctldev, pctldesc->pins,
+			      pctldesc->npins);
+	mutex_destroy(&pctldev->mutex);
+	kfree(pctldev);
+}
+
 static int pinctrl_claim_hogs(struct pinctrl_dev *pctldev)
 {
 	pctldev->p = create_pinctrl(pctldev->dev, pctldev);
@@ -2152,8 +2160,10 @@ struct pinctrl_dev *pinctrl_register(struct pinctrl_desc *pctldesc,
 		return pctldev;
 
 	error = pinctrl_enable(pctldev);
-	if (error)
+	if (error) {
+		pinctrl_uninit_controller(pctldev, pctldesc);
 		return ERR_PTR(error);
+	}
 
 	return pctldev;
 }
diff --git a/drivers/pinctrl/freescale/pinctrl-mxs.c b/drivers/pinctrl/freescale/pinctrl-mxs.c
index cf3f4d2e0c16..a53287aaa653 100644
--- a/drivers/pinctrl/freescale/pinctrl-mxs.c
+++ b/drivers/pinctrl/freescale/pinctrl-mxs.c
@@ -408,8 +408,8 @@ static int mxs_pinctrl_probe_dt(struct platform_device *pdev,
 	int ret;
 	u32 val;
 
-	child = of_get_next_child(np, NULL);
-	if (!child) {
+	val = of_get_child_count(np);
+	if (val == 0) {
 		dev_err(&pdev->dev, "no group is defined\n");
 		return -ENOENT;
 	}
diff --git a/drivers/pinctrl/pinctrl-rockchip.c b/drivers/pinctrl/pinctrl-rockchip.c
index caf8d0a98c32..b02eaba010d1 100644
--- a/drivers/pinctrl/pinctrl-rockchip.c
+++ b/drivers/pinctrl/pinctrl-rockchip.c
@@ -915,9 +915,8 @@ static struct rockchip_mux_route_data rk3308_mux_route_data[] = {
 	RK_MUXROUTE_SAME(0, RK_PC3, 1, 0x314, BIT(16 + 0) | BIT(0)), /* rtc_clk */
 	RK_MUXROUTE_SAME(1, RK_PC6, 2, 0x314, BIT(16 + 2) | BIT(16 + 3)), /* uart2_rxm0 */
 	RK_MUXROUTE_SAME(4, RK_PD2, 2, 0x314, BIT(16 + 2) | BIT(16 + 3) | BIT(2)), /* uart2_rxm1 */
-	RK_MUXROUTE_SAME(0, RK_PB7, 2, 0x608, BIT(16 + 8) | BIT(16 + 9)), /* i2c3_sdam0 */
-	RK_MUXROUTE_SAME(3, RK_PB4, 2, 0x608, BIT(16 + 8) | BIT(16 + 9) | BIT(8)), /* i2c3_sdam1 */
-	RK_MUXROUTE_SAME(2, RK_PA0, 3, 0x608, BIT(16 + 8) | BIT(16 + 9) | BIT(9)), /* i2c3_sdam2 */
+	RK_MUXROUTE_SAME(0, RK_PB7, 2, 0x314, BIT(16 + 4)), /* i2c3_sdam0 */
+	RK_MUXROUTE_SAME(3, RK_PB4, 2, 0x314, BIT(16 + 4) | BIT(4)), /* i2c3_sdam1 */
 	RK_MUXROUTE_SAME(1, RK_PA3, 2, 0x308, BIT(16 + 3)), /* i2s-8ch-1-sclktxm0 */
 	RK_MUXROUTE_SAME(1, RK_PA4, 2, 0x308, BIT(16 + 3)), /* i2s-8ch-1-sclkrxm0 */
 	RK_MUXROUTE_SAME(1, RK_PB5, 2, 0x308, BIT(16 + 3) | BIT(3)), /* i2s-8ch-1-sclktxm1 */
@@ -926,18 +925,6 @@ static struct rockchip_mux_route_data rk3308_mux_route_data[] = {
 	RK_MUXROUTE_SAME(1, RK_PB6, 4, 0x308, BIT(16 + 12) | BIT(16 + 13) | BIT(12)), /* pdm-clkm1 */
 	RK_MUXROUTE_SAME(2, RK_PA6, 2, 0x308, BIT(16 + 12) | BIT(16 + 13) | BIT(13)), /* pdm-clkm2 */
 	RK_MUXROUTE_SAME(2, RK_PA4, 3, 0x600, BIT(16 + 2) | BIT(2)), /* pdm-clkm-m2 */
-	RK_MUXROUTE_SAME(3, RK_PB2, 3, 0x314, BIT(16 + 9)), /* spi1_miso */
-	RK_MUXROUTE_SAME(2, RK_PA4, 2, 0x314, BIT(16 + 9) | BIT(9)), /* spi1_miso_m1 */
-	RK_MUXROUTE_SAME(0, RK_PB3, 3, 0x314, BIT(16 + 10) | BIT(16 + 11)), /* owire_m0 */
-	RK_MUXROUTE_SAME(1, RK_PC6, 7, 0x314, BIT(16 + 10) | BIT(16 + 11) | BIT(10)), /* owire_m1 */
-	RK_MUXROUTE_SAME(2, RK_PA2, 5, 0x314, BIT(16 + 10) | BIT(16 + 11) | BIT(11)), /* owire_m2 */
-	RK_MUXROUTE_SAME(0, RK_PB3, 2, 0x314, BIT(16 + 12) | BIT(16 + 13)), /* can_rxd_m0 */
-	RK_MUXROUTE_SAME(1, RK_PC6, 5, 0x314, BIT(16 + 12) | BIT(16 + 13) | BIT(12)), /* can_rxd_m1 */
-	RK_MUXROUTE_SAME(2, RK_PA2, 4, 0x314, BIT(16 + 12) | BIT(16 + 13) | BIT(13)), /* can_rxd_m2 */
-	RK_MUXROUTE_SAME(1, RK_PC4, 3, 0x314, BIT(16 + 14)), /* mac_rxd0_m0 */
-	RK_MUXROUTE_SAME(4, RK_PA2, 2, 0x314, BIT(16 + 14) | BIT(14)), /* mac_rxd0_m1 */
-	RK_MUXROUTE_SAME(3, RK_PB4, 4, 0x314, BIT(16 + 15)), /* uart3_rx */
-	RK_MUXROUTE_SAME(0, RK_PC1, 3, 0x314, BIT(16 + 15) | BIT(15)), /* uart3_rx_m1 */
 };
 
 static struct rockchip_mux_route_data rk3328_mux_route_data[] = {
diff --git a/drivers/pinctrl/pinctrl-single.c b/drivers/pinctrl/pinctrl-single.c
index 461a7c02d4a3..17e08f21756c 100644
--- a/drivers/pinctrl/pinctrl-single.c
+++ b/drivers/pinctrl/pinctrl-single.c
@@ -1327,7 +1327,6 @@ static void pcs_irq_free(struct pcs_device *pcs)
 static void pcs_free_resources(struct pcs_device *pcs)
 {
 	pcs_irq_free(pcs);
-	pinctrl_unregister(pcs->pctl);
 
 #if IS_BUILTIN(CONFIG_PINCTRL_SINGLE)
 	if (pcs->missing_nr_pinctrl_cells)
@@ -1884,7 +1883,7 @@ static int pcs_probe(struct platform_device *pdev)
 	if (ret < 0)
 		goto free;
 
-	ret = pinctrl_register_and_init(&pcs->desc, pcs->dev, pcs, &pcs->pctl);
+	ret = devm_pinctrl_register_and_init(pcs->dev, &pcs->desc, pcs, &pcs->pctl);
 	if (ret) {
 		dev_err(pcs->dev, "could not register single pinctrl driver\n");
 		goto free;
@@ -1917,8 +1916,10 @@ static int pcs_probe(struct platform_device *pdev)
 
 	dev_info(pcs->dev, "%i pins, size %u\n", pcs->desc.npins, pcs->size);
 
-	return pinctrl_enable(pcs->pctl);
+	if (pinctrl_enable(pcs->pctl))
+		goto free;
 
+	return 0;
 free:
 	pcs_free_resources(pcs);
 
diff --git a/drivers/pinctrl/renesas/pfc-r8a779g0.c b/drivers/pinctrl/renesas/pfc-r8a779g0.c
index d2de526a3b58..bb843e333c88 100644
--- a/drivers/pinctrl/renesas/pfc-r8a779g0.c
+++ b/drivers/pinctrl/renesas/pfc-r8a779g0.c
@@ -68,20 +68,20 @@
 #define GPSR0_9		F_(MSIOF5_SYNC,		IP1SR0_7_4)
 #define GPSR0_8		F_(MSIOF5_SS1,		IP1SR0_3_0)
 #define GPSR0_7		F_(MSIOF5_SS2,		IP0SR0_31_28)
-#define GPSR0_6		F_(IRQ0,		IP0SR0_27_24)
-#define GPSR0_5		F_(IRQ1,		IP0SR0_23_20)
-#define GPSR0_4		F_(IRQ2,		IP0SR0_19_16)
-#define GPSR0_3		F_(IRQ3,		IP0SR0_15_12)
+#define GPSR0_6		F_(IRQ0_A,		IP0SR0_27_24)
+#define GPSR0_5		F_(IRQ1_A,		IP0SR0_23_20)
+#define GPSR0_4		F_(IRQ2_A,		IP0SR0_19_16)
+#define GPSR0_3		F_(IRQ3_A,		IP0SR0_15_12)
 #define GPSR0_2		F_(GP0_02,		IP0SR0_11_8)
 #define GPSR0_1		F_(GP0_01,		IP0SR0_7_4)
 #define GPSR0_0		F_(GP0_00,		IP0SR0_3_0)
 
 /* GPSR1 */
-#define GPSR1_28	F_(HTX3,		IP3SR1_19_16)
-#define GPSR1_27	F_(HCTS3_N,		IP3SR1_15_12)
-#define GPSR1_26	F_(HRTS3_N,		IP3SR1_11_8)
-#define GPSR1_25	F_(HSCK3,		IP3SR1_7_4)
-#define GPSR1_24	F_(HRX3,		IP3SR1_3_0)
+#define GPSR1_28	F_(HTX3_A,		IP3SR1_19_16)
+#define GPSR1_27	F_(HCTS3_N_A,		IP3SR1_15_12)
+#define GPSR1_26	F_(HRTS3_N_A,		IP3SR1_11_8)
+#define GPSR1_25	F_(HSCK3_A,		IP3SR1_7_4)
+#define GPSR1_24	F_(HRX3_A,		IP3SR1_3_0)
 #define GPSR1_23	F_(GP1_23,		IP2SR1_31_28)
 #define GPSR1_22	F_(AUDIO_CLKIN,		IP2SR1_27_24)
 #define GPSR1_21	F_(AUDIO_CLKOUT,	IP2SR1_23_20)
@@ -119,14 +119,14 @@
 #define GPSR2_11	F_(CANFD0_RX,		IP1SR2_15_12)
 #define GPSR2_10	F_(CANFD0_TX,		IP1SR2_11_8)
 #define GPSR2_9		F_(CAN_CLK,		IP1SR2_7_4)
-#define GPSR2_8		F_(TPU0TO0,		IP1SR2_3_0)
-#define GPSR2_7		F_(TPU0TO1,		IP0SR2_31_28)
+#define GPSR2_8		F_(TPU0TO0_A,		IP1SR2_3_0)
+#define GPSR2_7		F_(TPU0TO1_A,		IP0SR2_31_28)
 #define GPSR2_6		F_(FXR_TXDB,		IP0SR2_27_24)
-#define GPSR2_5		F_(FXR_TXENB_N,		IP0SR2_23_20)
+#define GPSR2_5		F_(FXR_TXENB_N_A,	IP0SR2_23_20)
 #define GPSR2_4		F_(RXDB_EXTFXR,		IP0SR2_19_16)
 #define GPSR2_3		F_(CLK_EXTFXR,		IP0SR2_15_12)
 #define GPSR2_2		F_(RXDA_EXTFXR,		IP0SR2_11_8)
-#define GPSR2_1		F_(FXR_TXENA_N,		IP0SR2_7_4)
+#define GPSR2_1		F_(FXR_TXENA_N_A,	IP0SR2_7_4)
 #define GPSR2_0		F_(FXR_TXDA,		IP0SR2_3_0)
 
 /* GPSR3 */
@@ -275,13 +275,13 @@
 
 /* SR0 */
 /* IP0SR0 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
-#define IP0SR0_3_0	F_(0, 0)		FM(ERROROUTC_N_B)	FM(TCLK2_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_3_0	F_(0, 0)		FM(ERROROUTC_N_B)	FM(TCLK2_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP0SR0_7_4	F_(0, 0)		FM(MSIOF3_SS1)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP0SR0_11_8	F_(0, 0)		FM(MSIOF3_SS2)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR0_15_12	FM(IRQ3)		FM(MSIOF3_SCK)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR0_19_16	FM(IRQ2)		FM(MSIOF3_TXD)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR0_23_20	FM(IRQ1)		FM(MSIOF3_RXD)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR0_27_24	FM(IRQ0)		FM(MSIOF3_SYNC)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_15_12	FM(IRQ3_A)		FM(MSIOF3_SCK)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_19_16	FM(IRQ2_A)		FM(MSIOF3_TXD)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_23_20	FM(IRQ1_A)		FM(MSIOF3_RXD)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_27_24	FM(IRQ0_A)		FM(MSIOF3_SYNC)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP0SR0_31_28	FM(MSIOF5_SS2)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP1SR0 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
@@ -290,72 +290,72 @@
 #define IP1SR0_11_8	FM(MSIOF5_TXD)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR0_15_12	FM(MSIOF5_SCK)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR0_19_16	FM(MSIOF5_RXD)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR0_23_20	FM(MSIOF2_SS2)		FM(TCLK1)		FM(IRQ2_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR0_27_24	FM(MSIOF2_SS1)		FM(HTX1)		FM(TX1)			F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR0_31_28	FM(MSIOF2_SYNC)		FM(HRX1)		FM(RX1)			F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR0_23_20	FM(MSIOF2_SS2)		FM(TCLK1_A)		FM(IRQ2_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR0_27_24	FM(MSIOF2_SS1)		FM(HTX1_A)		FM(TX1_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR0_31_28	FM(MSIOF2_SYNC)		FM(HRX1_A)		FM(RX1_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP2SR0 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
-#define IP2SR0_3_0	FM(MSIOF2_TXD)		FM(HCTS1_N)		FM(CTS1_N)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR0_7_4	FM(MSIOF2_SCK)		FM(HRTS1_N)		FM(RTS1_N)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR0_11_8	FM(MSIOF2_RXD)		FM(HSCK1)		FM(SCK1)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR0_3_0	FM(MSIOF2_TXD)		FM(HCTS1_N_A)		FM(CTS1_N_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR0_7_4	FM(MSIOF2_SCK)		FM(HRTS1_N_A)		FM(RTS1_N_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR0_11_8	FM(MSIOF2_RXD)		FM(HSCK1_A)		FM(SCK1_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* SR1 */
 /* IP0SR1 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
-#define IP0SR1_3_0	FM(MSIOF1_SS2)		FM(HTX3_A)		FM(TX3)			F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_7_4	FM(MSIOF1_SS1)		FM(HCTS3_N_A)		FM(RX3)			F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_11_8	FM(MSIOF1_SYNC)		FM(HRTS3_N_A)		FM(RTS3_N)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_15_12	FM(MSIOF1_SCK)		FM(HSCK3_A)		FM(CTS3_N)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_19_16	FM(MSIOF1_TXD)		FM(HRX3_A)		FM(SCK3)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_3_0	FM(MSIOF1_SS2)		FM(HTX3_B)		FM(TX3_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_7_4	FM(MSIOF1_SS1)		FM(HCTS3_N_B)		FM(RX3_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_11_8	FM(MSIOF1_SYNC)		FM(HRTS3_N_B)		FM(RTS3_N_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_15_12	FM(MSIOF1_SCK)		FM(HSCK3_B)		FM(CTS3_N_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_19_16	FM(MSIOF1_TXD)		FM(HRX3_B)		FM(SCK3_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP0SR1_23_20	FM(MSIOF1_RXD)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_27_24	FM(MSIOF0_SS2)		FM(HTX1_X)		FM(TX1_X)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_31_28	FM(MSIOF0_SS1)		FM(HRX1_X)		FM(RX1_X)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_27_24	FM(MSIOF0_SS2)		FM(HTX1_B)		FM(TX1_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_31_28	FM(MSIOF0_SS1)		FM(HRX1_B)		FM(RX1_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP1SR1 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
-#define IP1SR1_3_0	FM(MSIOF0_SYNC)		FM(HCTS1_N_X)		FM(CTS1_N_X)		FM(CANFD5_TX_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_7_4	FM(MSIOF0_TXD)		FM(HRTS1_N_X)		FM(RTS1_N_X)		FM(CANFD5_RX_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_11_8	FM(MSIOF0_SCK)		FM(HSCK1_X)		FM(SCK1_X)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_3_0	FM(MSIOF0_SYNC)		FM(HCTS1_N_B)		FM(CTS1_N_B)		FM(CANFD5_TX_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_7_4	FM(MSIOF0_TXD)		FM(HRTS1_N_B)		FM(RTS1_N_B)		FM(CANFD5_RX_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_11_8	FM(MSIOF0_SCK)		FM(HSCK1_B)		FM(SCK1_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR1_15_12	FM(MSIOF0_RXD)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR1_19_16	FM(HTX0)		FM(TX0)			F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_23_20	FM(HCTS0_N)		FM(CTS0_N)		FM(PWM8_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_27_24	FM(HRTS0_N)		FM(RTS0_N)		FM(PWM9_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_31_28	FM(HSCK0)		FM(SCK0)		FM(PWM0_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_23_20	FM(HCTS0_N)		FM(CTS0_N)		FM(PWM8)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_27_24	FM(HRTS0_N)		FM(RTS0_N)		FM(PWM9)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_31_28	FM(HSCK0)		FM(SCK0)		FM(PWM0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP2SR1 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
 #define IP2SR1_3_0	FM(HRX0)		FM(RX0)			F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP2SR1_7_4	FM(SCIF_CLK)		FM(IRQ4_A)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_11_8	FM(SSI_SCK)		FM(TCLK3)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_15_12	FM(SSI_WS)		FM(TCLK4)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_19_16	FM(SSI_SD)		FM(IRQ0_A)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_23_20	FM(AUDIO_CLKOUT)	FM(IRQ1_A)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_11_8	FM(SSI_SCK)		FM(TCLK3_B)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_15_12	FM(SSI_WS)		FM(TCLK4_B)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_19_16	FM(SSI_SD)		FM(IRQ0_B)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_23_20	FM(AUDIO_CLKOUT)	FM(IRQ1_B)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP2SR1_27_24	FM(AUDIO_CLKIN)		FM(PWM3_A)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_31_28	F_(0, 0)		FM(TCLK2)		FM(MSIOF4_SS1)		FM(IRQ3_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_31_28	F_(0, 0)		FM(TCLK2_A)		FM(MSIOF4_SS1)		FM(IRQ3_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP3SR1 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
-#define IP3SR1_3_0	FM(HRX3)		FM(SCK3_A)		FM(MSIOF4_SS2)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP3SR1_7_4	FM(HSCK3)		FM(CTS3_N_A)		FM(MSIOF4_SCK)		FM(TPU0TO0_A)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP3SR1_11_8	FM(HRTS3_N)		FM(RTS3_N_A)		FM(MSIOF4_TXD)		FM(TPU0TO1_A)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP3SR1_15_12	FM(HCTS3_N)		FM(RX3_A)		FM(MSIOF4_RXD)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP3SR1_19_16	FM(HTX3)		FM(TX3_A)		FM(MSIOF4_SYNC)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_3_0	FM(HRX3_A)		FM(SCK3_A)		FM(MSIOF4_SS2)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_7_4	FM(HSCK3_A)		FM(CTS3_N_A)		FM(MSIOF4_SCK)		FM(TPU0TO0_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_11_8	FM(HRTS3_N_A)		FM(RTS3_N_A)		FM(MSIOF4_TXD)		FM(TPU0TO1_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_15_12	FM(HCTS3_N_A)		FM(RX3_A)		FM(MSIOF4_RXD)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_19_16	FM(HTX3_A)		FM(TX3_A)		FM(MSIOF4_SYNC)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* SR2 */
 /* IP0SR2 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
-#define IP0SR2_3_0	FM(FXR_TXDA)		FM(CANFD1_TX)		FM(TPU0TO2_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_7_4	FM(FXR_TXENA_N)		FM(CANFD1_RX)		FM(TPU0TO3_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_11_8	FM(RXDA_EXTFXR)		FM(CANFD5_TX)		FM(IRQ5)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_15_12	FM(CLK_EXTFXR)		FM(CANFD5_RX)		FM(IRQ4_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_3_0	FM(FXR_TXDA)		FM(CANFD1_TX)		FM(TPU0TO2_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_7_4	FM(FXR_TXENA_N_A)	FM(CANFD1_RX)		FM(TPU0TO3_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_11_8	FM(RXDA_EXTFXR)		FM(CANFD5_TX_A)		FM(IRQ5)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_15_12	FM(CLK_EXTFXR)		FM(CANFD5_RX_A)		FM(IRQ4_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP0SR2_19_16	FM(RXDB_EXTFXR)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_23_20	FM(FXR_TXENB_N)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_23_20	FM(FXR_TXENB_N_A)	F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP0SR2_27_24	FM(FXR_TXDB)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_31_28	FM(TPU0TO1)		FM(CANFD6_TX)		F_(0, 0)		FM(TCLK2_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_31_28	FM(TPU0TO1_A)		FM(CANFD6_TX)		F_(0, 0)		FM(TCLK2_C)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP1SR2 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
-#define IP1SR2_3_0	FM(TPU0TO0)		FM(CANFD6_RX)		F_(0, 0)		FM(TCLK1_A)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_7_4	FM(CAN_CLK)		FM(FXR_TXENA_N_X)	F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_11_8	FM(CANFD0_TX)		FM(FXR_TXENB_N_X)	F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_3_0	FM(TPU0TO0_A)		FM(CANFD6_RX)		F_(0, 0)		FM(TCLK1_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_7_4	FM(CAN_CLK)		FM(FXR_TXENA_N_B)	F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_11_8	FM(CANFD0_TX)		FM(FXR_TXENB_N_B)	F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR2_15_12	FM(CANFD0_RX)		FM(STPWT_EXTFXR)	F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_19_16	FM(CANFD2_TX)		FM(TPU0TO2)		F_(0, 0)		FM(TCLK3_A)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_23_20	FM(CANFD2_RX)		FM(TPU0TO3)		FM(PWM1_B)		FM(TCLK4_A)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_27_24	FM(CANFD3_TX)		F_(0, 0)		FM(PWM2_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_19_16	FM(CANFD2_TX)		FM(TPU0TO2_A)		F_(0, 0)		FM(TCLK3_C)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_23_20	FM(CANFD2_RX)		FM(TPU0TO3_A)		FM(PWM1_B)		FM(TCLK4_C)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_27_24	FM(CANFD3_TX)		F_(0, 0)		FM(PWM2)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR2_31_28	FM(CANFD3_RX)		F_(0, 0)		FM(PWM3_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP2SR2 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
@@ -381,8 +381,8 @@
 #define IP1SR3_11_8	FM(MMC_SD_CMD)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR3_15_12	FM(SD_CD)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR3_19_16	FM(SD_WP)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR3_23_20	FM(IPC_CLKIN)		FM(IPC_CLKEN_IN)	FM(PWM1_A)		FM(TCLK3_X)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR3_27_24	FM(IPC_CLKOUT)		FM(IPC_CLKEN_OUT)	FM(ERROROUTC_N_A)	FM(TCLK4_X)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR3_23_20	FM(IPC_CLKIN)		FM(IPC_CLKEN_IN)	FM(PWM1_A)		FM(TCLK3_A)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR3_27_24	FM(IPC_CLKOUT)		FM(IPC_CLKEN_OUT)	FM(ERROROUTC_N_A)	FM(TCLK4_A)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR3_31_28	FM(QSPI0_SSL)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP2SR3 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
@@ -718,22 +718,22 @@ static const u16 pinmux_data[] = {
 
 	/* IP0SR0 */
 	PINMUX_IPSR_GPSR(IP0SR0_3_0,	ERROROUTC_N_B),
-	PINMUX_IPSR_GPSR(IP0SR0_3_0,	TCLK2_A),
+	PINMUX_IPSR_GPSR(IP0SR0_3_0,	TCLK2_B),
 
 	PINMUX_IPSR_GPSR(IP0SR0_7_4,	MSIOF3_SS1),
 
 	PINMUX_IPSR_GPSR(IP0SR0_11_8,	MSIOF3_SS2),
 
-	PINMUX_IPSR_GPSR(IP0SR0_15_12,	IRQ3),
+	PINMUX_IPSR_GPSR(IP0SR0_15_12,	IRQ3_A),
 	PINMUX_IPSR_GPSR(IP0SR0_15_12,	MSIOF3_SCK),
 
-	PINMUX_IPSR_GPSR(IP0SR0_19_16,	IRQ2),
+	PINMUX_IPSR_GPSR(IP0SR0_19_16,	IRQ2_A),
 	PINMUX_IPSR_GPSR(IP0SR0_19_16,	MSIOF3_TXD),
 
-	PINMUX_IPSR_GPSR(IP0SR0_23_20,	IRQ1),
+	PINMUX_IPSR_GPSR(IP0SR0_23_20,	IRQ1_A),
 	PINMUX_IPSR_GPSR(IP0SR0_23_20,	MSIOF3_RXD),
 
-	PINMUX_IPSR_GPSR(IP0SR0_27_24,	IRQ0),
+	PINMUX_IPSR_GPSR(IP0SR0_27_24,	IRQ0_A),
 	PINMUX_IPSR_GPSR(IP0SR0_27_24,	MSIOF3_SYNC),
 
 	PINMUX_IPSR_GPSR(IP0SR0_31_28,	MSIOF5_SS2),
@@ -750,75 +750,75 @@ static const u16 pinmux_data[] = {
 	PINMUX_IPSR_GPSR(IP1SR0_19_16,	MSIOF5_RXD),
 
 	PINMUX_IPSR_GPSR(IP1SR0_23_20,	MSIOF2_SS2),
-	PINMUX_IPSR_GPSR(IP1SR0_23_20,	TCLK1),
-	PINMUX_IPSR_GPSR(IP1SR0_23_20,	IRQ2_A),
+	PINMUX_IPSR_GPSR(IP1SR0_23_20,	TCLK1_A),
+	PINMUX_IPSR_GPSR(IP1SR0_23_20,	IRQ2_B),
 
 	PINMUX_IPSR_GPSR(IP1SR0_27_24,	MSIOF2_SS1),
-	PINMUX_IPSR_GPSR(IP1SR0_27_24,	HTX1),
-	PINMUX_IPSR_GPSR(IP1SR0_27_24,	TX1),
+	PINMUX_IPSR_GPSR(IP1SR0_27_24,	HTX1_A),
+	PINMUX_IPSR_GPSR(IP1SR0_27_24,	TX1_A),
 
 	PINMUX_IPSR_GPSR(IP1SR0_31_28,	MSIOF2_SYNC),
-	PINMUX_IPSR_GPSR(IP1SR0_31_28,	HRX1),
-	PINMUX_IPSR_GPSR(IP1SR0_31_28,	RX1),
+	PINMUX_IPSR_GPSR(IP1SR0_31_28,	HRX1_A),
+	PINMUX_IPSR_GPSR(IP1SR0_31_28,	RX1_A),
 
 	/* IP2SR0 */
 	PINMUX_IPSR_GPSR(IP2SR0_3_0,	MSIOF2_TXD),
-	PINMUX_IPSR_GPSR(IP2SR0_3_0,	HCTS1_N),
-	PINMUX_IPSR_GPSR(IP2SR0_3_0,	CTS1_N),
+	PINMUX_IPSR_GPSR(IP2SR0_3_0,	HCTS1_N_A),
+	PINMUX_IPSR_GPSR(IP2SR0_3_0,	CTS1_N_A),
 
 	PINMUX_IPSR_GPSR(IP2SR0_7_4,	MSIOF2_SCK),
-	PINMUX_IPSR_GPSR(IP2SR0_7_4,	HRTS1_N),
-	PINMUX_IPSR_GPSR(IP2SR0_7_4,	RTS1_N),
+	PINMUX_IPSR_GPSR(IP2SR0_7_4,	HRTS1_N_A),
+	PINMUX_IPSR_GPSR(IP2SR0_7_4,	RTS1_N_A),
 
 	PINMUX_IPSR_GPSR(IP2SR0_11_8,	MSIOF2_RXD),
-	PINMUX_IPSR_GPSR(IP2SR0_11_8,	HSCK1),
-	PINMUX_IPSR_GPSR(IP2SR0_11_8,	SCK1),
+	PINMUX_IPSR_GPSR(IP2SR0_11_8,	HSCK1_A),
+	PINMUX_IPSR_GPSR(IP2SR0_11_8,	SCK1_A),
 
 	/* IP0SR1 */
 	PINMUX_IPSR_GPSR(IP0SR1_3_0,	MSIOF1_SS2),
-	PINMUX_IPSR_GPSR(IP0SR1_3_0,	HTX3_A),
-	PINMUX_IPSR_GPSR(IP0SR1_3_0,	TX3),
+	PINMUX_IPSR_GPSR(IP0SR1_3_0,	HTX3_B),
+	PINMUX_IPSR_GPSR(IP0SR1_3_0,	TX3_B),
 
 	PINMUX_IPSR_GPSR(IP0SR1_7_4,	MSIOF1_SS1),
-	PINMUX_IPSR_GPSR(IP0SR1_7_4,	HCTS3_N_A),
-	PINMUX_IPSR_GPSR(IP0SR1_7_4,	RX3),
+	PINMUX_IPSR_GPSR(IP0SR1_7_4,	HCTS3_N_B),
+	PINMUX_IPSR_GPSR(IP0SR1_7_4,	RX3_B),
 
 	PINMUX_IPSR_GPSR(IP0SR1_11_8,	MSIOF1_SYNC),
-	PINMUX_IPSR_GPSR(IP0SR1_11_8,	HRTS3_N_A),
-	PINMUX_IPSR_GPSR(IP0SR1_11_8,	RTS3_N),
+	PINMUX_IPSR_GPSR(IP0SR1_11_8,	HRTS3_N_B),
+	PINMUX_IPSR_GPSR(IP0SR1_11_8,	RTS3_N_B),
 
 	PINMUX_IPSR_GPSR(IP0SR1_15_12,	MSIOF1_SCK),
-	PINMUX_IPSR_GPSR(IP0SR1_15_12,	HSCK3_A),
-	PINMUX_IPSR_GPSR(IP0SR1_15_12,	CTS3_N),
+	PINMUX_IPSR_GPSR(IP0SR1_15_12,	HSCK3_B),
+	PINMUX_IPSR_GPSR(IP0SR1_15_12,	CTS3_N_B),
 
 	PINMUX_IPSR_GPSR(IP0SR1_19_16,	MSIOF1_TXD),
-	PINMUX_IPSR_GPSR(IP0SR1_19_16,	HRX3_A),
-	PINMUX_IPSR_GPSR(IP0SR1_19_16,	SCK3),
+	PINMUX_IPSR_GPSR(IP0SR1_19_16,	HRX3_B),
+	PINMUX_IPSR_GPSR(IP0SR1_19_16,	SCK3_B),
 
 	PINMUX_IPSR_GPSR(IP0SR1_23_20,	MSIOF1_RXD),
 
 	PINMUX_IPSR_GPSR(IP0SR1_27_24,	MSIOF0_SS2),
-	PINMUX_IPSR_GPSR(IP0SR1_27_24,	HTX1_X),
-	PINMUX_IPSR_GPSR(IP0SR1_27_24,	TX1_X),
+	PINMUX_IPSR_GPSR(IP0SR1_27_24,	HTX1_B),
+	PINMUX_IPSR_GPSR(IP0SR1_27_24,	TX1_B),
 
 	PINMUX_IPSR_GPSR(IP0SR1_31_28,	MSIOF0_SS1),
-	PINMUX_IPSR_GPSR(IP0SR1_31_28,	HRX1_X),
-	PINMUX_IPSR_GPSR(IP0SR1_31_28,	RX1_X),
+	PINMUX_IPSR_GPSR(IP0SR1_31_28,	HRX1_B),
+	PINMUX_IPSR_GPSR(IP0SR1_31_28,	RX1_B),
 
 	/* IP1SR1 */
 	PINMUX_IPSR_GPSR(IP1SR1_3_0,	MSIOF0_SYNC),
-	PINMUX_IPSR_GPSR(IP1SR1_3_0,	HCTS1_N_X),
-	PINMUX_IPSR_GPSR(IP1SR1_3_0,	CTS1_N_X),
+	PINMUX_IPSR_GPSR(IP1SR1_3_0,	HCTS1_N_B),
+	PINMUX_IPSR_GPSR(IP1SR1_3_0,	CTS1_N_B),
 	PINMUX_IPSR_GPSR(IP1SR1_3_0,	CANFD5_TX_B),
 
 	PINMUX_IPSR_GPSR(IP1SR1_7_4,	MSIOF0_TXD),
-	PINMUX_IPSR_GPSR(IP1SR1_7_4,	HRTS1_N_X),
-	PINMUX_IPSR_GPSR(IP1SR1_7_4,	RTS1_N_X),
+	PINMUX_IPSR_GPSR(IP1SR1_7_4,	HRTS1_N_B),
+	PINMUX_IPSR_GPSR(IP1SR1_7_4,	RTS1_N_B),
 	PINMUX_IPSR_GPSR(IP1SR1_7_4,	CANFD5_RX_B),
 
 	PINMUX_IPSR_GPSR(IP1SR1_11_8,	MSIOF0_SCK),
-	PINMUX_IPSR_GPSR(IP1SR1_11_8,	HSCK1_X),
-	PINMUX_IPSR_GPSR(IP1SR1_11_8,	SCK1_X),
+	PINMUX_IPSR_GPSR(IP1SR1_11_8,	HSCK1_B),
+	PINMUX_IPSR_GPSR(IP1SR1_11_8,	SCK1_B),
 
 	PINMUX_IPSR_GPSR(IP1SR1_15_12,	MSIOF0_RXD),
 
@@ -827,15 +827,15 @@ static const u16 pinmux_data[] = {
 
 	PINMUX_IPSR_GPSR(IP1SR1_23_20,	HCTS0_N),
 	PINMUX_IPSR_GPSR(IP1SR1_23_20,	CTS0_N),
-	PINMUX_IPSR_GPSR(IP1SR1_23_20,	PWM8_A),
+	PINMUX_IPSR_GPSR(IP1SR1_23_20,	PWM8),
 
 	PINMUX_IPSR_GPSR(IP1SR1_27_24,	HRTS0_N),
 	PINMUX_IPSR_GPSR(IP1SR1_27_24,	RTS0_N),
-	PINMUX_IPSR_GPSR(IP1SR1_27_24,	PWM9_A),
+	PINMUX_IPSR_GPSR(IP1SR1_27_24,	PWM9),
 
 	PINMUX_IPSR_GPSR(IP1SR1_31_28,	HSCK0),
 	PINMUX_IPSR_GPSR(IP1SR1_31_28,	SCK0),
-	PINMUX_IPSR_GPSR(IP1SR1_31_28,	PWM0_A),
+	PINMUX_IPSR_GPSR(IP1SR1_31_28,	PWM0),
 
 	/* IP2SR1 */
 	PINMUX_IPSR_GPSR(IP2SR1_3_0,	HRX0),
@@ -845,99 +845,99 @@ static const u16 pinmux_data[] = {
 	PINMUX_IPSR_GPSR(IP2SR1_7_4,	IRQ4_A),
 
 	PINMUX_IPSR_GPSR(IP2SR1_11_8,	SSI_SCK),
-	PINMUX_IPSR_GPSR(IP2SR1_11_8,	TCLK3),
+	PINMUX_IPSR_GPSR(IP2SR1_11_8,	TCLK3_B),
 
 	PINMUX_IPSR_GPSR(IP2SR1_15_12,	SSI_WS),
-	PINMUX_IPSR_GPSR(IP2SR1_15_12,	TCLK4),
+	PINMUX_IPSR_GPSR(IP2SR1_15_12,	TCLK4_B),
 
 	PINMUX_IPSR_GPSR(IP2SR1_19_16,	SSI_SD),
-	PINMUX_IPSR_GPSR(IP2SR1_19_16,	IRQ0_A),
+	PINMUX_IPSR_GPSR(IP2SR1_19_16,	IRQ0_B),
 
 	PINMUX_IPSR_GPSR(IP2SR1_23_20,	AUDIO_CLKOUT),
-	PINMUX_IPSR_GPSR(IP2SR1_23_20,	IRQ1_A),
+	PINMUX_IPSR_GPSR(IP2SR1_23_20,	IRQ1_B),
 
 	PINMUX_IPSR_GPSR(IP2SR1_27_24,	AUDIO_CLKIN),
 	PINMUX_IPSR_GPSR(IP2SR1_27_24,	PWM3_A),
 
-	PINMUX_IPSR_GPSR(IP2SR1_31_28,	TCLK2),
+	PINMUX_IPSR_GPSR(IP2SR1_31_28,	TCLK2_A),
 	PINMUX_IPSR_GPSR(IP2SR1_31_28,	MSIOF4_SS1),
 	PINMUX_IPSR_GPSR(IP2SR1_31_28,	IRQ3_B),
 
 	/* IP3SR1 */
-	PINMUX_IPSR_GPSR(IP3SR1_3_0,	HRX3),
+	PINMUX_IPSR_GPSR(IP3SR1_3_0,	HRX3_A),
 	PINMUX_IPSR_GPSR(IP3SR1_3_0,	SCK3_A),
 	PINMUX_IPSR_GPSR(IP3SR1_3_0,	MSIOF4_SS2),
 
-	PINMUX_IPSR_GPSR(IP3SR1_7_4,	HSCK3),
+	PINMUX_IPSR_GPSR(IP3SR1_7_4,	HSCK3_A),
 	PINMUX_IPSR_GPSR(IP3SR1_7_4,	CTS3_N_A),
 	PINMUX_IPSR_GPSR(IP3SR1_7_4,	MSIOF4_SCK),
-	PINMUX_IPSR_GPSR(IP3SR1_7_4,	TPU0TO0_A),
+	PINMUX_IPSR_GPSR(IP3SR1_7_4,	TPU0TO0_B),
 
-	PINMUX_IPSR_GPSR(IP3SR1_11_8,	HRTS3_N),
+	PINMUX_IPSR_GPSR(IP3SR1_11_8,	HRTS3_N_A),
 	PINMUX_IPSR_GPSR(IP3SR1_11_8,	RTS3_N_A),
 	PINMUX_IPSR_GPSR(IP3SR1_11_8,	MSIOF4_TXD),
-	PINMUX_IPSR_GPSR(IP3SR1_11_8,	TPU0TO1_A),
+	PINMUX_IPSR_GPSR(IP3SR1_11_8,	TPU0TO1_B),
 
-	PINMUX_IPSR_GPSR(IP3SR1_15_12,	HCTS3_N),
+	PINMUX_IPSR_GPSR(IP3SR1_15_12,	HCTS3_N_A),
 	PINMUX_IPSR_GPSR(IP3SR1_15_12,	RX3_A),
 	PINMUX_IPSR_GPSR(IP3SR1_15_12,	MSIOF4_RXD),
 
-	PINMUX_IPSR_GPSR(IP3SR1_19_16,	HTX3),
+	PINMUX_IPSR_GPSR(IP3SR1_19_16,	HTX3_A),
 	PINMUX_IPSR_GPSR(IP3SR1_19_16,	TX3_A),
 	PINMUX_IPSR_GPSR(IP3SR1_19_16,	MSIOF4_SYNC),
 
 	/* IP0SR2 */
 	PINMUX_IPSR_GPSR(IP0SR2_3_0,	FXR_TXDA),
 	PINMUX_IPSR_GPSR(IP0SR2_3_0,	CANFD1_TX),
-	PINMUX_IPSR_GPSR(IP0SR2_3_0,	TPU0TO2_A),
+	PINMUX_IPSR_GPSR(IP0SR2_3_0,	TPU0TO2_B),
 
-	PINMUX_IPSR_GPSR(IP0SR2_7_4,	FXR_TXENA_N),
+	PINMUX_IPSR_GPSR(IP0SR2_7_4,	FXR_TXENA_N_A),
 	PINMUX_IPSR_GPSR(IP0SR2_7_4,	CANFD1_RX),
-	PINMUX_IPSR_GPSR(IP0SR2_7_4,	TPU0TO3_A),
+	PINMUX_IPSR_GPSR(IP0SR2_7_4,	TPU0TO3_B),
 
 	PINMUX_IPSR_GPSR(IP0SR2_11_8,	RXDA_EXTFXR),
-	PINMUX_IPSR_GPSR(IP0SR2_11_8,	CANFD5_TX),
+	PINMUX_IPSR_GPSR(IP0SR2_11_8,	CANFD5_TX_A),
 	PINMUX_IPSR_GPSR(IP0SR2_11_8,	IRQ5),
 
 	PINMUX_IPSR_GPSR(IP0SR2_15_12,	CLK_EXTFXR),
-	PINMUX_IPSR_GPSR(IP0SR2_15_12,	CANFD5_RX),
+	PINMUX_IPSR_GPSR(IP0SR2_15_12,	CANFD5_RX_A),
 	PINMUX_IPSR_GPSR(IP0SR2_15_12,	IRQ4_B),
 
 	PINMUX_IPSR_GPSR(IP0SR2_19_16,	RXDB_EXTFXR),
 
-	PINMUX_IPSR_GPSR(IP0SR2_23_20,	FXR_TXENB_N),
+	PINMUX_IPSR_GPSR(IP0SR2_23_20,	FXR_TXENB_N_A),
 
 	PINMUX_IPSR_GPSR(IP0SR2_27_24,	FXR_TXDB),
 
-	PINMUX_IPSR_GPSR(IP0SR2_31_28,	TPU0TO1),
+	PINMUX_IPSR_GPSR(IP0SR2_31_28,	TPU0TO1_A),
 	PINMUX_IPSR_GPSR(IP0SR2_31_28,	CANFD6_TX),
-	PINMUX_IPSR_GPSR(IP0SR2_31_28,	TCLK2_B),
+	PINMUX_IPSR_GPSR(IP0SR2_31_28,	TCLK2_C),
 
 	/* IP1SR2 */
-	PINMUX_IPSR_GPSR(IP1SR2_3_0,	TPU0TO0),
+	PINMUX_IPSR_GPSR(IP1SR2_3_0,	TPU0TO0_A),
 	PINMUX_IPSR_GPSR(IP1SR2_3_0,	CANFD6_RX),
-	PINMUX_IPSR_GPSR(IP1SR2_3_0,	TCLK1_A),
+	PINMUX_IPSR_GPSR(IP1SR2_3_0,	TCLK1_B),
 
 	PINMUX_IPSR_GPSR(IP1SR2_7_4,	CAN_CLK),
-	PINMUX_IPSR_GPSR(IP1SR2_7_4,	FXR_TXENA_N_X),
+	PINMUX_IPSR_GPSR(IP1SR2_7_4,	FXR_TXENA_N_B),
 
 	PINMUX_IPSR_GPSR(IP1SR2_11_8,	CANFD0_TX),
-	PINMUX_IPSR_GPSR(IP1SR2_11_8,	FXR_TXENB_N_X),
+	PINMUX_IPSR_GPSR(IP1SR2_11_8,	FXR_TXENB_N_B),
 
 	PINMUX_IPSR_GPSR(IP1SR2_15_12,	CANFD0_RX),
 	PINMUX_IPSR_GPSR(IP1SR2_15_12,	STPWT_EXTFXR),
 
 	PINMUX_IPSR_GPSR(IP1SR2_19_16,	CANFD2_TX),
-	PINMUX_IPSR_GPSR(IP1SR2_19_16,	TPU0TO2),
-	PINMUX_IPSR_GPSR(IP1SR2_19_16,	TCLK3_A),
+	PINMUX_IPSR_GPSR(IP1SR2_19_16,	TPU0TO2_A),
+	PINMUX_IPSR_GPSR(IP1SR2_19_16,	TCLK3_C),
 
 	PINMUX_IPSR_GPSR(IP1SR2_23_20,	CANFD2_RX),
-	PINMUX_IPSR_GPSR(IP1SR2_23_20,	TPU0TO3),
+	PINMUX_IPSR_GPSR(IP1SR2_23_20,	TPU0TO3_A),
 	PINMUX_IPSR_GPSR(IP1SR2_23_20,	PWM1_B),
-	PINMUX_IPSR_GPSR(IP1SR2_23_20,	TCLK4_A),
+	PINMUX_IPSR_GPSR(IP1SR2_23_20,	TCLK4_C),
 
 	PINMUX_IPSR_GPSR(IP1SR2_27_24,	CANFD3_TX),
-	PINMUX_IPSR_GPSR(IP1SR2_27_24,	PWM2_B),
+	PINMUX_IPSR_GPSR(IP1SR2_27_24,	PWM2),
 
 	PINMUX_IPSR_GPSR(IP1SR2_31_28,	CANFD3_RX),
 	PINMUX_IPSR_GPSR(IP1SR2_31_28,	PWM3_B),
@@ -979,12 +979,12 @@ static const u16 pinmux_data[] = {
 	PINMUX_IPSR_GPSR(IP1SR3_23_20,	IPC_CLKIN),
 	PINMUX_IPSR_GPSR(IP1SR3_23_20,	IPC_CLKEN_IN),
 	PINMUX_IPSR_GPSR(IP1SR3_23_20,	PWM1_A),
-	PINMUX_IPSR_GPSR(IP1SR3_23_20,	TCLK3_X),
+	PINMUX_IPSR_GPSR(IP1SR3_23_20,	TCLK3_A),
 
 	PINMUX_IPSR_GPSR(IP1SR3_27_24,	IPC_CLKOUT),
 	PINMUX_IPSR_GPSR(IP1SR3_27_24,	IPC_CLKEN_OUT),
 	PINMUX_IPSR_GPSR(IP1SR3_27_24,	ERROROUTC_N_A),
-	PINMUX_IPSR_GPSR(IP1SR3_27_24,	TCLK4_X),
+	PINMUX_IPSR_GPSR(IP1SR3_27_24,	TCLK4_A),
 
 	PINMUX_IPSR_GPSR(IP1SR3_31_28,	QSPI0_SSL),
 
@@ -1531,15 +1531,14 @@ static const unsigned int canfd4_data_mux[] = {
 };
 
 /* - CANFD5 ----------------------------------------------------------------- */
-static const unsigned int canfd5_data_pins[] = {
-	/* CANFD5_TX, CANFD5_RX */
+static const unsigned int canfd5_data_a_pins[] = {
+	/* CANFD5_TX_A, CANFD5_RX_A */
 	RCAR_GP_PIN(2, 2), RCAR_GP_PIN(2, 3),
 };
-static const unsigned int canfd5_data_mux[] = {
-	CANFD5_TX_MARK, CANFD5_RX_MARK,
+static const unsigned int canfd5_data_a_mux[] = {
+	CANFD5_TX_A_MARK, CANFD5_RX_A_MARK,
 };
 
-/* - CANFD5_B ----------------------------------------------------------------- */
 static const unsigned int canfd5_data_b_pins[] = {
 	/* CANFD5_TX_B, CANFD5_RX_B */
 	RCAR_GP_PIN(1, 8), RCAR_GP_PIN(1, 9),
@@ -1599,49 +1598,48 @@ static const unsigned int hscif0_ctrl_mux[] = {
 };
 
 /* - HSCIF1 ----------------------------------------------------------------- */
-static const unsigned int hscif1_data_pins[] = {
-	/* HRX1, HTX1 */
+static const unsigned int hscif1_data_a_pins[] = {
+	/* HRX1_A, HTX1_A */
 	RCAR_GP_PIN(0, 15), RCAR_GP_PIN(0, 14),
 };
-static const unsigned int hscif1_data_mux[] = {
-	HRX1_MARK, HTX1_MARK,
+static const unsigned int hscif1_data_a_mux[] = {
+	HRX1_A_MARK, HTX1_A_MARK,
 };
-static const unsigned int hscif1_clk_pins[] = {
-	/* HSCK1 */
+static const unsigned int hscif1_clk_a_pins[] = {
+	/* HSCK1_A */
 	RCAR_GP_PIN(0, 18),
 };
-static const unsigned int hscif1_clk_mux[] = {
-	HSCK1_MARK,
+static const unsigned int hscif1_clk_a_mux[] = {
+	HSCK1_A_MARK,
 };
-static const unsigned int hscif1_ctrl_pins[] = {
-	/* HRTS1_N, HCTS1_N */
+static const unsigned int hscif1_ctrl_a_pins[] = {
+	/* HRTS1_N_A, HCTS1_N_A */
 	RCAR_GP_PIN(0, 17), RCAR_GP_PIN(0, 16),
 };
-static const unsigned int hscif1_ctrl_mux[] = {
-	HRTS1_N_MARK, HCTS1_N_MARK,
+static const unsigned int hscif1_ctrl_a_mux[] = {
+	HRTS1_N_A_MARK, HCTS1_N_A_MARK,
 };
 
-/* - HSCIF1_X---------------------------------------------------------------- */
-static const unsigned int hscif1_data_x_pins[] = {
-	/* HRX1_X, HTX1_X */
+static const unsigned int hscif1_data_b_pins[] = {
+	/* HRX1_B, HTX1_B */
 	RCAR_GP_PIN(1, 7), RCAR_GP_PIN(1, 6),
 };
-static const unsigned int hscif1_data_x_mux[] = {
-	HRX1_X_MARK, HTX1_X_MARK,
+static const unsigned int hscif1_data_b_mux[] = {
+	HRX1_B_MARK, HTX1_B_MARK,
 };
-static const unsigned int hscif1_clk_x_pins[] = {
-	/* HSCK1_X */
+static const unsigned int hscif1_clk_b_pins[] = {
+	/* HSCK1_B */
 	RCAR_GP_PIN(1, 10),
 };
-static const unsigned int hscif1_clk_x_mux[] = {
-	HSCK1_X_MARK,
+static const unsigned int hscif1_clk_b_mux[] = {
+	HSCK1_B_MARK,
 };
-static const unsigned int hscif1_ctrl_x_pins[] = {
-	/* HRTS1_N_X, HCTS1_N_X */
+static const unsigned int hscif1_ctrl_b_pins[] = {
+	/* HRTS1_N_B, HCTS1_N_B */
 	RCAR_GP_PIN(1, 9), RCAR_GP_PIN(1, 8),
 };
-static const unsigned int hscif1_ctrl_x_mux[] = {
-	HRTS1_N_X_MARK, HCTS1_N_X_MARK,
+static const unsigned int hscif1_ctrl_b_mux[] = {
+	HRTS1_N_B_MARK, HCTS1_N_B_MARK,
 };
 
 /* - HSCIF2 ----------------------------------------------------------------- */
@@ -1668,49 +1666,48 @@ static const unsigned int hscif2_ctrl_mux[] = {
 };
 
 /* - HSCIF3 ----------------------------------------------------------------- */
-static const unsigned int hscif3_data_pins[] = {
-	/* HRX3, HTX3 */
+static const unsigned int hscif3_data_a_pins[] = {
+	/* HRX3_A, HTX3_A */
 	RCAR_GP_PIN(1, 24), RCAR_GP_PIN(1, 28),
 };
-static const unsigned int hscif3_data_mux[] = {
-	HRX3_MARK, HTX3_MARK,
+static const unsigned int hscif3_data_a_mux[] = {
+	HRX3_A_MARK, HTX3_A_MARK,
 };
-static const unsigned int hscif3_clk_pins[] = {
-	/* HSCK3 */
+static const unsigned int hscif3_clk_a_pins[] = {
+	/* HSCK3_A */
 	RCAR_GP_PIN(1, 25),
 };
-static const unsigned int hscif3_clk_mux[] = {
-	HSCK3_MARK,
+static const unsigned int hscif3_clk_a_mux[] = {
+	HSCK3_A_MARK,
 };
-static const unsigned int hscif3_ctrl_pins[] = {
-	/* HRTS3_N, HCTS3_N */
+static const unsigned int hscif3_ctrl_a_pins[] = {
+	/* HRTS3_N_A, HCTS3_N_A */
 	RCAR_GP_PIN(1, 26), RCAR_GP_PIN(1, 27),
 };
-static const unsigned int hscif3_ctrl_mux[] = {
-	HRTS3_N_MARK, HCTS3_N_MARK,
+static const unsigned int hscif3_ctrl_a_mux[] = {
+	HRTS3_N_A_MARK, HCTS3_N_A_MARK,
 };
 
-/* - HSCIF3_A ----------------------------------------------------------------- */
-static const unsigned int hscif3_data_a_pins[] = {
-	/* HRX3_A, HTX3_A */
+static const unsigned int hscif3_data_b_pins[] = {
+	/* HRX3_B, HTX3_B */
 	RCAR_GP_PIN(1, 4), RCAR_GP_PIN(1, 0),
 };
-static const unsigned int hscif3_data_a_mux[] = {
-	HRX3_A_MARK, HTX3_A_MARK,
+static const unsigned int hscif3_data_b_mux[] = {
+	HRX3_B_MARK, HTX3_B_MARK,
 };
-static const unsigned int hscif3_clk_a_pins[] = {
-	/* HSCK3_A */
+static const unsigned int hscif3_clk_b_pins[] = {
+	/* HSCK3_B */
 	RCAR_GP_PIN(1, 3),
 };
-static const unsigned int hscif3_clk_a_mux[] = {
-	HSCK3_A_MARK,
+static const unsigned int hscif3_clk_b_mux[] = {
+	HSCK3_B_MARK,
 };
-static const unsigned int hscif3_ctrl_a_pins[] = {
-	/* HRTS3_N_A, HCTS3_N_A */
+static const unsigned int hscif3_ctrl_b_pins[] = {
+	/* HRTS3_N_B, HCTS3_N_B */
 	RCAR_GP_PIN(1, 2), RCAR_GP_PIN(1, 1),
 };
-static const unsigned int hscif3_ctrl_a_mux[] = {
-	HRTS3_N_A_MARK, HCTS3_N_A_MARK,
+static const unsigned int hscif3_ctrl_b_mux[] = {
+	HRTS3_N_B_MARK, HCTS3_N_B_MARK,
 };
 
 /* - I2C0 ------------------------------------------------------------------- */
@@ -2093,13 +2090,13 @@ static const unsigned int pcie1_clkreq_n_mux[] = {
 	PCIE1_CLKREQ_N_MARK,
 };
 
-/* - PWM0_A ------------------------------------------------------------------- */
-static const unsigned int pwm0_a_pins[] = {
-	/* PWM0_A */
+/* - PWM0 ------------------------------------------------------------------- */
+static const unsigned int pwm0_pins[] = {
+	/* PWM0 */
 	RCAR_GP_PIN(1, 15),
 };
-static const unsigned int pwm0_a_mux[] = {
-	PWM0_A_MARK,
+static const unsigned int pwm0_mux[] = {
+	PWM0_MARK,
 };
 
 /* - PWM1_A ------------------------------------------------------------------- */
@@ -2120,13 +2117,13 @@ static const unsigned int pwm1_b_mux[] = {
 	PWM1_B_MARK,
 };
 
-/* - PWM2_B ------------------------------------------------------------------- */
-static const unsigned int pwm2_b_pins[] = {
-	/* PWM2_B */
+/* - PWM2 ------------------------------------------------------------------- */
+static const unsigned int pwm2_pins[] = {
+	/* PWM2 */
 	RCAR_GP_PIN(2, 14),
 };
-static const unsigned int pwm2_b_mux[] = {
-	PWM2_B_MARK,
+static const unsigned int pwm2_mux[] = {
+	PWM2_MARK,
 };
 
 /* - PWM3_A ------------------------------------------------------------------- */
@@ -2183,22 +2180,22 @@ static const unsigned int pwm7_mux[] = {
 	PWM7_MARK,
 };
 
-/* - PWM8_A ------------------------------------------------------------------- */
-static const unsigned int pwm8_a_pins[] = {
-	/* PWM8_A */
+/* - PWM8 ------------------------------------------------------------------- */
+static const unsigned int pwm8_pins[] = {
+	/* PWM8 */
 	RCAR_GP_PIN(1, 13),
 };
-static const unsigned int pwm8_a_mux[] = {
-	PWM8_A_MARK,
+static const unsigned int pwm8_mux[] = {
+	PWM8_MARK,
 };
 
-/* - PWM9_A ------------------------------------------------------------------- */
-static const unsigned int pwm9_a_pins[] = {
-	/* PWM9_A */
+/* - PWM9 ------------------------------------------------------------------- */
+static const unsigned int pwm9_pins[] = {
+	/* PWM9 */
 	RCAR_GP_PIN(1, 14),
 };
-static const unsigned int pwm9_a_mux[] = {
-	PWM9_A_MARK,
+static const unsigned int pwm9_mux[] = {
+	PWM9_MARK,
 };
 
 /* - QSPI0 ------------------------------------------------------------------ */
@@ -2261,75 +2258,51 @@ static const unsigned int scif0_ctrl_mux[] = {
 };
 
 /* - SCIF1 ------------------------------------------------------------------ */
-static const unsigned int scif1_data_pins[] = {
-	/* RX1, TX1 */
+static const unsigned int scif1_data_a_pins[] = {
+	/* RX1_A, TX1_A */
 	RCAR_GP_PIN(0, 15), RCAR_GP_PIN(0, 14),
 };
-static const unsigned int scif1_data_mux[] = {
-	RX1_MARK, TX1_MARK,
+static const unsigned int scif1_data_a_mux[] = {
+	RX1_A_MARK, TX1_A_MARK,
 };
-static const unsigned int scif1_clk_pins[] = {
-	/* SCK1 */
+static const unsigned int scif1_clk_a_pins[] = {
+	/* SCK1_A */
 	RCAR_GP_PIN(0, 18),
 };
-static const unsigned int scif1_clk_mux[] = {
-	SCK1_MARK,
+static const unsigned int scif1_clk_a_mux[] = {
+	SCK1_A_MARK,
 };
-static const unsigned int scif1_ctrl_pins[] = {
-	/* RTS1_N, CTS1_N */
+static const unsigned int scif1_ctrl_a_pins[] = {
+	/* RTS1_N_A, CTS1_N_A */
 	RCAR_GP_PIN(0, 17), RCAR_GP_PIN(0, 16),
 };
-static const unsigned int scif1_ctrl_mux[] = {
-	RTS1_N_MARK, CTS1_N_MARK,
+static const unsigned int scif1_ctrl_a_mux[] = {
+	RTS1_N_A_MARK, CTS1_N_A_MARK,
 };
 
-/* - SCIF1_X ------------------------------------------------------------------ */
-static const unsigned int scif1_data_x_pins[] = {
-	/* RX1_X, TX1_X */
+static const unsigned int scif1_data_b_pins[] = {
+	/* RX1_B, TX1_B */
 	RCAR_GP_PIN(1, 7), RCAR_GP_PIN(1, 6),
 };
-static const unsigned int scif1_data_x_mux[] = {
-	RX1_X_MARK, TX1_X_MARK,
+static const unsigned int scif1_data_b_mux[] = {
+	RX1_B_MARK, TX1_B_MARK,
 };
-static const unsigned int scif1_clk_x_pins[] = {
-	/* SCK1_X */
+static const unsigned int scif1_clk_b_pins[] = {
+	/* SCK1_B */
 	RCAR_GP_PIN(1, 10),
 };
-static const unsigned int scif1_clk_x_mux[] = {
-	SCK1_X_MARK,
+static const unsigned int scif1_clk_b_mux[] = {
+	SCK1_B_MARK,
 };
-static const unsigned int scif1_ctrl_x_pins[] = {
-	/* RTS1_N_X, CTS1_N_X */
+static const unsigned int scif1_ctrl_b_pins[] = {
+	/* RTS1_N_B, CTS1_N_B */
 	RCAR_GP_PIN(1, 9), RCAR_GP_PIN(1, 8),
 };
-static const unsigned int scif1_ctrl_x_mux[] = {
-	RTS1_N_X_MARK, CTS1_N_X_MARK,
+static const unsigned int scif1_ctrl_b_mux[] = {
+	RTS1_N_B_MARK, CTS1_N_B_MARK,
 };
 
 /* - SCIF3 ------------------------------------------------------------------ */
-static const unsigned int scif3_data_pins[] = {
-	/* RX3, TX3 */
-	RCAR_GP_PIN(1, 1), RCAR_GP_PIN(1, 0),
-};
-static const unsigned int scif3_data_mux[] = {
-	RX3_MARK, TX3_MARK,
-};
-static const unsigned int scif3_clk_pins[] = {
-	/* SCK3 */
-	RCAR_GP_PIN(1, 4),
-};
-static const unsigned int scif3_clk_mux[] = {
-	SCK3_MARK,
-};
-static const unsigned int scif3_ctrl_pins[] = {
-	/* RTS3_N, CTS3_N */
-	RCAR_GP_PIN(1, 2), RCAR_GP_PIN(1, 3),
-};
-static const unsigned int scif3_ctrl_mux[] = {
-	RTS3_N_MARK, CTS3_N_MARK,
-};
-
-/* - SCIF3_A ------------------------------------------------------------------ */
 static const unsigned int scif3_data_a_pins[] = {
 	/* RX3_A, TX3_A */
 	RCAR_GP_PIN(1, 27), RCAR_GP_PIN(1, 28),
@@ -2352,6 +2325,28 @@ static const unsigned int scif3_ctrl_a_mux[] = {
 	RTS3_N_A_MARK, CTS3_N_A_MARK,
 };
 
+static const unsigned int scif3_data_b_pins[] = {
+	/* RX3_B, TX3_B */
+	RCAR_GP_PIN(1, 1), RCAR_GP_PIN(1, 0),
+};
+static const unsigned int scif3_data_b_mux[] = {
+	RX3_B_MARK, TX3_B_MARK,
+};
+static const unsigned int scif3_clk_b_pins[] = {
+	/* SCK3_B */
+	RCAR_GP_PIN(1, 4),
+};
+static const unsigned int scif3_clk_b_mux[] = {
+	SCK3_B_MARK,
+};
+static const unsigned int scif3_ctrl_b_pins[] = {
+	/* RTS3_N_B, CTS3_N_B */
+	RCAR_GP_PIN(1, 2), RCAR_GP_PIN(1, 3),
+};
+static const unsigned int scif3_ctrl_b_mux[] = {
+	RTS3_N_B_MARK, CTS3_N_B_MARK,
+};
+
 /* - SCIF4 ------------------------------------------------------------------ */
 static const unsigned int scif4_data_pins[] = {
 	/* RX4, TX4 */
@@ -2408,64 +2403,63 @@ static const unsigned int ssi_ctrl_mux[] = {
 	SSI_SCK_MARK, SSI_WS_MARK,
 };
 
-/* - TPU ------------------------------------------------------------------- */
-static const unsigned int tpu_to0_pins[] = {
-	/* TPU0TO0 */
+/* - TPU -------------------------------------------------------------------- */
+static const unsigned int tpu_to0_a_pins[] = {
+	/* TPU0TO0_A */
 	RCAR_GP_PIN(2, 8),
 };
-static const unsigned int tpu_to0_mux[] = {
-	TPU0TO0_MARK,
+static const unsigned int tpu_to0_a_mux[] = {
+	TPU0TO0_A_MARK,
 };
-static const unsigned int tpu_to1_pins[] = {
-	/* TPU0TO1 */
+static const unsigned int tpu_to1_a_pins[] = {
+	/* TPU0TO1_A */
 	RCAR_GP_PIN(2, 7),
 };
-static const unsigned int tpu_to1_mux[] = {
-	TPU0TO1_MARK,
+static const unsigned int tpu_to1_a_mux[] = {
+	TPU0TO1_A_MARK,
 };
-static const unsigned int tpu_to2_pins[] = {
-	/* TPU0TO2 */
+static const unsigned int tpu_to2_a_pins[] = {
+	/* TPU0TO2_A */
 	RCAR_GP_PIN(2, 12),
 };
-static const unsigned int tpu_to2_mux[] = {
-	TPU0TO2_MARK,
+static const unsigned int tpu_to2_a_mux[] = {
+	TPU0TO2_A_MARK,
 };
-static const unsigned int tpu_to3_pins[] = {
-	/* TPU0TO3 */
+static const unsigned int tpu_to3_a_pins[] = {
+	/* TPU0TO3_A */
 	RCAR_GP_PIN(2, 13),
 };
-static const unsigned int tpu_to3_mux[] = {
-	TPU0TO3_MARK,
+static const unsigned int tpu_to3_a_mux[] = {
+	TPU0TO3_A_MARK,
 };
 
-/* - TPU_A ------------------------------------------------------------------- */
-static const unsigned int tpu_to0_a_pins[] = {
-	/* TPU0TO0_A */
+static const unsigned int tpu_to0_b_pins[] = {
+	/* TPU0TO0_B */
 	RCAR_GP_PIN(1, 25),
 };
-static const unsigned int tpu_to0_a_mux[] = {
-	TPU0TO0_A_MARK,
+static const unsigned int tpu_to0_b_mux[] = {
+	TPU0TO0_B_MARK,
 };
-static const unsigned int tpu_to1_a_pins[] = {
-	/* TPU0TO1_A */
+static const unsigned int tpu_to1_b_pins[] = {
+	/* TPU0TO1_B */
 	RCAR_GP_PIN(1, 26),
 };
-static const unsigned int tpu_to1_a_mux[] = {
-	TPU0TO1_A_MARK,
+static const unsigned int tpu_to1_b_mux[] = {
+	TPU0TO1_B_MARK,
 };
-static const unsigned int tpu_to2_a_pins[] = {
-	/* TPU0TO2_A */
+static const unsigned int tpu_to2_b_pins[] = {
+	/* TPU0TO2_B */
 	RCAR_GP_PIN(2, 0),
 };
-static const unsigned int tpu_to2_a_mux[] = {
-	TPU0TO2_A_MARK,
+static const unsigned int tpu_to2_b_mux[] = {
+	TPU0TO2_B_MARK,
 };
-static const unsigned int tpu_to3_a_pins[] = {
-	/* TPU0TO3_A */
+static const unsigned int tpu_to3_b_pins[] = {
+	/* TPU0TO3_B */
 	RCAR_GP_PIN(2, 1),
 };
-static const unsigned int tpu_to3_a_mux[] = {
-	TPU0TO3_A_MARK,
+static const unsigned int tpu_to3_b_mux[] = {
+	TPU0TO3_B_MARK,
 };
 
 /* - TSN0 ------------------------------------------------ */
@@ -2578,8 +2572,8 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
 	SH_PFC_PIN_GROUP(canfd2_data),
 	SH_PFC_PIN_GROUP(canfd3_data),
 	SH_PFC_PIN_GROUP(canfd4_data),
-	SH_PFC_PIN_GROUP(canfd5_data),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(canfd5_data_b),	/* suffix might be updated */
+	SH_PFC_PIN_GROUP(canfd5_data_a),
+	SH_PFC_PIN_GROUP(canfd5_data_b),
 	SH_PFC_PIN_GROUP(canfd6_data),
 	SH_PFC_PIN_GROUP(canfd7_data),
 	SH_PFC_PIN_GROUP(can_clk),
@@ -2587,21 +2581,21 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
 	SH_PFC_PIN_GROUP(hscif0_data),
 	SH_PFC_PIN_GROUP(hscif0_clk),
 	SH_PFC_PIN_GROUP(hscif0_ctrl),
-	SH_PFC_PIN_GROUP(hscif1_data),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif1_clk),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif1_ctrl),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif1_data_x),	/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif1_clk_x),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif1_ctrl_x),	/* suffix might be updated */
+	SH_PFC_PIN_GROUP(hscif1_data_a),
+	SH_PFC_PIN_GROUP(hscif1_clk_a),
+	SH_PFC_PIN_GROUP(hscif1_ctrl_a),
+	SH_PFC_PIN_GROUP(hscif1_data_b),
+	SH_PFC_PIN_GROUP(hscif1_clk_b),
+	SH_PFC_PIN_GROUP(hscif1_ctrl_b),
 	SH_PFC_PIN_GROUP(hscif2_data),
 	SH_PFC_PIN_GROUP(hscif2_clk),
 	SH_PFC_PIN_GROUP(hscif2_ctrl),
-	SH_PFC_PIN_GROUP(hscif3_data),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif3_clk),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif3_ctrl),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif3_data_a),	/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif3_clk_a),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif3_ctrl_a),	/* suffix might be updated */
+	SH_PFC_PIN_GROUP(hscif3_data_a),
+	SH_PFC_PIN_GROUP(hscif3_clk_a),
+	SH_PFC_PIN_GROUP(hscif3_ctrl_a),
+	SH_PFC_PIN_GROUP(hscif3_data_b),
+	SH_PFC_PIN_GROUP(hscif3_clk_b),
+	SH_PFC_PIN_GROUP(hscif3_ctrl_b),
 
 	SH_PFC_PIN_GROUP(i2c0),
 	SH_PFC_PIN_GROUP(i2c1),
@@ -2663,18 +2657,18 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
 	SH_PFC_PIN_GROUP(pcie0_clkreq_n),
 	SH_PFC_PIN_GROUP(pcie1_clkreq_n),
 
-	SH_PFC_PIN_GROUP(pwm0_a),		/* suffix might be updated */
+	SH_PFC_PIN_GROUP(pwm0),
 	SH_PFC_PIN_GROUP(pwm1_a),
 	SH_PFC_PIN_GROUP(pwm1_b),
-	SH_PFC_PIN_GROUP(pwm2_b),		/* suffix might be updated */
+	SH_PFC_PIN_GROUP(pwm2),
 	SH_PFC_PIN_GROUP(pwm3_a),
 	SH_PFC_PIN_GROUP(pwm3_b),
 	SH_PFC_PIN_GROUP(pwm4),
 	SH_PFC_PIN_GROUP(pwm5),
 	SH_PFC_PIN_GROUP(pwm6),
 	SH_PFC_PIN_GROUP(pwm7),
-	SH_PFC_PIN_GROUP(pwm8_a),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(pwm9_a),		/* suffix might be updated */
+	SH_PFC_PIN_GROUP(pwm8),
+	SH_PFC_PIN_GROUP(pwm9),
 
 	SH_PFC_PIN_GROUP(qspi0_ctrl),
 	BUS_DATA_PIN_GROUP(qspi0_data, 2),
@@ -2686,18 +2680,18 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
 	SH_PFC_PIN_GROUP(scif0_data),
 	SH_PFC_PIN_GROUP(scif0_clk),
 	SH_PFC_PIN_GROUP(scif0_ctrl),
-	SH_PFC_PIN_GROUP(scif1_data),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif1_clk),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif1_ctrl),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif1_data_x),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif1_clk_x),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif1_ctrl_x),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif3_data),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif3_clk),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif3_ctrl),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif3_data_a),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif3_clk_a),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif3_ctrl_a),		/* suffix might be updated */
+	SH_PFC_PIN_GROUP(scif1_data_a),
+	SH_PFC_PIN_GROUP(scif1_clk_a),
+	SH_PFC_PIN_GROUP(scif1_ctrl_a),
+	SH_PFC_PIN_GROUP(scif1_data_b),
+	SH_PFC_PIN_GROUP(scif1_clk_b),
+	SH_PFC_PIN_GROUP(scif1_ctrl_b),
+	SH_PFC_PIN_GROUP(scif3_data_a),
+	SH_PFC_PIN_GROUP(scif3_clk_a),
+	SH_PFC_PIN_GROUP(scif3_ctrl_a),
+	SH_PFC_PIN_GROUP(scif3_data_b),
+	SH_PFC_PIN_GROUP(scif3_clk_b),
+	SH_PFC_PIN_GROUP(scif3_ctrl_b),
 	SH_PFC_PIN_GROUP(scif4_data),
 	SH_PFC_PIN_GROUP(scif4_clk),
 	SH_PFC_PIN_GROUP(scif4_ctrl),
@@ -2707,14 +2701,14 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
 	SH_PFC_PIN_GROUP(ssi_data),
 	SH_PFC_PIN_GROUP(ssi_ctrl),
 
-	SH_PFC_PIN_GROUP(tpu_to0),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(tpu_to0_a),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(tpu_to1),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(tpu_to1_a),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(tpu_to2),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(tpu_to2_a),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(tpu_to3),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(tpu_to3_a),		/* suffix might be updated */
+	SH_PFC_PIN_GROUP(tpu_to0_a),
+	SH_PFC_PIN_GROUP(tpu_to0_b),
+	SH_PFC_PIN_GROUP(tpu_to1_a),
+	SH_PFC_PIN_GROUP(tpu_to1_b),
+	SH_PFC_PIN_GROUP(tpu_to2_a),
+	SH_PFC_PIN_GROUP(tpu_to2_b),
+	SH_PFC_PIN_GROUP(tpu_to3_a),
+	SH_PFC_PIN_GROUP(tpu_to3_b),
 
 	SH_PFC_PIN_GROUP(tsn0_link),
 	SH_PFC_PIN_GROUP(tsn0_phy_int),
@@ -2788,8 +2782,7 @@ static const char * const canfd4_groups[] = {
 };
 
 static const char * const canfd5_groups[] = {
-	/* suffix might be updated */
-	"canfd5_data",
+	"canfd5_data_a",
 	"canfd5_data_b",
 };
 
@@ -2812,13 +2805,12 @@ static const char * const hscif0_groups[] = {
 };
 
 static const char * const hscif1_groups[] = {
-	/* suffix might be updated */
-	"hscif1_data",
-	"hscif1_clk",
-	"hscif1_ctrl",
-	"hscif1_data_x",
-	"hscif1_clk_x",
-	"hscif1_ctrl_x",
+	"hscif1_data_a",
+	"hscif1_clk_a",
+	"hscif1_ctrl_a",
+	"hscif1_data_b",
+	"hscif1_clk_b",
+	"hscif1_ctrl_b",
 };
 
 static const char * const hscif2_groups[] = {
@@ -2828,13 +2820,12 @@ static const char * const hscif2_groups[] = {
 };
 
 static const char * const hscif3_groups[] = {
-	/* suffix might be updated */
-	"hscif3_data",
-	"hscif3_clk",
-	"hscif3_ctrl",
 	"hscif3_data_a",
 	"hscif3_clk_a",
 	"hscif3_ctrl_a",
+	"hscif3_data_b",
+	"hscif3_clk_b",
+	"hscif3_ctrl_b",
 };
 
 static const char * const i2c0_groups[] = {
@@ -2931,8 +2922,7 @@ static const char * const pcie_groups[] = {
 };
 
 static const char * const pwm0_groups[] = {
-	/* suffix might be updated */
-	"pwm0_a",
+	"pwm0",
 };
 
 static const char * const pwm1_groups[] = {
@@ -2941,8 +2931,7 @@ static const char * const pwm1_groups[] = {
 };
 
 static const char * const pwm2_groups[] = {
-	/* suffix might be updated */
-	"pwm2_b",
+	"pwm2",
 };
 
 static const char * const pwm3_groups[] = {
@@ -2967,13 +2956,11 @@ static const char * const pwm7_groups[] = {
 };
 
 static const char * const pwm8_groups[] = {
-	/* suffix might be updated */
-	"pwm8_a",
+	"pwm8",
 };
 
 static const char * const pwm9_groups[] = {
-	/* suffix might be updated */
-	"pwm9_a",
+	"pwm9",
 };
 
 static const char * const qspi0_groups[] = {
@@ -2995,23 +2982,21 @@ static const char * const scif0_groups[] = {
 };
 
 static const char * const scif1_groups[] = {
-	/* suffix might be updated */
-	"scif1_data",
-	"scif1_clk",
-	"scif1_ctrl",
-	"scif1_data_x",
-	"scif1_clk_x",
-	"scif1_ctrl_x",
+	"scif1_data_a",
+	"scif1_clk_a",
+	"scif1_ctrl_a",
+	"scif1_data_b",
+	"scif1_clk_b",
+	"scif1_ctrl_b",
 };
 
 static const char * const scif3_groups[] = {
-	/* suffix might be updated */
-	"scif3_data",
-	"scif3_clk",
-	"scif3_ctrl",
 	"scif3_data_a",
 	"scif3_clk_a",
 	"scif3_ctrl_a",
+	"scif3_data_b",
+	"scif3_clk_b",
+	"scif3_ctrl_b",
 };
 
 static const char * const scif4_groups[] = {
@@ -3034,15 +3019,14 @@ static const char * const ssi_groups[] = {
 };
 
 static const char * const tpu_groups[] = {
-	/* suffix might be updated */
-	"tpu_to0",
 	"tpu_to0_a",
-	"tpu_to1",
+	"tpu_to0_b",
 	"tpu_to1_a",
-	"tpu_to2",
+	"tpu_to1_b",
 	"tpu_to2_a",
-	"tpu_to3",
+	"tpu_to2_b",
 	"tpu_to3_a",
+	"tpu_to3_b",
 };
 
 static const char * const tsn0_groups[] = {
diff --git a/drivers/pinctrl/ti/pinctrl-ti-iodelay.c b/drivers/pinctrl/ti/pinctrl-ti-iodelay.c
index c1477f657839..5370bbdf2e1a 100644
--- a/drivers/pinctrl/ti/pinctrl-ti-iodelay.c
+++ b/drivers/pinctrl/ti/pinctrl-ti-iodelay.c
@@ -878,7 +878,7 @@ static int ti_iodelay_probe(struct platform_device *pdev)
 	iod->desc.name = dev_name(dev);
 	iod->desc.owner = THIS_MODULE;
 
-	ret = pinctrl_register_and_init(&iod->desc, dev, iod, &iod->pctl);
+	ret = devm_pinctrl_register_and_init(dev, &iod->desc, iod, &iod->pctl);
 	if (ret) {
 		dev_err(dev, "Failed to register pinctrl\n");
 		goto exit_out;
@@ -886,7 +886,11 @@ static int ti_iodelay_probe(struct platform_device *pdev)
 
 	platform_set_drvdata(pdev, iod);
 
-	return pinctrl_enable(iod->pctl);
+	ret = pinctrl_enable(iod->pctl);
+	if (ret)
+		goto exit_out;
+
+	return 0;
 
 exit_out:
 	of_node_put(np);
@@ -903,12 +907,6 @@ static int ti_iodelay_remove(struct platform_device *pdev)
 {
 	struct ti_iodelay_device *iod = platform_get_drvdata(pdev);
 
-	if (!iod)
-		return 0;
-
-	if (iod->pctl)
-		pinctrl_unregister(iod->pctl);
-
 	ti_iodelay_pinconf_deinit_dev(iod);
 
 	/* Expect other allocations to be freed by devm */
diff --git a/drivers/platform/chrome/cros_ec_debugfs.c b/drivers/platform/chrome/cros_ec_debugfs.c
index c876120e0ebc..793c8c4bf35b 100644
--- a/drivers/platform/chrome/cros_ec_debugfs.c
+++ b/drivers/platform/chrome/cros_ec_debugfs.c
@@ -329,6 +329,7 @@ static int ec_read_version_supported(struct cros_ec_dev *ec)
 	if (!msg)
 		return 0;
 
+	msg->version = 1;
 	msg->command = EC_CMD_GET_CMD_VERSIONS + ec->cmd_offset;
 	msg->outsize = sizeof(*params);
 	msg->insize = sizeof(*response);
diff --git a/drivers/platform/mips/cpu_hwmon.c b/drivers/platform/mips/cpu_hwmon.c
index d8c5f9195f85..2ac2f31090f9 100644
--- a/drivers/platform/mips/cpu_hwmon.c
+++ b/drivers/platform/mips/cpu_hwmon.c
@@ -139,6 +139,9 @@ static int __init loongson_hwmon_init(void)
 		csr_temp_enable = csr_readl(LOONGSON_CSR_FEATURES) &
 				  LOONGSON_CSRF_TEMP;
 
+	if (!csr_temp_enable && !loongson_chiptemp[0])
+		return -ENODEV;
+
 	nr_packages = loongson_sysconf.nr_cpus /
 		loongson_sysconf.cores_per_package;
 
diff --git a/drivers/pwm/pwm-atmel-tcb.c b/drivers/pwm/pwm-atmel-tcb.c
index c00dd37c5fbd..06df8c612741 100644
--- a/drivers/pwm/pwm-atmel-tcb.c
+++ b/drivers/pwm/pwm-atmel-tcb.c
@@ -82,7 +82,8 @@ static int atmel_tcb_pwm_request(struct pwm_chip *chip,
 	tcbpwm->period = 0;
 	tcbpwm->div = 0;
 
-	spin_lock(&tcbpwmc->lock);
+	guard(spinlock)(&tcbpwmc->lock);
+
 	regmap_read(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CMR), &cmr);
 	/*
 	 * Get init config from Timer Counter registers if
@@ -108,7 +109,6 @@ static int atmel_tcb_pwm_request(struct pwm_chip *chip,
 
 	cmr |= ATMEL_TC_WAVE | ATMEL_TC_WAVESEL_UP_AUTO | ATMEL_TC_EEVT_XC0;
 	regmap_write(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CMR), cmr);
-	spin_unlock(&tcbpwmc->lock);
 
 	return 0;
 }
@@ -138,7 +138,6 @@ static void atmel_tcb_pwm_disable(struct pwm_chip *chip, struct pwm_device *pwm,
 	if (tcbpwm->duty == 0)
 		polarity = !polarity;
 
-	spin_lock(&tcbpwmc->lock);
 	regmap_read(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CMR), &cmr);
 
 	/* flush old setting and set the new one */
@@ -173,8 +172,6 @@ static void atmel_tcb_pwm_disable(struct pwm_chip *chip, struct pwm_device *pwm,
 			     ATMEL_TC_SWTRG);
 		tcbpwmc->bkup.enabled = 0;
 	}
-
-	spin_unlock(&tcbpwmc->lock);
 }
 
 static int atmel_tcb_pwm_enable(struct pwm_chip *chip, struct pwm_device *pwm,
@@ -195,7 +192,6 @@ static int atmel_tcb_pwm_enable(struct pwm_chip *chip, struct pwm_device *pwm,
 	if (tcbpwm->duty == 0)
 		polarity = !polarity;
 
-	spin_lock(&tcbpwmc->lock);
 	regmap_read(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CMR), &cmr);
 
 	/* flush old setting and set the new one */
@@ -257,7 +253,6 @@ static int atmel_tcb_pwm_enable(struct pwm_chip *chip, struct pwm_device *pwm,
 	regmap_write(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CCR),
 		     ATMEL_TC_SWTRG | ATMEL_TC_CLKEN);
 	tcbpwmc->bkup.enabled = 1;
-	spin_unlock(&tcbpwmc->lock);
 	return 0;
 }
 
@@ -342,9 +337,12 @@ static int atmel_tcb_pwm_config(struct pwm_chip *chip, struct pwm_device *pwm,
 static int atmel_tcb_pwm_apply(struct pwm_chip *chip, struct pwm_device *pwm,
 			       const struct pwm_state *state)
 {
+	struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
 	int duty_cycle, period;
 	int ret;
 
+	guard(spinlock)(&tcbpwmc->lock);
+
 	if (!state->enabled) {
 		atmel_tcb_pwm_disable(chip, pwm, state->polarity);
 		return 0;
diff --git a/drivers/pwm/pwm-stm32.c b/drivers/pwm/pwm-stm32.c
index 9bdab6c24fba..b91a14c895be 100644
--- a/drivers/pwm/pwm-stm32.c
+++ b/drivers/pwm/pwm-stm32.c
@@ -456,8 +456,9 @@ static int stm32_pwm_apply(struct pwm_chip *chip, struct pwm_device *pwm,
 
 	enabled = pwm->state.enabled;
 
-	if (enabled && !state->enabled) {
-		stm32_pwm_disable(priv, pwm->hwpwm);
+	if (!state->enabled) {
+		if (enabled)
+			stm32_pwm_disable(priv, pwm->hwpwm);
 		return 0;
 	}
 
diff --git a/drivers/remoteproc/imx_rproc.c b/drivers/remoteproc/imx_rproc.c
index 8bb293b9f327..cfee164dd645 100644
--- a/drivers/remoteproc/imx_rproc.c
+++ b/drivers/remoteproc/imx_rproc.c
@@ -729,31 +729,37 @@ static int imx_rproc_addr_init(struct imx_rproc *priv,
 		struct resource res;
 
 		node = of_parse_phandle(np, "memory-region", a);
+		if (!node)
+			continue;
 		/* Not map vdevbuffer, vdevring region */
 		if (!strncmp(node->name, "vdev", strlen("vdev"))) {
 			of_node_put(node);
 			continue;
 		}
 		err = of_address_to_resource(node, 0, &res);
-		of_node_put(node);
 		if (err) {
 			dev_err(dev, "unable to resolve memory region\n");
+			of_node_put(node);
 			return err;
 		}
 
-		if (b >= IMX_RPROC_MEM_MAX)
+		if (b >= IMX_RPROC_MEM_MAX) {
+			of_node_put(node);
 			break;
+		}
 
 		/* Not use resource version, because we might share region */
 		priv->mem[b].cpu_addr = devm_ioremap_wc(&pdev->dev, res.start, resource_size(&res));
 		if (!priv->mem[b].cpu_addr) {
 			dev_err(dev, "failed to remap %pr\n", &res);
+			of_node_put(node);
 			return -ENOMEM;
 		}
 		priv->mem[b].sys_addr = res.start;
 		priv->mem[b].size = resource_size(&res);
 		if (!strcmp(node->name, "rsc-table"))
 			priv->rsc_table = priv->mem[b].cpu_addr;
+		of_node_put(node);
 		b++;
 	}
 
diff --git a/drivers/remoteproc/stm32_rproc.c b/drivers/remoteproc/stm32_rproc.c
index 61794c9c080f..c786badf08fa 100644
--- a/drivers/remoteproc/stm32_rproc.c
+++ b/drivers/remoteproc/stm32_rproc.c
@@ -294,7 +294,7 @@ static void stm32_rproc_mb_vq_work(struct work_struct *work)
 
 	mutex_lock(&rproc->lock);
 
-	if (rproc->state != RPROC_RUNNING)
+	if (rproc->state != RPROC_RUNNING && rproc->state != RPROC_ATTACHED)
 		goto unlock_mutex;
 
 	if (rproc_vq_interrupt(rproc, mb->vq_id) == IRQ_NONE)
diff --git a/drivers/rtc/interface.c b/drivers/rtc/interface.c
index 1b63111cdda2..0b23706d9fd3 100644
--- a/drivers/rtc/interface.c
+++ b/drivers/rtc/interface.c
@@ -274,10 +274,9 @@ int __rtc_read_alarm(struct rtc_device *rtc, struct rtc_wkalrm *alarm)
 			return err;
 
 		/* full-function RTCs won't have such missing fields */
-		if (rtc_valid_tm(&alarm->time) == 0) {
-			rtc_add_offset(rtc, &alarm->time);
-			return 0;
-		}
+		err = rtc_valid_tm(&alarm->time);
+		if (!err)
+			goto done;
 
 		/* get the "after" timestamp, to detect wrapped fields */
 		err = rtc_read_time(rtc, &now);
@@ -379,6 +378,8 @@ int __rtc_read_alarm(struct rtc_device *rtc, struct rtc_wkalrm *alarm)
 	if (err && alarm->enabled)
 		dev_warn(&rtc->dev, "invalid alarm value: %ptR\n",
 			 &alarm->time);
+	else
+		rtc_add_offset(rtc, &alarm->time);
 
 	return err;
 }
diff --git a/drivers/rtc/rtc-abx80x.c b/drivers/rtc/rtc-abx80x.c
index fde2b8054c2e..1298962402ff 100644
--- a/drivers/rtc/rtc-abx80x.c
+++ b/drivers/rtc/rtc-abx80x.c
@@ -705,14 +705,18 @@ static int abx80x_nvmem_xfer(struct abx80x_priv *priv, unsigned int offset,
 		if (ret)
 			return ret;
 
-		if (write)
+		if (write) {
 			ret = i2c_smbus_write_i2c_block_data(priv->client, reg,
 							     len, val);
-		else
+			if (ret)
+				return ret;
+		} else {
 			ret = i2c_smbus_read_i2c_block_data(priv->client, reg,
 							    len, val);
-		if (ret)
-			return ret;
+			if (ret <= 0)
+				return ret ? ret : -EIO;
+			len = ret;
+		}
 
 		offset += len;
 		val += len;
diff --git a/drivers/rtc/rtc-cmos.c b/drivers/rtc/rtc-cmos.c
index 7d99cd2c37a0..35dca2accbb8 100644
--- a/drivers/rtc/rtc-cmos.c
+++ b/drivers/rtc/rtc-cmos.c
@@ -643,11 +643,10 @@ static int cmos_nvram_read(void *priv, unsigned int off, void *val,
 			   size_t count)
 {
 	unsigned char *buf = val;
-	int	retval;
 
 	off += NVRAM_OFFSET;
 	spin_lock_irq(&rtc_lock);
-	for (retval = 0; count; count--, off++, retval++) {
+	for (; count; count--, off++) {
 		if (off < 128)
 			*buf++ = CMOS_READ(off);
 		else if (can_bank2)
@@ -657,7 +656,7 @@ static int cmos_nvram_read(void *priv, unsigned int off, void *val,
 	}
 	spin_unlock_irq(&rtc_lock);
 
-	return retval;
+	return count ? -EIO : 0;
 }
 
 static int cmos_nvram_write(void *priv, unsigned int off, void *val,
@@ -665,7 +664,6 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val,
 {
 	struct cmos_rtc	*cmos = priv;
 	unsigned char	*buf = val;
-	int		retval;
 
 	/* NOTE:  on at least PCs and Ataris, the boot firmware uses a
 	 * checksum on part of the NVRAM data.  That's currently ignored
@@ -674,7 +672,7 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val,
 	 */
 	off += NVRAM_OFFSET;
 	spin_lock_irq(&rtc_lock);
-	for (retval = 0; count; count--, off++, retval++) {
+	for (; count; count--, off++) {
 		/* don't trash RTC registers */
 		if (off == cmos->day_alrm
 				|| off == cmos->mon_alrm
@@ -689,7 +687,7 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val,
 	}
 	spin_unlock_irq(&rtc_lock);
 
-	return retval;
+	return count ? -EIO : 0;
 }
 
 /*----------------------------------------------------------------*/
diff --git a/drivers/rtc/rtc-isl1208.c b/drivers/rtc/rtc-isl1208.c
index e50c23ee1646..206f96b90f58 100644
--- a/drivers/rtc/rtc-isl1208.c
+++ b/drivers/rtc/rtc-isl1208.c
@@ -775,14 +775,13 @@ static int isl1208_nvmem_read(void *priv, unsigned int off, void *buf,
 {
 	struct isl1208_state *isl1208 = priv;
 	struct i2c_client *client = to_i2c_client(isl1208->rtc->dev.parent);
-	int ret;
 
 	/* nvmem sanitizes offset/count for us, but count==0 is possible */
 	if (!count)
 		return count;
-	ret = isl1208_i2c_read_regs(client, ISL1208_REG_USR1 + off, buf,
+
+	return isl1208_i2c_read_regs(client, ISL1208_REG_USR1 + off, buf,
 				    count);
-	return ret == 0 ? count : ret;
 }
 
 static int isl1208_nvmem_write(void *priv, unsigned int off, void *buf,
@@ -790,15 +789,13 @@ static int isl1208_nvmem_write(void *priv, unsigned int off, void *buf,
 {
 	struct isl1208_state *isl1208 = priv;
 	struct i2c_client *client = to_i2c_client(isl1208->rtc->dev.parent);
-	int ret;
 
 	/* nvmem sanitizes off/count for us, but count==0 is possible */
 	if (!count)
 		return count;
-	ret = isl1208_i2c_set_regs(client, ISL1208_REG_USR1 + off, buf,
-				   count);
 
-	return ret == 0 ? count : ret;
+	return isl1208_i2c_set_regs(client, ISL1208_REG_USR1 + off, buf,
+				   count);
 }
 
 static const struct nvmem_config isl1208_nvmem_config = {
diff --git a/drivers/s390/block/dasd_devmap.c b/drivers/s390/block/dasd_devmap.c
index c4e36650c426..91522dba9fd9 100644
--- a/drivers/s390/block/dasd_devmap.c
+++ b/drivers/s390/block/dasd_devmap.c
@@ -2258,13 +2258,19 @@ static ssize_t dasd_copy_pair_store(struct device *dev,
 
 	/* allocate primary devmap if needed */
 	prim_devmap = dasd_find_busid(prim_busid);
-	if (IS_ERR(prim_devmap))
+	if (IS_ERR(prim_devmap)) {
 		prim_devmap = dasd_add_busid(prim_busid, DASD_FEATURE_DEFAULT);
+		if (IS_ERR(prim_devmap))
+			return PTR_ERR(prim_devmap);
+	}
 
 	/* allocate secondary devmap if needed */
 	sec_devmap = dasd_find_busid(sec_busid);
-	if (IS_ERR(sec_devmap))
+	if (IS_ERR(sec_devmap)) {
 		sec_devmap = dasd_add_busid(sec_busid, DASD_FEATURE_DEFAULT);
+		if (IS_ERR(sec_devmap))
+			return PTR_ERR(sec_devmap);
+	}
 
 	/* setting copy relation is only allowed for offline secondary */
 	if (sec_devmap->device)
diff --git a/drivers/scsi/lpfc/lpfc_attr.c b/drivers/scsi/lpfc/lpfc_attr.c
index 79b45ea5fdb5..8123062ec2fa 100644
--- a/drivers/scsi/lpfc/lpfc_attr.c
+++ b/drivers/scsi/lpfc/lpfc_attr.c
@@ -1904,6 +1904,11 @@ lpfc_xcvr_data_show(struct device *dev, struct device_attribute *attr,
 
 	/* Get transceiver information */
 	rdp_context = kmalloc(sizeof(*rdp_context), GFP_KERNEL);
+	if (!rdp_context) {
+		len = scnprintf(buf, PAGE_SIZE - len,
+				"SPF info NA: alloc failure\n");
+		return len;
+	}
 
 	rc = lpfc_get_sfp_info_wait(phba, rdp_context);
 	if (rc) {
diff --git a/drivers/scsi/lpfc/lpfc_hbadisc.c b/drivers/scsi/lpfc/lpfc_hbadisc.c
index 93703ab6ce03..0a01575ab06d 100644
--- a/drivers/scsi/lpfc/lpfc_hbadisc.c
+++ b/drivers/scsi/lpfc/lpfc_hbadisc.c
@@ -5782,7 +5782,7 @@ lpfc_setup_disc_node(struct lpfc_vport *vport, uint32_t did)
 				return NULL;
 
 			if (ndlp->nlp_state > NLP_STE_UNUSED_NODE &&
-			    ndlp->nlp_state < NLP_STE_PRLI_ISSUE) {
+			    ndlp->nlp_state <= NLP_STE_PRLI_ISSUE) {
 				lpfc_disc_state_machine(vport, ndlp, NULL,
 							NLP_EVT_DEVICE_RECOVERY);
 			}
diff --git a/drivers/scsi/qla2xxx/qla_bsg.c b/drivers/scsi/qla2xxx/qla_bsg.c
index 19bb64bdd88b..52dc9604f567 100644
--- a/drivers/scsi/qla2xxx/qla_bsg.c
+++ b/drivers/scsi/qla2xxx/qla_bsg.c
@@ -324,7 +324,7 @@ qla2x00_process_els(struct bsg_job *bsg_job)
 		    "request_sg_cnt=%x reply_sg_cnt=%x.\n",
 		    bsg_job->request_payload.sg_cnt,
 		    bsg_job->reply_payload.sg_cnt);
-		rval = -EPERM;
+		rval = -ENOBUFS;
 		goto done;
 	}
 
@@ -3059,17 +3059,61 @@ qla24xx_bsg_request(struct bsg_job *bsg_job)
 	return ret;
 }
 
-int
-qla24xx_bsg_timeout(struct bsg_job *bsg_job)
+static bool qla_bsg_found(struct qla_qpair *qpair, struct bsg_job *bsg_job)
 {
+	bool found = false;
 	struct fc_bsg_reply *bsg_reply = bsg_job->reply;
 	scsi_qla_host_t *vha = shost_priv(fc_bsg_to_shost(bsg_job));
 	struct qla_hw_data *ha = vha->hw;
-	srb_t *sp;
-	int cnt, que;
+	srb_t *sp = NULL;
+	int cnt;
 	unsigned long flags;
 	struct req_que *req;
 
+	spin_lock_irqsave(qpair->qp_lock_ptr, flags);
+	req = qpair->req;
+
+	for (cnt = 1; cnt < req->num_outstanding_cmds; cnt++) {
+		sp = req->outstanding_cmds[cnt];
+		if (sp &&
+		    (sp->type == SRB_CT_CMD ||
+		     sp->type == SRB_ELS_CMD_HST ||
+		     sp->type == SRB_ELS_CMD_HST_NOLOGIN) &&
+		    sp->u.bsg_job == bsg_job) {
+			req->outstanding_cmds[cnt] = NULL;
+			spin_unlock_irqrestore(qpair->qp_lock_ptr, flags);
+
+			if (!ha->flags.eeh_busy && ha->isp_ops->abort_command(sp)) {
+				ql_log(ql_log_warn, vha, 0x7089,
+						"mbx abort_command failed.\n");
+				bsg_reply->result = -EIO;
+			} else {
+				ql_dbg(ql_dbg_user, vha, 0x708a,
+						"mbx abort_command success.\n");
+				bsg_reply->result = 0;
+			}
+			/* ref: INIT */
+			kref_put(&sp->cmd_kref, qla2x00_sp_release);
+
+			found = true;
+			goto done;
+		}
+	}
+	spin_unlock_irqrestore(qpair->qp_lock_ptr, flags);
+
+done:
+	return found;
+}
+
+int
+qla24xx_bsg_timeout(struct bsg_job *bsg_job)
+{
+	struct fc_bsg_reply *bsg_reply = bsg_job->reply;
+	scsi_qla_host_t *vha = shost_priv(fc_bsg_to_shost(bsg_job));
+	struct qla_hw_data *ha = vha->hw;
+	int i;
+	struct qla_qpair *qpair;
+
 	ql_log(ql_log_info, vha, 0x708b, "%s CMD timeout. bsg ptr %p.\n",
 	    __func__, bsg_job);
 
@@ -3079,48 +3123,22 @@ qla24xx_bsg_timeout(struct bsg_job *bsg_job)
 		qla_pci_set_eeh_busy(vha);
 	}
 
+	if (qla_bsg_found(ha->base_qpair, bsg_job))
+		goto done;
+
 	/* find the bsg job from the active list of commands */
-	spin_lock_irqsave(&ha->hardware_lock, flags);
-	for (que = 0; que < ha->max_req_queues; que++) {
-		req = ha->req_q_map[que];
-		if (!req)
+	for (i = 0; i < ha->max_qpairs; i++) {
+		qpair = vha->hw->queue_pair_map[i];
+		if (!qpair)
 			continue;
-
-		for (cnt = 1; cnt < req->num_outstanding_cmds; cnt++) {
-			sp = req->outstanding_cmds[cnt];
-			if (sp &&
-			    (sp->type == SRB_CT_CMD ||
-			     sp->type == SRB_ELS_CMD_HST ||
-			     sp->type == SRB_ELS_CMD_HST_NOLOGIN ||
-			     sp->type == SRB_FXIOCB_BCMD) &&
-			    sp->u.bsg_job == bsg_job) {
-				req->outstanding_cmds[cnt] = NULL;
-				spin_unlock_irqrestore(&ha->hardware_lock, flags);
-
-				if (!ha->flags.eeh_busy && ha->isp_ops->abort_command(sp)) {
-					ql_log(ql_log_warn, vha, 0x7089,
-					    "mbx abort_command failed.\n");
-					bsg_reply->result = -EIO;
-				} else {
-					ql_dbg(ql_dbg_user, vha, 0x708a,
-					    "mbx abort_command success.\n");
-					bsg_reply->result = 0;
-				}
-				spin_lock_irqsave(&ha->hardware_lock, flags);
-				goto done;
-
-			}
-		}
+		if (qla_bsg_found(qpair, bsg_job))
+			goto done;
 	}
-	spin_unlock_irqrestore(&ha->hardware_lock, flags);
+
 	ql_log(ql_log_info, vha, 0x708b, "SRB not found to abort.\n");
 	bsg_reply->result = -ENXIO;
-	return 0;
 
 done:
-	spin_unlock_irqrestore(&ha->hardware_lock, flags);
-	/* ref: INIT */
-	kref_put(&sp->cmd_kref, qla2x00_sp_release);
 	return 0;
 }
 
diff --git a/drivers/scsi/qla2xxx/qla_def.h b/drivers/scsi/qla2xxx/qla_def.h
index 2f49baf131e2..7cf998e3cc68 100644
--- a/drivers/scsi/qla2xxx/qla_def.h
+++ b/drivers/scsi/qla2xxx/qla_def.h
@@ -3309,9 +3309,20 @@ struct fab_scan_rp {
 	u8 node_name[8];
 };
 
+enum scan_step {
+	FAB_SCAN_START,
+	FAB_SCAN_GPNFT_FCP,
+	FAB_SCAN_GNNFT_FCP,
+	FAB_SCAN_GPNFT_NVME,
+	FAB_SCAN_GNNFT_NVME,
+};
+
 struct fab_scan {
 	struct fab_scan_rp *l;
 	u32 size;
+	u32 rscn_gen_start;
+	u32 rscn_gen_end;
+	enum scan_step step;
 	u16 scan_retry;
 #define MAX_SCAN_RETRIES 5
 	enum scan_flags_t scan_flags;
@@ -3537,9 +3548,8 @@ enum qla_work_type {
 	QLA_EVT_RELOGIN,
 	QLA_EVT_ASYNC_PRLO,
 	QLA_EVT_ASYNC_PRLO_DONE,
-	QLA_EVT_GPNFT,
-	QLA_EVT_GPNFT_DONE,
-	QLA_EVT_GNNFT_DONE,
+	QLA_EVT_SCAN_CMD,
+	QLA_EVT_SCAN_FINISH,
 	QLA_EVT_GFPNID,
 	QLA_EVT_SP_RETRY,
 	QLA_EVT_IIDMA,
@@ -5030,6 +5040,7 @@ typedef struct scsi_qla_host {
 
 	/* Counter to detect races between ELS and RSCN events */
 	atomic_t		generation_tick;
+	atomic_t		rscn_gen;
 	/* Time when global fcport update has been scheduled */
 	int			total_fcport_update_gen;
 	/* List of pending LOGOs, protected by tgt_mutex */
diff --git a/drivers/scsi/qla2xxx/qla_gbl.h b/drivers/scsi/qla2xxx/qla_gbl.h
index 7309310d2ab9..cededfda9d0e 100644
--- a/drivers/scsi/qla2xxx/qla_gbl.h
+++ b/drivers/scsi/qla2xxx/qla_gbl.h
@@ -728,9 +728,9 @@ int qla24xx_async_gpsc(scsi_qla_host_t *, fc_port_t *);
 void qla24xx_handle_gpsc_event(scsi_qla_host_t *, struct event_arg *);
 int qla2x00_mgmt_svr_login(scsi_qla_host_t *);
 int qla24xx_async_gffid(scsi_qla_host_t *vha, fc_port_t *fcport, bool);
-int qla24xx_async_gpnft(scsi_qla_host_t *, u8, srb_t *);
-void qla24xx_async_gpnft_done(scsi_qla_host_t *, srb_t *);
-void qla24xx_async_gnnft_done(scsi_qla_host_t *, srb_t *);
+int qla_fab_async_scan(scsi_qla_host_t *, srb_t *);
+void qla_fab_scan_start(struct scsi_qla_host *);
+void qla_fab_scan_finish(scsi_qla_host_t *, srb_t *);
 int qla24xx_post_gfpnid_work(struct scsi_qla_host *, fc_port_t *);
 int qla24xx_async_gfpnid(scsi_qla_host_t *, fc_port_t *);
 void qla24xx_handle_gfpnid_event(scsi_qla_host_t *, struct event_arg *);
diff --git a/drivers/scsi/qla2xxx/qla_gs.c b/drivers/scsi/qla2xxx/qla_gs.c
index 1cf9d200d563..d2bddca7045a 100644
--- a/drivers/scsi/qla2xxx/qla_gs.c
+++ b/drivers/scsi/qla2xxx/qla_gs.c
@@ -1710,7 +1710,7 @@ qla2x00_hba_attributes(scsi_qla_host_t *vha, void *entries,
 	eiter->type = cpu_to_be16(FDMI_HBA_OPTION_ROM_VERSION);
 	alen = scnprintf(
 		eiter->a.orom_version, sizeof(eiter->a.orom_version),
-		"%d.%02d", ha->bios_revision[1], ha->bios_revision[0]);
+		"%d.%02d", ha->efi_revision[1], ha->efi_revision[0]);
 	alen += FDMI_ATTR_ALIGNMENT(alen);
 	alen += FDMI_ATTR_TYPELEN(eiter);
 	eiter->len = cpu_to_be16(alen);
@@ -3168,7 +3168,30 @@ static int qla2x00_is_a_vp(scsi_qla_host_t *vha, u64 wwn)
 	return rc;
 }
 
-void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
+static bool qla_ok_to_clear_rscn(scsi_qla_host_t *vha, fc_port_t *fcport)
+{
+	u32 rscn_gen;
+
+	rscn_gen = atomic_read(&vha->rscn_gen);
+	ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0x2017,
+	    "%s %d %8phC rscn_gen %x start %x end %x current %x\n",
+	    __func__, __LINE__, fcport->port_name, fcport->rscn_gen,
+	    vha->scan.rscn_gen_start, vha->scan.rscn_gen_end, rscn_gen);
+
+	if (val_is_in_range(fcport->rscn_gen, vha->scan.rscn_gen_start,
+	    vha->scan.rscn_gen_end))
+		/* rscn came in before fabric scan */
+		return true;
+
+	if (val_is_in_range(fcport->rscn_gen, vha->scan.rscn_gen_end, rscn_gen))
+		/* rscn came in after fabric scan */
+		return false;
+
+	/* rare: fcport's scan_needed + rscn_gen must be stale */
+	return true;
+}
+
+void qla_fab_scan_finish(scsi_qla_host_t *vha, srb_t *sp)
 {
 	fc_port_t *fcport;
 	u32 i, rc;
@@ -3281,10 +3304,10 @@ void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
 				   (fcport->scan_needed &&
 				    fcport->port_type != FCT_INITIATOR &&
 				    fcport->port_type != FCT_NVME_INITIATOR)) {
+				fcport->scan_needed = 0;
 				qlt_schedule_sess_for_deletion(fcport);
 			}
 			fcport->d_id.b24 = rp->id.b24;
-			fcport->scan_needed = 0;
 			break;
 		}
 
@@ -3325,7 +3348,9 @@ void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
 				do_delete = true;
 			}
 
-			fcport->scan_needed = 0;
+			if (qla_ok_to_clear_rscn(vha, fcport))
+				fcport->scan_needed = 0;
+
 			if (((qla_dual_mode_enabled(vha) ||
 			      qla_ini_mode_enabled(vha)) &&
 			    atomic_read(&fcport->state) == FCS_ONLINE) ||
@@ -3355,7 +3380,9 @@ void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
 					    fcport->port_name, fcport->loop_id,
 					    fcport->login_retry);
 				}
-				fcport->scan_needed = 0;
+
+				if (qla_ok_to_clear_rscn(vha, fcport))
+					fcport->scan_needed = 0;
 				qla24xx_fcport_handle_login(vha, fcport);
 			}
 		}
@@ -3379,14 +3406,11 @@ void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
 	}
 }
 
-static int qla2x00_post_gnnft_gpnft_done_work(struct scsi_qla_host *vha,
+static int qla2x00_post_next_scan_work(struct scsi_qla_host *vha,
     srb_t *sp, int cmd)
 {
 	struct qla_work_evt *e;
 
-	if (cmd != QLA_EVT_GPNFT_DONE && cmd != QLA_EVT_GNNFT_DONE)
-		return QLA_PARAMETER_ERROR;
-
 	e = qla2x00_alloc_work(vha, cmd);
 	if (!e)
 		return QLA_FUNCTION_FAILED;
@@ -3396,37 +3420,15 @@ static int qla2x00_post_gnnft_gpnft_done_work(struct scsi_qla_host *vha,
 	return qla2x00_post_work(vha, e);
 }
 
-static int qla2x00_post_nvme_gpnft_work(struct scsi_qla_host *vha,
-    srb_t *sp, int cmd)
-{
-	struct qla_work_evt *e;
-
-	if (cmd != QLA_EVT_GPNFT)
-		return QLA_PARAMETER_ERROR;
-
-	e = qla2x00_alloc_work(vha, cmd);
-	if (!e)
-		return QLA_FUNCTION_FAILED;
-
-	e->u.gpnft.fc4_type = FC4_TYPE_NVME;
-	e->u.gpnft.sp = sp;
-
-	return qla2x00_post_work(vha, e);
-}
-
 static void qla2x00_find_free_fcp_nvme_slot(struct scsi_qla_host *vha,
 	struct srb *sp)
 {
 	struct qla_hw_data *ha = vha->hw;
 	int num_fibre_dev = ha->max_fibre_devices;
-	struct ct_sns_req *ct_req =
-		(struct ct_sns_req *)sp->u.iocb_cmd.u.ctarg.req;
 	struct ct_sns_gpnft_rsp *ct_rsp =
 		(struct ct_sns_gpnft_rsp *)sp->u.iocb_cmd.u.ctarg.rsp;
 	struct ct_sns_gpn_ft_data *d;
 	struct fab_scan_rp *rp;
-	u16 cmd = be16_to_cpu(ct_req->command);
-	u8 fc4_type = sp->gen2;
 	int i, j, k;
 	port_id_t id;
 	u8 found;
@@ -3445,85 +3447,83 @@ static void qla2x00_find_free_fcp_nvme_slot(struct scsi_qla_host *vha,
 		if (id.b24 == 0 || wwn == 0)
 			continue;
 
-		if (fc4_type == FC4_TYPE_FCP_SCSI) {
-			if (cmd == GPN_FT_CMD) {
-				rp = &vha->scan.l[j];
-				rp->id = id;
-				memcpy(rp->port_name, d->port_name, 8);
-				j++;
-				rp->fc4type = FS_FC4TYPE_FCP;
-			} else {
-				for (k = 0; k < num_fibre_dev; k++) {
-					rp = &vha->scan.l[k];
-					if (id.b24 == rp->id.b24) {
-						memcpy(rp->node_name,
-						    d->port_name, 8);
-						break;
-					}
+		ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0x2025,
+		       "%s %06x %8ph \n",
+		       __func__, id.b24, d->port_name);
+
+		switch (vha->scan.step) {
+		case FAB_SCAN_GPNFT_FCP:
+			rp = &vha->scan.l[j];
+			rp->id = id;
+			memcpy(rp->port_name, d->port_name, 8);
+			j++;
+			rp->fc4type = FS_FC4TYPE_FCP;
+			break;
+		case FAB_SCAN_GNNFT_FCP:
+			for (k = 0; k < num_fibre_dev; k++) {
+				rp = &vha->scan.l[k];
+				if (id.b24 == rp->id.b24) {
+					memcpy(rp->node_name,
+					    d->port_name, 8);
+					break;
 				}
 			}
-		} else {
-			/* Search if the fibre device supports FC4_TYPE_NVME */
-			if (cmd == GPN_FT_CMD) {
-				found = 0;
-
-				for (k = 0; k < num_fibre_dev; k++) {
-					rp = &vha->scan.l[k];
-					if (!memcmp(rp->port_name,
-					    d->port_name, 8)) {
-						/*
-						 * Supports FC-NVMe & FCP
-						 */
-						rp->fc4type |= FS_FC4TYPE_NVME;
-						found = 1;
-						break;
-					}
+			break;
+		case FAB_SCAN_GPNFT_NVME:
+			found = 0;
+
+			for (k = 0; k < num_fibre_dev; k++) {
+				rp = &vha->scan.l[k];
+				if (!memcmp(rp->port_name, d->port_name, 8)) {
+					/*
+					 * Supports FC-NVMe & FCP
+					 */
+					rp->fc4type |= FS_FC4TYPE_NVME;
+					found = 1;
+					break;
 				}
+			}
 
-				/* We found new FC-NVMe only port */
-				if (!found) {
-					for (k = 0; k < num_fibre_dev; k++) {
-						rp = &vha->scan.l[k];
-						if (wwn_to_u64(rp->port_name)) {
-							continue;
-						} else {
-							rp->id = id;
-							memcpy(rp->port_name,
-							    d->port_name, 8);
-							rp->fc4type =
-							    FS_FC4TYPE_NVME;
-							break;
-						}
-					}
-				}
-			} else {
+			/* We found new FC-NVMe only port */
+			if (!found) {
 				for (k = 0; k < num_fibre_dev; k++) {
 					rp = &vha->scan.l[k];
-					if (id.b24 == rp->id.b24) {
-						memcpy(rp->node_name,
-						    d->port_name, 8);
+					if (wwn_to_u64(rp->port_name)) {
+						continue;
+					} else {
+						rp->id = id;
+						memcpy(rp->port_name, d->port_name, 8);
+						rp->fc4type = FS_FC4TYPE_NVME;
 						break;
 					}
 				}
 			}
+			break;
+		case FAB_SCAN_GNNFT_NVME:
+			for (k = 0; k < num_fibre_dev; k++) {
+				rp = &vha->scan.l[k];
+				if (id.b24 == rp->id.b24) {
+					memcpy(rp->node_name, d->port_name, 8);
+					break;
+				}
+			}
+			break;
+		default:
+			break;
 		}
 	}
 }
 
-static void qla2x00_async_gpnft_gnnft_sp_done(srb_t *sp, int res)
+static void qla_async_scan_sp_done(srb_t *sp, int res)
 {
 	struct scsi_qla_host *vha = sp->vha;
-	struct ct_sns_req *ct_req =
-		(struct ct_sns_req *)sp->u.iocb_cmd.u.ctarg.req;
-	u16 cmd = be16_to_cpu(ct_req->command);
-	u8 fc4_type = sp->gen2;
 	unsigned long flags;
 	int rc;
 
 	/* gen2 field is holding the fc4type */
-	ql_dbg(ql_dbg_disc, vha, 0xffff,
-	    "Async done-%s res %x FC4Type %x\n",
-	    sp->name, res, sp->gen2);
+	ql_dbg(ql_dbg_disc, vha, 0x2026,
+	    "Async done-%s res %x step %x\n",
+	    sp->name, res, vha->scan.step);
 
 	sp->rc = res;
 	if (res) {
@@ -3547,8 +3547,7 @@ static void qla2x00_async_gpnft_gnnft_sp_done(srb_t *sp, int res)
 		 * sp for GNNFT_DONE work. This will allow all
 		 * the resource to get freed up.
 		 */
-		rc = qla2x00_post_gnnft_gpnft_done_work(vha, sp,
-		    QLA_EVT_GNNFT_DONE);
+		rc = qla2x00_post_next_scan_work(vha, sp, QLA_EVT_SCAN_FINISH);
 		if (rc) {
 			/* Cleanup here to prevent memory leak */
 			qla24xx_sp_unmap(vha, sp);
@@ -3573,28 +3572,30 @@ static void qla2x00_async_gpnft_gnnft_sp_done(srb_t *sp, int res)
 
 	qla2x00_find_free_fcp_nvme_slot(vha, sp);
 
-	if ((fc4_type == FC4_TYPE_FCP_SCSI) && vha->flags.nvme_enabled &&
-	    cmd == GNN_FT_CMD) {
-		spin_lock_irqsave(&vha->work_lock, flags);
-		vha->scan.scan_flags &= ~SF_SCANNING;
-		spin_unlock_irqrestore(&vha->work_lock, flags);
+	spin_lock_irqsave(&vha->work_lock, flags);
+	vha->scan.scan_flags &= ~SF_SCANNING;
+	spin_unlock_irqrestore(&vha->work_lock, flags);
 
-		sp->rc = res;
-		rc = qla2x00_post_nvme_gpnft_work(vha, sp, QLA_EVT_GPNFT);
-		if (rc) {
-			qla24xx_sp_unmap(vha, sp);
-			set_bit(LOCAL_LOOP_UPDATE, &vha->dpc_flags);
-			set_bit(LOOP_RESYNC_NEEDED, &vha->dpc_flags);
-		}
-		return;
-	}
+	switch (vha->scan.step) {
+	case FAB_SCAN_GPNFT_FCP:
+	case FAB_SCAN_GPNFT_NVME:
+		rc = qla2x00_post_next_scan_work(vha, sp, QLA_EVT_SCAN_CMD);
+		break;
+	case  FAB_SCAN_GNNFT_FCP:
+		if (vha->flags.nvme_enabled)
+			rc = qla2x00_post_next_scan_work(vha, sp, QLA_EVT_SCAN_CMD);
+		else
+			rc = qla2x00_post_next_scan_work(vha, sp, QLA_EVT_SCAN_FINISH);
 
-	if (cmd == GPN_FT_CMD) {
-		rc = qla2x00_post_gnnft_gpnft_done_work(vha, sp,
-		    QLA_EVT_GPNFT_DONE);
-	} else {
-		rc = qla2x00_post_gnnft_gpnft_done_work(vha, sp,
-		    QLA_EVT_GNNFT_DONE);
+		break;
+	case  FAB_SCAN_GNNFT_NVME:
+		rc = qla2x00_post_next_scan_work(vha, sp, QLA_EVT_SCAN_FINISH);
+		break;
+	default:
+		/* should not be here */
+		WARN_ON(1);
+		rc = QLA_FUNCTION_FAILED;
+		break;
 	}
 
 	if (rc) {
@@ -3605,127 +3606,16 @@ static void qla2x00_async_gpnft_gnnft_sp_done(srb_t *sp, int res)
 	}
 }
 
-/*
- * Get WWNN list for fc4_type
- *
- * It is assumed the same SRB is re-used from GPNFT to avoid
- * mem free & re-alloc
- */
-static int qla24xx_async_gnnft(scsi_qla_host_t *vha, struct srb *sp,
-    u8 fc4_type)
-{
-	int rval = QLA_FUNCTION_FAILED;
-	struct ct_sns_req *ct_req;
-	struct ct_sns_pkt *ct_sns;
-	unsigned long flags;
-
-	if (!vha->flags.online) {
-		spin_lock_irqsave(&vha->work_lock, flags);
-		vha->scan.scan_flags &= ~SF_SCANNING;
-		spin_unlock_irqrestore(&vha->work_lock, flags);
-		goto done_free_sp;
-	}
-
-	if (!sp->u.iocb_cmd.u.ctarg.req || !sp->u.iocb_cmd.u.ctarg.rsp) {
-		ql_log(ql_log_warn, vha, 0xffff,
-		    "%s: req %p rsp %p are not setup\n",
-		    __func__, sp->u.iocb_cmd.u.ctarg.req,
-		    sp->u.iocb_cmd.u.ctarg.rsp);
-		spin_lock_irqsave(&vha->work_lock, flags);
-		vha->scan.scan_flags &= ~SF_SCANNING;
-		spin_unlock_irqrestore(&vha->work_lock, flags);
-		WARN_ON(1);
-		set_bit(LOCAL_LOOP_UPDATE, &vha->dpc_flags);
-		set_bit(LOOP_RESYNC_NEEDED, &vha->dpc_flags);
-		goto done_free_sp;
-	}
-
-	ql_dbg(ql_dbg_disc, vha, 0xfffff,
-	    "%s: FC4Type %x, CT-PASSTHRU %s command ctarg rsp size %d, ctarg req size %d\n",
-	    __func__, fc4_type, sp->name, sp->u.iocb_cmd.u.ctarg.rsp_size,
-	     sp->u.iocb_cmd.u.ctarg.req_size);
-
-	sp->type = SRB_CT_PTHRU_CMD;
-	sp->name = "gnnft";
-	sp->gen1 = vha->hw->base_qpair->chip_reset;
-	sp->gen2 = fc4_type;
-	qla2x00_init_async_sp(sp, qla2x00_get_async_timeout(vha) + 2,
-			      qla2x00_async_gpnft_gnnft_sp_done);
-
-	memset(sp->u.iocb_cmd.u.ctarg.rsp, 0, sp->u.iocb_cmd.u.ctarg.rsp_size);
-	memset(sp->u.iocb_cmd.u.ctarg.req, 0, sp->u.iocb_cmd.u.ctarg.req_size);
-
-	ct_sns = (struct ct_sns_pkt *)sp->u.iocb_cmd.u.ctarg.req;
-	/* CT_IU preamble  */
-	ct_req = qla2x00_prep_ct_req(ct_sns, GNN_FT_CMD,
-	    sp->u.iocb_cmd.u.ctarg.rsp_size);
-
-	/* GPN_FT req */
-	ct_req->req.gpn_ft.port_type = fc4_type;
-
-	sp->u.iocb_cmd.u.ctarg.req_size = GNN_FT_REQ_SIZE;
-	sp->u.iocb_cmd.u.ctarg.nport_handle = NPH_SNS;
-
-	ql_dbg(ql_dbg_disc, vha, 0xffff,
-	    "Async-%s hdl=%x FC4Type %x.\n", sp->name,
-	    sp->handle, ct_req->req.gpn_ft.port_type);
-
-	rval = qla2x00_start_sp(sp);
-	if (rval != QLA_SUCCESS) {
-		goto done_free_sp;
-	}
-
-	return rval;
-
-done_free_sp:
-	if (sp->u.iocb_cmd.u.ctarg.req) {
-		dma_free_coherent(&vha->hw->pdev->dev,
-		    sp->u.iocb_cmd.u.ctarg.req_allocated_size,
-		    sp->u.iocb_cmd.u.ctarg.req,
-		    sp->u.iocb_cmd.u.ctarg.req_dma);
-		sp->u.iocb_cmd.u.ctarg.req = NULL;
-	}
-	if (sp->u.iocb_cmd.u.ctarg.rsp) {
-		dma_free_coherent(&vha->hw->pdev->dev,
-		    sp->u.iocb_cmd.u.ctarg.rsp_allocated_size,
-		    sp->u.iocb_cmd.u.ctarg.rsp,
-		    sp->u.iocb_cmd.u.ctarg.rsp_dma);
-		sp->u.iocb_cmd.u.ctarg.rsp = NULL;
-	}
-	/* ref: INIT */
-	kref_put(&sp->cmd_kref, qla2x00_sp_release);
-
-	spin_lock_irqsave(&vha->work_lock, flags);
-	vha->scan.scan_flags &= ~SF_SCANNING;
-	if (vha->scan.scan_flags == 0) {
-		ql_dbg(ql_dbg_disc, vha, 0xffff,
-		    "%s: schedule\n", __func__);
-		vha->scan.scan_flags |= SF_QUEUED;
-		schedule_delayed_work(&vha->scan.scan_work, 5);
-	}
-	spin_unlock_irqrestore(&vha->work_lock, flags);
-
-
-	return rval;
-} /* GNNFT */
-
-void qla24xx_async_gpnft_done(scsi_qla_host_t *vha, srb_t *sp)
-{
-	ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0xffff,
-	    "%s enter\n", __func__);
-	qla24xx_async_gnnft(vha, sp, sp->gen2);
-}
-
 /* Get WWPN list for certain fc4_type */
-int qla24xx_async_gpnft(scsi_qla_host_t *vha, u8 fc4_type, srb_t *sp)
+int qla_fab_async_scan(scsi_qla_host_t *vha, srb_t *sp)
 {
 	int rval = QLA_FUNCTION_FAILED;
 	struct ct_sns_req       *ct_req;
 	struct ct_sns_pkt *ct_sns;
-	u32 rspsz;
+	u32 rspsz = 0;
 	unsigned long flags;
 
-	ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0xffff,
+	ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0x200c,
 	    "%s enter\n", __func__);
 
 	if (!vha->flags.online)
@@ -3734,22 +3624,21 @@ int qla24xx_async_gpnft(scsi_qla_host_t *vha, u8 fc4_type, srb_t *sp)
 	spin_lock_irqsave(&vha->work_lock, flags);
 	if (vha->scan.scan_flags & SF_SCANNING) {
 		spin_unlock_irqrestore(&vha->work_lock, flags);
-		ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0xffff,
+		ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0x2012,
 		    "%s: scan active\n", __func__);
 		return rval;
 	}
 	vha->scan.scan_flags |= SF_SCANNING;
+	if (!sp)
+		vha->scan.step = FAB_SCAN_START;
+
 	spin_unlock_irqrestore(&vha->work_lock, flags);
 
-	if (fc4_type == FC4_TYPE_FCP_SCSI) {
-		ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0xffff,
+	switch (vha->scan.step) {
+	case FAB_SCAN_START:
+		ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0x2018,
 		    "%s: Performing FCP Scan\n", __func__);
 
-		if (sp) {
-			/* ref: INIT */
-			kref_put(&sp->cmd_kref, qla2x00_sp_release);
-		}
-
 		/* ref: INIT */
 		sp = qla2x00_get_sp(vha, NULL, GFP_KERNEL);
 		if (!sp) {
@@ -3765,7 +3654,7 @@ int qla24xx_async_gpnft(scsi_qla_host_t *vha, u8 fc4_type, srb_t *sp)
 								GFP_KERNEL);
 		sp->u.iocb_cmd.u.ctarg.req_allocated_size = sizeof(struct ct_sns_pkt);
 		if (!sp->u.iocb_cmd.u.ctarg.req) {
-			ql_log(ql_log_warn, vha, 0xffff,
+			ql_log(ql_log_warn, vha, 0x201a,
 			    "Failed to allocate ct_sns request.\n");
 			spin_lock_irqsave(&vha->work_lock, flags);
 			vha->scan.scan_flags &= ~SF_SCANNING;
@@ -3773,7 +3662,6 @@ int qla24xx_async_gpnft(scsi_qla_host_t *vha, u8 fc4_type, srb_t *sp)
 			qla2x00_rel_sp(sp);
 			return rval;
 		}
-		sp->u.iocb_cmd.u.ctarg.req_size = GPN_FT_REQ_SIZE;
 
 		rspsz = sizeof(struct ct_sns_gpnft_rsp) +
 			vha->hw->max_fibre_devices *
@@ -3785,7 +3673,7 @@ int qla24xx_async_gpnft(scsi_qla_host_t *vha, u8 fc4_type, srb_t *sp)
 								GFP_KERNEL);
 		sp->u.iocb_cmd.u.ctarg.rsp_allocated_size = rspsz;
 		if (!sp->u.iocb_cmd.u.ctarg.rsp) {
-			ql_log(ql_log_warn, vha, 0xffff,
+			ql_log(ql_log_warn, vha, 0x201b,
 			    "Failed to allocate ct_sns request.\n");
 			spin_lock_irqsave(&vha->work_lock, flags);
 			vha->scan.scan_flags &= ~SF_SCANNING;
@@ -3805,35 +3693,95 @@ int qla24xx_async_gpnft(scsi_qla_host_t *vha, u8 fc4_type, srb_t *sp)
 		    "%s scan list size %d\n", __func__, vha->scan.size);
 
 		memset(vha->scan.l, 0, vha->scan.size);
-	} else if (!sp) {
-		ql_dbg(ql_dbg_disc, vha, 0xffff,
-		    "NVME scan did not provide SP\n");
+
+		vha->scan.step = FAB_SCAN_GPNFT_FCP;
+		break;
+	case FAB_SCAN_GPNFT_FCP:
+		vha->scan.step = FAB_SCAN_GNNFT_FCP;
+		break;
+	case FAB_SCAN_GNNFT_FCP:
+		vha->scan.step = FAB_SCAN_GPNFT_NVME;
+		break;
+	case FAB_SCAN_GPNFT_NVME:
+		vha->scan.step = FAB_SCAN_GNNFT_NVME;
+		break;
+	case FAB_SCAN_GNNFT_NVME:
+	default:
+		/* should not be here */
+		WARN_ON(1);
+		goto done_free_sp;
+	}
+
+	if (!sp) {
+		ql_dbg(ql_dbg_disc, vha, 0x201c,
+		    "scan did not provide SP\n");
 		return rval;
 	}
+	if (!sp->u.iocb_cmd.u.ctarg.req || !sp->u.iocb_cmd.u.ctarg.rsp) {
+		ql_log(ql_log_warn, vha, 0x201d,
+		    "%s: req %p rsp %p are not setup\n",
+		    __func__, sp->u.iocb_cmd.u.ctarg.req,
+		    sp->u.iocb_cmd.u.ctarg.rsp);
+		spin_lock_irqsave(&vha->work_lock, flags);
+		vha->scan.scan_flags &= ~SF_SCANNING;
+		spin_unlock_irqrestore(&vha->work_lock, flags);
+		WARN_ON(1);
+		set_bit(LOCAL_LOOP_UPDATE, &vha->dpc_flags);
+		set_bit(LOOP_RESYNC_NEEDED, &vha->dpc_flags);
+		goto done_free_sp;
+	}
+
+	rspsz = sp->u.iocb_cmd.u.ctarg.rsp_size;
+	memset(sp->u.iocb_cmd.u.ctarg.req, 0, sp->u.iocb_cmd.u.ctarg.req_size);
+	memset(sp->u.iocb_cmd.u.ctarg.rsp, 0, sp->u.iocb_cmd.u.ctarg.rsp_size);
+
 
 	sp->type = SRB_CT_PTHRU_CMD;
-	sp->name = "gpnft";
 	sp->gen1 = vha->hw->base_qpair->chip_reset;
-	sp->gen2 = fc4_type;
 	qla2x00_init_async_sp(sp, qla2x00_get_async_timeout(vha) + 2,
-			      qla2x00_async_gpnft_gnnft_sp_done);
-
-	rspsz = sp->u.iocb_cmd.u.ctarg.rsp_size;
-	memset(sp->u.iocb_cmd.u.ctarg.rsp, 0, sp->u.iocb_cmd.u.ctarg.rsp_size);
-	memset(sp->u.iocb_cmd.u.ctarg.req, 0, sp->u.iocb_cmd.u.ctarg.req_size);
+			      qla_async_scan_sp_done);
 
 	ct_sns = (struct ct_sns_pkt *)sp->u.iocb_cmd.u.ctarg.req;
-	/* CT_IU preamble  */
-	ct_req = qla2x00_prep_ct_req(ct_sns, GPN_FT_CMD, rspsz);
 
-	/* GPN_FT req */
-	ct_req->req.gpn_ft.port_type = fc4_type;
+	/* CT_IU preamble  */
+	switch (vha->scan.step) {
+	case FAB_SCAN_GPNFT_FCP:
+		sp->name = "gpnft";
+		ct_req = qla2x00_prep_ct_req(ct_sns, GPN_FT_CMD, rspsz);
+		ct_req->req.gpn_ft.port_type = FC4_TYPE_FCP_SCSI;
+		sp->u.iocb_cmd.u.ctarg.req_size = GPN_FT_REQ_SIZE;
+		break;
+	case FAB_SCAN_GNNFT_FCP:
+		sp->name = "gnnft";
+		ct_req = qla2x00_prep_ct_req(ct_sns, GNN_FT_CMD, rspsz);
+		ct_req->req.gpn_ft.port_type = FC4_TYPE_FCP_SCSI;
+		sp->u.iocb_cmd.u.ctarg.req_size = GNN_FT_REQ_SIZE;
+		break;
+	case FAB_SCAN_GPNFT_NVME:
+		sp->name = "gpnft";
+		ct_req = qla2x00_prep_ct_req(ct_sns, GPN_FT_CMD, rspsz);
+		ct_req->req.gpn_ft.port_type = FC4_TYPE_NVME;
+		sp->u.iocb_cmd.u.ctarg.req_size = GPN_FT_REQ_SIZE;
+		break;
+	case FAB_SCAN_GNNFT_NVME:
+		sp->name = "gnnft";
+		ct_req = qla2x00_prep_ct_req(ct_sns, GNN_FT_CMD, rspsz);
+		ct_req->req.gpn_ft.port_type = FC4_TYPE_NVME;
+		sp->u.iocb_cmd.u.ctarg.req_size = GNN_FT_REQ_SIZE;
+		break;
+	default:
+		/* should not be here */
+		WARN_ON(1);
+		goto done_free_sp;
+	}
 
 	sp->u.iocb_cmd.u.ctarg.nport_handle = NPH_SNS;
 
-	ql_dbg(ql_dbg_disc, vha, 0xffff,
-	    "Async-%s hdl=%x FC4Type %x.\n", sp->name,
-	    sp->handle, ct_req->req.gpn_ft.port_type);
+	ql_dbg(ql_dbg_disc, vha, 0x2003,
+	       "%s: step %d, rsp size %d, req size %d hdl %x %s FC4TYPE %x \n",
+	       __func__, vha->scan.step, sp->u.iocb_cmd.u.ctarg.rsp_size,
+	       sp->u.iocb_cmd.u.ctarg.req_size, sp->handle, sp->name,
+	       ct_req->req.gpn_ft.port_type);
 
 	rval = qla2x00_start_sp(sp);
 	if (rval != QLA_SUCCESS) {
@@ -3864,7 +3812,7 @@ int qla24xx_async_gpnft(scsi_qla_host_t *vha, u8 fc4_type, srb_t *sp)
 	spin_lock_irqsave(&vha->work_lock, flags);
 	vha->scan.scan_flags &= ~SF_SCANNING;
 	if (vha->scan.scan_flags == 0) {
-		ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0xffff,
+		ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0x2007,
 		    "%s: Scan scheduled.\n", __func__);
 		vha->scan.scan_flags |= SF_QUEUED;
 		schedule_delayed_work(&vha->scan.scan_work, 5);
@@ -3875,6 +3823,15 @@ int qla24xx_async_gpnft(scsi_qla_host_t *vha, u8 fc4_type, srb_t *sp)
 	return rval;
 }
 
+void qla_fab_scan_start(struct scsi_qla_host *vha)
+{
+	int rval;
+
+	rval = qla_fab_async_scan(vha, NULL);
+	if (rval)
+		set_bit(LOOP_RESYNC_NEEDED, &vha->dpc_flags);
+}
+
 void qla_scan_work_fn(struct work_struct *work)
 {
 	struct fab_scan *s = container_of(to_delayed_work(work),
diff --git a/drivers/scsi/qla2xxx/qla_init.c b/drivers/scsi/qla2xxx/qla_init.c
index 8377624d76c9..eda3bdab934d 100644
--- a/drivers/scsi/qla2xxx/qla_init.c
+++ b/drivers/scsi/qla2xxx/qla_init.c
@@ -1842,10 +1842,18 @@ int qla24xx_post_newsess_work(struct scsi_qla_host *vha, port_id_t *id,
 	return qla2x00_post_work(vha, e);
 }
 
+static void qla_rscn_gen_tick(scsi_qla_host_t *vha, u32 *ret_rscn_gen)
+{
+	*ret_rscn_gen = atomic_inc_return(&vha->rscn_gen);
+	/* memory barrier */
+	wmb();
+}
+
 void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
 {
 	fc_port_t *fcport;
 	unsigned long flags;
+	u32 rscn_gen;
 
 	switch (ea->id.b.rsvd_1) {
 	case RSCN_PORT_ADDR:
@@ -1875,15 +1883,16 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
 					 * Otherwise we're already in the middle of a relogin
 					 */
 					fcport->scan_needed = 1;
-					fcport->rscn_gen++;
+					qla_rscn_gen_tick(vha, &fcport->rscn_gen);
 				}
 			} else {
 				fcport->scan_needed = 1;
-				fcport->rscn_gen++;
+				qla_rscn_gen_tick(vha, &fcport->rscn_gen);
 			}
 		}
 		break;
 	case RSCN_AREA_ADDR:
+		qla_rscn_gen_tick(vha, &rscn_gen);
 		list_for_each_entry(fcport, &vha->vp_fcports, list) {
 			if (fcport->flags & FCF_FCP2_DEVICE &&
 			    atomic_read(&fcport->state) == FCS_ONLINE)
@@ -1891,11 +1900,12 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
 
 			if ((ea->id.b24 & 0xffff00) == (fcport->d_id.b24 & 0xffff00)) {
 				fcport->scan_needed = 1;
-				fcport->rscn_gen++;
+				fcport->rscn_gen = rscn_gen;
 			}
 		}
 		break;
 	case RSCN_DOM_ADDR:
+		qla_rscn_gen_tick(vha, &rscn_gen);
 		list_for_each_entry(fcport, &vha->vp_fcports, list) {
 			if (fcport->flags & FCF_FCP2_DEVICE &&
 			    atomic_read(&fcport->state) == FCS_ONLINE)
@@ -1903,19 +1913,20 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
 
 			if ((ea->id.b24 & 0xff0000) == (fcport->d_id.b24 & 0xff0000)) {
 				fcport->scan_needed = 1;
-				fcport->rscn_gen++;
+				fcport->rscn_gen = rscn_gen;
 			}
 		}
 		break;
 	case RSCN_FAB_ADDR:
 	default:
+		qla_rscn_gen_tick(vha, &rscn_gen);
 		list_for_each_entry(fcport, &vha->vp_fcports, list) {
 			if (fcport->flags & FCF_FCP2_DEVICE &&
 			    atomic_read(&fcport->state) == FCS_ONLINE)
 				continue;
 
 			fcport->scan_needed = 1;
-			fcport->rscn_gen++;
+			fcport->rscn_gen = rscn_gen;
 		}
 		break;
 	}
@@ -1924,6 +1935,7 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
 	if (vha->scan.scan_flags == 0) {
 		ql_dbg(ql_dbg_disc, vha, 0xffff, "%s: schedule\n", __func__);
 		vha->scan.scan_flags |= SF_QUEUED;
+		vha->scan.rscn_gen_start = atomic_read(&vha->rscn_gen);
 		schedule_delayed_work(&vha->scan.scan_work, 5);
 	}
 	spin_unlock_irqrestore(&vha->work_lock, flags);
@@ -6393,10 +6405,9 @@ qla2x00_configure_fabric(scsi_qla_host_t *vha)
 		qlt_do_generation_tick(vha, &discovery_gen);
 
 		if (USE_ASYNC_SCAN(ha)) {
-			rval = qla24xx_async_gpnft(vha, FC4_TYPE_FCP_SCSI,
-			    NULL);
-			if (rval)
-				set_bit(LOOP_RESYNC_NEEDED, &vha->dpc_flags);
+			/* start of scan begins here */
+			vha->scan.rscn_gen_end = atomic_read(&vha->rscn_gen);
+			qla_fab_scan_start(vha);
 		} else  {
 			list_for_each_entry(fcport, &vha->vp_fcports, list)
 				fcport->scan_state = QLA_FCPORT_SCAN;
@@ -8207,15 +8218,21 @@ qla28xx_get_aux_images(
 	struct qla27xx_image_status pri_aux_image_status, sec_aux_image_status;
 	bool valid_pri_image = false, valid_sec_image = false;
 	bool active_pri_image = false, active_sec_image = false;
+	int rc;
 
 	if (!ha->flt_region_aux_img_status_pri) {
 		ql_dbg(ql_dbg_init, vha, 0x018a, "Primary aux image not addressed\n");
 		goto check_sec_image;
 	}
 
-	qla24xx_read_flash_data(vha, (uint32_t *)&pri_aux_image_status,
+	rc = qla24xx_read_flash_data(vha, (uint32_t *)&pri_aux_image_status,
 	    ha->flt_region_aux_img_status_pri,
 	    sizeof(pri_aux_image_status) >> 2);
+	if (rc) {
+		ql_log(ql_log_info, vha, 0x01a1,
+		    "Unable to read Primary aux image(%x).\n", rc);
+		goto check_sec_image;
+	}
 	qla27xx_print_image(vha, "Primary aux image", &pri_aux_image_status);
 
 	if (qla28xx_check_aux_image_status_signature(&pri_aux_image_status)) {
@@ -8246,9 +8263,15 @@ qla28xx_get_aux_images(
 		goto check_valid_image;
 	}
 
-	qla24xx_read_flash_data(vha, (uint32_t *)&sec_aux_image_status,
+	rc = qla24xx_read_flash_data(vha, (uint32_t *)&sec_aux_image_status,
 	    ha->flt_region_aux_img_status_sec,
 	    sizeof(sec_aux_image_status) >> 2);
+	if (rc) {
+		ql_log(ql_log_info, vha, 0x01a2,
+		    "Unable to read Secondary aux image(%x).\n", rc);
+		goto check_valid_image;
+	}
+
 	qla27xx_print_image(vha, "Secondary aux image", &sec_aux_image_status);
 
 	if (qla28xx_check_aux_image_status_signature(&sec_aux_image_status)) {
@@ -8306,6 +8329,7 @@ qla27xx_get_active_image(struct scsi_qla_host *vha,
 	struct qla27xx_image_status pri_image_status, sec_image_status;
 	bool valid_pri_image = false, valid_sec_image = false;
 	bool active_pri_image = false, active_sec_image = false;
+	int rc;
 
 	if (!ha->flt_region_img_status_pri) {
 		ql_dbg(ql_dbg_init, vha, 0x018a, "Primary image not addressed\n");
@@ -8347,8 +8371,14 @@ qla27xx_get_active_image(struct scsi_qla_host *vha,
 		goto check_valid_image;
 	}
 
-	qla24xx_read_flash_data(vha, (uint32_t *)(&sec_image_status),
+	rc = qla24xx_read_flash_data(vha, (uint32_t *)(&sec_image_status),
 	    ha->flt_region_img_status_sec, sizeof(sec_image_status) >> 2);
+	if (rc) {
+		ql_log(ql_log_info, vha, 0x01a3,
+		    "Unable to read Secondary image status(%x).\n", rc);
+		goto check_valid_image;
+	}
+
 	qla27xx_print_image(vha, "Secondary image", &sec_image_status);
 
 	if (qla27xx_check_image_status_signature(&sec_image_status)) {
@@ -8420,11 +8450,10 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
 	    "FW: Loading firmware from flash (%x).\n", faddr);
 
 	dcode = (uint32_t *)req->ring;
-	qla24xx_read_flash_data(vha, dcode, faddr, 8);
-	if (qla24xx_risc_firmware_invalid(dcode)) {
+	rval = qla24xx_read_flash_data(vha, dcode, faddr, 8);
+	if (rval || qla24xx_risc_firmware_invalid(dcode)) {
 		ql_log(ql_log_fatal, vha, 0x008c,
-		    "Unable to verify the integrity of flash firmware "
-		    "image.\n");
+		    "Unable to verify the integrity of flash firmware image (rval %x).\n", rval);
 		ql_log(ql_log_fatal, vha, 0x008d,
 		    "Firmware data: %08x %08x %08x %08x.\n",
 		    dcode[0], dcode[1], dcode[2], dcode[3]);
@@ -8438,7 +8467,12 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
 	for (j = 0; j < segments; j++) {
 		ql_dbg(ql_dbg_init, vha, 0x008d,
 		    "-> Loading segment %u...\n", j);
-		qla24xx_read_flash_data(vha, dcode, faddr, 10);
+		rval = qla24xx_read_flash_data(vha, dcode, faddr, 10);
+		if (rval) {
+			ql_log(ql_log_fatal, vha, 0x016a,
+			    "-> Unable to read segment addr + size .\n");
+			return QLA_FUNCTION_FAILED;
+		}
 		risc_addr = be32_to_cpu((__force __be32)dcode[2]);
 		risc_size = be32_to_cpu((__force __be32)dcode[3]);
 		if (!*srisc_addr) {
@@ -8454,7 +8488,13 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
 			ql_dbg(ql_dbg_init, vha, 0x008e,
 			    "-> Loading fragment %u: %#x <- %#x (%#lx dwords)...\n",
 			    fragment, risc_addr, faddr, dlen);
-			qla24xx_read_flash_data(vha, dcode, faddr, dlen);
+			rval = qla24xx_read_flash_data(vha, dcode, faddr, dlen);
+			if (rval) {
+				ql_log(ql_log_fatal, vha, 0x016b,
+				    "-> Unable to read fragment(faddr %#x dlen %#lx).\n",
+				    faddr, dlen);
+				return QLA_FUNCTION_FAILED;
+			}
 			for (i = 0; i < dlen; i++)
 				dcode[i] = swab32(dcode[i]);
 
@@ -8483,7 +8523,14 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
 		fwdt->length = 0;
 
 		dcode = (uint32_t *)req->ring;
-		qla24xx_read_flash_data(vha, dcode, faddr, 7);
+
+		rval = qla24xx_read_flash_data(vha, dcode, faddr, 7);
+		if (rval) {
+			ql_log(ql_log_fatal, vha, 0x016c,
+			    "-> Unable to read template size.\n");
+			goto failed;
+		}
+
 		risc_size = be32_to_cpu((__force __be32)dcode[2]);
 		ql_dbg(ql_dbg_init, vha, 0x0161,
 		    "-> fwdt%u template array at %#x (%#x dwords)\n",
@@ -8509,11 +8556,12 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
 		}
 
 		dcode = fwdt->template;
-		qla24xx_read_flash_data(vha, dcode, faddr, risc_size);
+		rval = qla24xx_read_flash_data(vha, dcode, faddr, risc_size);
 
-		if (!qla27xx_fwdt_template_valid(dcode)) {
+		if (rval || !qla27xx_fwdt_template_valid(dcode)) {
 			ql_log(ql_log_warn, vha, 0x0165,
-			    "-> fwdt%u failed template validate\n", j);
+			    "-> fwdt%u failed template validate (rval %x)\n",
+			    j, rval);
 			goto failed;
 		}
 
diff --git a/drivers/scsi/qla2xxx/qla_inline.h b/drivers/scsi/qla2xxx/qla_inline.h
index a4a56ab0ba74..ef4b3cc1cd77 100644
--- a/drivers/scsi/qla2xxx/qla_inline.h
+++ b/drivers/scsi/qla2xxx/qla_inline.h
@@ -631,3 +631,11 @@ static inline int qla_mapq_alloc_qp_cpu_map(struct qla_hw_data *ha)
 	}
 	return 0;
 }
+
+static inline bool val_is_in_range(u32 val, u32 start, u32 end)
+{
+	if (val >= start && val <= end)
+		return true;
+	else
+		return false;
+}
diff --git a/drivers/scsi/qla2xxx/qla_mid.c b/drivers/scsi/qla2xxx/qla_mid.c
index b67416951a5f..76703f2706b8 100644
--- a/drivers/scsi/qla2xxx/qla_mid.c
+++ b/drivers/scsi/qla2xxx/qla_mid.c
@@ -180,7 +180,7 @@ qla24xx_disable_vp(scsi_qla_host_t *vha)
 	atomic_set(&vha->loop_state, LOOP_DOWN);
 	atomic_set(&vha->loop_down_timer, LOOP_DOWN_TIME);
 	list_for_each_entry(fcport, &vha->vp_fcports, list)
-		fcport->logout_on_delete = 0;
+		fcport->logout_on_delete = 1;
 
 	if (!vha->hw->flags.edif_enabled)
 		qla2x00_wait_for_sess_deletion(vha);
diff --git a/drivers/scsi/qla2xxx/qla_nvme.c b/drivers/scsi/qla2xxx/qla_nvme.c
index a8ddf356e662..8f4cc136a9c9 100644
--- a/drivers/scsi/qla2xxx/qla_nvme.c
+++ b/drivers/scsi/qla2xxx/qla_nvme.c
@@ -49,7 +49,10 @@ int qla_nvme_register_remote(struct scsi_qla_host *vha, struct fc_port *fcport)
 		return 0;
 	}
 
-	if (!vha->nvme_local_port && qla_nvme_register_hba(vha))
+	if (qla_nvme_register_hba(vha))
+		return 0;
+
+	if (!vha->nvme_local_port)
 		return 0;
 
 	if (!(fcport->nvme_prli_service_param &
diff --git a/drivers/scsi/qla2xxx/qla_os.c b/drivers/scsi/qla2xxx/qla_os.c
index 63f45d50bf83..da8331dbb01c 100644
--- a/drivers/scsi/qla2xxx/qla_os.c
+++ b/drivers/scsi/qla2xxx/qla_os.c
@@ -1874,14 +1874,9 @@ __qla2x00_abort_all_cmds(struct qla_qpair *qp, int res)
 	for (cnt = 1; cnt < req->num_outstanding_cmds; cnt++) {
 		sp = req->outstanding_cmds[cnt];
 		if (sp) {
-			/*
-			 * perform lockless completion during driver unload
-			 */
 			if (qla2x00_chip_is_down(vha)) {
 				req->outstanding_cmds[cnt] = NULL;
-				spin_unlock_irqrestore(qp->qp_lock_ptr, flags);
 				sp->done(sp, res);
-				spin_lock_irqsave(qp->qp_lock_ptr, flags);
 				continue;
 			}
 
@@ -4688,7 +4683,7 @@ static void
 qla2x00_number_of_exch(scsi_qla_host_t *vha, u32 *ret_cnt, u16 max_cnt)
 {
 	u32 temp;
-	struct init_cb_81xx *icb = (struct init_cb_81xx *)&vha->hw->init_cb;
+	struct init_cb_81xx *icb = (struct init_cb_81xx *)vha->hw->init_cb;
 	*ret_cnt = FW_DEF_EXCHANGES_CNT;
 
 	if (max_cnt > vha->hw->max_exchg)
@@ -5562,15 +5557,11 @@ qla2x00_do_work(struct scsi_qla_host *vha)
 			qla2x00_async_prlo_done(vha, e->u.logio.fcport,
 			    e->u.logio.data);
 			break;
-		case QLA_EVT_GPNFT:
-			qla24xx_async_gpnft(vha, e->u.gpnft.fc4_type,
-			    e->u.gpnft.sp);
-			break;
-		case QLA_EVT_GPNFT_DONE:
-			qla24xx_async_gpnft_done(vha, e->u.iosb.sp);
+		case QLA_EVT_SCAN_CMD:
+			qla_fab_async_scan(vha, e->u.iosb.sp);
 			break;
-		case QLA_EVT_GNNFT_DONE:
-			qla24xx_async_gnnft_done(vha, e->u.iosb.sp);
+		case QLA_EVT_SCAN_FINISH:
+			qla_fab_scan_finish(vha, e->u.iosb.sp);
 			break;
 		case QLA_EVT_GFPNID:
 			qla24xx_async_gfpnid(vha, e->u.fcport.fcport);
diff --git a/drivers/scsi/qla2xxx/qla_sup.c b/drivers/scsi/qla2xxx/qla_sup.c
index c092a6b1ced4..6d16546e1729 100644
--- a/drivers/scsi/qla2xxx/qla_sup.c
+++ b/drivers/scsi/qla2xxx/qla_sup.c
@@ -555,6 +555,7 @@ qla2xxx_find_flt_start(scsi_qla_host_t *vha, uint32_t *start)
 	struct qla_flt_location *fltl = (void *)req->ring;
 	uint32_t *dcode = (uint32_t *)req->ring;
 	uint8_t *buf = (void *)req->ring, *bcode,  last_image;
+	int rc;
 
 	/*
 	 * FLT-location structure resides after the last PCI region.
@@ -584,14 +585,24 @@ qla2xxx_find_flt_start(scsi_qla_host_t *vha, uint32_t *start)
 	pcihdr = 0;
 	do {
 		/* Verify PCI expansion ROM header. */
-		qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20);
+		rc = qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20);
+		if (rc) {
+			ql_log(ql_log_info, vha, 0x016d,
+			    "Unable to read PCI Expansion Rom Header (%x).\n", rc);
+			return QLA_FUNCTION_FAILED;
+		}
 		bcode = buf + (pcihdr % 4);
 		if (bcode[0x0] != 0x55 || bcode[0x1] != 0xaa)
 			goto end;
 
 		/* Locate PCI data structure. */
 		pcids = pcihdr + ((bcode[0x19] << 8) | bcode[0x18]);
-		qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20);
+		rc = qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20);
+		if (rc) {
+			ql_log(ql_log_info, vha, 0x0179,
+			    "Unable to read PCI Data Structure (%x).\n", rc);
+			return QLA_FUNCTION_FAILED;
+		}
 		bcode = buf + (pcihdr % 4);
 
 		/* Validate signature of PCI data structure. */
@@ -606,7 +617,12 @@ qla2xxx_find_flt_start(scsi_qla_host_t *vha, uint32_t *start)
 	} while (!last_image);
 
 	/* Now verify FLT-location structure. */
-	qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, sizeof(*fltl) >> 2);
+	rc = qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, sizeof(*fltl) >> 2);
+	if (rc) {
+		ql_log(ql_log_info, vha, 0x017a,
+		    "Unable to read FLT (%x).\n", rc);
+		return QLA_FUNCTION_FAILED;
+	}
 	if (memcmp(fltl->sig, "QFLT", 4))
 		goto end;
 
@@ -2605,13 +2621,18 @@ qla24xx_read_optrom_data(struct scsi_qla_host *vha, void *buf,
     uint32_t offset, uint32_t length)
 {
 	struct qla_hw_data *ha = vha->hw;
+	int rc;
 
 	/* Suspend HBA. */
 	scsi_block_requests(vha->host);
 	set_bit(MBX_UPDATE_FLASH_ACTIVE, &ha->mbx_cmd_flags);
 
 	/* Go with read. */
-	qla24xx_read_flash_data(vha, buf, offset >> 2, length >> 2);
+	rc = qla24xx_read_flash_data(vha, buf, offset >> 2, length >> 2);
+	if (rc) {
+		ql_log(ql_log_info, vha, 0x01a0,
+		    "Unable to perform optrom read(%x).\n", rc);
+	}
 
 	/* Resume HBA. */
 	clear_bit(MBX_UPDATE_FLASH_ACTIVE, &ha->mbx_cmd_flags);
@@ -3412,7 +3433,7 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
 	struct active_regions active_regions = { };
 
 	if (IS_P3P_TYPE(ha))
-		return ret;
+		return QLA_SUCCESS;
 
 	if (!mbuf)
 		return QLA_FUNCTION_FAILED;
@@ -3432,20 +3453,31 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
 
 	do {
 		/* Verify PCI expansion ROM header. */
-		qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20);
+		ret = qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20);
+		if (ret) {
+			ql_log(ql_log_info, vha, 0x017d,
+			    "Unable to read PCI EXP Rom Header(%x).\n", ret);
+			return QLA_FUNCTION_FAILED;
+		}
+
 		bcode = mbuf + (pcihdr % 4);
 		if (memcmp(bcode, "\x55\xaa", 2)) {
 			/* No signature */
 			ql_log(ql_log_fatal, vha, 0x0059,
 			    "No matching ROM signature.\n");
-			ret = QLA_FUNCTION_FAILED;
-			break;
+			return QLA_FUNCTION_FAILED;
 		}
 
 		/* Locate PCI data structure. */
 		pcids = pcihdr + ((bcode[0x19] << 8) | bcode[0x18]);
 
-		qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20);
+		ret = qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20);
+		if (ret) {
+			ql_log(ql_log_info, vha, 0x018e,
+			    "Unable to read PCI Data Structure (%x).\n", ret);
+			return QLA_FUNCTION_FAILED;
+		}
+
 		bcode = mbuf + (pcihdr % 4);
 
 		/* Validate signature of PCI data structure. */
@@ -3454,8 +3486,7 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
 			ql_log(ql_log_fatal, vha, 0x005a,
 			    "PCI data struct not found pcir_adr=%x.\n", pcids);
 			ql_dump_buffer(ql_dbg_init, vha, 0x0059, dcode, 32);
-			ret = QLA_FUNCTION_FAILED;
-			break;
+			return QLA_FUNCTION_FAILED;
 		}
 
 		/* Read version */
@@ -3507,20 +3538,26 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
 			faddr = ha->flt_region_fw_sec;
 	}
 
-	qla24xx_read_flash_data(vha, dcode, faddr, 8);
-	if (qla24xx_risc_firmware_invalid(dcode)) {
-		ql_log(ql_log_warn, vha, 0x005f,
-		    "Unrecognized fw revision at %x.\n",
-		    ha->flt_region_fw * 4);
-		ql_dump_buffer(ql_dbg_init, vha, 0x005f, dcode, 32);
+	ret = qla24xx_read_flash_data(vha, dcode, faddr, 8);
+	if (ret) {
+		ql_log(ql_log_info, vha, 0x019e,
+		    "Unable to read FW version (%x).\n", ret);
+		return ret;
 	} else {
-		for (i = 0; i < 4; i++)
-			ha->fw_revision[i] =
+		if (qla24xx_risc_firmware_invalid(dcode)) {
+			ql_log(ql_log_warn, vha, 0x005f,
+			    "Unrecognized fw revision at %x.\n",
+			    ha->flt_region_fw * 4);
+			ql_dump_buffer(ql_dbg_init, vha, 0x005f, dcode, 32);
+		} else {
+			for (i = 0; i < 4; i++)
+				ha->fw_revision[i] =
 				be32_to_cpu((__force __be32)dcode[4+i]);
-		ql_dbg(ql_dbg_init, vha, 0x0060,
-		    "Firmware revision (flash) %u.%u.%u (%x).\n",
-		    ha->fw_revision[0], ha->fw_revision[1],
-		    ha->fw_revision[2], ha->fw_revision[3]);
+			ql_dbg(ql_dbg_init, vha, 0x0060,
+			    "Firmware revision (flash) %u.%u.%u (%x).\n",
+			    ha->fw_revision[0], ha->fw_revision[1],
+			    ha->fw_revision[2], ha->fw_revision[3]);
+		}
 	}
 
 	/* Check for golden firmware and get version if available */
@@ -3531,18 +3568,23 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
 
 	memset(ha->gold_fw_version, 0, sizeof(ha->gold_fw_version));
 	faddr = ha->flt_region_gold_fw;
-	qla24xx_read_flash_data(vha, dcode, ha->flt_region_gold_fw, 8);
-	if (qla24xx_risc_firmware_invalid(dcode)) {
-		ql_log(ql_log_warn, vha, 0x0056,
-		    "Unrecognized golden fw at %#x.\n", faddr);
-		ql_dump_buffer(ql_dbg_init, vha, 0x0056, dcode, 32);
+	ret = qla24xx_read_flash_data(vha, dcode, ha->flt_region_gold_fw, 8);
+	if (ret) {
+		ql_log(ql_log_info, vha, 0x019f,
+		    "Unable to read Gold FW version (%x).\n", ret);
 		return ret;
-	}
-
-	for (i = 0; i < 4; i++)
-		ha->gold_fw_version[i] =
-			be32_to_cpu((__force __be32)dcode[4+i]);
+	} else {
+		if (qla24xx_risc_firmware_invalid(dcode)) {
+			ql_log(ql_log_warn, vha, 0x0056,
+			    "Unrecognized golden fw at %#x.\n", faddr);
+			ql_dump_buffer(ql_dbg_init, vha, 0x0056, dcode, 32);
+			return QLA_FUNCTION_FAILED;
+		}
 
+		for (i = 0; i < 4; i++)
+			ha->gold_fw_version[i] =
+			   be32_to_cpu((__force __be32)dcode[4+i]);
+	}
 	return ret;
 }
 
diff --git a/drivers/scsi/sr_ioctl.c b/drivers/scsi/sr_ioctl.c
index a0d2556a27bb..089653018d32 100644
--- a/drivers/scsi/sr_ioctl.c
+++ b/drivers/scsi/sr_ioctl.c
@@ -431,7 +431,7 @@ int sr_select_speed(struct cdrom_device_info *cdi, unsigned long speed)
 	struct packet_command cgc;
 
 	/* avoid exceeding the max speed or overflowing integer bounds */
-	speed = clamp(0, speed, 0xffff / 177);
+	speed = clamp(speed, 0, 0xffff / 177);
 
 	if (speed == 0)
 		speed = 0xffff;	/* set to max */
diff --git a/drivers/soc/qcom/icc-bwmon.c b/drivers/soc/qcom/icc-bwmon.c
index adf2d523f103..59ef8d739e93 100644
--- a/drivers/soc/qcom/icc-bwmon.c
+++ b/drivers/soc/qcom/icc-bwmon.c
@@ -565,7 +565,7 @@ static void bwmon_start(struct icc_bwmon *bwmon)
 	int window;
 
 	/* No need to check for errors, as this must have succeeded before. */
-	dev_pm_opp_find_bw_ceil(bwmon->dev, &bw_low, 0);
+	dev_pm_opp_put(dev_pm_opp_find_bw_ceil(bwmon->dev, &bw_low, 0));
 
 	bwmon_clear_counters(bwmon, true);
 
@@ -772,11 +772,13 @@ static int bwmon_probe(struct platform_device *pdev)
 	opp = dev_pm_opp_find_bw_floor(dev, &bwmon->max_bw_kbps, 0);
 	if (IS_ERR(opp))
 		return dev_err_probe(dev, PTR_ERR(opp), "failed to find max peak bandwidth\n");
+	dev_pm_opp_put(opp);
 
 	bwmon->min_bw_kbps = 0;
 	opp = dev_pm_opp_find_bw_ceil(dev, &bwmon->min_bw_kbps, 0);
 	if (IS_ERR(opp))
 		return dev_err_probe(dev, PTR_ERR(opp), "failed to find min peak bandwidth\n");
+	dev_pm_opp_put(opp);
 
 	bwmon->dev = dev;
 
diff --git a/drivers/soc/qcom/pdr_interface.c b/drivers/soc/qcom/pdr_interface.c
index 0034af927b48..c7cd4daa10b0 100644
--- a/drivers/soc/qcom/pdr_interface.c
+++ b/drivers/soc/qcom/pdr_interface.c
@@ -76,12 +76,12 @@ static int pdr_locator_new_server(struct qmi_handle *qmi,
 					      locator_hdl);
 	struct pdr_service *pds;
 
+	mutex_lock(&pdr->lock);
 	/* Create a local client port for QMI communication */
 	pdr->locator_addr.sq_family = AF_QIPCRTR;
 	pdr->locator_addr.sq_node = svc->node;
 	pdr->locator_addr.sq_port = svc->port;
 
-	mutex_lock(&pdr->lock);
 	pdr->locator_init_complete = true;
 	mutex_unlock(&pdr->lock);
 
@@ -104,10 +104,10 @@ static void pdr_locator_del_server(struct qmi_handle *qmi,
 
 	mutex_lock(&pdr->lock);
 	pdr->locator_init_complete = false;
-	mutex_unlock(&pdr->lock);
 
 	pdr->locator_addr.sq_node = 0;
 	pdr->locator_addr.sq_port = 0;
+	mutex_unlock(&pdr->lock);
 }
 
 static const struct qmi_ops pdr_locator_ops = {
@@ -365,12 +365,14 @@ static int pdr_get_domain_list(struct servreg_get_domain_list_req *req,
 	if (ret < 0)
 		return ret;
 
+	mutex_lock(&pdr->lock);
 	ret = qmi_send_request(&pdr->locator_hdl,
 			       &pdr->locator_addr,
 			       &txn, SERVREG_GET_DOMAIN_LIST_REQ,
 			       SERVREG_GET_DOMAIN_LIST_REQ_MAX_LEN,
 			       servreg_get_domain_list_req_ei,
 			       req);
+	mutex_unlock(&pdr->lock);
 	if (ret < 0) {
 		qmi_txn_cancel(&txn);
 		return ret;
@@ -415,7 +417,7 @@ static int pdr_locate_service(struct pdr_handle *pdr, struct pdr_service *pds)
 		if (ret < 0)
 			goto out;
 
-		for (i = domains_read; i < resp->domain_list_len; i++) {
+		for (i = 0; i < resp->domain_list_len; i++) {
 			entry = &resp->domain_list[i];
 
 			if (strnlen(entry->name, sizeof(entry->name)) == sizeof(entry->name))
diff --git a/drivers/soc/qcom/pmic_glink.c b/drivers/soc/qcom/pmic_glink.c
index 61a359938b6c..71d261ac8aa4 100644
--- a/drivers/soc/qcom/pmic_glink.c
+++ b/drivers/soc/qcom/pmic_glink.c
@@ -376,8 +376,17 @@ static struct platform_driver pmic_glink_driver = {
 
 static int pmic_glink_init(void)
 {
-	platform_driver_register(&pmic_glink_driver);
-	register_rpmsg_driver(&pmic_glink_rpmsg_driver);
+	int ret;
+
+	ret = platform_driver_register(&pmic_glink_driver);
+	if (ret < 0)
+		return ret;
+
+	ret = register_rpmsg_driver(&pmic_glink_rpmsg_driver);
+	if (ret < 0) {
+		platform_driver_unregister(&pmic_glink_driver);
+		return ret;
+	}
 
 	return 0;
 };
diff --git a/drivers/soc/qcom/rpmh-rsc.c b/drivers/soc/qcom/rpmh-rsc.c
index daf64be966fe..dfc2d4e38fa9 100644
--- a/drivers/soc/qcom/rpmh-rsc.c
+++ b/drivers/soc/qcom/rpmh-rsc.c
@@ -646,13 +646,14 @@ int rpmh_rsc_send_data(struct rsc_drv *drv, const struct tcs_request *msg)
 {
 	struct tcs_group *tcs;
 	int tcs_id;
-	unsigned long flags;
+
+	might_sleep();
 
 	tcs = get_tcs_for_msg(drv, msg);
 	if (IS_ERR(tcs))
 		return PTR_ERR(tcs);
 
-	spin_lock_irqsave(&drv->lock, flags);
+	spin_lock_irq(&drv->lock);
 
 	/* Wait forever for a free tcs. It better be there eventually! */
 	wait_event_lock_irq(drv->tcs_wait,
@@ -670,7 +671,7 @@ int rpmh_rsc_send_data(struct rsc_drv *drv, const struct tcs_request *msg)
 		write_tcs_reg_sync(drv, drv->regs[RSC_DRV_CMD_ENABLE], tcs_id, 0);
 		enable_tcs_irq(drv, tcs_id, true);
 	}
-	spin_unlock_irqrestore(&drv->lock, flags);
+	spin_unlock_irq(&drv->lock);
 
 	/*
 	 * These two can be done after the lock is released because:
diff --git a/drivers/soc/qcom/rpmh.c b/drivers/soc/qcom/rpmh.c
index 08e09642d7f5..62dfc7df9354 100644
--- a/drivers/soc/qcom/rpmh.c
+++ b/drivers/soc/qcom/rpmh.c
@@ -183,7 +183,6 @@ static int __rpmh_write(const struct device *dev, enum rpmh_state state,
 	}
 
 	if (state == RPMH_ACTIVE_ONLY_STATE) {
-		WARN_ON(irqs_disabled());
 		ret = rpmh_rsc_send_data(ctrlr_to_drv(ctrlr), &rpm_msg->msg);
 	} else {
 		/* Clean up our call by spoofing tx_done */
diff --git a/drivers/soc/xilinx/xlnx_event_manager.c b/drivers/soc/xilinx/xlnx_event_manager.c
index 042553abe1bf..098a2ecfd5c6 100644
--- a/drivers/soc/xilinx/xlnx_event_manager.c
+++ b/drivers/soc/xilinx/xlnx_event_manager.c
@@ -3,6 +3,7 @@
  * Xilinx Event Management Driver
  *
  *  Copyright (C) 2021 Xilinx, Inc.
+ *  Copyright (C) 2024 Advanced Micro Devices, Inc.
  *
  *  Abhyuday Godhasara <abhyuday.godhasara@...inx.com>
  */
@@ -19,7 +20,7 @@
 #include <linux/platform_device.h>
 #include <linux/slab.h>
 
-static DEFINE_PER_CPU_READ_MOSTLY(int, cpu_number1);
+static DEFINE_PER_CPU_READ_MOSTLY(int, dummy_cpu_number);
 
 static int virq_sgi;
 static int event_manager_availability = -EACCES;
@@ -555,7 +556,6 @@ static void xlnx_disable_percpu_irq(void *data)
 static int xlnx_event_init_sgi(struct platform_device *pdev)
 {
 	int ret = 0;
-	int cpu;
 	/*
 	 * IRQ related structures are used for the following:
 	 * for each SGI interrupt ensure its mapped by GIC IRQ domain
@@ -592,11 +592,8 @@ static int xlnx_event_init_sgi(struct platform_device *pdev)
 	sgi_fwspec.param[0] = sgi_num;
 	virq_sgi = irq_create_fwspec_mapping(&sgi_fwspec);
 
-	cpu = get_cpu();
-	per_cpu(cpu_number1, cpu) = cpu;
 	ret = request_percpu_irq(virq_sgi, xlnx_event_handler, "xlnx_event_mgmt",
-				 &cpu_number1);
-	put_cpu();
+				 &dummy_cpu_number);
 
 	WARN_ON(ret);
 	if (ret) {
@@ -612,16 +609,12 @@ static int xlnx_event_init_sgi(struct platform_device *pdev)
 
 static void xlnx_event_cleanup_sgi(struct platform_device *pdev)
 {
-	int cpu = smp_processor_id();
-
-	per_cpu(cpu_number1, cpu) = cpu;
-
 	cpuhp_remove_state(CPUHP_AP_ONLINE_DYN);
 
 	on_each_cpu(xlnx_disable_percpu_irq, NULL, 1);
 
 	irq_clear_status_flags(virq_sgi, IRQ_PER_CPU);
-	free_percpu_irq(virq_sgi, &cpu_number1);
+	free_percpu_irq(virq_sgi, &dummy_cpu_number);
 	irq_dispose_mapping(virq_sgi);
 }
 
diff --git a/drivers/soc/xilinx/zynqmp_power.c b/drivers/soc/xilinx/zynqmp_power.c
index c2c819701eec..d7c784d77208 100644
--- a/drivers/soc/xilinx/zynqmp_power.c
+++ b/drivers/soc/xilinx/zynqmp_power.c
@@ -188,7 +188,9 @@ static int zynqmp_pm_probe(struct platform_device *pdev)
 	u32 pm_api_version;
 	struct mbox_client *client;
 
-	zynqmp_pm_get_api_version(&pm_api_version);
+	ret = zynqmp_pm_get_api_version(&pm_api_version);
+	if (ret)
+		return ret;
 
 	/* Check PM API version number */
 	if (pm_api_version < ZYNQMP_PM_VERSION)
diff --git a/drivers/spi/atmel-quadspi.c b/drivers/spi/atmel-quadspi.c
index 3d1252566134..4cc4f32ca449 100644
--- a/drivers/spi/atmel-quadspi.c
+++ b/drivers/spi/atmel-quadspi.c
@@ -756,8 +756,15 @@ static int __maybe_unused atmel_qspi_resume(struct device *dev)
 	struct atmel_qspi *aq = spi_controller_get_devdata(ctrl);
 	int ret;
 
-	clk_prepare(aq->pclk);
-	clk_prepare(aq->qspick);
+	ret = clk_prepare(aq->pclk);
+	if (ret)
+		return ret;
+
+	ret = clk_prepare(aq->qspick);
+	if (ret) {
+		clk_unprepare(aq->pclk);
+		return ret;
+	}
 
 	ret = pm_runtime_force_resume(dev);
 	if (ret < 0)
diff --git a/drivers/spi/spi-microchip-core.c b/drivers/spi/spi-microchip-core.c
index b451cd4860ec..aa05127c8696 100644
--- a/drivers/spi/spi-microchip-core.c
+++ b/drivers/spi/spi-microchip-core.c
@@ -21,7 +21,7 @@
 #include <linux/spi/spi.h>
 
 #define MAX_LEN				(0xffff)
-#define MAX_CS				(8)
+#define MAX_CS				(1)
 #define DEFAULT_FRAMESIZE		(8)
 #define FIFO_DEPTH			(32)
 #define CLK_GEN_MODE1_MAX		(255)
@@ -75,6 +75,7 @@
 
 #define REG_CONTROL		(0x00)
 #define REG_FRAME_SIZE		(0x04)
+#define  FRAME_SIZE_MASK	GENMASK(5, 0)
 #define REG_STATUS		(0x08)
 #define REG_INT_CLEAR		(0x0c)
 #define REG_RX_DATA		(0x10)
@@ -89,6 +90,9 @@
 #define REG_RIS			(0x24)
 #define REG_CONTROL2		(0x28)
 #define REG_COMMAND		(0x2c)
+#define  COMMAND_CLRFRAMECNT	BIT(4)
+#define  COMMAND_TXFIFORST		BIT(3)
+#define  COMMAND_RXFIFORST		BIT(2)
 #define REG_PKTSIZE		(0x30)
 #define REG_CMD_SIZE		(0x34)
 #define REG_HWSTATUS		(0x38)
@@ -103,6 +107,7 @@ struct mchp_corespi {
 	u8 *rx_buf;
 	u32 clk_gen; /* divider for spi output clock generated by the controller */
 	u32 clk_mode;
+	u32 pending_slave_select;
 	int irq;
 	int tx_len;
 	int rx_len;
@@ -148,62 +153,59 @@ static inline void mchp_corespi_read_fifo(struct mchp_corespi *spi)
 
 static void mchp_corespi_enable_ints(struct mchp_corespi *spi)
 {
-	u32 control, mask = INT_ENABLE_MASK;
-
-	mchp_corespi_disable(spi);
-
-	control = mchp_corespi_read(spi, REG_CONTROL);
-
-	control |= mask;
-	mchp_corespi_write(spi, REG_CONTROL, control);
+	u32 control = mchp_corespi_read(spi, REG_CONTROL);
 
-	control |= CONTROL_ENABLE;
+	control |= INT_ENABLE_MASK;
 	mchp_corespi_write(spi, REG_CONTROL, control);
 }
 
 static void mchp_corespi_disable_ints(struct mchp_corespi *spi)
 {
-	u32 control, mask = INT_ENABLE_MASK;
-
-	mchp_corespi_disable(spi);
-
-	control = mchp_corespi_read(spi, REG_CONTROL);
-	control &= ~mask;
-	mchp_corespi_write(spi, REG_CONTROL, control);
+	u32 control = mchp_corespi_read(spi, REG_CONTROL);
 
-	control |= CONTROL_ENABLE;
+	control &= ~INT_ENABLE_MASK;
 	mchp_corespi_write(spi, REG_CONTROL, control);
 }
 
 static inline void mchp_corespi_set_xfer_size(struct mchp_corespi *spi, int len)
 {
 	u32 control;
-	u16 lenpart;
+	u32 lenpart;
+	u32 frames = mchp_corespi_read(spi, REG_FRAMESUP);
 
 	/*
-	 * Disable the SPI controller. Writes to transfer length have
-	 * no effect when the controller is enabled.
+	 * Writing to FRAMECNT in REG_CONTROL will reset the frame count, taking
+	 * a shortcut requires an explicit clear.
 	 */
-	mchp_corespi_disable(spi);
+	if (frames == len) {
+		mchp_corespi_write(spi, REG_COMMAND, COMMAND_CLRFRAMECNT);
+		return;
+	}
 
 	/*
 	 * The lower 16 bits of the frame count are stored in the control reg
 	 * for legacy reasons, but the upper 16 written to a different register:
 	 * FRAMESUP. While both the upper and lower bits can be *READ* from the
-	 * FRAMESUP register, writing to the lower 16 bits is a NOP
+	 * FRAMESUP register, writing to the lower 16 bits is (supposedly) a NOP.
+	 *
+	 * The driver used to disable the controller while modifying the frame
+	 * count, and mask off the lower 16 bits of len while writing to
+	 * FRAMES_UP. When the driver was changed to disable the controller as
+	 * infrequently as possible, it was discovered that the logic of
+	 * lenpart = len & 0xffff_0000
+	 * write(REG_FRAMESUP, lenpart)
+	 * would actually write zeros into the lower 16 bits on an mpfs250t-es,
+	 * despite documentation stating these bits were read-only.
+	 * Writing len unmasked into FRAMES_UP ensures those bits aren't zeroed
+	 * on an mpfs250t-es and will be a NOP for the lower 16 bits on hardware
+	 * that matches the documentation.
 	 */
 	lenpart = len & 0xffff;
-
 	control = mchp_corespi_read(spi, REG_CONTROL);
 	control &= ~CONTROL_FRAMECNT_MASK;
 	control |= lenpart << CONTROL_FRAMECNT_SHIFT;
 	mchp_corespi_write(spi, REG_CONTROL, control);
-
-	lenpart = len & 0xffff0000;
-	mchp_corespi_write(spi, REG_FRAMESUP, lenpart);
-
-	control |= CONTROL_ENABLE;
-	mchp_corespi_write(spi, REG_CONTROL, control);
+	mchp_corespi_write(spi, REG_FRAMESUP, len);
 }
 
 static inline void mchp_corespi_write_fifo(struct mchp_corespi *spi)
@@ -226,17 +228,22 @@ static inline void mchp_corespi_write_fifo(struct mchp_corespi *spi)
 
 static inline void mchp_corespi_set_framesize(struct mchp_corespi *spi, int bt)
 {
+	u32 frame_size = mchp_corespi_read(spi, REG_FRAME_SIZE);
 	u32 control;
 
+	if ((frame_size & FRAME_SIZE_MASK) == bt)
+		return;
+
 	/*
 	 * Disable the SPI controller. Writes to the frame size have
 	 * no effect when the controller is enabled.
 	 */
-	mchp_corespi_disable(spi);
+	control = mchp_corespi_read(spi, REG_CONTROL);
+	control &= ~CONTROL_ENABLE;
+	mchp_corespi_write(spi, REG_CONTROL, control);
 
 	mchp_corespi_write(spi, REG_FRAME_SIZE, bt);
 
-	control = mchp_corespi_read(spi, REG_CONTROL);
 	control |= CONTROL_ENABLE;
 	mchp_corespi_write(spi, REG_CONTROL, control);
 }
@@ -244,49 +251,56 @@ static inline void mchp_corespi_set_framesize(struct mchp_corespi *spi, int bt)
 static void mchp_corespi_set_cs(struct spi_device *spi, bool disable)
 {
 	u32 reg;
-	struct mchp_corespi *corespi = spi_master_get_devdata(spi->master);
+	struct mchp_corespi *corespi = spi_controller_get_devdata(spi->controller);
 
 	reg = mchp_corespi_read(corespi, REG_SLAVE_SELECT);
 	reg &= ~BIT(spi_get_chipselect(spi, 0));
 	reg |= !disable << spi_get_chipselect(spi, 0);
+	corespi->pending_slave_select = reg;
 
-	mchp_corespi_write(corespi, REG_SLAVE_SELECT, reg);
+	/*
+	 * Only deassert chip select immediately. Writing to some registers
+	 * requires the controller to be disabled, which results in the
+	 * output pins being tristated and can cause the SCLK and MOSI lines
+	 * to transition. Therefore asserting the chip select is deferred
+	 * until just before writing to the TX FIFO, to ensure the device
+	 * doesn't see any spurious clock transitions whilst CS is enabled.
+	 */
+	if (((spi->mode & SPI_CS_HIGH) == 0) == disable)
+		mchp_corespi_write(corespi, REG_SLAVE_SELECT, reg);
 }
 
 static int mchp_corespi_setup(struct spi_device *spi)
 {
-	struct mchp_corespi *corespi = spi_master_get_devdata(spi->master);
+	struct mchp_corespi *corespi = spi_controller_get_devdata(spi->controller);
 	u32 reg;
 
 	/*
-	 * Active high slaves need to be specifically set to their inactive
+	 * Active high targets need to be specifically set to their inactive
 	 * states during probe by adding them to the "control group" & thus
 	 * driving their select line low.
 	 */
 	if (spi->mode & SPI_CS_HIGH) {
 		reg = mchp_corespi_read(corespi, REG_SLAVE_SELECT);
 		reg |= BIT(spi_get_chipselect(spi, 0));
+		corespi->pending_slave_select = reg;
 		mchp_corespi_write(corespi, REG_SLAVE_SELECT, reg);
 	}
 	return 0;
 }
 
-static void mchp_corespi_init(struct spi_master *master, struct mchp_corespi *spi)
+static void mchp_corespi_init(struct spi_controller *host, struct mchp_corespi *spi)
 {
 	unsigned long clk_hz;
 	u32 control = mchp_corespi_read(spi, REG_CONTROL);
 
-	control |= CONTROL_MASTER;
+	control &= ~CONTROL_ENABLE;
+	mchp_corespi_write(spi, REG_CONTROL, control);
 
+	control |= CONTROL_MASTER;
 	control &= ~CONTROL_MODE_MASK;
 	control |= MOTOROLA_MODE;
 
-	mchp_corespi_set_framesize(spi, DEFAULT_FRAMESIZE);
-
-	/* max. possible spi clock rate is the apb clock rate */
-	clk_hz = clk_get_rate(spi->clk);
-	master->max_speed_hz = clk_hz;
-
 	/*
 	 * The controller must be configured so that it doesn't remove Chip
 	 * Select until the entire message has been transferred, even if at
@@ -295,19 +309,25 @@ static void mchp_corespi_init(struct spi_master *master, struct mchp_corespi *sp
 	 * BIGFIFO mode is also enabled, which sets the fifo depth to 32 frames
 	 * for the 8 bit transfers that this driver uses.
 	 */
-	control = mchp_corespi_read(spi, REG_CONTROL);
 	control |= CONTROL_SPS | CONTROL_BIGFIFO;
 
 	mchp_corespi_write(spi, REG_CONTROL, control);
 
+	mchp_corespi_set_framesize(spi, DEFAULT_FRAMESIZE);
+
+	/* max. possible spi clock rate is the apb clock rate */
+	clk_hz = clk_get_rate(spi->clk);
+	host->max_speed_hz = clk_hz;
+
 	mchp_corespi_enable_ints(spi);
 
 	/*
 	 * It is required to enable direct mode, otherwise control over the chip
 	 * select is relinquished to the hardware. SSELOUT is enabled too so we
-	 * can deal with active high slaves.
+	 * can deal with active high targets.
 	 */
-	mchp_corespi_write(spi, REG_SLAVE_SELECT, SSELOUT | SSEL_DIRECT);
+	spi->pending_slave_select = SSELOUT | SSEL_DIRECT;
+	mchp_corespi_write(spi, REG_SLAVE_SELECT, spi->pending_slave_select);
 
 	control = mchp_corespi_read(spi, REG_CONTROL);
 
@@ -321,8 +341,6 @@ static inline void mchp_corespi_set_clk_gen(struct mchp_corespi *spi)
 {
 	u32 control;
 
-	mchp_corespi_disable(spi);
-
 	control = mchp_corespi_read(spi, REG_CONTROL);
 	if (spi->clk_mode)
 		control |= CONTROL_CLKMODE;
@@ -331,12 +349,12 @@ static inline void mchp_corespi_set_clk_gen(struct mchp_corespi *spi)
 
 	mchp_corespi_write(spi, REG_CLK_GEN, spi->clk_gen);
 	mchp_corespi_write(spi, REG_CONTROL, control);
-	mchp_corespi_write(spi, REG_CONTROL, control | CONTROL_ENABLE);
 }
 
 static inline void mchp_corespi_set_mode(struct mchp_corespi *spi, unsigned int mode)
 {
-	u32 control, mode_val;
+	u32 mode_val;
+	u32 control = mchp_corespi_read(spi, REG_CONTROL);
 
 	switch (mode & SPI_MODE_X_MASK) {
 	case SPI_MODE_0:
@@ -354,12 +372,13 @@ static inline void mchp_corespi_set_mode(struct mchp_corespi *spi, unsigned int
 	}
 
 	/*
-	 * Disable the SPI controller. Writes to the frame size have
+	 * Disable the SPI controller. Writes to the frame protocol have
 	 * no effect when the controller is enabled.
 	 */
-	mchp_corespi_disable(spi);
 
-	control = mchp_corespi_read(spi, REG_CONTROL);
+	control &= ~CONTROL_ENABLE;
+	mchp_corespi_write(spi, REG_CONTROL, control);
+
 	control &= ~(SPI_MODE_X_MASK << MODE_X_MASK_SHIFT);
 	control |= mode_val;
 
@@ -371,8 +390,8 @@ static inline void mchp_corespi_set_mode(struct mchp_corespi *spi, unsigned int
 
 static irqreturn_t mchp_corespi_interrupt(int irq, void *dev_id)
 {
-	struct spi_master *master = dev_id;
-	struct mchp_corespi *spi = spi_master_get_devdata(master);
+	struct spi_controller *host = dev_id;
+	struct mchp_corespi *spi = spi_controller_get_devdata(host);
 	u32 intfield = mchp_corespi_read(spi, REG_MIS) & 0xf;
 	bool finalise = false;
 
@@ -380,26 +399,23 @@ static irqreturn_t mchp_corespi_interrupt(int irq, void *dev_id)
 	if (intfield == 0)
 		return IRQ_NONE;
 
-	if (intfield & INT_TXDONE) {
+	if (intfield & INT_TXDONE)
 		mchp_corespi_write(spi, REG_INT_CLEAR, INT_TXDONE);
 
+	if (intfield & INT_RXRDY) {
+		mchp_corespi_write(spi, REG_INT_CLEAR, INT_RXRDY);
+
 		if (spi->rx_len)
 			mchp_corespi_read_fifo(spi);
-
-		if (spi->tx_len)
-			mchp_corespi_write_fifo(spi);
-
-		if (!spi->rx_len)
-			finalise = true;
 	}
 
-	if (intfield & INT_RXRDY)
-		mchp_corespi_write(spi, REG_INT_CLEAR, INT_RXRDY);
+	if (!spi->rx_len && !spi->tx_len)
+		finalise = true;
 
 	if (intfield & INT_RX_CHANNEL_OVERFLOW) {
 		mchp_corespi_write(spi, REG_INT_CLEAR, INT_RX_CHANNEL_OVERFLOW);
 		finalise = true;
-		dev_err(&master->dev,
+		dev_err(&host->dev,
 			"%s: RX OVERFLOW: rxlen: %d, txlen: %d\n", __func__,
 			spi->rx_len, spi->tx_len);
 	}
@@ -407,13 +423,13 @@ static irqreturn_t mchp_corespi_interrupt(int irq, void *dev_id)
 	if (intfield & INT_TX_CHANNEL_UNDERRUN) {
 		mchp_corespi_write(spi, REG_INT_CLEAR, INT_TX_CHANNEL_UNDERRUN);
 		finalise = true;
-		dev_err(&master->dev,
+		dev_err(&host->dev,
 			"%s: TX UNDERFLOW: rxlen: %d, txlen: %d\n", __func__,
 			spi->rx_len, spi->tx_len);
 	}
 
 	if (finalise)
-		spi_finalize_current_transfer(master);
+		spi_finalize_current_transfer(host);
 
 	return IRQ_HANDLED;
 }
@@ -455,16 +471,16 @@ static int mchp_corespi_calculate_clkgen(struct mchp_corespi *spi,
 	return 0;
 }
 
-static int mchp_corespi_transfer_one(struct spi_master *master,
+static int mchp_corespi_transfer_one(struct spi_controller *host,
 				     struct spi_device *spi_dev,
 				     struct spi_transfer *xfer)
 {
-	struct mchp_corespi *spi = spi_master_get_devdata(master);
+	struct mchp_corespi *spi = spi_controller_get_devdata(host);
 	int ret;
 
 	ret = mchp_corespi_calculate_clkgen(spi, (unsigned long)xfer->speed_hz);
 	if (ret) {
-		dev_err(&master->dev, "failed to set clk_gen for target %u Hz\n", xfer->speed_hz);
+		dev_err(&host->dev, "failed to set clk_gen for target %u Hz\n", xfer->speed_hz);
 		return ret;
 	}
 
@@ -479,16 +495,21 @@ static int mchp_corespi_transfer_one(struct spi_master *master,
 	mchp_corespi_set_xfer_size(spi, (spi->tx_len > FIFO_DEPTH)
 				   ? FIFO_DEPTH : spi->tx_len);
 
-	if (spi->tx_len)
+	mchp_corespi_write(spi, REG_COMMAND, COMMAND_RXFIFORST | COMMAND_TXFIFORST);
+
+	mchp_corespi_write(spi, REG_SLAVE_SELECT, spi->pending_slave_select);
+
+	while (spi->tx_len)
 		mchp_corespi_write_fifo(spi);
+
 	return 1;
 }
 
-static int mchp_corespi_prepare_message(struct spi_master *master,
+static int mchp_corespi_prepare_message(struct spi_controller *host,
 					struct spi_message *msg)
 {
 	struct spi_device *spi_dev = msg->spi;
-	struct mchp_corespi *spi = spi_master_get_devdata(master);
+	struct mchp_corespi *spi = spi_controller_get_devdata(host);
 
 	mchp_corespi_set_framesize(spi, DEFAULT_FRAMESIZE);
 	mchp_corespi_set_mode(spi, spi_dev->mode);
@@ -498,32 +519,32 @@ static int mchp_corespi_prepare_message(struct spi_master *master,
 
 static int mchp_corespi_probe(struct platform_device *pdev)
 {
-	struct spi_master *master;
+	struct spi_controller *host;
 	struct mchp_corespi *spi;
 	struct resource *res;
 	u32 num_cs;
 	int ret = 0;
 
-	master = devm_spi_alloc_master(&pdev->dev, sizeof(*spi));
-	if (!master)
+	host = devm_spi_alloc_host(&pdev->dev, sizeof(*spi));
+	if (!host)
 		return dev_err_probe(&pdev->dev, -ENOMEM,
-				     "unable to allocate master for SPI controller\n");
+				     "unable to allocate host for SPI controller\n");
 
-	platform_set_drvdata(pdev, master);
+	platform_set_drvdata(pdev, host);
 
 	if (of_property_read_u32(pdev->dev.of_node, "num-cs", &num_cs))
 		num_cs = MAX_CS;
 
-	master->num_chipselect = num_cs;
-	master->mode_bits = SPI_CPOL | SPI_CPHA | SPI_CS_HIGH;
-	master->setup = mchp_corespi_setup;
-	master->bits_per_word_mask = SPI_BPW_MASK(8);
-	master->transfer_one = mchp_corespi_transfer_one;
-	master->prepare_message = mchp_corespi_prepare_message;
-	master->set_cs = mchp_corespi_set_cs;
-	master->dev.of_node = pdev->dev.of_node;
+	host->num_chipselect = num_cs;
+	host->mode_bits = SPI_CPOL | SPI_CPHA | SPI_CS_HIGH;
+	host->setup = mchp_corespi_setup;
+	host->bits_per_word_mask = SPI_BPW_MASK(8);
+	host->transfer_one = mchp_corespi_transfer_one;
+	host->prepare_message = mchp_corespi_prepare_message;
+	host->set_cs = mchp_corespi_set_cs;
+	host->dev.of_node = pdev->dev.of_node;
 
-	spi = spi_master_get_devdata(master);
+	spi = spi_controller_get_devdata(host);
 
 	spi->regs = devm_platform_get_and_ioremap_resource(pdev, 0, &res);
 	if (IS_ERR(spi->regs))
@@ -534,7 +555,7 @@ static int mchp_corespi_probe(struct platform_device *pdev)
 		return spi->irq;
 
 	ret = devm_request_irq(&pdev->dev, spi->irq, mchp_corespi_interrupt,
-			       IRQF_SHARED, dev_name(&pdev->dev), master);
+			       IRQF_SHARED, dev_name(&pdev->dev), host);
 	if (ret)
 		return dev_err_probe(&pdev->dev, ret,
 				     "could not request irq\n");
@@ -549,25 +570,25 @@ static int mchp_corespi_probe(struct platform_device *pdev)
 		return dev_err_probe(&pdev->dev, ret,
 				     "failed to enable clock\n");
 
-	mchp_corespi_init(master, spi);
+	mchp_corespi_init(host, spi);
 
-	ret = devm_spi_register_master(&pdev->dev, master);
+	ret = devm_spi_register_controller(&pdev->dev, host);
 	if (ret) {
 		mchp_corespi_disable(spi);
 		clk_disable_unprepare(spi->clk);
 		return dev_err_probe(&pdev->dev, ret,
-				     "unable to register master for SPI controller\n");
+				     "unable to register host for SPI controller\n");
 	}
 
-	dev_info(&pdev->dev, "Registered SPI controller %d\n", master->bus_num);
+	dev_info(&pdev->dev, "Registered SPI controller %d\n", host->bus_num);
 
 	return 0;
 }
 
 static void mchp_corespi_remove(struct platform_device *pdev)
 {
-	struct spi_master *master  = platform_get_drvdata(pdev);
-	struct mchp_corespi *spi = spi_master_get_devdata(master);
+	struct spi_controller *host  = platform_get_drvdata(pdev);
+	struct mchp_corespi *spi = spi_controller_get_devdata(host);
 
 	mchp_corespi_disable_ints(spi);
 	clk_disable_unprepare(spi->clk);
diff --git a/drivers/spi/spidev.c b/drivers/spi/spidev.c
index d13dc15cc191..1a8dd1001244 100644
--- a/drivers/spi/spidev.c
+++ b/drivers/spi/spidev.c
@@ -738,6 +738,7 @@ static const struct of_device_id spidev_dt_ids[] = {
 	{ .compatible = "lwn,bk4", .data = &spidev_of_check },
 	{ .compatible = "menlo,m53cpld", .data = &spidev_of_check },
 	{ .compatible = "micron,spi-authenta", .data = &spidev_of_check },
+	{ .compatible = "rohm,bh2228fv", .data = &spidev_of_check },
 	{ .compatible = "rohm,dh2228fv", .data = &spidev_of_check },
 	{ .compatible = "semtech,sx1301", .data = &spidev_of_check },
 	{ .compatible = "silabs,em3581", .data = &spidev_of_check },
diff --git a/drivers/ufs/core/ufs-mcq.c b/drivers/ufs/core/ufs-mcq.c
index a10fc7a69710..af5ce45315b3 100644
--- a/drivers/ufs/core/ufs-mcq.c
+++ b/drivers/ufs/core/ufs-mcq.c
@@ -230,8 +230,6 @@ int ufshcd_mcq_memory_alloc(struct ufs_hba *hba)
 
 /* Operation and runtime registers configuration */
 #define MCQ_CFG_n(r, i)	((r) + MCQ_QCFG_SIZE * (i))
-#define MCQ_OPR_OFFSET_n(p, i) \
-	(hba->mcq_opr[(p)].offset + hba->mcq_opr[(p)].stride * (i))
 
 static void __iomem *mcq_opr_base(struct ufs_hba *hba,
 					 enum ufshcd_mcq_opr n, int i)
@@ -344,10 +342,10 @@ void ufshcd_mcq_make_queues_operational(struct ufs_hba *hba)
 		ufsmcq_writelx(hba, upper_32_bits(hwq->sqe_dma_addr),
 			      MCQ_CFG_n(REG_SQUBA, i));
 		/* Submission Queue Doorbell Address Offset */
-		ufsmcq_writelx(hba, MCQ_OPR_OFFSET_n(OPR_SQD, i),
+		ufsmcq_writelx(hba, ufshcd_mcq_opr_offset(hba, OPR_SQD, i),
 			      MCQ_CFG_n(REG_SQDAO, i));
 		/* Submission Queue Interrupt Status Address Offset */
-		ufsmcq_writelx(hba, MCQ_OPR_OFFSET_n(OPR_SQIS, i),
+		ufsmcq_writelx(hba, ufshcd_mcq_opr_offset(hba, OPR_SQIS, i),
 			      MCQ_CFG_n(REG_SQISAO, i));
 
 		/* Completion Queue Lower Base Address */
@@ -357,10 +355,10 @@ void ufshcd_mcq_make_queues_operational(struct ufs_hba *hba)
 		ufsmcq_writelx(hba, upper_32_bits(hwq->cqe_dma_addr),
 			      MCQ_CFG_n(REG_CQUBA, i));
 		/* Completion Queue Doorbell Address Offset */
-		ufsmcq_writelx(hba, MCQ_OPR_OFFSET_n(OPR_CQD, i),
+		ufsmcq_writelx(hba, ufshcd_mcq_opr_offset(hba, OPR_CQD, i),
 			      MCQ_CFG_n(REG_CQDAO, i));
 		/* Completion Queue Interrupt Status Address Offset */
-		ufsmcq_writelx(hba, MCQ_OPR_OFFSET_n(OPR_CQIS, i),
+		ufsmcq_writelx(hba, ufshcd_mcq_opr_offset(hba, OPR_CQIS, i),
 			      MCQ_CFG_n(REG_CQISAO, i));
 
 		/* Save the base addresses for quicker access */
diff --git a/drivers/usb/typec/mux/nb7vpq904m.c b/drivers/usb/typec/mux/nb7vpq904m.c
index cda206cf0c38..596639dad31d 100644
--- a/drivers/usb/typec/mux/nb7vpq904m.c
+++ b/drivers/usb/typec/mux/nb7vpq904m.c
@@ -453,7 +453,7 @@ static int nb7vpq904m_probe(struct i2c_client *client)
 
 	ret = nb7vpq904m_parse_data_lanes_mapping(nb7);
 	if (ret)
-		return ret;
+		goto err_switch_put;
 
 	ret = regulator_enable(nb7->vcc_supply);
 	if (ret)
@@ -496,6 +496,9 @@ static int nb7vpq904m_probe(struct i2c_client *client)
 	gpiod_set_value(nb7->enable_gpio, 0);
 	regulator_disable(nb7->vcc_supply);
 
+err_switch_put:
+	typec_switch_put(nb7->typec_switch);
+
 	return ret;
 }
 
@@ -509,6 +512,8 @@ static void nb7vpq904m_remove(struct i2c_client *client)
 	gpiod_set_value(nb7->enable_gpio, 0);
 
 	regulator_disable(nb7->vcc_supply);
+
+	typec_switch_put(nb7->typec_switch);
 }
 
 static const struct i2c_device_id nb7vpq904m_table[] = {
diff --git a/drivers/vhost/vsock.c b/drivers/vhost/vsock.c
index 61255855d490..d94a06008ff6 100644
--- a/drivers/vhost/vsock.c
+++ b/drivers/vhost/vsock.c
@@ -656,6 +656,7 @@ static int vhost_vsock_dev_open(struct inode *inode, struct file *file)
 	}
 
 	vsock->guest_cid = 0; /* no CID assigned yet */
+	vsock->seqpacket_allow = false;
 
 	atomic_set(&vsock->queued_replies, 0);
 
@@ -799,8 +800,7 @@ static int vhost_vsock_set_features(struct vhost_vsock *vsock, u64 features)
 			goto err;
 	}
 
-	if (features & (1ULL << VIRTIO_VSOCK_F_SEQPACKET))
-		vsock->seqpacket_allow = true;
+	vsock->seqpacket_allow = features & (1ULL << VIRTIO_VSOCK_F_SEQPACKET);
 
 	for (i = 0; i < ARRAY_SIZE(vsock->vqs); i++) {
 		vq = &vsock->vqs[i];
diff --git a/drivers/video/logo/pnmtologo.c b/drivers/video/logo/pnmtologo.c
index ada5ef6e51b7..87912cc35e92 100644
--- a/drivers/video/logo/pnmtologo.c
+++ b/drivers/video/logo/pnmtologo.c
@@ -235,8 +235,6 @@ static void write_header(void)
 	fputs("/*\n", out);
 	fputs(" *  DO NOT EDIT THIS FILE!\n", out);
 	fputs(" *\n", out);
-	fprintf(out, " *  It was automatically generated from %s\n", filename);
-	fputs(" *\n", out);
 	fprintf(out, " *  Linux logo %s\n", logoname);
 	fputs(" */\n\n", out);
 	fputs("#include <linux/linux_logo.h>\n\n", out);
diff --git a/drivers/watchdog/rzg2l_wdt.c b/drivers/watchdog/rzg2l_wdt.c
index 1741f98ca67c..7bce093316c4 100644
--- a/drivers/watchdog/rzg2l_wdt.c
+++ b/drivers/watchdog/rzg2l_wdt.c
@@ -123,8 +123,11 @@ static void rzg2l_wdt_init_timeout(struct watchdog_device *wdev)
 static int rzg2l_wdt_start(struct watchdog_device *wdev)
 {
 	struct rzg2l_wdt_priv *priv = watchdog_get_drvdata(wdev);
+	int ret;
 
-	pm_runtime_get_sync(wdev->parent);
+	ret = pm_runtime_resume_and_get(wdev->parent);
+	if (ret)
+		return ret;
 
 	/* Initialize time out */
 	rzg2l_wdt_init_timeout(wdev);
@@ -141,15 +144,21 @@ static int rzg2l_wdt_start(struct watchdog_device *wdev)
 static int rzg2l_wdt_stop(struct watchdog_device *wdev)
 {
 	struct rzg2l_wdt_priv *priv = watchdog_get_drvdata(wdev);
+	int ret;
 
 	rzg2l_wdt_reset(priv);
-	pm_runtime_put(wdev->parent);
+
+	ret = pm_runtime_put(wdev->parent);
+	if (ret < 0)
+		return ret;
 
 	return 0;
 }
 
 static int rzg2l_wdt_set_timeout(struct watchdog_device *wdev, unsigned int timeout)
 {
+	int ret = 0;
+
 	wdev->timeout = timeout;
 
 	/*
@@ -158,11 +167,14 @@ static int rzg2l_wdt_set_timeout(struct watchdog_device *wdev, unsigned int time
 	 * to reset the module) so that it is updated with new timeout values.
 	 */
 	if (watchdog_active(wdev)) {
-		rzg2l_wdt_stop(wdev);
-		rzg2l_wdt_start(wdev);
+		ret = rzg2l_wdt_stop(wdev);
+		if (ret)
+			return ret;
+
+		ret = rzg2l_wdt_start(wdev);
 	}
 
-	return 0;
+	return ret;
 }
 
 static int rzg2l_wdt_restart(struct watchdog_device *wdev,
diff --git a/fs/btrfs/compression.c b/fs/btrfs/compression.c
index 8818ed5c390f..a815ce9cfb51 100644
--- a/fs/btrfs/compression.c
+++ b/fs/btrfs/compression.c
@@ -420,6 +420,7 @@ static noinline int add_ra_bio_pages(struct inode *inode,
 			put_page(page);
 			break;
 		}
+		add_size = min(em->start + em->len, page_end + 1) - cur;
 		free_extent_map(em);
 
 		if (page->index == end_index) {
@@ -432,7 +433,6 @@ static noinline int add_ra_bio_pages(struct inode *inode,
 			}
 		}
 
-		add_size = min(em->start + em->len, page_end + 1) - cur;
 		ret = bio_add_page(orig_bio, page, add_size, offset_in_page(cur));
 		if (ret != add_size) {
 			unlock_extent(tree, cur, page_end, NULL);
diff --git a/fs/ceph/super.c b/fs/ceph/super.c
index 52af90beab00..ec51e398562c 100644
--- a/fs/ceph/super.c
+++ b/fs/ceph/super.c
@@ -958,7 +958,8 @@ static int __init init_caches(void)
 	if (!ceph_mds_request_cachep)
 		goto bad_mds_req;
 
-	ceph_wb_pagevec_pool = mempool_create_kmalloc_pool(10, CEPH_MAX_WRITE_SIZE >> PAGE_SHIFT);
+	ceph_wb_pagevec_pool = mempool_create_kmalloc_pool(10,
+	    (CEPH_MAX_WRITE_SIZE >> PAGE_SHIFT) * sizeof(struct page *));
 	if (!ceph_wb_pagevec_pool)
 		goto bad_pagevec_pool;
 
diff --git a/fs/exfat/dir.c b/fs/exfat/dir.c
index e1586bba6d86..7a715016b96f 100644
--- a/fs/exfat/dir.c
+++ b/fs/exfat/dir.c
@@ -890,7 +890,7 @@ int exfat_get_dentry_set(struct exfat_entry_set_cache *es,
 
 	num_bh = EXFAT_B_TO_BLK_ROUND_UP(off + num_entries * DENTRY_SIZE, sb);
 	if (num_bh > ARRAY_SIZE(es->__bh)) {
-		es->bh = kmalloc_array(num_bh, sizeof(*es->bh), GFP_KERNEL);
+		es->bh = kmalloc_array(num_bh, sizeof(*es->bh), GFP_NOFS);
 		if (!es->bh) {
 			brelse(bh);
 			return -ENOMEM;
diff --git a/fs/ext2/balloc.c b/fs/ext2/balloc.c
index e124f3d709b2..f2052723821a 100644
--- a/fs/ext2/balloc.c
+++ b/fs/ext2/balloc.c
@@ -77,26 +77,33 @@ static int ext2_valid_block_bitmap(struct super_block *sb,
 	ext2_grpblk_t next_zero_bit;
 	ext2_fsblk_t bitmap_blk;
 	ext2_fsblk_t group_first_block;
+	ext2_grpblk_t max_bit;
 
 	group_first_block = ext2_group_first_block_no(sb, block_group);
+	max_bit = ext2_group_last_block_no(sb, block_group) - group_first_block;
 
 	/* check whether block bitmap block number is set */
 	bitmap_blk = le32_to_cpu(desc->bg_block_bitmap);
 	offset = bitmap_blk - group_first_block;
-	if (!ext2_test_bit(offset, bh->b_data))
+	if (offset < 0 || offset > max_bit ||
+	    !ext2_test_bit(offset, bh->b_data))
 		/* bad block bitmap */
 		goto err_out;
 
 	/* check whether the inode bitmap block number is set */
 	bitmap_blk = le32_to_cpu(desc->bg_inode_bitmap);
 	offset = bitmap_blk - group_first_block;
-	if (!ext2_test_bit(offset, bh->b_data))
+	if (offset < 0 || offset > max_bit ||
+	    !ext2_test_bit(offset, bh->b_data))
 		/* bad block bitmap */
 		goto err_out;
 
 	/* check whether the inode table block number is set */
 	bitmap_blk = le32_to_cpu(desc->bg_inode_table);
 	offset = bitmap_blk - group_first_block;
+	if (offset < 0 || offset > max_bit ||
+	    offset + EXT2_SB(sb)->s_itb_per_group - 1 > max_bit)
+		goto err_out;
 	next_zero_bit = ext2_find_next_zero_bit(bh->b_data,
 				offset + EXT2_SB(sb)->s_itb_per_group,
 				offset);
diff --git a/fs/ext4/extents_status.c b/fs/ext4/extents_status.c
index f4b50652f0cc..d9d5cfb9c951 100644
--- a/fs/ext4/extents_status.c
+++ b/fs/ext4/extents_status.c
@@ -310,6 +310,8 @@ void ext4_es_find_extent_range(struct inode *inode,
 			       ext4_lblk_t lblk, ext4_lblk_t end,
 			       struct extent_status *es)
 {
+	es->es_lblk = es->es_len = es->es_pblk = 0;
+
 	if (EXT4_SB(inode->i_sb)->s_mount_state & EXT4_FC_REPLAY)
 		return;
 
diff --git a/fs/ext4/fast_commit.c b/fs/ext4/fast_commit.c
index b06de728b3b6..5d473e50598f 100644
--- a/fs/ext4/fast_commit.c
+++ b/fs/ext4/fast_commit.c
@@ -649,6 +649,12 @@ void ext4_fc_track_range(handle_t *handle, struct inode *inode, ext4_lblk_t star
 	if (ext4_test_mount_flag(inode->i_sb, EXT4_MF_FC_INELIGIBLE))
 		return;
 
+	if (ext4_has_inline_data(inode)) {
+		ext4_fc_mark_ineligible(inode->i_sb, EXT4_FC_REASON_XATTR,
+					handle);
+		return;
+	}
+
 	args.start = start;
 	args.end = end;
 
diff --git a/fs/ext4/namei.c b/fs/ext4/namei.c
index a2ee882e5ebb..3bd2301cb48e 100644
--- a/fs/ext4/namei.c
+++ b/fs/ext4/namei.c
@@ -151,10 +151,11 @@ static struct buffer_head *__ext4_read_dirblock(struct inode *inode,
 
 		return bh;
 	}
-	if (!bh && (type == INDEX || type == DIRENT_HTREE)) {
+	/* The first directory block must not be a hole. */
+	if (!bh && (type == INDEX || type == DIRENT_HTREE || block == 0)) {
 		ext4_error_inode(inode, func, line, block,
-				 "Directory hole found for htree %s block",
-				 (type == INDEX) ? "index" : "leaf");
+				 "Directory hole found for htree %s block %u",
+				 (type == INDEX) ? "index" : "leaf", block);
 		return ERR_PTR(-EFSCORRUPTED);
 	}
 	if (!bh)
@@ -2218,6 +2219,52 @@ static int add_dirent_to_buf(handle_t *handle, struct ext4_filename *fname,
 	return err ? err : err2;
 }
 
+static bool ext4_check_dx_root(struct inode *dir, struct dx_root *root)
+{
+	struct fake_dirent *fde;
+	const char *error_msg;
+	unsigned int rlen;
+	unsigned int blocksize = dir->i_sb->s_blocksize;
+	char *blockend = (char *)root + dir->i_sb->s_blocksize;
+
+	fde = &root->dot;
+	if (unlikely(fde->name_len != 1)) {
+		error_msg = "invalid name_len for '.'";
+		goto corrupted;
+	}
+	if (unlikely(strncmp(root->dot_name, ".", fde->name_len))) {
+		error_msg = "invalid name for '.'";
+		goto corrupted;
+	}
+	rlen = ext4_rec_len_from_disk(fde->rec_len, blocksize);
+	if (unlikely((char *)fde + rlen >= blockend)) {
+		error_msg = "invalid rec_len for '.'";
+		goto corrupted;
+	}
+
+	fde = &root->dotdot;
+	if (unlikely(fde->name_len != 2)) {
+		error_msg = "invalid name_len for '..'";
+		goto corrupted;
+	}
+	if (unlikely(strncmp(root->dotdot_name, "..", fde->name_len))) {
+		error_msg = "invalid name for '..'";
+		goto corrupted;
+	}
+	rlen = ext4_rec_len_from_disk(fde->rec_len, blocksize);
+	if (unlikely((char *)fde + rlen >= blockend)) {
+		error_msg = "invalid rec_len for '..'";
+		goto corrupted;
+	}
+
+	return true;
+
+corrupted:
+	EXT4_ERROR_INODE(dir, "Corrupt dir, %s, running e2fsck is recommended",
+			 error_msg);
+	return false;
+}
+
 /*
  * This converts a one block unindexed directory to a 3 block indexed
  * directory, and adds the dentry to the indexed directory.
@@ -2252,17 +2299,17 @@ static int make_indexed_dir(handle_t *handle, struct ext4_filename *fname,
 		brelse(bh);
 		return retval;
 	}
+
 	root = (struct dx_root *) bh->b_data;
+	if (!ext4_check_dx_root(dir, root)) {
+		brelse(bh);
+		return -EFSCORRUPTED;
+	}
 
 	/* The 0th block becomes the root, move the dirents out */
 	fde = &root->dotdot;
 	de = (struct ext4_dir_entry_2 *)((char *)fde +
 		ext4_rec_len_from_disk(fde->rec_len, blocksize));
-	if ((char *) de >= (((char *) root) + blocksize)) {
-		EXT4_ERROR_INODE(dir, "invalid rec_len for '..'");
-		brelse(bh);
-		return -EFSCORRUPTED;
-	}
 	len = ((char *) root) + (blocksize - csum_size) - (char *) de;
 
 	/* Allocate new block for the 0th block's dirents */
@@ -3087,10 +3134,7 @@ bool ext4_empty_dir(struct inode *inode)
 		EXT4_ERROR_INODE(inode, "invalid size");
 		return false;
 	}
-	/* The first directory block must not be a hole,
-	 * so treat it as DIRENT_HTREE
-	 */
-	bh = ext4_read_dirblock(inode, 0, DIRENT_HTREE);
+	bh = ext4_read_dirblock(inode, 0, EITHER);
 	if (IS_ERR(bh))
 		return false;
 
@@ -3535,10 +3579,7 @@ static struct buffer_head *ext4_get_first_dir_block(handle_t *handle,
 		struct ext4_dir_entry_2 *de;
 		unsigned int offset;
 
-		/* The first directory block must not be a hole, so
-		 * treat it as DIRENT_HTREE
-		 */
-		bh = ext4_read_dirblock(inode, 0, DIRENT_HTREE);
+		bh = ext4_read_dirblock(inode, 0, EITHER);
 		if (IS_ERR(bh)) {
 			*retval = PTR_ERR(bh);
 			return NULL;
diff --git a/fs/ext4/xattr.c b/fs/ext4/xattr.c
index 41b4630b17d6..c58cbe9f7809 100644
--- a/fs/ext4/xattr.c
+++ b/fs/ext4/xattr.c
@@ -1433,6 +1433,12 @@ static int ext4_xattr_inode_write(handle_t *handle, struct inode *ea_inode,
 			goto out;
 
 		memcpy(bh->b_data, buf, csize);
+		/*
+		 * Zero out block tail to avoid writing uninitialized memory
+		 * to disk.
+		 */
+		if (csize < blocksize)
+			memset(bh->b_data + csize, 0, blocksize - csize);
 		set_buffer_uptodate(bh);
 		ext4_handle_dirty_metadata(handle, ea_inode, bh);
 
diff --git a/fs/f2fs/checkpoint.c b/fs/f2fs/checkpoint.c
index 58ce751da92b..1a33a8c1623f 100644
--- a/fs/f2fs/checkpoint.c
+++ b/fs/f2fs/checkpoint.c
@@ -1170,6 +1170,11 @@ static void __prepare_cp_block(struct f2fs_sb_info *sbi)
 	ckpt->valid_node_count = cpu_to_le32(valid_node_count(sbi));
 	ckpt->valid_inode_count = cpu_to_le32(valid_inode_count(sbi));
 	ckpt->next_free_nid = cpu_to_le32(last_nid);
+
+	/* update user_block_counts */
+	sbi->last_valid_block_count = sbi->total_valid_block_count;
+	percpu_counter_set(&sbi->alloc_valid_block_count, 0);
+	percpu_counter_set(&sbi->rf_node_block_count, 0);
 }
 
 static bool __need_flush_quota(struct f2fs_sb_info *sbi)
@@ -1559,11 +1564,6 @@ static int do_checkpoint(struct f2fs_sb_info *sbi, struct cp_control *cpc)
 		start_blk += NR_CURSEG_NODE_TYPE;
 	}
 
-	/* update user_block_counts */
-	sbi->last_valid_block_count = sbi->total_valid_block_count;
-	percpu_counter_set(&sbi->alloc_valid_block_count, 0);
-	percpu_counter_set(&sbi->rf_node_block_count, 0);
-
 	/* Here, we have one bio having CP pack except cp pack 2 page */
 	f2fs_sync_meta_pages(sbi, META, LONG_MAX, FS_CP_META_IO);
 	/* Wait for all dirty meta pages to be submitted for IO */
diff --git a/fs/f2fs/data.c b/fs/f2fs/data.c
index 2c4cb801899e..84fc87018180 100644
--- a/fs/f2fs/data.c
+++ b/fs/f2fs/data.c
@@ -2586,7 +2586,7 @@ bool f2fs_should_update_outplace(struct inode *inode, struct f2fs_io_info *fio)
 		return true;
 	if (IS_NOQUOTA(inode))
 		return true;
-	if (f2fs_is_atomic_file(inode))
+	if (f2fs_used_in_atomic_write(inode))
 		return true;
 
 	/* swap file is migrating in aligned write mode */
@@ -2672,7 +2672,7 @@ int f2fs_do_write_data_page(struct f2fs_io_info *fio)
 	}
 
 	/* wait for GCed page writeback via META_MAPPING */
-	if (fio->post_read)
+	if (fio->meta_gc)
 		f2fs_wait_on_block_writeback(inode, fio->old_blkaddr);
 
 	/*
@@ -2768,7 +2768,7 @@ int f2fs_write_single_data_page(struct page *page, int *submitted,
 		.submitted = 0,
 		.compr_blocks = compr_blocks,
 		.need_lock = compr_blocks ? LOCK_DONE : LOCK_RETRY,
-		.post_read = f2fs_post_read_required(inode) ? 1 : 0,
+		.meta_gc = f2fs_meta_inode_gc_required(inode) ? 1 : 0,
 		.io_type = io_type,
 		.io_wbc = wbc,
 		.bio = bio,
diff --git a/fs/f2fs/f2fs.h b/fs/f2fs/f2fs.h
index c7e717ab0900..19490dd83219 100644
--- a/fs/f2fs/f2fs.h
+++ b/fs/f2fs/f2fs.h
@@ -798,6 +798,7 @@ enum {
 	FI_COW_FILE,		/* indicate COW file */
 	FI_ATOMIC_COMMITTED,	/* indicate atomic commit completed except disk sync */
 	FI_ATOMIC_REPLACE,	/* indicate atomic replace */
+	FI_OPENED_FILE,		/* indicate file has been opened */
 	FI_MAX,			/* max flag, never be used */
 };
 
@@ -836,7 +837,11 @@ struct f2fs_inode_info {
 	struct task_struct *atomic_write_task;	/* store atomic write task */
 	struct extent_tree *extent_tree[NR_EXTENT_CACHES];
 					/* cached extent_tree entry */
-	struct inode *cow_inode;	/* copy-on-write inode for atomic write */
+	union {
+		struct inode *cow_inode;	/* copy-on-write inode for atomic write */
+		struct inode *atomic_inode;
+					/* point to atomic_inode, available only for cow_inode */
+	};
 
 	/* avoid racing between foreground op and gc */
 	struct f2fs_rwsem i_gc_rwsem[2];
@@ -1204,7 +1209,7 @@ struct f2fs_io_info {
 	unsigned int in_list:1;		/* indicate fio is in io_list */
 	unsigned int is_por:1;		/* indicate IO is from recovery or not */
 	unsigned int encrypted:1;	/* indicate file is encrypted */
-	unsigned int post_read:1;	/* require post read */
+	unsigned int meta_gc:1;		/* require meta inode GC */
 	enum iostat_type io_type;	/* io type */
 	struct writeback_control *io_wbc; /* writeback control */
 	struct bio **bio;		/* bio for ipu */
@@ -4255,6 +4260,16 @@ static inline bool f2fs_post_read_required(struct inode *inode)
 		f2fs_compressed_file(inode);
 }
 
+static inline bool f2fs_used_in_atomic_write(struct inode *inode)
+{
+	return f2fs_is_atomic_file(inode) || f2fs_is_cow_file(inode);
+}
+
+static inline bool f2fs_meta_inode_gc_required(struct inode *inode)
+{
+	return f2fs_post_read_required(inode) || f2fs_used_in_atomic_write(inode);
+}
+
 /*
  * compress.c
  */
diff --git a/fs/f2fs/file.c b/fs/f2fs/file.c
index 154c55c1a0f4..523896200908 100644
--- a/fs/f2fs/file.c
+++ b/fs/f2fs/file.c
@@ -534,6 +534,42 @@ static int f2fs_file_mmap(struct file *file, struct vm_area_struct *vma)
 	return 0;
 }
 
+static int finish_preallocate_blocks(struct inode *inode)
+{
+	int ret;
+
+	inode_lock(inode);
+	if (is_inode_flag_set(inode, FI_OPENED_FILE)) {
+		inode_unlock(inode);
+		return 0;
+	}
+
+	if (!file_should_truncate(inode)) {
+		set_inode_flag(inode, FI_OPENED_FILE);
+		inode_unlock(inode);
+		return 0;
+	}
+
+	f2fs_down_write(&F2FS_I(inode)->i_gc_rwsem[WRITE]);
+	filemap_invalidate_lock(inode->i_mapping);
+
+	truncate_setsize(inode, i_size_read(inode));
+	ret = f2fs_truncate(inode);
+
+	filemap_invalidate_unlock(inode->i_mapping);
+	f2fs_up_write(&F2FS_I(inode)->i_gc_rwsem[WRITE]);
+
+	if (!ret)
+		set_inode_flag(inode, FI_OPENED_FILE);
+
+	inode_unlock(inode);
+	if (ret)
+		return ret;
+
+	file_dont_truncate(inode);
+	return 0;
+}
+
 static int f2fs_file_open(struct inode *inode, struct file *filp)
 {
 	int err = fscrypt_file_open(inode, filp);
@@ -551,7 +587,11 @@ static int f2fs_file_open(struct inode *inode, struct file *filp)
 	filp->f_mode |= FMODE_NOWAIT | FMODE_BUF_RASYNC;
 	filp->f_mode |= FMODE_CAN_ODIRECT;
 
-	return dquot_file_open(inode, filp);
+	err = dquot_file_open(inode, filp);
+	if (err)
+		return err;
+
+	return finish_preallocate_blocks(inode);
 }
 
 void f2fs_truncate_data_blocks_range(struct dnode_of_data *dn, int count)
@@ -803,6 +843,8 @@ static bool f2fs_force_buffered_io(struct inode *inode, int rw)
 		return true;
 	if (f2fs_compressed_file(inode))
 		return true;
+	if (f2fs_has_inline_data(inode))
+		return true;
 
 	/* disallow direct IO if any of devices has unaligned blksize */
 	if (f2fs_is_multi_device(sbi) && !sbi->aligned_blksize)
@@ -2117,6 +2159,9 @@ static int f2fs_ioc_start_atomic_write(struct file *filp, bool truncate)
 
 		set_inode_flag(fi->cow_inode, FI_COW_FILE);
 		clear_inode_flag(fi->cow_inode, FI_INLINE_DATA);
+
+		/* Set the COW inode's atomic_inode to the atomic inode */
+		F2FS_I(fi->cow_inode)->atomic_inode = inode;
 	} else {
 		/* Reuse the already created COW inode */
 		ret = f2fs_do_truncate_blocks(fi->cow_inode, 0, true);
diff --git a/fs/f2fs/gc.c b/fs/f2fs/gc.c
index 3f0632dd9d2e..afb7c88ba06b 100644
--- a/fs/f2fs/gc.c
+++ b/fs/f2fs/gc.c
@@ -1171,7 +1171,8 @@ static bool is_alive(struct f2fs_sb_info *sbi, struct f2fs_summary *sum,
 static int ra_data_block(struct inode *inode, pgoff_t index)
 {
 	struct f2fs_sb_info *sbi = F2FS_I_SB(inode);
-	struct address_space *mapping = inode->i_mapping;
+	struct address_space *mapping = f2fs_is_cow_file(inode) ?
+				F2FS_I(inode)->atomic_inode->i_mapping : inode->i_mapping;
 	struct dnode_of_data dn;
 	struct page *page;
 	struct f2fs_io_info fio = {
@@ -1262,6 +1263,8 @@ static int ra_data_block(struct inode *inode, pgoff_t index)
 static int move_data_block(struct inode *inode, block_t bidx,
 				int gc_type, unsigned int segno, int off)
 {
+	struct address_space *mapping = f2fs_is_cow_file(inode) ?
+				F2FS_I(inode)->atomic_inode->i_mapping : inode->i_mapping;
 	struct f2fs_io_info fio = {
 		.sbi = F2FS_I_SB(inode),
 		.ino = inode->i_ino,
@@ -1284,7 +1287,7 @@ static int move_data_block(struct inode *inode, block_t bidx,
 				CURSEG_ALL_DATA_ATGC : CURSEG_COLD_DATA;
 
 	/* do not read out */
-	page = f2fs_grab_cache_page(inode->i_mapping, bidx, false);
+	page = f2fs_grab_cache_page(mapping, bidx, false);
 	if (!page)
 		return -ENOMEM;
 
@@ -1576,7 +1579,7 @@ static int gc_data_segment(struct f2fs_sb_info *sbi, struct f2fs_summary *sum,
 			start_bidx = f2fs_start_bidx_of_node(nofs, inode) +
 								ofs_in_node;
 
-			if (f2fs_post_read_required(inode)) {
+			if (f2fs_meta_inode_gc_required(inode)) {
 				int err = ra_data_block(inode, start_bidx);
 
 				f2fs_up_write(&F2FS_I(inode)->i_gc_rwsem[WRITE]);
@@ -1627,7 +1630,7 @@ static int gc_data_segment(struct f2fs_sb_info *sbi, struct f2fs_summary *sum,
 
 			start_bidx = f2fs_start_bidx_of_node(nofs, inode)
 								+ ofs_in_node;
-			if (f2fs_post_read_required(inode))
+			if (f2fs_meta_inode_gc_required(inode))
 				err = move_data_block(inode, start_bidx,
 							gc_type, segno, off);
 			else
@@ -1635,7 +1638,7 @@ static int gc_data_segment(struct f2fs_sb_info *sbi, struct f2fs_summary *sum,
 								segno, off);
 
 			if (!err && (gc_type == FG_GC ||
-					f2fs_post_read_required(inode)))
+					f2fs_meta_inode_gc_required(inode)))
 				submitted++;
 
 			if (locked) {
diff --git a/fs/f2fs/inline.c b/fs/f2fs/inline.c
index 2fe25619ccb5..2cbe557f971e 100644
--- a/fs/f2fs/inline.c
+++ b/fs/f2fs/inline.c
@@ -16,7 +16,7 @@
 
 static bool support_inline_data(struct inode *inode)
 {
-	if (f2fs_is_atomic_file(inode))
+	if (f2fs_used_in_atomic_write(inode))
 		return false;
 	if (!S_ISREG(inode->i_mode) && !S_ISLNK(inode->i_mode))
 		return false;
@@ -203,8 +203,10 @@ int f2fs_convert_inline_inode(struct inode *inode)
 	struct page *ipage, *page;
 	int err = 0;
 
-	if (!f2fs_has_inline_data(inode) ||
-			f2fs_hw_is_readonly(sbi) || f2fs_readonly(sbi->sb))
+	if (f2fs_hw_is_readonly(sbi) || f2fs_readonly(sbi->sb))
+		return -EROFS;
+
+	if (!f2fs_has_inline_data(inode))
 		return 0;
 
 	err = f2fs_dquot_initialize(inode);
diff --git a/fs/f2fs/inode.c b/fs/f2fs/inode.c
index ab2eecd986ec..0172f4e50306 100644
--- a/fs/f2fs/inode.c
+++ b/fs/f2fs/inode.c
@@ -29,6 +29,9 @@ void f2fs_mark_inode_dirty_sync(struct inode *inode, bool sync)
 	if (is_inode_flag_set(inode, FI_NEW_INODE))
 		return;
 
+	if (f2fs_readonly(F2FS_I_SB(inode)->sb))
+		return;
+
 	if (f2fs_inode_dirtied(inode, sync))
 		return;
 
@@ -610,14 +613,6 @@ struct inode *f2fs_iget(struct super_block *sb, unsigned long ino)
 	}
 	f2fs_set_inode_flags(inode);
 
-	if (file_should_truncate(inode) &&
-			!is_sbi_flag_set(sbi, SBI_POR_DOING)) {
-		ret = f2fs_truncate(inode);
-		if (ret)
-			goto bad_inode;
-		file_dont_truncate(inode);
-	}
-
 	unlock_new_inode(inode);
 	trace_f2fs_iget(inode);
 	return inode;
@@ -813,8 +808,9 @@ void f2fs_evict_inode(struct inode *inode)
 
 	f2fs_abort_atomic_write(inode, true);
 
-	if (fi->cow_inode) {
+	if (fi->cow_inode && f2fs_is_cow_file(fi->cow_inode)) {
 		clear_inode_flag(fi->cow_inode, FI_COW_FILE);
+		F2FS_I(fi->cow_inode)->atomic_inode = NULL;
 		iput(fi->cow_inode);
 		fi->cow_inode = NULL;
 	}
diff --git a/fs/f2fs/segment.c b/fs/f2fs/segment.c
index b578ce3757ef..22080606b876 100644
--- a/fs/f2fs/segment.c
+++ b/fs/f2fs/segment.c
@@ -3659,7 +3659,7 @@ int f2fs_inplace_write_data(struct f2fs_io_info *fio)
 		goto drop_bio;
 	}
 
-	if (fio->post_read)
+	if (fio->meta_gc)
 		f2fs_truncate_meta_inode_pages(sbi, fio->new_blkaddr, 1);
 
 	stat_inc_inplace_blocks(fio->sbi);
@@ -3825,7 +3825,7 @@ void f2fs_wait_on_block_writeback(struct inode *inode, block_t blkaddr)
 	struct f2fs_sb_info *sbi = F2FS_I_SB(inode);
 	struct page *cpage;
 
-	if (!f2fs_post_read_required(inode))
+	if (!f2fs_meta_inode_gc_required(inode))
 		return;
 
 	if (!__is_valid_data_blkaddr(blkaddr))
@@ -3844,7 +3844,7 @@ void f2fs_wait_on_block_writeback_range(struct inode *inode, block_t blkaddr,
 	struct f2fs_sb_info *sbi = F2FS_I_SB(inode);
 	block_t i;
 
-	if (!f2fs_post_read_required(inode))
+	if (!f2fs_meta_inode_gc_required(inode))
 		return;
 
 	for (i = 0; i < len; i++)
diff --git a/fs/f2fs/segment.h b/fs/f2fs/segment.h
index 4595f1cc0382..952970166d5d 100644
--- a/fs/f2fs/segment.h
+++ b/fs/f2fs/segment.h
@@ -348,7 +348,8 @@ static inline unsigned int get_ckpt_valid_blocks(struct f2fs_sb_info *sbi,
 				unsigned int segno, bool use_section)
 {
 	if (use_section && __is_large_section(sbi)) {
-		unsigned int start_segno = START_SEGNO(segno);
+		unsigned int secno = GET_SEC_FROM_SEG(sbi, segno);
+		unsigned int start_segno = GET_SEG_FROM_SEC(sbi, secno);
 		unsigned int blocks = 0;
 		int i;
 
diff --git a/fs/fuse/inode.c b/fs/fuse/inode.c
index 23ab31b967a1..04c7ba3ea03a 100644
--- a/fs/fuse/inode.c
+++ b/fs/fuse/inode.c
@@ -751,6 +751,8 @@ static int fuse_parse_param(struct fs_context *fsc, struct fs_parameter *param)
 	struct fs_parse_result result;
 	struct fuse_fs_context *ctx = fsc->fs_private;
 	int opt;
+	kuid_t kuid;
+	kgid_t kgid;
 
 	if (fsc->purpose == FS_CONTEXT_FOR_RECONFIGURE) {
 		/*
@@ -795,16 +797,30 @@ static int fuse_parse_param(struct fs_context *fsc, struct fs_parameter *param)
 		break;
 
 	case OPT_USER_ID:
-		ctx->user_id = make_kuid(fsc->user_ns, result.uint_32);
-		if (!uid_valid(ctx->user_id))
+		kuid =  make_kuid(fsc->user_ns, result.uint_32);
+		if (!uid_valid(kuid))
 			return invalfc(fsc, "Invalid user_id");
+		/*
+		 * The requested uid must be representable in the
+		 * filesystem's idmapping.
+		 */
+		if (!kuid_has_mapping(fsc->user_ns, kuid))
+			return invalfc(fsc, "Invalid user_id");
+		ctx->user_id = kuid;
 		ctx->user_id_present = true;
 		break;
 
 	case OPT_GROUP_ID:
-		ctx->group_id = make_kgid(fsc->user_ns, result.uint_32);
-		if (!gid_valid(ctx->group_id))
+		kgid = make_kgid(fsc->user_ns, result.uint_32);;
+		if (!gid_valid(kgid))
+			return invalfc(fsc, "Invalid group_id");
+		/*
+		 * The requested gid must be representable in the
+		 * filesystem's idmapping.
+		 */
+		if (!kgid_has_mapping(fsc->user_ns, kgid))
 			return invalfc(fsc, "Invalid group_id");
+		ctx->group_id = kgid;
 		ctx->group_id_present = true;
 		break;
 
diff --git a/fs/hfs/inode.c b/fs/hfs/inode.c
index ee349b72cfb3..61ed76d10392 100644
--- a/fs/hfs/inode.c
+++ b/fs/hfs/inode.c
@@ -204,6 +204,7 @@ struct inode *hfs_new_inode(struct inode *dir, const struct qstr *name, umode_t
 	HFS_I(inode)->flags = 0;
 	HFS_I(inode)->rsrc_inode = NULL;
 	HFS_I(inode)->fs_blocks = 0;
+	HFS_I(inode)->tz_secondswest = sys_tz.tz_minuteswest * 60;
 	if (S_ISDIR(mode)) {
 		inode->i_size = 2;
 		HFS_SB(sb)->folder_count++;
@@ -279,6 +280,8 @@ void hfs_inode_read_fork(struct inode *inode, struct hfs_extent *ext,
 	for (count = 0, i = 0; i < 3; i++)
 		count += be16_to_cpu(ext[i].count);
 	HFS_I(inode)->first_blocks = count;
+	HFS_I(inode)->cached_start = 0;
+	HFS_I(inode)->cached_blocks = 0;
 
 	inode->i_size = HFS_I(inode)->phys_size = log_size;
 	HFS_I(inode)->fs_blocks = (log_size + sb->s_blocksize - 1) >> sb->s_blocksize_bits;
diff --git a/fs/hfsplus/bfind.c b/fs/hfsplus/bfind.c
index ca2ba8c9f82e..901e83d65d20 100644
--- a/fs/hfsplus/bfind.c
+++ b/fs/hfsplus/bfind.c
@@ -25,19 +25,8 @@ int hfs_find_init(struct hfs_btree *tree, struct hfs_find_data *fd)
 	fd->key = ptr + tree->max_key_len + 2;
 	hfs_dbg(BNODE_REFS, "find_init: %d (%p)\n",
 		tree->cnid, __builtin_return_address(0));
-	switch (tree->cnid) {
-	case HFSPLUS_CAT_CNID:
-		mutex_lock_nested(&tree->tree_lock, CATALOG_BTREE_MUTEX);
-		break;
-	case HFSPLUS_EXT_CNID:
-		mutex_lock_nested(&tree->tree_lock, EXTENTS_BTREE_MUTEX);
-		break;
-	case HFSPLUS_ATTR_CNID:
-		mutex_lock_nested(&tree->tree_lock, ATTR_BTREE_MUTEX);
-		break;
-	default:
-		BUG();
-	}
+	mutex_lock_nested(&tree->tree_lock,
+			hfsplus_btree_lock_class(tree));
 	return 0;
 }
 
diff --git a/fs/hfsplus/extents.c b/fs/hfsplus/extents.c
index 3c572e44f2ad..9c51867dddc5 100644
--- a/fs/hfsplus/extents.c
+++ b/fs/hfsplus/extents.c
@@ -430,7 +430,8 @@ int hfsplus_free_fork(struct super_block *sb, u32 cnid,
 		hfsplus_free_extents(sb, ext_entry, total_blocks - start,
 				     total_blocks);
 		total_blocks = start;
-		mutex_lock(&fd.tree->tree_lock);
+		mutex_lock_nested(&fd.tree->tree_lock,
+			hfsplus_btree_lock_class(fd.tree));
 	} while (total_blocks > blocks);
 	hfs_find_exit(&fd);
 
@@ -592,7 +593,8 @@ void hfsplus_file_truncate(struct inode *inode)
 					     alloc_cnt, alloc_cnt - blk_cnt);
 			hfsplus_dump_extent(hip->first_extents);
 			hip->first_blocks = blk_cnt;
-			mutex_lock(&fd.tree->tree_lock);
+			mutex_lock_nested(&fd.tree->tree_lock,
+				hfsplus_btree_lock_class(fd.tree));
 			break;
 		}
 		res = __hfsplus_ext_cache_extent(&fd, inode, alloc_cnt);
@@ -606,7 +608,8 @@ void hfsplus_file_truncate(struct inode *inode)
 		hfsplus_free_extents(sb, hip->cached_extents,
 				     alloc_cnt - start, alloc_cnt - blk_cnt);
 		hfsplus_dump_extent(hip->cached_extents);
-		mutex_lock(&fd.tree->tree_lock);
+		mutex_lock_nested(&fd.tree->tree_lock,
+				hfsplus_btree_lock_class(fd.tree));
 		if (blk_cnt > start) {
 			hip->extent_state |= HFSPLUS_EXT_DIRTY;
 			break;
diff --git a/fs/hfsplus/hfsplus_fs.h b/fs/hfsplus/hfsplus_fs.h
index 7ededcb720c1..583c196ecd52 100644
--- a/fs/hfsplus/hfsplus_fs.h
+++ b/fs/hfsplus/hfsplus_fs.h
@@ -552,6 +552,27 @@ static inline __be32 __hfsp_ut2mt(time64_t ut)
 	return cpu_to_be32(lower_32_bits(ut) + HFSPLUS_UTC_OFFSET);
 }
 
+static inline enum hfsplus_btree_mutex_classes
+hfsplus_btree_lock_class(struct hfs_btree *tree)
+{
+	enum hfsplus_btree_mutex_classes class;
+
+	switch (tree->cnid) {
+	case HFSPLUS_CAT_CNID:
+		class = CATALOG_BTREE_MUTEX;
+		break;
+	case HFSPLUS_EXT_CNID:
+		class = EXTENTS_BTREE_MUTEX;
+		break;
+	case HFSPLUS_ATTR_CNID:
+		class = ATTR_BTREE_MUTEX;
+		break;
+	default:
+		BUG();
+	}
+	return class;
+}
+
 /* compatibility */
 #define hfsp_mt2ut(t)		(struct timespec64){ .tv_sec = __hfsp_mt2ut(t) }
 #define hfsp_ut2mt(t)		__hfsp_ut2mt((t).tv_sec)
diff --git a/fs/hostfs/hostfs.h b/fs/hostfs/hostfs.h
index 0239e3af3945..8b39c15c408c 100644
--- a/fs/hostfs/hostfs.h
+++ b/fs/hostfs/hostfs.h
@@ -63,9 +63,10 @@ struct hostfs_stat {
 	struct hostfs_timespec atime, mtime, ctime;
 	unsigned int blksize;
 	unsigned long long blocks;
-	unsigned int maj;
-	unsigned int min;
-	dev_t dev;
+	struct {
+		unsigned int maj;
+		unsigned int min;
+	} rdev, dev;
 };
 
 extern int stat_file(const char *path, struct hostfs_stat *p, int fd);
diff --git a/fs/hostfs/hostfs_kern.c b/fs/hostfs/hostfs_kern.c
index dc5a5cea5fae..ff201753fd18 100644
--- a/fs/hostfs/hostfs_kern.c
+++ b/fs/hostfs/hostfs_kern.c
@@ -526,10 +526,11 @@ static int hostfs_inode_update(struct inode *ino, const struct hostfs_stat *st)
 static int hostfs_inode_set(struct inode *ino, void *data)
 {
 	struct hostfs_stat *st = data;
-	dev_t rdev;
+	dev_t dev, rdev;
 
 	/* Reencode maj and min with the kernel encoding.*/
-	rdev = MKDEV(st->maj, st->min);
+	rdev = MKDEV(st->rdev.maj, st->rdev.min);
+	dev = MKDEV(st->dev.maj, st->dev.min);
 
 	switch (st->mode & S_IFMT) {
 	case S_IFLNK:
@@ -555,7 +556,7 @@ static int hostfs_inode_set(struct inode *ino, void *data)
 		return -EIO;
 	}
 
-	HOSTFS_I(ino)->dev = st->dev;
+	HOSTFS_I(ino)->dev = dev;
 	ino->i_ino = st->ino;
 	ino->i_mode = st->mode;
 	return hostfs_inode_update(ino, st);
@@ -564,8 +565,9 @@ static int hostfs_inode_set(struct inode *ino, void *data)
 static int hostfs_inode_test(struct inode *inode, void *data)
 {
 	const struct hostfs_stat *st = data;
+	dev_t dev = MKDEV(st->dev.maj, st->dev.min);
 
-	return inode->i_ino == st->ino && HOSTFS_I(inode)->dev == st->dev;
+	return inode->i_ino == st->ino && HOSTFS_I(inode)->dev == dev;
 }
 
 static struct inode *hostfs_iget(struct super_block *sb, char *name)
diff --git a/fs/hostfs/hostfs_user.c b/fs/hostfs/hostfs_user.c
index 840619e39a1a..97e9c40a9448 100644
--- a/fs/hostfs/hostfs_user.c
+++ b/fs/hostfs/hostfs_user.c
@@ -34,9 +34,10 @@ static void stat64_to_hostfs(const struct stat64 *buf, struct hostfs_stat *p)
 	p->mtime.tv_nsec = 0;
 	p->blksize = buf->st_blksize;
 	p->blocks = buf->st_blocks;
-	p->maj = os_major(buf->st_rdev);
-	p->min = os_minor(buf->st_rdev);
-	p->dev = buf->st_dev;
+	p->rdev.maj = os_major(buf->st_rdev);
+	p->rdev.min = os_minor(buf->st_rdev);
+	p->dev.maj = os_major(buf->st_dev);
+	p->dev.min = os_minor(buf->st_dev);
 }
 
 int stat_file(const char *path, struct hostfs_stat *p, int fd)
diff --git a/fs/jbd2/commit.c b/fs/jbd2/commit.c
index 5e122586e06e..0cd7439470fc 100644
--- a/fs/jbd2/commit.c
+++ b/fs/jbd2/commit.c
@@ -767,7 +767,7 @@ void jbd2_journal_commit_transaction(journal_t *journal)
 		if (first_block < journal->j_tail)
 			freed += journal->j_last - journal->j_first;
 		/* Update tail only if we free significant amount of space */
-		if (freed < jbd2_journal_get_max_txn_bufs(journal))
+		if (freed < journal->j_max_transaction_buffers)
 			update_tail = 0;
 	}
 	J_ASSERT(commit_transaction->t_state == T_COMMIT);
diff --git a/fs/jbd2/journal.c b/fs/jbd2/journal.c
index 19c69229ac6e..0168d2842707 100644
--- a/fs/jbd2/journal.c
+++ b/fs/jbd2/journal.c
@@ -1451,6 +1451,48 @@ static int journal_revoke_records_per_block(journal_t *journal)
 	return space / record_size;
 }
 
+static int jbd2_journal_get_max_txn_bufs(journal_t *journal)
+{
+	return (journal->j_total_len - journal->j_fc_wbufsize) / 4;
+}
+
+/*
+ * Base amount of descriptor blocks we reserve for each transaction.
+ */
+static int jbd2_descriptor_blocks_per_trans(journal_t *journal)
+{
+	int tag_space = journal->j_blocksize - sizeof(journal_header_t);
+	int tags_per_block;
+
+	/* Subtract UUID */
+	tag_space -= 16;
+	if (jbd2_journal_has_csum_v2or3(journal))
+		tag_space -= sizeof(struct jbd2_journal_block_tail);
+	/* Commit code leaves a slack space of 16 bytes at the end of block */
+	tags_per_block = (tag_space - 16) / journal_tag_bytes(journal);
+	/*
+	 * Revoke descriptors are accounted separately so we need to reserve
+	 * space for commit block and normal transaction descriptor blocks.
+	 */
+	return 1 + DIV_ROUND_UP(jbd2_journal_get_max_txn_bufs(journal),
+				tags_per_block);
+}
+
+/*
+ * Initialize number of blocks each transaction reserves for its bookkeeping
+ * and maximum number of blocks a transaction can use. This needs to be called
+ * after the journal size and the fastcommit area size are initialized.
+ */
+static void jbd2_journal_init_transaction_limits(journal_t *journal)
+{
+	journal->j_revoke_records_per_block =
+				journal_revoke_records_per_block(journal);
+	journal->j_transaction_overhead_buffers =
+				jbd2_descriptor_blocks_per_trans(journal);
+	journal->j_max_transaction_buffers =
+				jbd2_journal_get_max_txn_bufs(journal);
+}
+
 /*
  * Load the on-disk journal superblock and read the key fields into the
  * journal_t.
@@ -1492,8 +1534,8 @@ static int journal_load_superblock(journal_t *journal)
 	if (jbd2_journal_has_csum_v2or3(journal))
 		journal->j_csum_seed = jbd2_chksum(journal, ~0, sb->s_uuid,
 						   sizeof(sb->s_uuid));
-	journal->j_revoke_records_per_block =
-				journal_revoke_records_per_block(journal);
+	/* After journal features are set, we can compute transaction limits */
+	jbd2_journal_init_transaction_limits(journal);
 
 	if (jbd2_has_feature_fast_commit(journal)) {
 		journal->j_fc_last = be32_to_cpu(sb->s_maxlen);
@@ -1735,8 +1777,6 @@ static int journal_reset(journal_t *journal)
 	journal->j_commit_sequence = journal->j_transaction_sequence - 1;
 	journal->j_commit_request = journal->j_commit_sequence;
 
-	journal->j_max_transaction_buffers = jbd2_journal_get_max_txn_bufs(journal);
-
 	/*
 	 * Now that journal recovery is done, turn fast commits off here. This
 	 * way, if fast commit was enabled before the crash but if now FS has
@@ -2277,8 +2317,6 @@ jbd2_journal_initialize_fast_commit(journal_t *journal)
 	journal->j_fc_first = journal->j_last + 1;
 	journal->j_fc_off = 0;
 	journal->j_free = journal->j_last - journal->j_first;
-	journal->j_max_transaction_buffers =
-		jbd2_journal_get_max_txn_bufs(journal);
 
 	return 0;
 }
@@ -2366,8 +2404,7 @@ int jbd2_journal_set_features(journal_t *journal, unsigned long compat,
 	sb->s_feature_ro_compat |= cpu_to_be32(ro);
 	sb->s_feature_incompat  |= cpu_to_be32(incompat);
 	unlock_buffer(journal->j_sb_buffer);
-	journal->j_revoke_records_per_block =
-				journal_revoke_records_per_block(journal);
+	jbd2_journal_init_transaction_limits(journal);
 
 	return 1;
 #undef COMPAT_FEATURE_ON
@@ -2398,8 +2435,7 @@ void jbd2_journal_clear_features(journal_t *journal, unsigned long compat,
 	sb->s_feature_compat    &= ~cpu_to_be32(compat);
 	sb->s_feature_ro_compat &= ~cpu_to_be32(ro);
 	sb->s_feature_incompat  &= ~cpu_to_be32(incompat);
-	journal->j_revoke_records_per_block =
-				journal_revoke_records_per_block(journal);
+	jbd2_journal_init_transaction_limits(journal);
 }
 EXPORT_SYMBOL(jbd2_journal_clear_features);
 
diff --git a/fs/jbd2/transaction.c b/fs/jbd2/transaction.c
index 5f08b5fd105a..76adab83cac3 100644
--- a/fs/jbd2/transaction.c
+++ b/fs/jbd2/transaction.c
@@ -62,28 +62,6 @@ void jbd2_journal_free_transaction(transaction_t *transaction)
 	kmem_cache_free(transaction_cache, transaction);
 }
 
-/*
- * Base amount of descriptor blocks we reserve for each transaction.
- */
-static int jbd2_descriptor_blocks_per_trans(journal_t *journal)
-{
-	int tag_space = journal->j_blocksize - sizeof(journal_header_t);
-	int tags_per_block;
-
-	/* Subtract UUID */
-	tag_space -= 16;
-	if (jbd2_journal_has_csum_v2or3(journal))
-		tag_space -= sizeof(struct jbd2_journal_block_tail);
-	/* Commit code leaves a slack space of 16 bytes at the end of block */
-	tags_per_block = (tag_space - 16) / journal_tag_bytes(journal);
-	/*
-	 * Revoke descriptors are accounted separately so we need to reserve
-	 * space for commit block and normal transaction descriptor blocks.
-	 */
-	return 1 + DIV_ROUND_UP(journal->j_max_transaction_buffers,
-				tags_per_block);
-}
-
 /*
  * jbd2_get_transaction: obtain a new transaction_t object.
  *
@@ -109,7 +87,7 @@ static void jbd2_get_transaction(journal_t *journal,
 	transaction->t_expires = jiffies + journal->j_commit_interval;
 	atomic_set(&transaction->t_updates, 0);
 	atomic_set(&transaction->t_outstanding_credits,
-		   jbd2_descriptor_blocks_per_trans(journal) +
+		   journal->j_transaction_overhead_buffers +
 		   atomic_read(&journal->j_reserved_credits));
 	atomic_set(&transaction->t_outstanding_revokes, 0);
 	atomic_set(&transaction->t_handle_count, 0);
@@ -213,6 +191,13 @@ static void sub_reserved_credits(journal_t *journal, int blocks)
 	wake_up(&journal->j_wait_reserved);
 }
 
+/* Maximum number of blocks for user transaction payload */
+static int jbd2_max_user_trans_buffers(journal_t *journal)
+{
+	return journal->j_max_transaction_buffers -
+				journal->j_transaction_overhead_buffers;
+}
+
 /*
  * Wait until we can add credits for handle to the running transaction.  Called
  * with j_state_lock held for reading. Returns 0 if handle joined the running
@@ -262,12 +247,12 @@ __must_hold(&journal->j_state_lock)
 		 * big to fit this handle? Wait until reserved credits are freed.
 		 */
 		if (atomic_read(&journal->j_reserved_credits) + total >
-		    journal->j_max_transaction_buffers) {
+		    jbd2_max_user_trans_buffers(journal)) {
 			read_unlock(&journal->j_state_lock);
 			jbd2_might_wait_for_commit(journal);
 			wait_event(journal->j_wait_reserved,
 				   atomic_read(&journal->j_reserved_credits) + total <=
-				   journal->j_max_transaction_buffers);
+				   jbd2_max_user_trans_buffers(journal));
 			__acquire(&journal->j_state_lock); /* fake out sparse */
 			return 1;
 		}
@@ -307,14 +292,14 @@ __must_hold(&journal->j_state_lock)
 
 	needed = atomic_add_return(rsv_blocks, &journal->j_reserved_credits);
 	/* We allow at most half of a transaction to be reserved */
-	if (needed > journal->j_max_transaction_buffers / 2) {
+	if (needed > jbd2_max_user_trans_buffers(journal) / 2) {
 		sub_reserved_credits(journal, rsv_blocks);
 		atomic_sub(total, &t->t_outstanding_credits);
 		read_unlock(&journal->j_state_lock);
 		jbd2_might_wait_for_commit(journal);
 		wait_event(journal->j_wait_reserved,
 			 atomic_read(&journal->j_reserved_credits) + rsv_blocks
-			 <= journal->j_max_transaction_buffers / 2);
+			 <= jbd2_max_user_trans_buffers(journal) / 2);
 		__acquire(&journal->j_state_lock); /* fake out sparse */
 		return 1;
 	}
@@ -344,12 +329,12 @@ static int start_this_handle(journal_t *journal, handle_t *handle,
 	 * size and limit the number of total credits to not exceed maximum
 	 * transaction size per operation.
 	 */
-	if ((rsv_blocks > journal->j_max_transaction_buffers / 2) ||
-	    (rsv_blocks + blocks > journal->j_max_transaction_buffers)) {
+	if (rsv_blocks > jbd2_max_user_trans_buffers(journal) / 2 ||
+	    rsv_blocks + blocks > jbd2_max_user_trans_buffers(journal)) {
 		printk(KERN_ERR "JBD2: %s wants too many credits "
 		       "credits:%d rsv_credits:%d max:%d\n",
 		       current->comm, blocks, rsv_blocks,
-		       journal->j_max_transaction_buffers);
+		       jbd2_max_user_trans_buffers(journal));
 		WARN_ON(1);
 		return -ENOSPC;
 	}
diff --git a/fs/jfs/jfs_imap.c b/fs/jfs/jfs_imap.c
index eeedf606cf9d..4bc589c4dcca 100644
--- a/fs/jfs/jfs_imap.c
+++ b/fs/jfs/jfs_imap.c
@@ -290,7 +290,7 @@ int diSync(struct inode *ipimap)
 int diRead(struct inode *ip)
 {
 	struct jfs_sb_info *sbi = JFS_SBI(ip->i_sb);
-	int iagno, ino, extno, rc;
+	int iagno, ino, extno, rc, agno;
 	struct inode *ipimap;
 	struct dinode *dp;
 	struct iag *iagp;
@@ -339,8 +339,11 @@ int diRead(struct inode *ip)
 
 	/* get the ag for the iag */
 	agstart = le64_to_cpu(iagp->agstart);
+	agno = BLKTOAG(agstart, JFS_SBI(ip->i_sb));
 
 	release_metapage(mp);
+	if (agno >= MAXAG || agno < 0)
+		return -EIO;
 
 	rel_inode = (ino & (INOSPERPAGE - 1));
 	pageno = blkno >> sbi->l2nbperpage;
diff --git a/fs/kernfs/dir.c b/fs/kernfs/dir.c
index 2405aeb39b9a..b068ed32d7b3 100644
--- a/fs/kernfs/dir.c
+++ b/fs/kernfs/dir.c
@@ -127,7 +127,7 @@ static struct kernfs_node *kernfs_common_ancestor(struct kernfs_node *a,
  *
  * [3] when @kn_to is %NULL result will be "(null)"
  *
- * Return: the length of the full path.  If the full length is equal to or
+ * Return: the length of the constructed path.  If the path would have been
  * greater than @buflen, @buf contains the truncated path with the trailing
  * '\0'.  On error, -errno is returned.
  */
@@ -138,16 +138,17 @@ static int kernfs_path_from_node_locked(struct kernfs_node *kn_to,
 	struct kernfs_node *kn, *common;
 	const char parent_str[] = "/..";
 	size_t depth_from, depth_to, len = 0;
+	ssize_t copied;
 	int i, j;
 
 	if (!kn_to)
-		return strlcpy(buf, "(null)", buflen);
+		return strscpy(buf, "(null)", buflen);
 
 	if (!kn_from)
 		kn_from = kernfs_root(kn_to)->kn;
 
 	if (kn_from == kn_to)
-		return strlcpy(buf, "/", buflen);
+		return strscpy(buf, "/", buflen);
 
 	common = kernfs_common_ancestor(kn_from, kn_to);
 	if (WARN_ON(!common))
@@ -158,18 +159,19 @@ static int kernfs_path_from_node_locked(struct kernfs_node *kn_to,
 
 	buf[0] = '\0';
 
-	for (i = 0; i < depth_from; i++)
-		len += strlcpy(buf + len, parent_str,
-			       len < buflen ? buflen - len : 0);
+	for (i = 0; i < depth_from; i++) {
+		copied = strscpy(buf + len, parent_str, buflen - len);
+		if (copied < 0)
+			return copied;
+		len += copied;
+	}
 
 	/* Calculate how many bytes we need for the rest */
 	for (i = depth_to - 1; i >= 0; i--) {
 		for (kn = kn_to, j = 0; j < i; j++)
 			kn = kn->parent;
-		len += strlcpy(buf + len, "/",
-			       len < buflen ? buflen - len : 0);
-		len += strlcpy(buf + len, kn->name,
-			       len < buflen ? buflen - len : 0);
+
+		len += scnprintf(buf + len, buflen - len, "/%s", kn->name);
 	}
 
 	return len;
@@ -214,7 +216,7 @@ int kernfs_name(struct kernfs_node *kn, char *buf, size_t buflen)
  * path (which includes '..'s) as needed to reach from @from to @to is
  * returned.
  *
- * Return: the length of the full path.  If the full length is equal to or
+ * Return: the length of the constructed path.  If the path would have been
  * greater than @buflen, @buf contains the truncated path with the trailing
  * '\0'.  On error, -errno is returned.
  */
@@ -265,12 +267,10 @@ void pr_cont_kernfs_path(struct kernfs_node *kn)
 	sz = kernfs_path_from_node(kn, NULL, kernfs_pr_cont_buf,
 				   sizeof(kernfs_pr_cont_buf));
 	if (sz < 0) {
-		pr_cont("(error)");
-		goto out;
-	}
-
-	if (sz >= sizeof(kernfs_pr_cont_buf)) {
-		pr_cont("(name too long)");
+		if (sz == -E2BIG)
+			pr_cont("(name too long)");
+		else
+			pr_cont("(error)");
 		goto out;
 	}
 
diff --git a/fs/nfs/nfs4client.c b/fs/nfs/nfs4client.c
index 11e3a285594c..ac80f87cb9d9 100644
--- a/fs/nfs/nfs4client.c
+++ b/fs/nfs/nfs4client.c
@@ -231,9 +231,8 @@ struct nfs_client *nfs4_alloc_client(const struct nfs_client_initdata *cl_init)
 		__set_bit(NFS_CS_INFINITE_SLOTS, &clp->cl_flags);
 	__set_bit(NFS_CS_DISCRTRY, &clp->cl_flags);
 	__set_bit(NFS_CS_NO_RETRANS_TIMEOUT, &clp->cl_flags);
-
-	if (test_bit(NFS_CS_DS, &cl_init->init_flags))
-		__set_bit(NFS_CS_DS, &clp->cl_flags);
+	if (test_bit(NFS_CS_PNFS, &cl_init->init_flags))
+		__set_bit(NFS_CS_PNFS, &clp->cl_flags);
 	/*
 	 * Set up the connection to the server before we add add to the
 	 * global list.
@@ -1011,7 +1010,6 @@ struct nfs_client *nfs4_set_ds_client(struct nfs_server *mds_srv,
 	if (mds_srv->flags & NFS_MOUNT_NORESVPORT)
 		__set_bit(NFS_CS_NORESVPORT, &cl_init.init_flags);
 
-	__set_bit(NFS_CS_DS, &cl_init.init_flags);
 	__set_bit(NFS_CS_PNFS, &cl_init.init_flags);
 	cl_init.max_connect = NFS_MAX_TRANSPORTS;
 	/*
diff --git a/fs/nfs/nfs4proc.c b/fs/nfs/nfs4proc.c
index 05490d4784f1..e7ac249df1ad 100644
--- a/fs/nfs/nfs4proc.c
+++ b/fs/nfs/nfs4proc.c
@@ -8816,7 +8816,7 @@ nfs4_run_exchange_id(struct nfs_client *clp, const struct cred *cred,
 #ifdef CONFIG_NFS_V4_1_MIGRATION
 	calldata->args.flags |= EXCHGID4_FLAG_SUPP_MOVED_MIGR;
 #endif
-	if (test_bit(NFS_CS_DS, &clp->cl_flags))
+	if (test_bit(NFS_CS_PNFS, &clp->cl_flags))
 		calldata->args.flags |= EXCHGID4_FLAG_USE_PNFS_DS;
 	msg.rpc_argp = &calldata->args;
 	msg.rpc_resp = &calldata->res;
diff --git a/fs/nfsd/nfs4proc.c b/fs/nfsd/nfs4proc.c
index 4199ede0583c..451026f9986b 100644
--- a/fs/nfsd/nfs4proc.c
+++ b/fs/nfsd/nfs4proc.c
@@ -2218,7 +2218,7 @@ nfsd4_layoutget(struct svc_rqst *rqstp,
 	const struct nfsd4_layout_ops *ops;
 	struct nfs4_layout_stateid *ls;
 	__be32 nfserr;
-	int accmode = NFSD_MAY_READ_IF_EXEC;
+	int accmode = NFSD_MAY_READ_IF_EXEC | NFSD_MAY_OWNER_OVERRIDE;
 
 	switch (lgp->lg_seg.iomode) {
 	case IOMODE_READ:
@@ -2308,7 +2308,8 @@ nfsd4_layoutcommit(struct svc_rqst *rqstp,
 	struct nfs4_layout_stateid *ls;
 	__be32 nfserr;
 
-	nfserr = fh_verify(rqstp, current_fh, 0, NFSD_MAY_WRITE);
+	nfserr = fh_verify(rqstp, current_fh, 0,
+			   NFSD_MAY_WRITE | NFSD_MAY_OWNER_OVERRIDE);
 	if (nfserr)
 		goto out;
 
diff --git a/fs/nilfs2/btnode.c b/fs/nilfs2/btnode.c
index 5710833ac1cc..8fe348bceabe 100644
--- a/fs/nilfs2/btnode.c
+++ b/fs/nilfs2/btnode.c
@@ -51,12 +51,21 @@ nilfs_btnode_create_block(struct address_space *btnc, __u64 blocknr)
 
 	bh = nilfs_grab_buffer(inode, btnc, blocknr, BIT(BH_NILFS_Node));
 	if (unlikely(!bh))
-		return NULL;
+		return ERR_PTR(-ENOMEM);
 
 	if (unlikely(buffer_mapped(bh) || buffer_uptodate(bh) ||
 		     buffer_dirty(bh))) {
-		brelse(bh);
-		BUG();
+		/*
+		 * The block buffer at the specified new address was already
+		 * in use.  This can happen if it is a virtual block number
+		 * and has been reallocated due to corruption of the bitmap
+		 * used to manage its allocation state (if not, the buffer
+		 * clearing of an abandoned b-tree node is missing somewhere).
+		 */
+		nilfs_error(inode->i_sb,
+			    "state inconsistency probably due to duplicate use of b-tree node block address %llu (ino=%lu)",
+			    (unsigned long long)blocknr, inode->i_ino);
+		goto failed;
 	}
 	memset(bh->b_data, 0, i_blocksize(inode));
 	bh->b_bdev = inode->i_sb->s_bdev;
@@ -67,6 +76,12 @@ nilfs_btnode_create_block(struct address_space *btnc, __u64 blocknr)
 	unlock_page(bh->b_page);
 	put_page(bh->b_page);
 	return bh;
+
+failed:
+	unlock_page(bh->b_page);
+	put_page(bh->b_page);
+	brelse(bh);
+	return ERR_PTR(-EIO);
 }
 
 int nilfs_btnode_submit_block(struct address_space *btnc, __u64 blocknr,
@@ -217,8 +232,8 @@ int nilfs_btnode_prepare_change_key(struct address_space *btnc,
 	}
 
 	nbh = nilfs_btnode_create_block(btnc, newkey);
-	if (!nbh)
-		return -ENOMEM;
+	if (IS_ERR(nbh))
+		return PTR_ERR(nbh);
 
 	BUG_ON(nbh == obh);
 	ctxt->newbh = nbh;
diff --git a/fs/nilfs2/btree.c b/fs/nilfs2/btree.c
index 65659fa0372e..598f05867059 100644
--- a/fs/nilfs2/btree.c
+++ b/fs/nilfs2/btree.c
@@ -63,8 +63,8 @@ static int nilfs_btree_get_new_block(const struct nilfs_bmap *btree,
 	struct buffer_head *bh;
 
 	bh = nilfs_btnode_create_block(btnc, ptr);
-	if (!bh)
-		return -ENOMEM;
+	if (IS_ERR(bh))
+		return PTR_ERR(bh);
 
 	set_buffer_nilfs_volatile(bh);
 	*bhp = bh;
diff --git a/fs/nilfs2/segment.c b/fs/nilfs2/segment.c
index 5783efafbabd..e10f8a777ab0 100644
--- a/fs/nilfs2/segment.c
+++ b/fs/nilfs2/segment.c
@@ -136,7 +136,7 @@ static void nilfs_dispose_list(struct the_nilfs *, struct list_head *, int);
 
 #define nilfs_cnt32_ge(a, b)   \
 	(typecheck(__u32, a) && typecheck(__u32, b) && \
-	 ((__s32)(a) - (__s32)(b) >= 0))
+	 ((__s32)((a) - (b)) >= 0))
 
 static int nilfs_prepare_segment_lock(struct super_block *sb,
 				      struct nilfs_transaction_info *ti)
diff --git a/fs/ntfs3/attrib.c b/fs/ntfs3/attrib.c
index 7aadf5010999..fc6cea60044e 100644
--- a/fs/ntfs3/attrib.c
+++ b/fs/ntfs3/attrib.c
@@ -231,7 +231,7 @@ int attr_make_nonresident(struct ntfs_inode *ni, struct ATTRIB *attr,
 	struct ntfs_sb_info *sbi;
 	struct ATTRIB *attr_s;
 	struct MFT_REC *rec;
-	u32 used, asize, rsize, aoff, align;
+	u32 used, asize, rsize, aoff;
 	bool is_data;
 	CLST len, alen;
 	char *next;
@@ -252,10 +252,13 @@ int attr_make_nonresident(struct ntfs_inode *ni, struct ATTRIB *attr,
 	rsize = le32_to_cpu(attr->res.data_size);
 	is_data = attr->type == ATTR_DATA && !attr->name_len;
 
-	align = sbi->cluster_size;
-	if (is_attr_compressed(attr))
-		align <<= COMPRESSION_UNIT;
-	len = (rsize + align - 1) >> sbi->cluster_bits;
+	/* len - how many clusters required to store 'rsize' bytes */
+	if (is_attr_compressed(attr)) {
+		u8 shift = sbi->cluster_bits + NTFS_LZNT_CUNIT;
+		len = ((rsize + (1u << shift) - 1) >> shift) << NTFS_LZNT_CUNIT;
+	} else {
+		len = bytes_to_cluster(sbi, rsize);
+	}
 
 	run_init(run);
 
@@ -670,7 +673,8 @@ int attr_set_size(struct ntfs_inode *ni, enum ATTR_TYPE type,
 			goto undo_2;
 		}
 
-		if (!is_mft)
+		/* keep runs for $MFT::$ATTR_DATA and $MFT::$ATTR_BITMAP. */
+		if (ni->mi.rno != MFT_REC_MFT)
 			run_truncate_head(run, evcn + 1);
 
 		svcn = le64_to_cpu(attr->nres.svcn);
@@ -972,6 +976,19 @@ int attr_data_get_block(struct ntfs_inode *ni, CLST vcn, CLST clen, CLST *lcn,
 	if (err)
 		goto out;
 
+	/* Check for compressed frame. */
+	err = attr_is_frame_compressed(ni, attr, vcn >> NTFS_LZNT_CUNIT, &hint);
+	if (err)
+		goto out;
+
+	if (hint) {
+		/* if frame is compressed - don't touch it. */
+		*lcn = COMPRESSED_LCN;
+		*len = hint;
+		err = -EOPNOTSUPP;
+		goto out;
+	}
+
 	if (!*len) {
 		if (run_lookup_entry(run, vcn, lcn, len, NULL)) {
 			if (*lcn != SPARSE_LCN || !new)
@@ -1722,6 +1739,7 @@ int attr_allocate_frame(struct ntfs_inode *ni, CLST frame, size_t compr_size,
 
 	attr_b->nres.total_size = cpu_to_le64(total_size);
 	inode_set_bytes(&ni->vfs_inode, total_size);
+	ni->ni_flags |= NI_FLAG_UPDATE_PARENT;
 
 	mi_b->dirty = true;
 	mark_inode_dirty(&ni->vfs_inode);
diff --git a/fs/ntfs3/bitmap.c b/fs/ntfs3/bitmap.c
index 845f9b22deef..931a7744d186 100644
--- a/fs/ntfs3/bitmap.c
+++ b/fs/ntfs3/bitmap.c
@@ -1382,7 +1382,7 @@ int wnd_extend(struct wnd_bitmap *wnd, size_t new_bits)
 
 		err = ntfs_vbo_to_lbo(sbi, &wnd->run, vbo, &lbo, &bytes);
 		if (err)
-			break;
+			return err;
 
 		bh = ntfs_bread(sb, lbo >> sb->s_blocksize_bits);
 		if (!bh)
diff --git a/fs/ntfs3/dir.c b/fs/ntfs3/dir.c
index ac8eb8657f1a..9d0a09f00b38 100644
--- a/fs/ntfs3/dir.c
+++ b/fs/ntfs3/dir.c
@@ -326,7 +326,8 @@ static inline int ntfs_filldir(struct ntfs_sb_info *sbi, struct ntfs_inode *ni,
 	 * It does additional locks/reads just to get the type of name.
 	 * Should we use additional mount option to enable branch below?
 	 */
-	if ((fname->dup.fa & FILE_ATTRIBUTE_REPARSE_POINT) &&
+	if (((fname->dup.fa & FILE_ATTRIBUTE_REPARSE_POINT) ||
+	     fname->dup.ea_size) &&
 	    ino != ni->mi.rno) {
 		struct inode *inode = ntfs_iget5(sbi->sb, &e->ref, NULL);
 		if (!IS_ERR_OR_NULL(inode)) {
diff --git a/fs/ntfs3/file.c b/fs/ntfs3/file.c
index dfd5402a42e4..cd69cbd0aaae 100644
--- a/fs/ntfs3/file.c
+++ b/fs/ntfs3/file.c
@@ -299,10 +299,7 @@ static int ntfs_file_mmap(struct file *file, struct vm_area_struct *vma)
 		}
 
 		if (ni->i_valid < to) {
-			if (!inode_trylock(inode)) {
-				err = -EAGAIN;
-				goto out;
-			}
+			inode_lock(inode);
 			err = ntfs_extend_initialized_size(file, ni,
 							   ni->i_valid, to);
 			inode_unlock(inode);
diff --git a/fs/ntfs3/frecord.c b/fs/ntfs3/frecord.c
index 22fe7f58ad63..424865dfca74 100644
--- a/fs/ntfs3/frecord.c
+++ b/fs/ntfs3/frecord.c
@@ -1501,7 +1501,7 @@ int ni_insert_nonresident(struct ntfs_inode *ni, enum ATTR_TYPE type,
 
 	if (is_ext) {
 		if (flags & ATTR_FLAG_COMPRESSED)
-			attr->nres.c_unit = COMPRESSION_UNIT;
+			attr->nres.c_unit = NTFS_LZNT_CUNIT;
 		attr->nres.total_size = attr->nres.alloc_size;
 	}
 
diff --git a/fs/ntfs3/fslog.c b/fs/ntfs3/fslog.c
index c14ab9d5cfc7..231b012fb19d 100644
--- a/fs/ntfs3/fslog.c
+++ b/fs/ntfs3/fslog.c
@@ -2996,7 +2996,7 @@ static struct ATTRIB *attr_create_nonres_log(struct ntfs_sb_info *sbi,
 	if (is_ext) {
 		attr->name_off = SIZEOF_NONRESIDENT_EX_LE;
 		if (is_attr_compressed(attr))
-			attr->nres.c_unit = COMPRESSION_UNIT;
+			attr->nres.c_unit = NTFS_LZNT_CUNIT;
 
 		attr->nres.run_off =
 			cpu_to_le16(SIZEOF_NONRESIDENT_EX + name_size);
@@ -3922,6 +3922,9 @@ int log_replay(struct ntfs_inode *ni, bool *initialized)
 		goto out;
 	}
 
+	log->page_mask = log->page_size - 1;
+	log->page_bits = blksize_bits(log->page_size);
+
 	/* If the file size has shrunk then we won't mount it. */
 	if (log->l_size < le64_to_cpu(ra2->l_size)) {
 		err = -EINVAL;
diff --git a/fs/ntfs3/index.c b/fs/ntfs3/index.c
index 14284f0ed46a..0d8a96136b08 100644
--- a/fs/ntfs3/index.c
+++ b/fs/ntfs3/index.c
@@ -978,7 +978,7 @@ static struct indx_node *indx_new(struct ntfs_index *indx,
 		hdr->used =
 			cpu_to_le32(eo + sizeof(struct NTFS_DE) + sizeof(u64));
 		de_set_vbn_le(e, *sub_vbn);
-		hdr->flags = 1;
+		hdr->flags = NTFS_INDEX_HDR_HAS_SUBNODES;
 	} else {
 		e->size = cpu_to_le16(sizeof(struct NTFS_DE));
 		hdr->used = cpu_to_le32(eo + sizeof(struct NTFS_DE));
@@ -1682,7 +1682,7 @@ static int indx_insert_into_root(struct ntfs_index *indx, struct ntfs_inode *ni,
 	e->size = cpu_to_le16(sizeof(struct NTFS_DE) + sizeof(u64));
 	e->flags = NTFS_IE_HAS_SUBNODES | NTFS_IE_LAST;
 
-	hdr->flags = 1;
+	hdr->flags = NTFS_INDEX_HDR_HAS_SUBNODES;
 	hdr->used = hdr->total =
 		cpu_to_le32(new_root_size - offsetof(struct INDEX_ROOT, ihdr));
 
diff --git a/fs/ntfs3/inode.c b/fs/ntfs3/inode.c
index 6af705ccba65..1545262995da 100644
--- a/fs/ntfs3/inode.c
+++ b/fs/ntfs3/inode.c
@@ -1498,7 +1498,7 @@ struct inode *ntfs_create_inode(struct mnt_idmap *idmap, struct inode *dir,
 			attr->size = cpu_to_le32(SIZEOF_NONRESIDENT_EX + 8);
 			attr->name_off = SIZEOF_NONRESIDENT_EX_LE;
 			attr->flags = ATTR_FLAG_COMPRESSED;
-			attr->nres.c_unit = COMPRESSION_UNIT;
+			attr->nres.c_unit = NTFS_LZNT_CUNIT;
 			asize = SIZEOF_NONRESIDENT_EX + 8;
 		} else {
 			attr->size = cpu_to_le32(SIZEOF_NONRESIDENT + 8);
@@ -1652,7 +1652,9 @@ struct inode *ntfs_create_inode(struct mnt_idmap *idmap, struct inode *dir,
 	 * The packed size of extended attribute is stored in direntry too.
 	 * 'fname' here points to inside new_de.
 	 */
-	ntfs_save_wsl_perm(inode, &fname->dup.ea_size);
+	err = ntfs_save_wsl_perm(inode, &fname->dup.ea_size);
+	if (err)
+		goto out6;
 
 	/*
 	 * update ea_size in file_name attribute too.
@@ -1694,6 +1696,12 @@ struct inode *ntfs_create_inode(struct mnt_idmap *idmap, struct inode *dir,
 	goto out2;
 
 out6:
+	attr = ni_find_attr(ni, NULL, NULL, ATTR_EA, NULL, 0, NULL, NULL);
+	if (attr && attr->non_res) {
+		/* Delete ATTR_EA, if non-resident. */
+		attr_set_size(ni, ATTR_EA, NULL, 0, NULL, 0, NULL, false, NULL);
+	}
+
 	if (rp_inserted)
 		ntfs_remove_reparse(sbi, IO_REPARSE_TAG_SYMLINK, &new_de->ref);
 
@@ -2117,5 +2125,6 @@ const struct address_space_operations ntfs_aops = {
 const struct address_space_operations ntfs_aops_cmpr = {
 	.read_folio	= ntfs_read_folio,
 	.readahead	= ntfs_readahead,
+	.dirty_folio	= block_dirty_folio,
 };
 // clang-format on
diff --git a/fs/ntfs3/ntfs.h b/fs/ntfs3/ntfs.h
index b70288cc5f6f..964e27c7b901 100644
--- a/fs/ntfs3/ntfs.h
+++ b/fs/ntfs3/ntfs.h
@@ -82,9 +82,6 @@ typedef u32 CLST;
 #define RESIDENT_LCN   ((CLST)-2)
 #define COMPRESSED_LCN ((CLST)-3)
 
-#define COMPRESSION_UNIT     4
-#define COMPRESS_MAX_CLUSTER 0x1000
-
 enum RECORD_NUM {
 	MFT_REC_MFT		= 0,
 	MFT_REC_MIRR		= 1,
@@ -696,14 +693,15 @@ static inline bool de_has_vcn_ex(const struct NTFS_DE *e)
 	      offsetof(struct ATTR_FILE_NAME, name) + \
 	      NTFS_NAME_LEN * sizeof(short), 8)
 
+#define NTFS_INDEX_HDR_HAS_SUBNODES cpu_to_le32(1)
+
 struct INDEX_HDR {
 	__le32 de_off;	// 0x00: The offset from the start of this structure
 			// to the first NTFS_DE.
 	__le32 used;	// 0x04: The size of this structure plus all
 			// entries (quad-word aligned).
 	__le32 total;	// 0x08: The allocated size of for this structure plus all entries.
-	u8 flags;	// 0x0C: 0x00 = Small directory, 0x01 = Large directory.
-	u8 res[3];
+	__le32 flags;	// 0x0C: 0x00 = Small directory, 0x01 = Large directory.
 
 	//
 	// de_off + used <= total
@@ -751,7 +749,7 @@ static inline struct NTFS_DE *hdr_next_de(const struct INDEX_HDR *hdr,
 
 static inline bool hdr_has_subnode(const struct INDEX_HDR *hdr)
 {
-	return hdr->flags & 1;
+	return hdr->flags & NTFS_INDEX_HDR_HAS_SUBNODES;
 }
 
 struct INDEX_BUFFER {
@@ -771,7 +769,7 @@ static inline bool ib_is_empty(const struct INDEX_BUFFER *ib)
 
 static inline bool ib_is_leaf(const struct INDEX_BUFFER *ib)
 {
-	return !(ib->ihdr.flags & 1);
+	return !(ib->ihdr.flags & NTFS_INDEX_HDR_HAS_SUBNODES);
 }
 
 /* Index root structure ( 0x90 ). */
diff --git a/fs/ntfs3/super.c b/fs/ntfs3/super.c
index 10659817f98c..d47cfa215a36 100644
--- a/fs/ntfs3/super.c
+++ b/fs/ntfs3/super.c
@@ -276,7 +276,7 @@ static const struct fs_parameter_spec ntfs_fs_parameters[] = {
 	fsparam_flag_no("acl",			Opt_acl),
 	fsparam_string("iocharset",		Opt_iocharset),
 	fsparam_flag_no("prealloc",		Opt_prealloc),
-	fsparam_flag_no("nocase",		Opt_nocase),
+	fsparam_flag_no("case",		Opt_nocase),
 	{}
 };
 // clang-format on
@@ -463,7 +463,7 @@ static int ntfs3_volinfo(struct seq_file *m, void *o)
 	struct super_block *sb = m->private;
 	struct ntfs_sb_info *sbi = sb->s_fs_info;
 
-	seq_printf(m, "ntfs%d.%d\n%u\n%zu\n\%zu\n%zu\n%s\n%s\n",
+	seq_printf(m, "ntfs%d.%d\n%u\n%zu\n%zu\n%zu\n%s\n%s\n",
 		   sbi->volume.major_ver, sbi->volume.minor_ver,
 		   sbi->cluster_size, sbi->used.bitmap.nbits,
 		   sbi->mft.bitmap.nbits,
diff --git a/fs/proc/task_mmu.c b/fs/proc/task_mmu.c
index ac605f143762..59571737e167 100644
--- a/fs/proc/task_mmu.c
+++ b/fs/proc/task_mmu.c
@@ -1358,8 +1358,7 @@ static inline pagemap_entry_t make_pme(u64 frame, u64 flags)
 	return (pagemap_entry_t) { .pme = (frame & PM_PFRAME_MASK) | flags };
 }
 
-static int add_to_pagemap(unsigned long addr, pagemap_entry_t *pme,
-			  struct pagemapread *pm)
+static int add_to_pagemap(pagemap_entry_t *pme, struct pagemapread *pm)
 {
 	pm->buffer[pm->pos++] = *pme;
 	if (pm->pos >= pm->len)
@@ -1386,7 +1385,7 @@ static int pagemap_pte_hole(unsigned long start, unsigned long end,
 			hole_end = end;
 
 		for (; addr < hole_end; addr += PAGE_SIZE) {
-			err = add_to_pagemap(addr, &pme, pm);
+			err = add_to_pagemap(&pme, pm);
 			if (err)
 				goto out;
 		}
@@ -1398,7 +1397,7 @@ static int pagemap_pte_hole(unsigned long start, unsigned long end,
 		if (vma->vm_flags & VM_SOFTDIRTY)
 			pme = make_pme(0, PM_SOFT_DIRTY);
 		for (; addr < min(end, vma->vm_end); addr += PAGE_SIZE) {
-			err = add_to_pagemap(addr, &pme, pm);
+			err = add_to_pagemap(&pme, pm);
 			if (err)
 				goto out;
 		}
@@ -1412,7 +1411,6 @@ static pagemap_entry_t pte_to_pagemap_entry(struct pagemapread *pm,
 {
 	u64 frame = 0, flags = 0;
 	struct page *page = NULL;
-	bool migration = false;
 
 	if (pte_present(pte)) {
 		if (pm->show_pfn)
@@ -1444,7 +1442,6 @@ static pagemap_entry_t pte_to_pagemap_entry(struct pagemapread *pm,
 			    (offset << MAX_SWAPFILES_SHIFT);
 		}
 		flags |= PM_SWAP;
-		migration = is_migration_entry(entry);
 		if (is_pfn_swap_entry(entry))
 			page = pfn_swap_entry_to_page(entry);
 		if (pte_marker_entry_uffd_wp(entry))
@@ -1453,7 +1450,7 @@ static pagemap_entry_t pte_to_pagemap_entry(struct pagemapread *pm,
 
 	if (page && !PageAnon(page))
 		flags |= PM_FILE;
-	if (page && !migration && page_mapcount(page) == 1)
+	if (page && (flags & PM_PRESENT) && page_mapcount(page) == 1)
 		flags |= PM_MMAP_EXCLUSIVE;
 	if (vma->vm_flags & VM_SOFTDIRTY)
 		flags |= PM_SOFT_DIRTY;
@@ -1470,10 +1467,10 @@ static int pagemap_pmd_range(pmd_t *pmdp, unsigned long addr, unsigned long end,
 	pte_t *pte, *orig_pte;
 	int err = 0;
 #ifdef CONFIG_TRANSPARENT_HUGEPAGE
-	bool migration = false;
 
 	ptl = pmd_trans_huge_lock(pmdp, vma);
 	if (ptl) {
+		unsigned int idx = (addr & ~PMD_MASK) >> PAGE_SHIFT;
 		u64 flags = 0, frame = 0;
 		pmd_t pmd = *pmdp;
 		struct page *page = NULL;
@@ -1490,8 +1487,7 @@ static int pagemap_pmd_range(pmd_t *pmdp, unsigned long addr, unsigned long end,
 			if (pmd_uffd_wp(pmd))
 				flags |= PM_UFFD_WP;
 			if (pm->show_pfn)
-				frame = pmd_pfn(pmd) +
-					((addr & ~PMD_MASK) >> PAGE_SHIFT);
+				frame = pmd_pfn(pmd) + idx;
 		}
 #ifdef CONFIG_ARCH_ENABLE_THP_MIGRATION
 		else if (is_swap_pmd(pmd)) {
@@ -1500,11 +1496,9 @@ static int pagemap_pmd_range(pmd_t *pmdp, unsigned long addr, unsigned long end,
 
 			if (pm->show_pfn) {
 				if (is_pfn_swap_entry(entry))
-					offset = swp_offset_pfn(entry);
+					offset = swp_offset_pfn(entry) + idx;
 				else
-					offset = swp_offset(entry);
-				offset = offset +
-					((addr & ~PMD_MASK) >> PAGE_SHIFT);
+					offset = swp_offset(entry) + idx;
 				frame = swp_type(entry) |
 					(offset << MAX_SWAPFILES_SHIFT);
 			}
@@ -1514,18 +1508,23 @@ static int pagemap_pmd_range(pmd_t *pmdp, unsigned long addr, unsigned long end,
 			if (pmd_swp_uffd_wp(pmd))
 				flags |= PM_UFFD_WP;
 			VM_BUG_ON(!is_pmd_migration_entry(pmd));
-			migration = is_migration_entry(entry);
 			page = pfn_swap_entry_to_page(entry);
 		}
 #endif
 
-		if (page && !migration && page_mapcount(page) == 1)
-			flags |= PM_MMAP_EXCLUSIVE;
+		if (page && !PageAnon(page))
+			flags |= PM_FILE;
+
+		for (; addr != end; addr += PAGE_SIZE, idx++) {
+			unsigned long cur_flags = flags;
+			pagemap_entry_t pme;
 
-		for (; addr != end; addr += PAGE_SIZE) {
-			pagemap_entry_t pme = make_pme(frame, flags);
+			if (page && (flags & PM_PRESENT) &&
+			    page_mapcount(page + idx) == 1)
+				cur_flags |= PM_MMAP_EXCLUSIVE;
 
-			err = add_to_pagemap(addr, &pme, pm);
+			pme = make_pme(frame, cur_flags);
+			err = add_to_pagemap(&pme, pm);
 			if (err)
 				break;
 			if (pm->show_pfn) {
@@ -1553,7 +1552,7 @@ static int pagemap_pmd_range(pmd_t *pmdp, unsigned long addr, unsigned long end,
 		pagemap_entry_t pme;
 
 		pme = pte_to_pagemap_entry(pm, vma, addr, ptep_get(pte));
-		err = add_to_pagemap(addr, &pme, pm);
+		err = add_to_pagemap(&pme, pm);
 		if (err)
 			break;
 	}
@@ -1603,7 +1602,7 @@ static int pagemap_hugetlb_range(pte_t *ptep, unsigned long hmask,
 	for (; addr != end; addr += PAGE_SIZE) {
 		pagemap_entry_t pme = make_pme(frame, flags);
 
-		err = add_to_pagemap(addr, &pme, pm);
+		err = add_to_pagemap(&pme, pm);
 		if (err)
 			return err;
 		if (pm->show_pfn && (flags & PM_PRESENT))
diff --git a/fs/smb/client/cifsfs.c b/fs/smb/client/cifsfs.c
index 19183b8f26b0..87caeff427a1 100644
--- a/fs/smb/client/cifsfs.c
+++ b/fs/smb/client/cifsfs.c
@@ -1885,12 +1885,12 @@ init_cifs(void)
 					   WQ_FREEZABLE|WQ_MEM_RECLAIM, 0);
 	if (!serverclose_wq) {
 		rc = -ENOMEM;
-		goto out_destroy_serverclose_wq;
+		goto out_destroy_deferredclose_wq;
 	}
 
 	rc = cifs_init_inodecache();
 	if (rc)
-		goto out_destroy_deferredclose_wq;
+		goto out_destroy_serverclose_wq;
 
 	rc = init_mids();
 	if (rc)
@@ -1952,6 +1952,8 @@ init_cifs(void)
 	destroy_mids();
 out_destroy_inodecache:
 	cifs_destroy_inodecache();
+out_destroy_serverclose_wq:
+	destroy_workqueue(serverclose_wq);
 out_destroy_deferredclose_wq:
 	destroy_workqueue(deferredclose_wq);
 out_destroy_cifsoplockd_wq:
@@ -1962,8 +1964,6 @@ init_cifs(void)
 	destroy_workqueue(decrypt_wq);
 out_destroy_cifsiod_wq:
 	destroy_workqueue(cifsiod_wq);
-out_destroy_serverclose_wq:
-	destroy_workqueue(serverclose_wq);
 out_clean_proc:
 	cifs_proc_clean();
 	return rc;
diff --git a/fs/smb/client/connect.c b/fs/smb/client/connect.c
index 7a16e12f5da8..d2307162a2de 100644
--- a/fs/smb/client/connect.c
+++ b/fs/smb/client/connect.c
@@ -2614,6 +2614,13 @@ cifs_get_tcon(struct cifs_ses *ses, struct smb3_fs_context *ctx)
 			cifs_dbg(VFS, "Server does not support mounting with posix SMB3.11 extensions\n");
 			rc = -EOPNOTSUPP;
 			goto out_fail;
+		} else if (ses->server->vals->protocol_id == SMB10_PROT_ID)
+			if (cap_unix(ses))
+				cifs_dbg(FYI, "Unix Extensions requested on SMB1 mount\n");
+			else {
+				cifs_dbg(VFS, "SMB1 Unix Extensions not supported by server\n");
+				rc = -EOPNOTSUPP;
+				goto out_fail;
 		} else {
 			cifs_dbg(VFS,
 				"Check vers= mount option. SMB3.11 disabled but required for POSIX extensions\n");
@@ -3686,6 +3693,7 @@ int cifs_mount(struct cifs_sb_info *cifs_sb, struct smb3_fs_context *ctx)
 }
 #endif
 
+#ifdef CONFIG_CIFS_ALLOW_INSECURE_LEGACY
 /*
  * Issue a TREE_CONNECT request.
  */
@@ -3807,11 +3815,25 @@ CIFSTCon(const unsigned int xid, struct cifs_ses *ses,
 		else
 			tcon->Flags = 0;
 		cifs_dbg(FYI, "Tcon flags: 0x%x\n", tcon->Flags);
-	}
 
+		/*
+		 * reset_cifs_unix_caps calls QFSInfo which requires
+		 * need_reconnect to be false, but we would not need to call
+		 * reset_caps if this were not a reconnect case so must check
+		 * need_reconnect flag here.  The caller will also clear
+		 * need_reconnect when tcon was successful but needed to be
+		 * cleared earlier in the case of unix extensions reconnect
+		 */
+		if (tcon->need_reconnect && tcon->unix_ext) {
+			cifs_dbg(FYI, "resetting caps for %s\n", tcon->tree_name);
+			tcon->need_reconnect = false;
+			reset_cifs_unix_caps(xid, tcon, NULL, NULL);
+		}
+	}
 	cifs_buf_release(smb_buffer);
 	return rc;
 }
+#endif /* CONFIG_CIFS_ALLOW_INSECURE_LEGACY */
 
 static void delayed_free(struct rcu_head *p)
 {
diff --git a/fs/super.c b/fs/super.c
index 2d762ce67f6e..576abb1ff040 100644
--- a/fs/super.c
+++ b/fs/super.c
@@ -781,6 +781,17 @@ struct super_block *sget_fc(struct fs_context *fc,
 	struct user_namespace *user_ns = fc->global ? &init_user_ns : fc->user_ns;
 	int err;
 
+	/*
+	 * Never allow s_user_ns != &init_user_ns when FS_USERNS_MOUNT is
+	 * not set, as the filesystem is likely unprepared to handle it.
+	 * This can happen when fsconfig() is called from init_user_ns with
+	 * an fs_fd opened in another user namespace.
+	 */
+	if (user_ns != &init_user_ns && !(fc->fs_type->fs_flags & FS_USERNS_MOUNT)) {
+		errorfc(fc, "VFS: Mounting from non-initial user namespace is not allowed");
+		return ERR_PTR(-EPERM);
+	}
+
 retry:
 	spin_lock(&sb_lock);
 	if (test) {
diff --git a/fs/udf/balloc.c b/fs/udf/balloc.c
index ab3ffc355949..558ad046972a 100644
--- a/fs/udf/balloc.c
+++ b/fs/udf/balloc.c
@@ -64,8 +64,12 @@ static int read_block_bitmap(struct super_block *sb,
 	}
 
 	for (i = 0; i < count; i++)
-		if (udf_test_bit(i + off, bh->b_data))
+		if (udf_test_bit(i + off, bh->b_data)) {
+			bitmap->s_block_bitmap[bitmap_nr] =
+							ERR_PTR(-EFSCORRUPTED);
+			brelse(bh);
 			return -EFSCORRUPTED;
+		}
 	return 0;
 }
 
@@ -81,8 +85,15 @@ static int __load_block_bitmap(struct super_block *sb,
 			  block_group, nr_groups);
 	}
 
-	if (bitmap->s_block_bitmap[block_group])
+	if (bitmap->s_block_bitmap[block_group]) {
+		/*
+		 * The bitmap failed verification in the past. No point in
+		 * trying again.
+		 */
+		if (IS_ERR(bitmap->s_block_bitmap[block_group]))
+			return PTR_ERR(bitmap->s_block_bitmap[block_group]);
 		return block_group;
+	}
 
 	retval = read_block_bitmap(sb, bitmap, block_group, block_group);
 	if (retval < 0)
diff --git a/fs/udf/file.c b/fs/udf/file.c
index 0ceac4b5937c..94daaaf76f71 100644
--- a/fs/udf/file.c
+++ b/fs/udf/file.c
@@ -232,7 +232,9 @@ static int udf_setattr(struct mnt_idmap *idmap, struct dentry *dentry,
 
 	if ((attr->ia_valid & ATTR_SIZE) &&
 	    attr->ia_size != i_size_read(inode)) {
+		filemap_invalidate_lock(inode->i_mapping);
 		error = udf_setsize(inode, attr->ia_size);
+		filemap_invalidate_unlock(inode->i_mapping);
 		if (error)
 			return error;
 	}
diff --git a/fs/udf/inode.c b/fs/udf/inode.c
index 1ff8c1f17f9e..8db07d1f56bc 100644
--- a/fs/udf/inode.c
+++ b/fs/udf/inode.c
@@ -1252,7 +1252,6 @@ int udf_setsize(struct inode *inode, loff_t newsize)
 	if (IS_APPEND(inode) || IS_IMMUTABLE(inode))
 		return -EPERM;
 
-	filemap_invalidate_lock(inode->i_mapping);
 	iinfo = UDF_I(inode);
 	if (newsize > inode->i_size) {
 		if (iinfo->i_alloc_type == ICBTAG_FLAG_AD_IN_ICB) {
@@ -1265,11 +1264,11 @@ int udf_setsize(struct inode *inode, loff_t newsize)
 			}
 			err = udf_expand_file_adinicb(inode);
 			if (err)
-				goto out_unlock;
+				return err;
 		}
 		err = udf_extend_file(inode, newsize);
 		if (err)
-			goto out_unlock;
+			return err;
 set_size:
 		truncate_setsize(inode, newsize);
 	} else {
@@ -1287,14 +1286,14 @@ int udf_setsize(struct inode *inode, loff_t newsize)
 		err = block_truncate_page(inode->i_mapping, newsize,
 					  udf_get_block);
 		if (err)
-			goto out_unlock;
+			return err;
 		truncate_setsize(inode, newsize);
 		down_write(&iinfo->i_data_sem);
 		udf_clear_extent_cache(inode);
 		err = udf_truncate_extents(inode);
 		up_write(&iinfo->i_data_sem);
 		if (err)
-			goto out_unlock;
+			return err;
 	}
 update_time:
 	inode->i_mtime = inode_set_ctime_current(inode);
@@ -1302,8 +1301,6 @@ int udf_setsize(struct inode *inode, loff_t newsize)
 		udf_sync_inode(inode);
 	else
 		mark_inode_dirty(inode);
-out_unlock:
-	filemap_invalidate_unlock(inode->i_mapping);
 	return err;
 }
 
diff --git a/fs/udf/namei.c b/fs/udf/namei.c
index ae55ab8859b6..605f182da42c 100644
--- a/fs/udf/namei.c
+++ b/fs/udf/namei.c
@@ -874,8 +874,6 @@ static int udf_rename(struct mnt_idmap *idmap, struct inode *old_dir,
 	if (has_diriter) {
 		diriter.fi.icb.extLocation =
 					cpu_to_lelb(UDF_I(new_dir)->i_location);
-		udf_update_tag((char *)&diriter.fi,
-			       udf_dir_entry_len(&diriter.fi));
 		udf_fiiter_write_fi(&diriter, NULL);
 		udf_fiiter_release(&diriter);
 
diff --git a/fs/udf/super.c b/fs/udf/super.c
index 928a04d9d9e0..e0080fda2526 100644
--- a/fs/udf/super.c
+++ b/fs/udf/super.c
@@ -269,7 +269,8 @@ static void udf_sb_free_bitmap(struct udf_bitmap *bitmap)
 	int nr_groups = bitmap->s_nr_groups;
 
 	for (i = 0; i < nr_groups; i++)
-		brelse(bitmap->s_block_bitmap[i]);
+		if (!IS_ERR_OR_NULL(bitmap->s_block_bitmap[i]))
+			brelse(bitmap->s_block_bitmap[i]);
 
 	kvfree(bitmap);
 }
diff --git a/include/asm-generic/vmlinux.lds.h b/include/asm-generic/vmlinux.lds.h
index bae0fe4d499b..63029bc7c9dd 100644
--- a/include/asm-generic/vmlinux.lds.h
+++ b/include/asm-generic/vmlinux.lds.h
@@ -101,7 +101,7 @@
 #define DATA_MAIN .data .data.[0-9a-zA-Z_]* .data..L* .data..compoundliteral* .data.$__unnamed_* .data.$L*
 #define SDATA_MAIN .sdata .sdata.[0-9a-zA-Z_]*
 #define RODATA_MAIN .rodata .rodata.[0-9a-zA-Z_]* .rodata..L*
-#define BSS_MAIN .bss .bss.[0-9a-zA-Z_]* .bss..compoundliteral*
+#define BSS_MAIN .bss .bss.[0-9a-zA-Z_]* .bss..L* .bss..compoundliteral*
 #define SBSS_MAIN .sbss .sbss.[0-9a-zA-Z_]*
 #else
 #define TEXT_MAIN .text
diff --git a/include/drm/drm_mipi_dsi.h b/include/drm/drm_mipi_dsi.h
index 3011d33eccbd..900262f4c234 100644
--- a/include/drm/drm_mipi_dsi.h
+++ b/include/drm/drm_mipi_dsi.h
@@ -305,17 +305,17 @@ int mipi_dsi_dcs_get_display_brightness_large(struct mipi_dsi_device *dsi,
  * @dsi: DSI peripheral device
  * @seq: buffer containing the payload
  */
-#define mipi_dsi_generic_write_seq(dsi, seq...)                                \
-	do {                                                                   \
-		static const u8 d[] = { seq };                                 \
-		struct device *dev = &dsi->dev;                                \
-		int ret;                                                       \
-		ret = mipi_dsi_generic_write(dsi, d, ARRAY_SIZE(d));           \
-		if (ret < 0) {                                                 \
-			dev_err_ratelimited(dev, "transmit data failed: %d\n", \
-					    ret);                              \
-			return ret;                                            \
-		}                                                              \
+#define mipi_dsi_generic_write_seq(dsi, seq...)                                 \
+	do {                                                                    \
+		static const u8 d[] = { seq };                                  \
+		struct device *dev = &dsi->dev;                                 \
+		ssize_t ret;                                                    \
+		ret = mipi_dsi_generic_write(dsi, d, ARRAY_SIZE(d));            \
+		if (ret < 0) {                                                  \
+			dev_err_ratelimited(dev, "transmit data failed: %zd\n", \
+					    ret);                               \
+			return ret;                                             \
+		}                                                               \
 	} while (0)
 
 /**
@@ -324,18 +324,18 @@ int mipi_dsi_dcs_get_display_brightness_large(struct mipi_dsi_device *dsi,
  * @cmd: Command
  * @seq: buffer containing data to be transmitted
  */
-#define mipi_dsi_dcs_write_seq(dsi, cmd, seq...)                           \
-	do {                                                               \
-		static const u8 d[] = { cmd, seq };                        \
-		struct device *dev = &dsi->dev;                            \
-		int ret;                                                   \
-		ret = mipi_dsi_dcs_write_buffer(dsi, d, ARRAY_SIZE(d));    \
-		if (ret < 0) {                                             \
-			dev_err_ratelimited(                               \
-				dev, "sending command %#02x failed: %d\n", \
-				cmd, ret);                                 \
-			return ret;                                        \
-		}                                                          \
+#define mipi_dsi_dcs_write_seq(dsi, cmd, seq...)                            \
+	do {                                                                \
+		static const u8 d[] = { cmd, seq };                         \
+		struct device *dev = &dsi->dev;                             \
+		ssize_t ret;                                                \
+		ret = mipi_dsi_dcs_write_buffer(dsi, d, ARRAY_SIZE(d));     \
+		if (ret < 0) {                                              \
+			dev_err_ratelimited(                                \
+				dev, "sending command %#02x failed: %zd\n", \
+				cmd, ret);                                  \
+			return ret;                                         \
+		}                                                           \
 	} while (0)
 
 /**
diff --git a/include/linux/bpf_verifier.h b/include/linux/bpf_verifier.h
index 2d84d820a7ba..b62535fd8de5 100644
--- a/include/linux/bpf_verifier.h
+++ b/include/linux/bpf_verifier.h
@@ -760,7 +760,7 @@ static inline u32 type_flag(u32 type)
 /* only use after check_attach_btf_id() */
 static inline enum bpf_prog_type resolve_prog_type(const struct bpf_prog *prog)
 {
-	return prog->type == BPF_PROG_TYPE_EXT ?
+	return (prog->type == BPF_PROG_TYPE_EXT && prog->aux->dst_prog) ?
 		prog->aux->dst_prog->type : prog->type;
 }
 
diff --git a/include/linux/hugetlb.h b/include/linux/hugetlb.h
index 31b2927ada73..0c50c4fceb95 100644
--- a/include/linux/hugetlb.h
+++ b/include/linux/hugetlb.h
@@ -713,6 +713,7 @@ HPAGEFLAG(RawHwpUnreliable, raw_hwp_unreliable)
 /* Defines one hugetlb page size */
 struct hstate {
 	struct mutex resize_lock;
+	struct lock_class_key resize_key;
 	int next_nid_to_alloc;
 	int next_nid_to_free;
 	unsigned int order;
diff --git a/include/linux/jbd2.h b/include/linux/jbd2.h
index 0fc6c1f51262..8553dc1d0e89 100644
--- a/include/linux/jbd2.h
+++ b/include/linux/jbd2.h
@@ -1083,6 +1083,13 @@ struct journal_s
 	 */
 	int			j_revoke_records_per_block;
 
+	/**
+	 * @j_transaction_overhead:
+	 *
+	 * Number of blocks each transaction needs for its own bookkeeping
+	 */
+	int			j_transaction_overhead_buffers;
+
 	/**
 	 * @j_commit_interval:
 	 *
@@ -1666,11 +1673,6 @@ int jbd2_wait_inode_data(journal_t *journal, struct jbd2_inode *jinode);
 int jbd2_fc_wait_bufs(journal_t *journal, int num_blks);
 int jbd2_fc_release_bufs(journal_t *journal);
 
-static inline int jbd2_journal_get_max_txn_bufs(journal_t *journal)
-{
-	return (journal->j_total_len - journal->j_fc_wbufsize) / 4;
-}
-
 /*
  * is_journal_abort
  *
diff --git a/include/linux/mlx5/qp.h b/include/linux/mlx5/qp.h
index f0e55bf3ec8b..ad1ce650146c 100644
--- a/include/linux/mlx5/qp.h
+++ b/include/linux/mlx5/qp.h
@@ -576,9 +576,12 @@ static inline const char *mlx5_qp_state_str(int state)
 
 static inline int mlx5_get_qp_default_ts(struct mlx5_core_dev *dev)
 {
-	return !MLX5_CAP_ROCE(dev, qp_ts_format) ?
-		       MLX5_TIMESTAMP_FORMAT_FREE_RUNNING :
-		       MLX5_TIMESTAMP_FORMAT_DEFAULT;
+	u8 supported_ts_cap = mlx5_get_roce_state(dev) ?
+			      MLX5_CAP_ROCE(dev, qp_ts_format) :
+			      MLX5_CAP_GEN(dev, sq_ts_format);
+
+	return supported_ts_cap ? MLX5_TIMESTAMP_FORMAT_DEFAULT :
+	       MLX5_TIMESTAMP_FORMAT_FREE_RUNNING;
 }
 
 #endif /* MLX5_QP_H */
diff --git a/include/linux/objagg.h b/include/linux/objagg.h
index 78021777df46..6df5b887dc54 100644
--- a/include/linux/objagg.h
+++ b/include/linux/objagg.h
@@ -8,7 +8,6 @@ struct objagg_ops {
 	size_t obj_size;
 	bool (*delta_check)(void *priv, const void *parent_obj,
 			    const void *obj);
-	int (*hints_obj_cmp)(const void *obj1, const void *obj2);
 	void * (*delta_create)(void *priv, void *parent_obj, void *obj);
 	void (*delta_destroy)(void *priv, void *delta_priv);
 	void * (*root_create)(void *priv, void *obj, unsigned int root_id);
diff --git a/include/linux/pci.h b/include/linux/pci.h
index 512cb40150df..f14130011621 100644
--- a/include/linux/pci.h
+++ b/include/linux/pci.h
@@ -1146,6 +1146,7 @@ int pci_get_interrupt_pin(struct pci_dev *dev, struct pci_dev **bridge);
 u8 pci_common_swizzle(struct pci_dev *dev, u8 *pinp);
 struct pci_dev *pci_dev_get(struct pci_dev *dev);
 void pci_dev_put(struct pci_dev *dev);
+DEFINE_FREE(pci_dev_put, struct pci_dev *, if (_T) pci_dev_put(_T))
 void pci_remove_bus(struct pci_bus *b);
 void pci_stop_and_remove_bus_device(struct pci_dev *dev);
 void pci_stop_and_remove_bus_device_locked(struct pci_dev *dev);
@@ -1851,6 +1852,7 @@ void pci_cfg_access_unlock(struct pci_dev *dev);
 void pci_dev_lock(struct pci_dev *dev);
 int pci_dev_trylock(struct pci_dev *dev);
 void pci_dev_unlock(struct pci_dev *dev);
+DEFINE_GUARD(pci_dev, struct pci_dev *, pci_dev_lock(_T), pci_dev_unlock(_T))
 
 /*
  * PCI domain support.  Sometimes called PCI segment (eg by ACPI),
diff --git a/include/linux/perf_event.h b/include/linux/perf_event.h
index e846f87e2d09..95d4118ee4a9 100644
--- a/include/linux/perf_event.h
+++ b/include/linux/perf_event.h
@@ -786,6 +786,7 @@ struct perf_event {
 	struct irq_work			pending_irq;
 	struct callback_head		pending_task;
 	unsigned int			pending_work;
+	struct rcuwait			pending_work_wait;
 
 	atomic_t			event_limit;
 
diff --git a/include/linux/sbitmap.h b/include/linux/sbitmap.h
index d662cf136021..c09cdcc99471 100644
--- a/include/linux/sbitmap.h
+++ b/include/linux/sbitmap.h
@@ -36,6 +36,11 @@ struct sbitmap_word {
 	 * @cleared: word holding cleared bits
 	 */
 	unsigned long cleared ____cacheline_aligned_in_smp;
+
+	/**
+	 * @swap_lock: serializes simultaneous updates of ->word and ->cleared
+	 */
+	spinlock_t swap_lock;
 } ____cacheline_aligned_in_smp;
 
 /**
diff --git a/include/linux/task_work.h b/include/linux/task_work.h
index 795ef5a68429..26b8a47f41fc 100644
--- a/include/linux/task_work.h
+++ b/include/linux/task_work.h
@@ -30,7 +30,8 @@ int task_work_add(struct task_struct *task, struct callback_head *twork,
 
 struct callback_head *task_work_cancel_match(struct task_struct *task,
 	bool (*match)(struct callback_head *, void *data), void *data);
-struct callback_head *task_work_cancel(struct task_struct *, task_work_func_t);
+struct callback_head *task_work_cancel_func(struct task_struct *, task_work_func_t);
+bool task_work_cancel(struct task_struct *task, struct callback_head *cb);
 void task_work_run(void);
 
 static inline void exit_task_work(struct task_struct *task)
diff --git a/include/linux/virtio_net.h b/include/linux/virtio_net.h
index 4dfa9b69ca8d..d1d7825318c3 100644
--- a/include/linux/virtio_net.h
+++ b/include/linux/virtio_net.h
@@ -56,6 +56,7 @@ static inline int virtio_net_hdr_to_skb(struct sk_buff *skb,
 	unsigned int thlen = 0;
 	unsigned int p_off = 0;
 	unsigned int ip_proto;
+	u64 ret, remainder, gso_size;
 
 	if (hdr->gso_type != VIRTIO_NET_HDR_GSO_NONE) {
 		switch (hdr->gso_type & ~VIRTIO_NET_HDR_GSO_ECN) {
@@ -98,6 +99,16 @@ static inline int virtio_net_hdr_to_skb(struct sk_buff *skb,
 		u32 off = __virtio16_to_cpu(little_endian, hdr->csum_offset);
 		u32 needed = start + max_t(u32, thlen, off + sizeof(__sum16));
 
+		if (hdr->gso_size) {
+			gso_size = __virtio16_to_cpu(little_endian, hdr->gso_size);
+			ret = div64_u64_rem(skb->len, gso_size, &remainder);
+			if (!(ret && (hdr->gso_size > needed) &&
+						((remainder > needed) || (remainder == 0)))) {
+				return -EINVAL;
+			}
+			skb_shinfo(skb)->tx_flags |= SKBFL_SHARED_FRAG;
+		}
+
 		if (!pskb_may_pull(skb, needed))
 			return -EINVAL;
 
diff --git a/include/net/ip_fib.h b/include/net/ip_fib.h
index 15de07d36540..ca1700c2a573 100644
--- a/include/net/ip_fib.h
+++ b/include/net/ip_fib.h
@@ -173,6 +173,7 @@ struct fib_result {
 	unsigned char		type;
 	unsigned char		scope;
 	u32			tclassid;
+	dscp_t			dscp;
 	struct fib_nh_common	*nhc;
 	struct fib_info		*fi;
 	struct fib_table	*table;
diff --git a/include/net/tcp.h b/include/net/tcp.h
index 690770321a6e..71af24410443 100644
--- a/include/net/tcp.h
+++ b/include/net/tcp.h
@@ -624,6 +624,7 @@ void tcp_skb_collapse_tstamp(struct sk_buff *skb,
 /* tcp_input.c */
 void tcp_rearm_rto(struct sock *sk);
 void tcp_synack_rtt_meas(struct sock *sk, struct request_sock *req);
+void tcp_done_with_error(struct sock *sk, int err);
 void tcp_reset(struct sock *sk, struct sk_buff *skb);
 void tcp_fin(struct sock *sk);
 void tcp_check_space(struct sock *sk);
diff --git a/include/net/xfrm.h b/include/net/xfrm.h
index a3fd2cfed5e3..b280e7c46011 100644
--- a/include/net/xfrm.h
+++ b/include/net/xfrm.h
@@ -176,7 +176,10 @@ struct xfrm_state {
 		struct hlist_node	gclist;
 		struct hlist_node	bydst;
 	};
-	struct hlist_node	bysrc;
+	union {
+		struct hlist_node	dev_gclist;
+		struct hlist_node	bysrc;
+	};
 	struct hlist_node	byspi;
 	struct hlist_node	byseq;
 
@@ -1584,7 +1587,7 @@ int xfrm_state_check_expire(struct xfrm_state *x);
 static inline void xfrm_dev_state_update_curlft(struct xfrm_state *x)
 {
 	struct xfrm_dev_offload *xdo = &x->xso;
-	struct net_device *dev = xdo->dev;
+	struct net_device *dev = READ_ONCE(xdo->dev);
 
 	if (x->xso.type != XFRM_DEV_OFFLOAD_PACKET)
 		return;
@@ -1943,13 +1946,16 @@ int xfrm_dev_policy_add(struct net *net, struct xfrm_policy *xp,
 			struct xfrm_user_offload *xuo, u8 dir,
 			struct netlink_ext_ack *extack);
 bool xfrm_dev_offload_ok(struct sk_buff *skb, struct xfrm_state *x);
+void xfrm_dev_state_delete(struct xfrm_state *x);
+void xfrm_dev_state_free(struct xfrm_state *x);
 
 static inline void xfrm_dev_state_advance_esn(struct xfrm_state *x)
 {
 	struct xfrm_dev_offload *xso = &x->xso;
+	struct net_device *dev = READ_ONCE(xso->dev);
 
-	if (xso->dev && xso->dev->xfrmdev_ops->xdo_dev_state_advance_esn)
-		xso->dev->xfrmdev_ops->xdo_dev_state_advance_esn(x);
+	if (dev && dev->xfrmdev_ops->xdo_dev_state_advance_esn)
+		dev->xfrmdev_ops->xdo_dev_state_advance_esn(x);
 }
 
 static inline bool xfrm_dst_offload_ok(struct dst_entry *dst)
@@ -1970,28 +1976,6 @@ static inline bool xfrm_dst_offload_ok(struct dst_entry *dst)
 	return false;
 }
 
-static inline void xfrm_dev_state_delete(struct xfrm_state *x)
-{
-	struct xfrm_dev_offload *xso = &x->xso;
-
-	if (xso->dev)
-		xso->dev->xfrmdev_ops->xdo_dev_state_delete(x);
-}
-
-static inline void xfrm_dev_state_free(struct xfrm_state *x)
-{
-	struct xfrm_dev_offload *xso = &x->xso;
-	struct net_device *dev = xso->dev;
-
-	if (dev && dev->xfrmdev_ops) {
-		if (dev->xfrmdev_ops->xdo_dev_state_free)
-			dev->xfrmdev_ops->xdo_dev_state_free(x);
-		xso->dev = NULL;
-		xso->type = XFRM_DEV_OFFLOAD_UNSPECIFIED;
-		netdev_put(dev, &xso->dev_tracker);
-	}
-}
-
 static inline void xfrm_dev_policy_delete(struct xfrm_policy *x)
 {
 	struct xfrm_dev_offload *xdo = &x->xdo;
diff --git a/include/sound/tas2781-dsp.h b/include/sound/tas2781-dsp.h
index 4ef0f5c6fe6c..af3319dab230 100644
--- a/include/sound/tas2781-dsp.h
+++ b/include/sound/tas2781-dsp.h
@@ -112,10 +112,17 @@ struct tasdevice_fw {
 	struct device *dev;
 };
 
-enum tasdevice_dsp_fw_state {
-	TASDEVICE_DSP_FW_NONE = 0,
+enum tasdevice_fw_state {
+	/* Driver in startup mode, not load any firmware. */
 	TASDEVICE_DSP_FW_PENDING,
+	/* DSP firmware in the system, but parsing error. */
 	TASDEVICE_DSP_FW_FAIL,
+	/*
+	 * Only RCA (Reconfigurable Architecture) firmware load
+	 * successfully.
+	 */
+	TASDEVICE_RCA_FW_OK,
+	/* Both RCA and DSP firmware load successfully. */
 	TASDEVICE_DSP_FW_ALL_OK,
 };
 
diff --git a/include/trace/events/rpcgss.h b/include/trace/events/rpcgss.h
index f50fcafc69de..78704f1209d3 100644
--- a/include/trace/events/rpcgss.h
+++ b/include/trace/events/rpcgss.h
@@ -54,7 +54,7 @@ TRACE_DEFINE_ENUM(GSS_S_UNSEQ_TOKEN);
 TRACE_DEFINE_ENUM(GSS_S_GAP_TOKEN);
 
 #define show_gss_status(x)						\
-	__print_flags(x, "|",						\
+	__print_symbolic(x, 						\
 		{ GSS_S_BAD_MECH, "GSS_S_BAD_MECH" },			\
 		{ GSS_S_BAD_NAME, "GSS_S_BAD_NAME" },			\
 		{ GSS_S_BAD_NAMETYPE, "GSS_S_BAD_NAMETYPE" },		\
diff --git a/include/uapi/linux/netfilter/nf_tables.h b/include/uapi/linux/netfilter/nf_tables.h
index 117c6a9b845b..621e3035145e 100644
--- a/include/uapi/linux/netfilter/nf_tables.h
+++ b/include/uapi/linux/netfilter/nf_tables.h
@@ -1372,7 +1372,7 @@ enum nft_secmark_attributes {
 #define NFTA_SECMARK_MAX	(__NFTA_SECMARK_MAX - 1)
 
 /* Max security context length */
-#define NFT_SECMARK_CTX_MAXLEN		256
+#define NFT_SECMARK_CTX_MAXLEN		4096
 
 /**
  * enum nft_reject_types - nf_tables reject expression reject types
diff --git a/include/uapi/linux/zorro_ids.h b/include/uapi/linux/zorro_ids.h
index 6e574d7b7d79..393f2ee9c042 100644
--- a/include/uapi/linux/zorro_ids.h
+++ b/include/uapi/linux/zorro_ids.h
@@ -449,6 +449,9 @@
 #define  ZORRO_PROD_VMC_ISDN_BLASTER_Z2				ZORRO_ID(VMC, 0x01, 0)
 #define  ZORRO_PROD_VMC_HYPERCOM_4				ZORRO_ID(VMC, 0x02, 0)
 
+#define ZORRO_MANUF_CSLAB					0x1400
+#define  ZORRO_PROD_CSLAB_WARP_1260				ZORRO_ID(CSLAB, 0x65, 0)
+
 #define ZORRO_MANUF_INFORMATION					0x157C
 #define  ZORRO_PROD_INFORMATION_ISDN_ENGINE_I			ZORRO_ID(INFORMATION, 0x64, 0)
 
diff --git a/include/ufs/ufshcd.h b/include/ufs/ufshcd.h
index 7d07b256e906..e4da39736068 100644
--- a/include/ufs/ufshcd.h
+++ b/include/ufs/ufshcd.h
@@ -1117,6 +1117,12 @@ static inline bool is_mcq_enabled(struct ufs_hba *hba)
 	return hba->mcq_enabled;
 }
 
+static inline unsigned int ufshcd_mcq_opr_offset(struct ufs_hba *hba,
+		enum ufshcd_mcq_opr opr, int idx)
+{
+	return hba->mcq_opr[opr].offset + hba->mcq_opr[opr].stride * idx;
+}
+
 #ifdef CONFIG_SCSI_UFS_VARIABLE_SG_ENTRY_SIZE
 static inline size_t ufshcd_sg_entry_size(const struct ufs_hba *hba)
 {
diff --git a/io_uring/io-wq.c b/io_uring/io-wq.c
index 8a99aabcac2c..98c9cfb98306 100644
--- a/io_uring/io-wq.c
+++ b/io_uring/io-wq.c
@@ -23,6 +23,7 @@
 #include "io_uring.h"
 
 #define WORKER_IDLE_TIMEOUT	(5 * HZ)
+#define WORKER_INIT_LIMIT	3
 
 enum {
 	IO_WORKER_F_UP		= 0,	/* up and active */
@@ -59,6 +60,7 @@ struct io_worker {
 
 	unsigned long create_state;
 	struct callback_head create_work;
+	int init_retries;
 
 	union {
 		struct rcu_head rcu;
@@ -746,7 +748,7 @@ static bool io_wq_work_match_all(struct io_wq_work *work, void *data)
 	return true;
 }
 
-static inline bool io_should_retry_thread(long err)
+static inline bool io_should_retry_thread(struct io_worker *worker, long err)
 {
 	/*
 	 * Prevent perpetual task_work retry, if the task (or its group) is
@@ -754,6 +756,8 @@ static inline bool io_should_retry_thread(long err)
 	 */
 	if (fatal_signal_pending(current))
 		return false;
+	if (worker->init_retries++ >= WORKER_INIT_LIMIT)
+		return false;
 
 	switch (err) {
 	case -EAGAIN:
@@ -780,7 +784,7 @@ static void create_worker_cont(struct callback_head *cb)
 		io_init_new_worker(wq, worker, tsk);
 		io_worker_release(worker);
 		return;
-	} else if (!io_should_retry_thread(PTR_ERR(tsk))) {
+	} else if (!io_should_retry_thread(worker, PTR_ERR(tsk))) {
 		struct io_wq_acct *acct = io_wq_get_acct(worker);
 
 		atomic_dec(&acct->nr_running);
@@ -847,7 +851,7 @@ static bool create_io_worker(struct io_wq *wq, int index)
 	tsk = create_io_thread(io_wq_worker, worker, NUMA_NO_NODE);
 	if (!IS_ERR(tsk)) {
 		io_init_new_worker(wq, worker, tsk);
-	} else if (!io_should_retry_thread(PTR_ERR(tsk))) {
+	} else if (!io_should_retry_thread(worker, PTR_ERR(tsk))) {
 		kfree(worker);
 		goto fail;
 	} else {
diff --git a/io_uring/io_uring.c b/io_uring/io_uring.c
index a5628d29b9b1..68504709f75c 100644
--- a/io_uring/io_uring.c
+++ b/io_uring/io_uring.c
@@ -3350,8 +3350,11 @@ __cold void io_uring_cancel_generic(bool cancel_all, struct io_sq_data *sqd)
 		bool loop = false;
 
 		io_uring_drop_tctx_refs(current);
+		if (!tctx_inflight(tctx, !cancel_all))
+			break;
+
 		/* read completions before cancelations */
-		inflight = tctx_inflight(tctx, !cancel_all);
+		inflight = tctx_inflight(tctx, false);
 		if (!inflight)
 			break;
 
diff --git a/io_uring/timeout.c b/io_uring/timeout.c
index 7fd7dbb211d6..4f1f710197d6 100644
--- a/io_uring/timeout.c
+++ b/io_uring/timeout.c
@@ -644,7 +644,7 @@ void io_queue_linked_timeout(struct io_kiocb *req)
 
 static bool io_match_task(struct io_kiocb *head, struct task_struct *task,
 			  bool cancel_all)
-	__must_hold(&req->ctx->timeout_lock)
+	__must_hold(&head->ctx->timeout_lock)
 {
 	struct io_kiocb *req;
 
diff --git a/kernel/bpf/btf.c b/kernel/bpf/btf.c
index a31704a6bb61..fbf9721ba21b 100644
--- a/kernel/bpf/btf.c
+++ b/kernel/bpf/btf.c
@@ -405,7 +405,7 @@ const char *btf_type_str(const struct btf_type *t)
 struct btf_show {
 	u64 flags;
 	void *target;	/* target of show operation (seq file, buffer) */
-	void (*showfn)(struct btf_show *show, const char *fmt, va_list args);
+	__printf(2, 0) void (*showfn)(struct btf_show *show, const char *fmt, va_list args);
 	const struct btf *btf;
 	/* below are used during iteration */
 	struct {
@@ -7070,8 +7070,8 @@ static void btf_type_show(const struct btf *btf, u32 type_id, void *obj,
 	btf_type_ops(t)->show(btf, t, type_id, obj, 0, show);
 }
 
-static void btf_seq_show(struct btf_show *show, const char *fmt,
-			 va_list args)
+__printf(2, 0) static void btf_seq_show(struct btf_show *show, const char *fmt,
+					va_list args)
 {
 	seq_vprintf((struct seq_file *)show->target, fmt, args);
 }
@@ -7104,8 +7104,8 @@ struct btf_show_snprintf {
 	int len;		/* length we would have written */
 };
 
-static void btf_snprintf_show(struct btf_show *show, const char *fmt,
-			      va_list args)
+__printf(2, 0) static void btf_snprintf_show(struct btf_show *show, const char *fmt,
+					     va_list args)
 {
 	struct btf_show_snprintf *ssnprintf = (struct btf_show_snprintf *)show;
 	int len;
diff --git a/kernel/cgroup/cgroup-v1.c b/kernel/cgroup/cgroup-v1.c
index 76db6c67e39a..9cb00ebe9ac6 100644
--- a/kernel/cgroup/cgroup-v1.c
+++ b/kernel/cgroup/cgroup-v1.c
@@ -802,7 +802,7 @@ void cgroup1_release_agent(struct work_struct *work)
 		goto out_free;
 
 	ret = cgroup_path_ns(cgrp, pathbuf, PATH_MAX, &init_cgroup_ns);
-	if (ret < 0 || ret >= PATH_MAX)
+	if (ret < 0)
 		goto out_free;
 
 	argv[0] = agentbuf;
diff --git a/kernel/cgroup/cgroup.c b/kernel/cgroup/cgroup.c
index 518725b57200..094f51331925 100644
--- a/kernel/cgroup/cgroup.c
+++ b/kernel/cgroup/cgroup.c
@@ -1887,7 +1887,7 @@ int cgroup_show_path(struct seq_file *sf, struct kernfs_node *kf_node,
 	len = kernfs_path_from_node(kf_node, ns_cgroup->kn, buf, PATH_MAX);
 	spin_unlock_irq(&css_set_lock);
 
-	if (len >= PATH_MAX)
+	if (len == -E2BIG)
 		len = -ERANGE;
 	else if (len > 0) {
 		seq_escape(sf, buf, " \t\n\\");
@@ -6277,7 +6277,7 @@ int proc_cgroup_show(struct seq_file *m, struct pid_namespace *ns,
 		if (cgroup_on_dfl(cgrp) || !(tsk->flags & PF_EXITING)) {
 			retval = cgroup_path_ns_locked(cgrp, buf, PATH_MAX,
 						current->nsproxy->cgroup_ns);
-			if (retval >= PATH_MAX)
+			if (retval == -E2BIG)
 				retval = -ENAMETOOLONG;
 			if (retval < 0)
 				goto out_unlock;
diff --git a/kernel/cgroup/cpuset.c b/kernel/cgroup/cpuset.c
index 679460ebccfb..3646426c69e2 100644
--- a/kernel/cgroup/cpuset.c
+++ b/kernel/cgroup/cpuset.c
@@ -21,6 +21,7 @@
  *  License.  See the file COPYING in the main directory of the Linux
  *  distribution for more details.
  */
+#include "cgroup-internal.h"
 
 #include <linux/cpu.h>
 #include <linux/cpumask.h>
@@ -4293,11 +4294,15 @@ int proc_cpuset_show(struct seq_file *m, struct pid_namespace *ns,
 	if (!buf)
 		goto out;
 
-	css = task_get_css(tsk, cpuset_cgrp_id);
-	retval = cgroup_path_ns(css->cgroup, buf, PATH_MAX,
-				current->nsproxy->cgroup_ns);
-	css_put(css);
-	if (retval >= PATH_MAX)
+	rcu_read_lock();
+	spin_lock_irq(&css_set_lock);
+	css = task_css(tsk, cpuset_cgrp_id);
+	retval = cgroup_path_ns_locked(css->cgroup, buf, PATH_MAX,
+				       current->nsproxy->cgroup_ns);
+	spin_unlock_irq(&css_set_lock);
+	rcu_read_unlock();
+
+	if (retval == -E2BIG)
 		retval = -ENAMETOOLONG;
 	if (retval < 0)
 		goto out_free;
diff --git a/kernel/debug/kdb/kdb_io.c b/kernel/debug/kdb/kdb_io.c
index 2aeaf9765b24..4799f6250bb2 100644
--- a/kernel/debug/kdb/kdb_io.c
+++ b/kernel/debug/kdb/kdb_io.c
@@ -206,7 +206,7 @@ char kdb_getchar(void)
  */
 static void kdb_position_cursor(char *prompt, char *buffer, char *cp)
 {
-	kdb_printf("\r%s", kdb_prompt_str);
+	kdb_printf("\r%s", prompt);
 	if (cp > buffer)
 		kdb_printf("%.*s", (int)(cp - buffer), buffer);
 }
@@ -371,7 +371,7 @@ static char *kdb_read(char *buffer, size_t bufsize)
 			if (i >= dtab_count)
 				kdb_printf("...");
 			kdb_printf("\n");
-			kdb_printf(kdb_prompt_str);
+			kdb_printf("%s",  kdb_prompt_str);
 			kdb_printf("%s", buffer);
 			if (cp != lastchar)
 				kdb_position_cursor(kdb_prompt_str, buffer, cp);
@@ -463,7 +463,7 @@ char *kdb_getstr(char *buffer, size_t bufsize, const char *prompt)
 {
 	if (prompt && kdb_prompt_str != prompt)
 		strscpy(kdb_prompt_str, prompt, CMD_BUFLEN);
-	kdb_printf(kdb_prompt_str);
+	kdb_printf("%s", kdb_prompt_str);
 	kdb_nextline = 1;	/* Prompt and input resets line number */
 	return kdb_read(buffer, bufsize);
 }
diff --git a/kernel/dma/mapping.c b/kernel/dma/mapping.c
index e323ca48f7f2..f1d9f01b283d 100644
--- a/kernel/dma/mapping.c
+++ b/kernel/dma/mapping.c
@@ -67,8 +67,8 @@ void dmam_free_coherent(struct device *dev, size_t size, void *vaddr,
 {
 	struct dma_devres match_data = { size, vaddr, dma_handle };
 
-	dma_free_coherent(dev, size, vaddr, dma_handle);
 	WARN_ON(devres_destroy(dev, dmam_release, dmam_match, &match_data));
+	dma_free_coherent(dev, size, vaddr, dma_handle);
 }
 EXPORT_SYMBOL(dmam_free_coherent);
 
diff --git a/kernel/events/core.c b/kernel/events/core.c
index 3e0db5b5a183..0f2b5610933d 100644
--- a/kernel/events/core.c
+++ b/kernel/events/core.c
@@ -2284,18 +2284,14 @@ event_sched_out(struct perf_event *event, struct perf_event_context *ctx)
 	}
 
 	if (event->pending_sigtrap) {
-		bool dec = true;
-
 		event->pending_sigtrap = 0;
 		if (state != PERF_EVENT_STATE_OFF &&
-		    !event->pending_work) {
+		    !event->pending_work &&
+		    !task_work_add(current, &event->pending_task, TWA_RESUME)) {
 			event->pending_work = 1;
-			dec = false;
-			WARN_ON_ONCE(!atomic_long_inc_not_zero(&event->refcount));
-			task_work_add(current, &event->pending_task, TWA_RESUME);
-		}
-		if (dec)
+		} else {
 			local_dec(&event->ctx->nr_pending);
+		}
 	}
 
 	perf_event_set_state(event, state);
@@ -5175,9 +5171,35 @@ static bool exclusive_event_installable(struct perf_event *event,
 static void perf_addr_filters_splice(struct perf_event *event,
 				       struct list_head *head);
 
+static void perf_pending_task_sync(struct perf_event *event)
+{
+	struct callback_head *head = &event->pending_task;
+
+	if (!event->pending_work)
+		return;
+	/*
+	 * If the task is queued to the current task's queue, we
+	 * obviously can't wait for it to complete. Simply cancel it.
+	 */
+	if (task_work_cancel(current, head)) {
+		event->pending_work = 0;
+		local_dec(&event->ctx->nr_pending);
+		return;
+	}
+
+	/*
+	 * All accesses related to the event are within the same
+	 * non-preemptible section in perf_pending_task(). The RCU
+	 * grace period before the event is freed will make sure all
+	 * those accesses are complete by then.
+	 */
+	rcuwait_wait_event(&event->pending_work_wait, !event->pending_work, TASK_UNINTERRUPTIBLE);
+}
+
 static void _free_event(struct perf_event *event)
 {
 	irq_work_sync(&event->pending_irq);
+	perf_pending_task_sync(event);
 
 	unaccount_event(event);
 
@@ -6478,6 +6500,8 @@ static int perf_mmap(struct file *file, struct vm_area_struct *vma)
 			return -EINVAL;
 
 		nr_pages = vma_size / PAGE_SIZE;
+		if (nr_pages > INT_MAX)
+			return -ENOMEM;
 
 		mutex_lock(&event->mmap_mutex);
 		ret = -EINVAL;
@@ -6808,24 +6832,28 @@ static void perf_pending_task(struct callback_head *head)
 	struct perf_event *event = container_of(head, struct perf_event, pending_task);
 	int rctx;
 
+	/*
+	 * All accesses to the event must belong to the same implicit RCU read-side
+	 * critical section as the ->pending_work reset. See comment in
+	 * perf_pending_task_sync().
+	 */
+	preempt_disable_notrace();
 	/*
 	 * If we 'fail' here, that's OK, it means recursion is already disabled
 	 * and we won't recurse 'further'.
 	 */
-	preempt_disable_notrace();
 	rctx = perf_swevent_get_recursion_context();
 
 	if (event->pending_work) {
 		event->pending_work = 0;
 		perf_sigtrap(event);
 		local_dec(&event->ctx->nr_pending);
+		rcuwait_wake_up(&event->pending_work_wait);
 	}
 
 	if (rctx >= 0)
 		perf_swevent_put_recursion_context(rctx);
 	preempt_enable_notrace();
-
-	put_event(event);
 }
 
 #ifdef CONFIG_GUEST_PERF_EVENTS
@@ -9271,21 +9299,19 @@ static void perf_event_bpf_emit_ksymbols(struct bpf_prog *prog,
 	bool unregister = type == PERF_BPF_EVENT_PROG_UNLOAD;
 	int i;
 
-	if (prog->aux->func_cnt == 0) {
-		perf_event_ksymbol(PERF_RECORD_KSYMBOL_TYPE_BPF,
-				   (u64)(unsigned long)prog->bpf_func,
-				   prog->jited_len, unregister,
-				   prog->aux->ksym.name);
-	} else {
-		for (i = 0; i < prog->aux->func_cnt; i++) {
-			struct bpf_prog *subprog = prog->aux->func[i];
-
-			perf_event_ksymbol(
-				PERF_RECORD_KSYMBOL_TYPE_BPF,
-				(u64)(unsigned long)subprog->bpf_func,
-				subprog->jited_len, unregister,
-				subprog->aux->ksym.name);
-		}
+	perf_event_ksymbol(PERF_RECORD_KSYMBOL_TYPE_BPF,
+			   (u64)(unsigned long)prog->bpf_func,
+			   prog->jited_len, unregister,
+			   prog->aux->ksym.name);
+
+	for (i = 1; i < prog->aux->func_cnt; i++) {
+		struct bpf_prog *subprog = prog->aux->func[i];
+
+		perf_event_ksymbol(
+			PERF_RECORD_KSYMBOL_TYPE_BPF,
+			(u64)(unsigned long)subprog->bpf_func,
+			subprog->jited_len, unregister,
+			subprog->aux->ksym.name);
 	}
 }
 
@@ -11929,6 +11955,7 @@ perf_event_alloc(struct perf_event_attr *attr, int cpu,
 	init_waitqueue_head(&event->waitq);
 	init_irq_work(&event->pending_irq, perf_pending_irq);
 	init_task_work(&event->pending_task, perf_pending_task);
+	rcuwait_init(&event->pending_work_wait);
 
 	mutex_init(&event->mmap_mutex);
 	raw_spin_lock_init(&event->addr_filters.lock);
diff --git a/kernel/events/internal.h b/kernel/events/internal.h
index 5150d5f84c03..386d21c7edfa 100644
--- a/kernel/events/internal.h
+++ b/kernel/events/internal.h
@@ -128,7 +128,7 @@ static inline unsigned long perf_data_size(struct perf_buffer *rb)
 
 static inline unsigned long perf_aux_size(struct perf_buffer *rb)
 {
-	return rb->aux_nr_pages << PAGE_SHIFT;
+	return (unsigned long)rb->aux_nr_pages << PAGE_SHIFT;
 }
 
 #define __DEFINE_OUTPUT_COPY_BODY(advance_buf, memcpy_func, ...)	\
diff --git a/kernel/events/ring_buffer.c b/kernel/events/ring_buffer.c
index e8d82c2f07d0..f1f4a627f93d 100644
--- a/kernel/events/ring_buffer.c
+++ b/kernel/events/ring_buffer.c
@@ -684,7 +684,9 @@ int rb_alloc_aux(struct perf_buffer *rb, struct perf_event *event,
 		 * max_order, to aid PMU drivers in double buffering.
 		 */
 		if (!watermark)
-			watermark = nr_pages << (PAGE_SHIFT - 1);
+			watermark = min_t(unsigned long,
+					  U32_MAX,
+					  (unsigned long)nr_pages << (PAGE_SHIFT - 1));
 
 		/*
 		 * Use aux_watermark as the basis for chunking to
diff --git a/kernel/irq/irqdomain.c b/kernel/irq/irqdomain.c
index 0bdef4fe925b..ddaaccdc09fa 100644
--- a/kernel/irq/irqdomain.c
+++ b/kernel/irq/irqdomain.c
@@ -154,7 +154,6 @@ static struct irq_domain *__irq_domain_create(struct fwnode_handle *fwnode,
 		switch (fwid->type) {
 		case IRQCHIP_FWNODE_NAMED:
 		case IRQCHIP_FWNODE_NAMED_ID:
-			domain->fwnode = fwnode;
 			domain->name = kstrdup(fwid->name, GFP_KERNEL);
 			if (!domain->name) {
 				kfree(domain);
@@ -163,7 +162,6 @@ static struct irq_domain *__irq_domain_create(struct fwnode_handle *fwnode,
 			domain->flags |= IRQ_DOMAIN_NAME_ALLOCATED;
 			break;
 		default:
-			domain->fwnode = fwnode;
 			domain->name = fwid->name;
 			break;
 		}
@@ -183,7 +181,6 @@ static struct irq_domain *__irq_domain_create(struct fwnode_handle *fwnode,
 		}
 
 		domain->name = strreplace(name, '/', ':');
-		domain->fwnode = fwnode;
 		domain->flags |= IRQ_DOMAIN_NAME_ALLOCATED;
 	}
 
@@ -199,8 +196,8 @@ static struct irq_domain *__irq_domain_create(struct fwnode_handle *fwnode,
 		domain->flags |= IRQ_DOMAIN_NAME_ALLOCATED;
 	}
 
-	fwnode_handle_get(fwnode);
-	fwnode_dev_initialized(fwnode, true);
+	domain->fwnode = fwnode_handle_get(fwnode);
+	fwnode_dev_initialized(domain->fwnode, true);
 
 	/* Fill structure */
 	INIT_RADIX_TREE(&domain->revmap_tree, GFP_KERNEL);
diff --git a/kernel/irq/manage.c b/kernel/irq/manage.c
index 1782f90cd8c6..a054cd5ec08b 100644
--- a/kernel/irq/manage.c
+++ b/kernel/irq/manage.c
@@ -1332,7 +1332,7 @@ static int irq_thread(void *data)
 	 * synchronize_hardirq(). So neither IRQTF_RUNTHREAD nor the
 	 * oneshot mask bit can be set.
 	 */
-	task_work_cancel(current, irq_thread_dtor);
+	task_work_cancel_func(current, irq_thread_dtor);
 	return 0;
 }
 
diff --git a/kernel/jump_label.c b/kernel/jump_label.c
index d9c822bbffb8..eec802175ccc 100644
--- a/kernel/jump_label.c
+++ b/kernel/jump_label.c
@@ -131,7 +131,7 @@ bool static_key_fast_inc_not_disabled(struct static_key *key)
 	STATIC_KEY_CHECK_USE(key);
 	/*
 	 * Negative key->enabled has a special meaning: it sends
-	 * static_key_slow_inc() down the slow path, and it is non-zero
+	 * static_key_slow_inc/dec() down the slow path, and it is non-zero
 	 * so it counts as "enabled" in jump_label_update().  Note that
 	 * atomic_inc_unless_negative() checks >= 0, so roll our own.
 	 */
@@ -150,7 +150,7 @@ bool static_key_slow_inc_cpuslocked(struct static_key *key)
 	lockdep_assert_cpus_held();
 
 	/*
-	 * Careful if we get concurrent static_key_slow_inc() calls;
+	 * Careful if we get concurrent static_key_slow_inc/dec() calls;
 	 * later calls must wait for the first one to _finish_ the
 	 * jump_label_update() process.  At the same time, however,
 	 * the jump_label_update() call below wants to see
@@ -247,20 +247,32 @@ EXPORT_SYMBOL_GPL(static_key_disable);
 
 static bool static_key_slow_try_dec(struct static_key *key)
 {
-	int val;
-
-	val = atomic_fetch_add_unless(&key->enabled, -1, 1);
-	if (val == 1)
-		return false;
+	int v;
 
 	/*
-	 * The negative count check is valid even when a negative
-	 * key->enabled is in use by static_key_slow_inc(); a
-	 * __static_key_slow_dec() before the first static_key_slow_inc()
-	 * returns is unbalanced, because all other static_key_slow_inc()
-	 * instances block while the update is in progress.
+	 * Go into the slow path if key::enabled is less than or equal than
+	 * one. One is valid to shut down the key, anything less than one
+	 * is an imbalance, which is handled at the call site.
+	 *
+	 * That includes the special case of '-1' which is set in
+	 * static_key_slow_inc_cpuslocked(), but that's harmless as it is
+	 * fully serialized in the slow path below. By the time this task
+	 * acquires the jump label lock the value is back to one and the
+	 * retry under the lock must succeed.
 	 */
-	WARN(val < 0, "jump label: negative count!\n");
+	v = atomic_read(&key->enabled);
+	do {
+		/*
+		 * Warn about the '-1' case though; since that means a
+		 * decrement is concurrent with a first (0->1) increment. IOW
+		 * people are trying to disable something that wasn't yet fully
+		 * enabled. This suggests an ordering problem on the user side.
+		 */
+		WARN_ON_ONCE(v < 0);
+		if (v <= 1)
+			return false;
+	} while (!likely(atomic_try_cmpxchg(&key->enabled, &v, v - 1)));
+
 	return true;
 }
 
@@ -271,10 +283,11 @@ static void __static_key_slow_dec_cpuslocked(struct static_key *key)
 	if (static_key_slow_try_dec(key))
 		return;
 
-	jump_label_lock();
-	if (atomic_dec_and_test(&key->enabled))
+	guard(mutex)(&jump_label_mutex);
+	if (atomic_cmpxchg(&key->enabled, 1, 0))
 		jump_label_update(key);
-	jump_label_unlock();
+	else
+		WARN_ON_ONCE(!static_key_slow_try_dec(key));
 }
 
 static void __static_key_slow_dec(struct static_key *key)
diff --git a/kernel/locking/rwsem.c b/kernel/locking/rwsem.c
index 9eabd585ce7a..11ed7ce6579e 100644
--- a/kernel/locking/rwsem.c
+++ b/kernel/locking/rwsem.c
@@ -1297,7 +1297,7 @@ static inline int __down_read_trylock(struct rw_semaphore *sem)
 /*
  * lock for writing
  */
-static inline int __down_write_common(struct rw_semaphore *sem, int state)
+static __always_inline int __down_write_common(struct rw_semaphore *sem, int state)
 {
 	int ret = 0;
 
@@ -1310,12 +1310,12 @@ static inline int __down_write_common(struct rw_semaphore *sem, int state)
 	return ret;
 }
 
-static inline void __down_write(struct rw_semaphore *sem)
+static __always_inline void __down_write(struct rw_semaphore *sem)
 {
 	__down_write_common(sem, TASK_UNINTERRUPTIBLE);
 }
 
-static inline int __down_write_killable(struct rw_semaphore *sem)
+static __always_inline int __down_write_killable(struct rw_semaphore *sem)
 {
 	return __down_write_common(sem, TASK_KILLABLE);
 }
diff --git a/kernel/rcu/tasks.h b/kernel/rcu/tasks.h
index 305e960c08ac..ff8d539ee22b 100644
--- a/kernel/rcu/tasks.h
+++ b/kernel/rcu/tasks.h
@@ -1675,6 +1675,16 @@ static void rcu_tasks_trace_pregp_step(struct list_head *hop)
 	// allow safe access to the hop list.
 	for_each_online_cpu(cpu) {
 		rcu_read_lock();
+		// Note that cpu_curr_snapshot() picks up the target
+		// CPU's current task while its runqueue is locked with
+		// an smp_mb__after_spinlock().  This ensures that either
+		// the grace-period kthread will see that task's read-side
+		// critical section or the task will see the updater's pre-GP
+		// accesses.  The trailing smp_mb() in cpu_curr_snapshot()
+		// does not currently play a role other than simplify
+		// that function's ordering semantics.  If these simplified
+		// ordering semantics continue to be redundant, that smp_mb()
+		// might be removed.
 		t = cpu_curr_snapshot(cpu);
 		if (rcu_tasks_trace_pertask_prep(t, true))
 			trc_add_holdout(t, hop);
diff --git a/kernel/sched/core.c b/kernel/sched/core.c
index 820880960513..92e4afeb71ad 100644
--- a/kernel/sched/core.c
+++ b/kernel/sched/core.c
@@ -1304,27 +1304,24 @@ int tg_nop(struct task_group *tg, void *data)
 static void set_load_weight(struct task_struct *p, bool update_load)
 {
 	int prio = p->static_prio - MAX_RT_PRIO;
-	struct load_weight *load = &p->se.load;
+	struct load_weight lw;
 
-	/*
-	 * SCHED_IDLE tasks get minimal weight:
-	 */
 	if (task_has_idle_policy(p)) {
-		load->weight = scale_load(WEIGHT_IDLEPRIO);
-		load->inv_weight = WMULT_IDLEPRIO;
-		return;
+		lw.weight = scale_load(WEIGHT_IDLEPRIO);
+		lw.inv_weight = WMULT_IDLEPRIO;
+	} else {
+		lw.weight = scale_load(sched_prio_to_weight[prio]);
+		lw.inv_weight = sched_prio_to_wmult[prio];
 	}
 
 	/*
 	 * SCHED_OTHER tasks have to update their load when changing their
 	 * weight
 	 */
-	if (update_load && p->sched_class == &fair_sched_class) {
-		reweight_task(p, prio);
-	} else {
-		load->weight = scale_load(sched_prio_to_weight[prio]);
-		load->inv_weight = sched_prio_to_wmult[prio];
-	}
+	if (update_load && p->sched_class == &fair_sched_class)
+		reweight_task(p, &lw);
+	else
+		p->se.load = lw;
 }
 
 #ifdef CONFIG_UCLAMP_TASK
@@ -4438,12 +4435,7 @@ int task_call_func(struct task_struct *p, task_call_f func, void *arg)
  * @cpu: The CPU on which to snapshot the task.
  *
  * Returns the task_struct pointer of the task "currently" running on
- * the specified CPU.  If the same task is running on that CPU throughout,
- * the return value will be a pointer to that task's task_struct structure.
- * If the CPU did any context switches even vaguely concurrently with the
- * execution of this function, the return value will be a pointer to the
- * task_struct structure of a randomly chosen task that was running on
- * that CPU somewhere around the time that this function was executing.
+ * the specified CPU.
  *
  * If the specified CPU was offline, the return value is whatever it
  * is, perhaps a pointer to the task_struct structure of that CPU's idle
@@ -4457,11 +4449,16 @@ int task_call_func(struct task_struct *p, task_call_f func, void *arg)
  */
 struct task_struct *cpu_curr_snapshot(int cpu)
 {
+	struct rq *rq = cpu_rq(cpu);
 	struct task_struct *t;
+	struct rq_flags rf;
 
-	smp_mb(); /* Pairing determined by caller's synchronization design. */
+	rq_lock_irqsave(rq, &rf);
+	smp_mb__after_spinlock(); /* Pairing determined by caller's synchronization design. */
 	t = rcu_dereference(cpu_curr(cpu));
+	rq_unlock_irqrestore(rq, &rf);
 	smp_mb(); /* Pairing determined by caller's synchronization design. */
+
 	return t;
 }
 
diff --git a/kernel/sched/fair.c b/kernel/sched/fair.c
index d3d0a1c9336b..b2e1009e5706 100644
--- a/kernel/sched/fair.c
+++ b/kernel/sched/fair.c
@@ -3791,15 +3791,14 @@ static void reweight_entity(struct cfs_rq *cfs_rq, struct sched_entity *se,
 	}
 }
 
-void reweight_task(struct task_struct *p, int prio)
+void reweight_task(struct task_struct *p, const struct load_weight *lw)
 {
 	struct sched_entity *se = &p->se;
 	struct cfs_rq *cfs_rq = cfs_rq_of(se);
 	struct load_weight *load = &se->load;
-	unsigned long weight = scale_load(sched_prio_to_weight[prio]);
 
-	reweight_entity(cfs_rq, se, weight);
-	load->inv_weight = sched_prio_to_wmult[prio];
+	reweight_entity(cfs_rq, se, lw->weight);
+	load->inv_weight = lw->inv_weight;
 }
 
 static inline int throttled_hierarchy(struct cfs_rq *cfs_rq);
diff --git a/kernel/sched/sched.h b/kernel/sched/sched.h
index 2e8f26a919ed..8cbbbea7fdbb 100644
--- a/kernel/sched/sched.h
+++ b/kernel/sched/sched.h
@@ -2435,7 +2435,7 @@ extern void init_sched_dl_class(void);
 extern void init_sched_rt_class(void);
 extern void init_sched_fair_class(void);
 
-extern void reweight_task(struct task_struct *p, int prio);
+extern void reweight_task(struct task_struct *p, const struct load_weight *lw);
 
 extern void resched_curr(struct rq *rq);
 extern void resched_cpu(int cpu);
diff --git a/kernel/signal.c b/kernel/signal.c
index 09019017d669..21903f524ef8 100644
--- a/kernel/signal.c
+++ b/kernel/signal.c
@@ -2587,6 +2587,14 @@ static void do_freezer_trap(void)
 	spin_unlock_irq(&current->sighand->siglock);
 	cgroup_enter_frozen();
 	schedule();
+
+	/*
+	 * We could've been woken by task_work, run it to clear
+	 * TIF_NOTIFY_SIGNAL. The caller will retry if necessary.
+	 */
+	clear_notify_signal();
+	if (unlikely(task_work_pending(current)))
+		task_work_run();
 }
 
 static int ptrace_signal(int signr, kernel_siginfo_t *info, enum pid_type type)
diff --git a/kernel/task_work.c b/kernel/task_work.c
index 95a7e1b7f1da..2134ac8057a9 100644
--- a/kernel/task_work.c
+++ b/kernel/task_work.c
@@ -120,9 +120,9 @@ static bool task_work_func_match(struct callback_head *cb, void *data)
 }
 
 /**
- * task_work_cancel - cancel a pending work added by task_work_add()
- * @task: the task which should execute the work
- * @func: identifies the work to remove
+ * task_work_cancel_func - cancel a pending work matching a function added by task_work_add()
+ * @task: the task which should execute the func's work
+ * @func: identifies the func to match with a work to remove
  *
  * Find the last queued pending work with ->func == @func and remove
  * it from queue.
@@ -131,11 +131,35 @@ static bool task_work_func_match(struct callback_head *cb, void *data)
  * The found work or NULL if not found.
  */
 struct callback_head *
-task_work_cancel(struct task_struct *task, task_work_func_t func)
+task_work_cancel_func(struct task_struct *task, task_work_func_t func)
 {
 	return task_work_cancel_match(task, task_work_func_match, func);
 }
 
+static bool task_work_match(struct callback_head *cb, void *data)
+{
+	return cb == data;
+}
+
+/**
+ * task_work_cancel - cancel a pending work added by task_work_add()
+ * @task: the task which should execute the work
+ * @cb: the callback to remove if queued
+ *
+ * Remove a callback from a task's queue if queued.
+ *
+ * RETURNS:
+ * True if the callback was queued and got cancelled, false otherwise.
+ */
+bool task_work_cancel(struct task_struct *task, struct callback_head *cb)
+{
+	struct callback_head *ret;
+
+	ret = task_work_cancel_match(task, task_work_match, cb);
+
+	return ret == cb;
+}
+
 /**
  * task_work_run - execute the works added by task_work_add()
  *
@@ -168,7 +192,7 @@ void task_work_run(void)
 		if (!work)
 			break;
 		/*
-		 * Synchronize with task_work_cancel(). It can not remove
+		 * Synchronize with task_work_cancel_match(). It can not remove
 		 * the first entry == work, cmpxchg(task_works) must fail.
 		 * But it can remove another entry from the ->next list.
 		 */
diff --git a/kernel/time/tick-broadcast.c b/kernel/time/tick-broadcast.c
index 771d1e040303..b4843099a8da 100644
--- a/kernel/time/tick-broadcast.c
+++ b/kernel/time/tick-broadcast.c
@@ -1141,6 +1141,7 @@ void tick_broadcast_switch_to_oneshot(void)
 #ifdef CONFIG_HOTPLUG_CPU
 void hotplug_cpu__broadcast_tick_pull(int deadcpu)
 {
+	struct tick_device *td = this_cpu_ptr(&tick_cpu_device);
 	struct clock_event_device *bc;
 	unsigned long flags;
 
@@ -1148,6 +1149,28 @@ void hotplug_cpu__broadcast_tick_pull(int deadcpu)
 	bc = tick_broadcast_device.evtdev;
 
 	if (bc && broadcast_needs_cpu(bc, deadcpu)) {
+		/*
+		 * If the broadcast force bit of the current CPU is set,
+		 * then the current CPU has not yet reprogrammed the local
+		 * timer device to avoid a ping-pong race. See
+		 * ___tick_broadcast_oneshot_control().
+		 *
+		 * If the broadcast device is hrtimer based then
+		 * programming the broadcast event below does not have any
+		 * effect because the local clockevent device is not
+		 * running and not programmed because the broadcast event
+		 * is not earlier than the pending event of the local clock
+		 * event device. As a consequence all CPUs waiting for a
+		 * broadcast event are stuck forever.
+		 *
+		 * Detect this condition and reprogram the cpu local timer
+		 * device to avoid the starvation.
+		 */
+		if (tick_check_broadcast_expired()) {
+			cpumask_clear_cpu(smp_processor_id(), tick_broadcast_force_mask);
+			tick_program_event(td->evtdev->next_event, 1);
+		}
+
 		/* This moves the broadcast assignment to this CPU: */
 		clockevents_program_event(bc, bc->next_event, 1);
 	}
diff --git a/kernel/trace/pid_list.c b/kernel/trace/pid_list.c
index 95106d02b32d..85de221c0b6f 100644
--- a/kernel/trace/pid_list.c
+++ b/kernel/trace/pid_list.c
@@ -354,7 +354,7 @@ static void pid_list_refill_irq(struct irq_work *iwork)
 	while (upper_count-- > 0) {
 		union upper_chunk *chunk;
 
-		chunk = kzalloc(sizeof(*chunk), GFP_KERNEL);
+		chunk = kzalloc(sizeof(*chunk), GFP_NOWAIT);
 		if (!chunk)
 			break;
 		*upper_next = chunk;
@@ -365,7 +365,7 @@ static void pid_list_refill_irq(struct irq_work *iwork)
 	while (lower_count-- > 0) {
 		union lower_chunk *chunk;
 
-		chunk = kzalloc(sizeof(*chunk), GFP_KERNEL);
+		chunk = kzalloc(sizeof(*chunk), GFP_NOWAIT);
 		if (!chunk)
 			break;
 		*lower_next = chunk;
diff --git a/kernel/watchdog_perf.c b/kernel/watchdog_perf.c
index 8ea00c4a24b2..0052afe18b7f 100644
--- a/kernel/watchdog_perf.c
+++ b/kernel/watchdog_perf.c
@@ -75,11 +75,15 @@ static bool watchdog_check_timestamp(void)
 	__this_cpu_write(last_timestamp, now);
 	return true;
 }
-#else
-static inline bool watchdog_check_timestamp(void)
+
+static void watchdog_init_timestamp(void)
 {
-	return true;
+	__this_cpu_write(nmi_rearmed, 0);
+	__this_cpu_write(last_timestamp, ktime_get_mono_fast_ns());
 }
+#else
+static inline bool watchdog_check_timestamp(void) { return true; }
+static inline void watchdog_init_timestamp(void) { }
 #endif
 
 static struct perf_event_attr wd_hw_attr = {
@@ -147,6 +151,7 @@ void watchdog_hardlockup_enable(unsigned int cpu)
 	if (!atomic_fetch_inc(&watchdog_cpus))
 		pr_info("Enabled. Permanently consumes one hw-PMU counter.\n");
 
+	watchdog_init_timestamp();
 	perf_event_enable(this_cpu_read(watchdog_ev));
 }
 
diff --git a/lib/build_OID_registry b/lib/build_OID_registry
index d7fc32ea8ac2..56d8bafeb848 100755
--- a/lib/build_OID_registry
+++ b/lib/build_OID_registry
@@ -8,6 +8,7 @@
 #
 
 use strict;
+use Cwd qw(abs_path);
 
 my @names = ();
 my @oids = ();
@@ -17,6 +18,8 @@ if ($#ARGV != 1) {
     exit(2);
 }
 
+my $abs_srctree = abs_path($ENV{'srctree'});
+
 #
 # Open the file to read from
 #
@@ -35,7 +38,7 @@ close IN_FILE || die;
 #
 open C_FILE, ">$ARGV[1]" or die;
 print C_FILE "/*\n";
-print C_FILE " * Automatically generated by ", $0, ".  Do not edit\n";
+print C_FILE " * Automatically generated by ", $0 =~ s#^\Q$abs_srctree/\E##r, ".  Do not edit\n";
 print C_FILE " */\n";
 
 #
diff --git a/lib/decompress_bunzip2.c b/lib/decompress_bunzip2.c
index 3518e7394eca..ca736166f100 100644
--- a/lib/decompress_bunzip2.c
+++ b/lib/decompress_bunzip2.c
@@ -232,7 +232,8 @@ static int INIT get_next_block(struct bunzip_data *bd)
 	   RUNB) */
 	symCount = symTotal+2;
 	for (j = 0; j < groupCount; j++) {
-		unsigned char length[MAX_SYMBOLS], temp[MAX_HUFCODE_BITS+1];
+		unsigned char length[MAX_SYMBOLS];
+		unsigned short temp[MAX_HUFCODE_BITS+1];
 		int	minLen,	maxLen, pp;
 		/* Read Huffman code lengths for each symbol.  They're
 		   stored in a way similar to mtf; record a starting
diff --git a/lib/kobject_uevent.c b/lib/kobject_uevent.c
index 7c44b7ae4c5c..d397b1ad5ccf 100644
--- a/lib/kobject_uevent.c
+++ b/lib/kobject_uevent.c
@@ -432,8 +432,23 @@ static void zap_modalias_env(struct kobj_uevent_env *env)
 		len = strlen(env->envp[i]) + 1;
 
 		if (i != env->envp_idx - 1) {
+			/* @env->envp[] contains pointers to @env->buf[]
+			 * with @env->buflen chars, and we are removing
+			 * variable MODALIAS here pointed by @env->envp[i]
+			 * with length @len as shown below:
+			 *
+			 * 0               @env->buf[]      @env->buflen
+			 * ---------------------------------------------
+			 * ^             ^              ^              ^
+			 * |             |->   @len   <-| target block |
+			 * @env->envp[0] @env->envp[i]  @env->envp[i + 1]
+			 *
+			 * so the "target block" indicated above is moved
+			 * backward by @len, and its right size is
+			 * @env->buflen - (@env->envp[i + 1] - @env->envp[0]).
+			 */
 			memmove(env->envp[i], env->envp[i + 1],
-				env->buflen - len);
+				env->buflen - (env->envp[i + 1] - env->envp[0]));
 
 			for (j = i; j < env->envp_idx - 1; j++)
 				env->envp[j] = env->envp[j + 1] - len;
diff --git a/lib/objagg.c b/lib/objagg.c
index 1e248629ed64..1608895b009c 100644
--- a/lib/objagg.c
+++ b/lib/objagg.c
@@ -167,6 +167,9 @@ static int objagg_obj_parent_assign(struct objagg *objagg,
 {
 	void *delta_priv;
 
+	if (WARN_ON(!objagg_obj_is_root(parent)))
+		return -EINVAL;
+
 	delta_priv = objagg->ops->delta_create(objagg->priv, parent->obj,
 					       objagg_obj->obj);
 	if (IS_ERR(delta_priv))
@@ -903,20 +906,6 @@ static const struct objagg_opt_algo *objagg_opt_algos[] = {
 	[OBJAGG_OPT_ALGO_SIMPLE_GREEDY] = &objagg_opt_simple_greedy,
 };
 
-static int objagg_hints_obj_cmp(struct rhashtable_compare_arg *arg,
-				const void *obj)
-{
-	struct rhashtable *ht = arg->ht;
-	struct objagg_hints *objagg_hints =
-			container_of(ht, struct objagg_hints, node_ht);
-	const struct objagg_ops *ops = objagg_hints->ops;
-	const char *ptr = obj;
-
-	ptr += ht->p.key_offset;
-	return ops->hints_obj_cmp ? ops->hints_obj_cmp(ptr, arg->key) :
-				    memcmp(ptr, arg->key, ht->p.key_len);
-}
-
 /**
  * objagg_hints_get - obtains hints instance
  * @objagg:		objagg instance
@@ -955,7 +944,6 @@ struct objagg_hints *objagg_hints_get(struct objagg *objagg,
 				offsetof(struct objagg_hints_node, obj);
 	objagg_hints->ht_params.head_offset =
 				offsetof(struct objagg_hints_node, ht_node);
-	objagg_hints->ht_params.obj_cmpfn = objagg_hints_obj_cmp;
 
 	err = rhashtable_init(&objagg_hints->node_ht, &objagg_hints->ht_params);
 	if (err)
diff --git a/lib/sbitmap.c b/lib/sbitmap.c
index d0a5081dfd12..9307bf17a817 100644
--- a/lib/sbitmap.c
+++ b/lib/sbitmap.c
@@ -60,12 +60,30 @@ static inline void update_alloc_hint_after_get(struct sbitmap *sb,
 /*
  * See if we have deferred clears that we can batch move
  */
-static inline bool sbitmap_deferred_clear(struct sbitmap_word *map)
+static inline bool sbitmap_deferred_clear(struct sbitmap_word *map,
+		unsigned int depth, unsigned int alloc_hint, bool wrap)
 {
-	unsigned long mask;
+	unsigned long mask, word_mask;
 
-	if (!READ_ONCE(map->cleared))
-		return false;
+	guard(spinlock_irqsave)(&map->swap_lock);
+
+	if (!map->cleared) {
+		if (depth == 0)
+			return false;
+
+		word_mask = (~0UL) >> (BITS_PER_LONG - depth);
+		/*
+		 * The current behavior is to always retry after moving
+		 * ->cleared to word, and we change it to retry in case
+		 * of any free bits. To avoid an infinite loop, we need
+		 * to take wrap & alloc_hint into account, otherwise a
+		 * soft lockup may occur.
+		 */
+		if (!wrap && alloc_hint)
+			word_mask &= ~((1UL << alloc_hint) - 1);
+
+		return (READ_ONCE(map->word) & word_mask) != word_mask;
+	}
 
 	/*
 	 * First get a stable cleared mask, setting the old mask to 0.
@@ -85,6 +103,7 @@ int sbitmap_init_node(struct sbitmap *sb, unsigned int depth, int shift,
 		      bool alloc_hint)
 {
 	unsigned int bits_per_word;
+	int i;
 
 	if (shift < 0)
 		shift = sbitmap_calculate_shift(depth);
@@ -116,6 +135,9 @@ int sbitmap_init_node(struct sbitmap *sb, unsigned int depth, int shift,
 		return -ENOMEM;
 	}
 
+	for (i = 0; i < sb->map_nr; i++)
+		spin_lock_init(&sb->map[i].swap_lock);
+
 	return 0;
 }
 EXPORT_SYMBOL_GPL(sbitmap_init_node);
@@ -126,7 +148,7 @@ void sbitmap_resize(struct sbitmap *sb, unsigned int depth)
 	unsigned int i;
 
 	for (i = 0; i < sb->map_nr; i++)
-		sbitmap_deferred_clear(&sb->map[i]);
+		sbitmap_deferred_clear(&sb->map[i], 0, 0, 0);
 
 	sb->depth = depth;
 	sb->map_nr = DIV_ROUND_UP(sb->depth, bits_per_word);
@@ -179,7 +201,7 @@ static int sbitmap_find_bit_in_word(struct sbitmap_word *map,
 					alloc_hint, wrap);
 		if (nr != -1)
 			break;
-		if (!sbitmap_deferred_clear(map))
+		if (!sbitmap_deferred_clear(map, depth, alloc_hint, wrap))
 			break;
 	} while (1);
 
@@ -499,18 +521,18 @@ unsigned long __sbitmap_queue_get_batch(struct sbitmap_queue *sbq, int nr_tags,
 		struct sbitmap_word *map = &sb->map[index];
 		unsigned long get_mask;
 		unsigned int map_depth = __map_depth(sb, index);
+		unsigned long val;
 
-		sbitmap_deferred_clear(map);
-		if (map->word == (1UL << (map_depth - 1)) - 1)
+		sbitmap_deferred_clear(map, 0, 0, 0);
+		val = READ_ONCE(map->word);
+		if (val == (1UL << (map_depth - 1)) - 1)
 			goto next;
 
-		nr = find_first_zero_bit(&map->word, map_depth);
+		nr = find_first_zero_bit(&val, map_depth);
 		if (nr + nr_tags <= map_depth) {
 			atomic_long_t *ptr = (atomic_long_t *) &map->word;
-			unsigned long val;
 
 			get_mask = ((1UL << nr_tags) - 1) << nr;
-			val = READ_ONCE(map->word);
 			while (!atomic_long_try_cmpxchg(ptr, &val,
 							  get_mask | val))
 				;
diff --git a/mm/hugetlb.c b/mm/hugetlb.c
index 789decf5d11b..a480affd475b 100644
--- a/mm/hugetlb.c
+++ b/mm/hugetlb.c
@@ -2518,6 +2518,23 @@ struct folio *alloc_hugetlb_folio_vma(struct hstate *h, struct vm_area_struct *v
 	return folio;
 }
 
+static nodemask_t *policy_mbind_nodemask(gfp_t gfp)
+{
+#ifdef CONFIG_NUMA
+	struct mempolicy *mpol = get_task_policy(current);
+
+	/*
+	 * Only enforce MPOL_BIND policy which overlaps with cpuset policy
+	 * (from policy_nodemask) specifically for hugetlb case
+	 */
+	if (mpol->mode == MPOL_BIND &&
+		(apply_policy_zone(mpol, gfp_zone(gfp)) &&
+		 cpuset_nodemask_valid_mems_allowed(&mpol->nodes)))
+		return &mpol->nodes;
+#endif
+	return NULL;
+}
+
 /*
  * Increase the hugetlb pool such that it can accommodate a reservation
  * of size 'delta'.
@@ -2531,6 +2548,8 @@ static int gather_surplus_pages(struct hstate *h, long delta)
 	long i;
 	long needed, allocated;
 	bool alloc_ok = true;
+	int node;
+	nodemask_t *mbind_nodemask = policy_mbind_nodemask(htlb_alloc_mask(h));
 
 	lockdep_assert_held(&hugetlb_lock);
 	needed = (h->resv_huge_pages + delta) - h->free_huge_pages;
@@ -2545,8 +2564,15 @@ static int gather_surplus_pages(struct hstate *h, long delta)
 retry:
 	spin_unlock_irq(&hugetlb_lock);
 	for (i = 0; i < needed; i++) {
-		folio = alloc_surplus_hugetlb_folio(h, htlb_alloc_mask(h),
-				NUMA_NO_NODE, NULL);
+		folio = NULL;
+		for_each_node_mask(node, cpuset_current_mems_allowed) {
+			if (!mbind_nodemask || node_isset(node, *mbind_nodemask)) {
+				folio = alloc_surplus_hugetlb_folio(h, htlb_alloc_mask(h),
+						node, NULL);
+				if (folio)
+					break;
+			}
+		}
 		if (!folio) {
 			alloc_ok = false;
 			break;
@@ -4308,7 +4334,7 @@ void __init hugetlb_add_hstate(unsigned int order)
 	BUG_ON(hugetlb_max_hstate >= HUGE_MAX_HSTATE);
 	BUG_ON(order == 0);
 	h = &hstates[hugetlb_max_hstate++];
-	mutex_init(&h->resize_lock);
+	__mutex_init(&h->resize_lock, "resize mutex", &h->resize_key);
 	h->order = order;
 	h->mask = ~(huge_page_size(h) - 1);
 	for (i = 0; i < MAX_NUMNODES; ++i)
@@ -4531,23 +4557,6 @@ static int __init default_hugepagesz_setup(char *s)
 }
 __setup("default_hugepagesz=", default_hugepagesz_setup);
 
-static nodemask_t *policy_mbind_nodemask(gfp_t gfp)
-{
-#ifdef CONFIG_NUMA
-	struct mempolicy *mpol = get_task_policy(current);
-
-	/*
-	 * Only enforce MPOL_BIND policy which overlaps with cpuset policy
-	 * (from policy_nodemask) specifically for hugetlb case
-	 */
-	if (mpol->mode == MPOL_BIND &&
-		(apply_policy_zone(mpol, gfp_zone(gfp)) &&
-		 cpuset_nodemask_valid_mems_allowed(&mpol->nodes)))
-		return &mpol->nodes;
-#endif
-	return NULL;
-}
-
 static unsigned int allowed_mems_nr(struct hstate *h)
 {
 	int node;
diff --git a/mm/memory.c b/mm/memory.c
index e44d4d887cf6..58408bf96e0e 100644
--- a/mm/memory.c
+++ b/mm/memory.c
@@ -4353,7 +4353,7 @@ void set_pte_range(struct vm_fault *vmf, struct folio *folio,
 	struct vm_area_struct *vma = vmf->vma;
 	bool uffd_wp = vmf_orig_pte_uffd_wp(vmf);
 	bool write = vmf->flags & FAULT_FLAG_WRITE;
-	bool prefault = in_range(vmf->address, addr, nr * PAGE_SIZE);
+	bool prefault = !in_range(vmf->address, addr, nr * PAGE_SIZE);
 	pte_t entry;
 
 	flush_icache_pages(vma, page, nr);
diff --git a/mm/mempolicy.c b/mm/mempolicy.c
index e52e3a0b8f2e..4cae854c0f28 100644
--- a/mm/mempolicy.c
+++ b/mm/mempolicy.c
@@ -3134,8 +3134,9 @@ int mpol_parse_str(char *str, struct mempolicy **mpol)
  * @pol:  pointer to mempolicy to be formatted
  *
  * Convert @pol into a string.  If @buffer is too short, truncate the string.
- * Recommend a @maxlen of at least 32 for the longest mode, "interleave", the
- * longest flag, "relative", and to display at least a few node ids.
+ * Recommend a @maxlen of at least 51 for the longest mode, "weighted
+ * interleave", plus the longest flag flags, "relative|balancing", and to
+ * display at least a few node ids.
  */
 void mpol_to_str(char *buffer, int maxlen, struct mempolicy *pol)
 {
@@ -3144,7 +3145,10 @@ void mpol_to_str(char *buffer, int maxlen, struct mempolicy *pol)
 	unsigned short mode = MPOL_DEFAULT;
 	unsigned short flags = 0;
 
-	if (pol && pol != &default_policy && !(pol->flags & MPOL_F_MORON)) {
+	if (pol &&
+	    pol != &default_policy &&
+	    !(pol >= &preferred_node_policy[0] &&
+	      pol <= &preferred_node_policy[ARRAY_SIZE(preferred_node_policy) - 1])) {
 		mode = pol->mode;
 		flags = pol->flags;
 	}
@@ -3171,12 +3175,18 @@ void mpol_to_str(char *buffer, int maxlen, struct mempolicy *pol)
 		p += snprintf(p, buffer + maxlen - p, "=");
 
 		/*
-		 * Currently, the only defined flags are mutually exclusive
+		 * Static and relative are mutually exclusive.
 		 */
 		if (flags & MPOL_F_STATIC_NODES)
 			p += snprintf(p, buffer + maxlen - p, "static");
 		else if (flags & MPOL_F_RELATIVE_NODES)
 			p += snprintf(p, buffer + maxlen - p, "relative");
+
+		if (flags & MPOL_F_NUMA_BALANCING) {
+			if (!is_power_of_2(flags & MPOL_MODE_FLAGS))
+				p += snprintf(p, buffer + maxlen - p, "|");
+			p += snprintf(p, buffer + maxlen - p, "balancing");
+		}
 	}
 
 	if (!nodes_empty(nodes))
diff --git a/mm/mmap_lock.c b/mm/mmap_lock.c
index 1854850b4b89..368b840e7508 100644
--- a/mm/mmap_lock.c
+++ b/mm/mmap_lock.c
@@ -19,14 +19,7 @@ EXPORT_TRACEPOINT_SYMBOL(mmap_lock_released);
 
 #ifdef CONFIG_MEMCG
 
-/*
- * Our various events all share the same buffer (because we don't want or need
- * to allocate a set of buffers *per event type*), so we need to protect against
- * concurrent _reg() and _unreg() calls, and count how many _reg() calls have
- * been made.
- */
-static DEFINE_MUTEX(reg_lock);
-static int reg_refcount; /* Protected by reg_lock. */
+static atomic_t reg_refcount;
 
 /*
  * Size of the buffer for memcg path names. Ignoring stack trace support,
@@ -34,136 +27,22 @@ static int reg_refcount; /* Protected by reg_lock. */
  */
 #define MEMCG_PATH_BUF_SIZE MAX_FILTER_STR_VAL
 
-/*
- * How many contexts our trace events might be called in: normal, softirq, irq,
- * and NMI.
- */
-#define CONTEXT_COUNT 4
-
-struct memcg_path {
-	local_lock_t lock;
-	char __rcu *buf;
-	local_t buf_idx;
-};
-static DEFINE_PER_CPU(struct memcg_path, memcg_paths) = {
-	.lock = INIT_LOCAL_LOCK(lock),
-	.buf_idx = LOCAL_INIT(0),
-};
-
-static char **tmp_bufs;
-
-/* Called with reg_lock held. */
-static void free_memcg_path_bufs(void)
-{
-	struct memcg_path *memcg_path;
-	int cpu;
-	char **old = tmp_bufs;
-
-	for_each_possible_cpu(cpu) {
-		memcg_path = per_cpu_ptr(&memcg_paths, cpu);
-		*(old++) = rcu_dereference_protected(memcg_path->buf,
-			lockdep_is_held(&reg_lock));
-		rcu_assign_pointer(memcg_path->buf, NULL);
-	}
-
-	/* Wait for inflight memcg_path_buf users to finish. */
-	synchronize_rcu();
-
-	old = tmp_bufs;
-	for_each_possible_cpu(cpu) {
-		kfree(*(old++));
-	}
-
-	kfree(tmp_bufs);
-	tmp_bufs = NULL;
-}
-
 int trace_mmap_lock_reg(void)
 {
-	int cpu;
-	char *new;
-
-	mutex_lock(&reg_lock);
-
-	/* If the refcount is going 0->1, proceed with allocating buffers. */
-	if (reg_refcount++)
-		goto out;
-
-	tmp_bufs = kmalloc_array(num_possible_cpus(), sizeof(*tmp_bufs),
-				 GFP_KERNEL);
-	if (tmp_bufs == NULL)
-		goto out_fail;
-
-	for_each_possible_cpu(cpu) {
-		new = kmalloc(MEMCG_PATH_BUF_SIZE * CONTEXT_COUNT, GFP_KERNEL);
-		if (new == NULL)
-			goto out_fail_free;
-		rcu_assign_pointer(per_cpu_ptr(&memcg_paths, cpu)->buf, new);
-		/* Don't need to wait for inflights, they'd have gotten NULL. */
-	}
-
-out:
-	mutex_unlock(&reg_lock);
+	atomic_inc(&reg_refcount);
 	return 0;
-
-out_fail_free:
-	free_memcg_path_bufs();
-out_fail:
-	/* Since we failed, undo the earlier ref increment. */
-	--reg_refcount;
-
-	mutex_unlock(&reg_lock);
-	return -ENOMEM;
 }
 
 void trace_mmap_lock_unreg(void)
 {
-	mutex_lock(&reg_lock);
-
-	/* If the refcount is going 1->0, proceed with freeing buffers. */
-	if (--reg_refcount)
-		goto out;
-
-	free_memcg_path_bufs();
-
-out:
-	mutex_unlock(&reg_lock);
-}
-
-static inline char *get_memcg_path_buf(void)
-{
-	struct memcg_path *memcg_path = this_cpu_ptr(&memcg_paths);
-	char *buf;
-	int idx;
-
-	rcu_read_lock();
-	buf = rcu_dereference(memcg_path->buf);
-	if (buf == NULL) {
-		rcu_read_unlock();
-		return NULL;
-	}
-	idx = local_add_return(MEMCG_PATH_BUF_SIZE, &memcg_path->buf_idx) -
-	      MEMCG_PATH_BUF_SIZE;
-	return &buf[idx];
+	atomic_dec(&reg_refcount);
 }
 
-static inline void put_memcg_path_buf(void)
-{
-	local_sub(MEMCG_PATH_BUF_SIZE, &this_cpu_ptr(&memcg_paths)->buf_idx);
-	rcu_read_unlock();
-}
-
-#define TRACE_MMAP_LOCK_EVENT(type, mm, ...)                                   \
-	do {                                                                   \
-		const char *memcg_path;                                        \
-		local_lock(&memcg_paths.lock);                                 \
-		memcg_path = get_mm_memcg_path(mm);                            \
-		trace_mmap_lock_##type(mm,                                     \
-				       memcg_path != NULL ? memcg_path : "",   \
-				       ##__VA_ARGS__);                         \
-		if (likely(memcg_path != NULL))                                \
-			put_memcg_path_buf();                                  \
-		local_unlock(&memcg_paths.lock);                               \
+#define TRACE_MMAP_LOCK_EVENT(type, mm, ...)                    \
+	do {                                                    \
+		char buf[MEMCG_PATH_BUF_SIZE];                  \
+		get_mm_memcg_path(mm, buf, sizeof(buf));        \
+		trace_mmap_lock_##type(mm, buf, ##__VA_ARGS__); \
 	} while (0)
 
 #else /* !CONFIG_MEMCG */
@@ -185,37 +64,23 @@ void trace_mmap_lock_unreg(void)
 #ifdef CONFIG_TRACING
 #ifdef CONFIG_MEMCG
 /*
- * Write the given mm_struct's memcg path to a percpu buffer, and return a
- * pointer to it. If the path cannot be determined, or no buffer was available
- * (because the trace event is being unregistered), NULL is returned.
- *
- * Note: buffers are allocated per-cpu to avoid locking, so preemption must be
- * disabled by the caller before calling us, and re-enabled only after the
- * caller is done with the pointer.
- *
- * The caller must call put_memcg_path_buf() once the buffer is no longer
- * needed. This must be done while preemption is still disabled.
+ * Write the given mm_struct's memcg path to a buffer. If the path cannot be
+ * determined or the trace event is being unregistered, empty string is written.
  */
-static const char *get_mm_memcg_path(struct mm_struct *mm)
+static void get_mm_memcg_path(struct mm_struct *mm, char *buf, size_t buflen)
 {
-	char *buf = NULL;
-	struct mem_cgroup *memcg = get_mem_cgroup_from_mm(mm);
+	struct mem_cgroup *memcg;
 
+	buf[0] = '\0';
+	/* No need to get path if no trace event is registered. */
+	if (!atomic_read(&reg_refcount))
+		return;
+	memcg = get_mem_cgroup_from_mm(mm);
 	if (memcg == NULL)
-		goto out;
-	if (unlikely(memcg->css.cgroup == NULL))
-		goto out_put;
-
-	buf = get_memcg_path_buf();
-	if (buf == NULL)
-		goto out_put;
-
-	cgroup_path(memcg->css.cgroup, buf, MEMCG_PATH_BUF_SIZE);
-
-out_put:
+		return;
+	if (memcg->css.cgroup)
+		cgroup_path(memcg->css.cgroup, buf, buflen);
 	css_put(&memcg->css);
-out:
-	return buf;
 }
 
 #endif /* CONFIG_MEMCG */
diff --git a/mm/vmscan.c b/mm/vmscan.c
index e9d4c1f6d7bb..83fa8e924f8a 100644
--- a/mm/vmscan.c
+++ b/mm/vmscan.c
@@ -4546,6 +4546,32 @@ static bool try_to_inc_max_seq(struct lruvec *lruvec, unsigned long max_seq,
  *                          working set protection
  ******************************************************************************/
 
+static void set_initial_priority(struct pglist_data *pgdat, struct scan_control *sc)
+{
+	int priority;
+	unsigned long reclaimable;
+
+	if (sc->priority != DEF_PRIORITY || sc->nr_to_reclaim < MIN_LRU_BATCH)
+		return;
+	/*
+	 * Determine the initial priority based on
+	 * (total >> priority) * reclaimed_to_scanned_ratio = nr_to_reclaim,
+	 * where reclaimed_to_scanned_ratio = inactive / total.
+	 */
+	reclaimable = node_page_state(pgdat, NR_INACTIVE_FILE);
+	if (can_reclaim_anon_pages(NULL, pgdat->node_id, sc))
+		reclaimable += node_page_state(pgdat, NR_INACTIVE_ANON);
+
+	/* round down reclaimable and round up sc->nr_to_reclaim */
+	priority = fls_long(reclaimable) - 1 - fls_long(sc->nr_to_reclaim - 1);
+
+	/*
+	 * The estimation is based on LRU pages only, so cap it to prevent
+	 * overshoots of shrinker objects by large margins.
+	 */
+	sc->priority = clamp(priority, DEF_PRIORITY / 2, DEF_PRIORITY);
+}
+
 static bool lruvec_is_sizable(struct lruvec *lruvec, struct scan_control *sc)
 {
 	int gen, type, zone;
@@ -4579,19 +4605,17 @@ static bool lruvec_is_reclaimable(struct lruvec *lruvec, struct scan_control *sc
 	struct mem_cgroup *memcg = lruvec_memcg(lruvec);
 	DEFINE_MIN_SEQ(lruvec);
 
-	/* see the comment on lru_gen_folio */
-	gen = lru_gen_from_seq(min_seq[LRU_GEN_FILE]);
-	birth = READ_ONCE(lruvec->lrugen.timestamps[gen]);
-
-	if (time_is_after_jiffies(birth + min_ttl))
+	if (mem_cgroup_below_min(NULL, memcg))
 		return false;
 
 	if (!lruvec_is_sizable(lruvec, sc))
 		return false;
 
-	mem_cgroup_calculate_protection(NULL, memcg);
+	/* see the comment on lru_gen_folio */
+	gen = lru_gen_from_seq(min_seq[LRU_GEN_FILE]);
+	birth = READ_ONCE(lruvec->lrugen.timestamps[gen]);
 
-	return !mem_cgroup_below_min(NULL, memcg);
+	return time_is_before_jiffies(birth + min_ttl);
 }
 
 /* to protect the working set of the last N jiffies */
@@ -4601,23 +4625,20 @@ static void lru_gen_age_node(struct pglist_data *pgdat, struct scan_control *sc)
 {
 	struct mem_cgroup *memcg;
 	unsigned long min_ttl = READ_ONCE(lru_gen_min_ttl);
+	bool reclaimable = !min_ttl;
 
 	VM_WARN_ON_ONCE(!current_is_kswapd());
 
-	/* check the order to exclude compaction-induced reclaim */
-	if (!min_ttl || sc->order || sc->priority == DEF_PRIORITY)
-		return;
+	set_initial_priority(pgdat, sc);
 
 	memcg = mem_cgroup_iter(NULL, NULL, NULL);
 	do {
 		struct lruvec *lruvec = mem_cgroup_lruvec(memcg, pgdat);
 
-		if (lruvec_is_reclaimable(lruvec, sc, min_ttl)) {
-			mem_cgroup_iter_break(NULL, memcg);
-			return;
-		}
+		mem_cgroup_calculate_protection(NULL, memcg);
 
-		cond_resched();
+		if (!reclaimable)
+			reclaimable = lruvec_is_reclaimable(lruvec, sc, min_ttl);
 	} while ((memcg = mem_cgroup_iter(NULL, memcg, NULL)));
 
 	/*
@@ -4625,7 +4646,7 @@ static void lru_gen_age_node(struct pglist_data *pgdat, struct scan_control *sc)
 	 * younger than min_ttl. However, another possibility is all memcgs are
 	 * either too small or below min.
 	 */
-	if (mutex_trylock(&oom_lock)) {
+	if (!reclaimable && mutex_trylock(&oom_lock)) {
 		struct oom_control oc = {
 			.gfp_mask = sc->gfp_mask,
 		};
@@ -5226,7 +5247,6 @@ static int evict_folios(struct lruvec *lruvec, struct scan_control *sc, int swap
 
 		/* retry folios that may have missed folio_rotate_reclaimable() */
 		list_move(&folio->lru, &clean);
-		sc->nr_scanned -= folio_nr_pages(folio);
 	}
 
 	spin_lock_irq(&lruvec->lru_lock);
@@ -5425,8 +5445,7 @@ static int shrink_one(struct lruvec *lruvec, struct scan_control *sc)
 	struct mem_cgroup *memcg = lruvec_memcg(lruvec);
 	struct pglist_data *pgdat = lruvec_pgdat(lruvec);
 
-	mem_cgroup_calculate_protection(NULL, memcg);
-
+	/* lru_gen_age_node() called mem_cgroup_calculate_protection() */
 	if (mem_cgroup_below_min(NULL, memcg))
 		return MEMCG_LRU_YOUNG;
 
@@ -5566,29 +5585,6 @@ static void lru_gen_shrink_lruvec(struct lruvec *lruvec, struct scan_control *sc
 
 #endif
 
-static void set_initial_priority(struct pglist_data *pgdat, struct scan_control *sc)
-{
-	int priority;
-	unsigned long reclaimable;
-	struct lruvec *lruvec = mem_cgroup_lruvec(NULL, pgdat);
-
-	if (sc->priority != DEF_PRIORITY || sc->nr_to_reclaim < MIN_LRU_BATCH)
-		return;
-	/*
-	 * Determine the initial priority based on
-	 * (total >> priority) * reclaimed_to_scanned_ratio = nr_to_reclaim,
-	 * where reclaimed_to_scanned_ratio = inactive / total.
-	 */
-	reclaimable = node_page_state(pgdat, NR_INACTIVE_FILE);
-	if (get_swappiness(lruvec, sc))
-		reclaimable += node_page_state(pgdat, NR_INACTIVE_ANON);
-
-	/* round down reclaimable and round up sc->nr_to_reclaim */
-	priority = fls_long(reclaimable) - 1 - fls_long(sc->nr_to_reclaim - 1);
-
-	sc->priority = clamp(priority, 0, DEF_PRIORITY);
-}
-
 static void lru_gen_shrink_node(struct pglist_data *pgdat, struct scan_control *sc)
 {
 	struct blk_plug plug;
@@ -7351,6 +7347,7 @@ static bool kswapd_shrink_node(pg_data_t *pgdat,
 {
 	struct zone *zone;
 	int z;
+	unsigned long nr_reclaimed = sc->nr_reclaimed;
 
 	/* Reclaim a number of pages proportional to the number of zones */
 	sc->nr_to_reclaim = 0;
@@ -7378,7 +7375,8 @@ static bool kswapd_shrink_node(pg_data_t *pgdat,
 	if (sc->order && sc->nr_reclaimed >= compact_gap(sc->order))
 		sc->order = 0;
 
-	return sc->nr_scanned >= sc->nr_to_reclaim;
+	/* account for progress from mm_account_reclaimed_pages() */
+	return max(sc->nr_scanned, sc->nr_reclaimed - nr_reclaimed) >= sc->nr_to_reclaim;
 }
 
 /* Page allocator PCP high watermark is lowered if reclaim is active. */
diff --git a/net/bridge/br_forward.c b/net/bridge/br_forward.c
index d97064d460dc..e19b583ff2c6 100644
--- a/net/bridge/br_forward.c
+++ b/net/bridge/br_forward.c
@@ -25,8 +25,8 @@ static inline int should_deliver(const struct net_bridge_port *p,
 
 	vg = nbp_vlan_group_rcu(p);
 	return ((p->flags & BR_HAIRPIN_MODE) || skb->dev != p->dev) &&
-		p->state == BR_STATE_FORWARDING && br_allowed_egress(vg, skb) &&
-		nbp_switchdev_allowed_egress(p, skb) &&
+		(br_mst_is_enabled(p->br) || p->state == BR_STATE_FORWARDING) &&
+		br_allowed_egress(vg, skb) && nbp_switchdev_allowed_egress(p, skb) &&
 		!br_skb_isolated(p, skb);
 }
 
diff --git a/net/core/filter.c b/net/core/filter.c
index afe38b8dee02..8cb44cd29967 100644
--- a/net/core/filter.c
+++ b/net/core/filter.c
@@ -3530,13 +3530,20 @@ static int bpf_skb_net_grow(struct sk_buff *skb, u32 off, u32 len_diff,
 	if (skb_is_gso(skb)) {
 		struct skb_shared_info *shinfo = skb_shinfo(skb);
 
-		/* Due to header grow, MSS needs to be downgraded. */
-		if (!(flags & BPF_F_ADJ_ROOM_FIXED_GSO))
-			skb_decrease_gso_size(shinfo, len_diff);
-
 		/* Header must be checked, and gso_segs recomputed. */
 		shinfo->gso_type |= gso_type;
 		shinfo->gso_segs = 0;
+
+		/* Due to header growth, MSS needs to be downgraded.
+		 * There is a BUG_ON() when segmenting the frag_list with
+		 * head_frag true, so linearize the skb after downgrading
+		 * the MSS.
+		 */
+		if (!(flags & BPF_F_ADJ_ROOM_FIXED_GSO)) {
+			skb_decrease_gso_size(shinfo, len_diff);
+			if (shinfo->frag_list)
+				return skb_linearize(skb);
+		}
 	}
 
 	return 0;
diff --git a/net/core/flow_dissector.c b/net/core/flow_dissector.c
index 272f09251343..b22d20cc417b 100644
--- a/net/core/flow_dissector.c
+++ b/net/core/flow_dissector.c
@@ -1093,7 +1093,7 @@ bool __skb_flow_dissect(const struct net *net,
 		}
 	}
 
-	WARN_ON_ONCE(!net);
+	DEBUG_NET_WARN_ON_ONCE(!net);
 	if (net) {
 		enum netns_bpf_attach_type type = NETNS_BPF_FLOW_DISSECTOR;
 		struct bpf_prog_array *run_array;
diff --git a/net/core/xdp.c b/net/core/xdp.c
index 5fe4c099f30a..5ee3f8f165e5 100644
--- a/net/core/xdp.c
+++ b/net/core/xdp.c
@@ -126,10 +126,8 @@ void xdp_unreg_mem_model(struct xdp_mem_info *mem)
 		return;
 
 	if (type == MEM_TYPE_PAGE_POOL) {
-		rcu_read_lock();
-		xa = rhashtable_lookup(mem_id_ht, &id, mem_id_rht_params);
+		xa = rhashtable_lookup_fast(mem_id_ht, &id, mem_id_rht_params);
 		page_pool_destroy(xa->page_pool);
-		rcu_read_unlock();
 	}
 }
 EXPORT_SYMBOL_GPL(xdp_unreg_mem_model);
diff --git a/net/ipv4/esp4.c b/net/ipv4/esp4.c
index fe501d2186bc..eeace9b509ce 100644
--- a/net/ipv4/esp4.c
+++ b/net/ipv4/esp4.c
@@ -238,8 +238,7 @@ static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb)
 #else
 static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb)
 {
-	kfree_skb(skb);
-
+	WARN_ON(1);
 	return -EOPNOTSUPP;
 }
 #endif
diff --git a/net/ipv4/fib_semantics.c b/net/ipv4/fib_semantics.c
index 5eb1b8d302bb..e3268615a65a 100644
--- a/net/ipv4/fib_semantics.c
+++ b/net/ipv4/fib_semantics.c
@@ -2270,6 +2270,15 @@ void fib_select_path(struct net *net, struct fib_result *res,
 		fib_select_default(fl4, res);
 
 check_saddr:
-	if (!fl4->saddr)
-		fl4->saddr = fib_result_prefsrc(net, res);
+	if (!fl4->saddr) {
+		struct net_device *l3mdev;
+
+		l3mdev = dev_get_by_index_rcu(net, fl4->flowi4_l3mdev);
+
+		if (!l3mdev ||
+		    l3mdev_master_dev_rcu(FIB_RES_DEV(*res)) == l3mdev)
+			fl4->saddr = fib_result_prefsrc(net, res);
+		else
+			fl4->saddr = inet_select_addr(l3mdev, 0, RT_SCOPE_LINK);
+	}
 }
diff --git a/net/ipv4/fib_trie.c b/net/ipv4/fib_trie.c
index 9bdfdab906fe..77b97c48da5e 100644
--- a/net/ipv4/fib_trie.c
+++ b/net/ipv4/fib_trie.c
@@ -1628,6 +1628,7 @@ int fib_table_lookup(struct fib_table *tb, const struct flowi4 *flp,
 			res->nhc = nhc;
 			res->type = fa->fa_type;
 			res->scope = fi->fib_scope;
+			res->dscp = fa->fa_dscp;
 			res->fi = fi;
 			res->table = tb;
 			res->fa_head = &n->leaf;
diff --git a/net/ipv4/nexthop.c b/net/ipv4/nexthop.c
index bbff68b5b5d4..8d41b0394219 100644
--- a/net/ipv4/nexthop.c
+++ b/net/ipv4/nexthop.c
@@ -676,9 +676,10 @@ static int nla_put_nh_group(struct sk_buff *skb, struct nh_group *nhg)
 
 	p = nla_data(nla);
 	for (i = 0; i < nhg->num_nh; ++i) {
-		p->id = nhg->nh_entries[i].nh->id;
-		p->weight = nhg->nh_entries[i].weight - 1;
-		p += 1;
+		*p++ = (struct nexthop_grp) {
+			.id = nhg->nh_entries[i].nh->id,
+			.weight = nhg->nh_entries[i].weight - 1,
+		};
 	}
 
 	if (nhg->resilient && nla_put_nh_group_res(skb, nhg))
diff --git a/net/ipv4/route.c b/net/ipv4/route.c
index 40b9c579c917..285482060082 100644
--- a/net/ipv4/route.c
+++ b/net/ipv4/route.c
@@ -1275,7 +1275,7 @@ void ip_rt_get_source(u8 *addr, struct sk_buff *skb, struct rtable *rt)
 		struct flowi4 fl4 = {
 			.daddr = iph->daddr,
 			.saddr = iph->saddr,
-			.flowi4_tos = RT_TOS(iph->tos),
+			.flowi4_tos = iph->tos & IPTOS_RT_MASK,
 			.flowi4_oif = rt->dst.dev->ifindex,
 			.flowi4_iif = skb->dev->ifindex,
 			.flowi4_mark = skb->mark,
@@ -2930,9 +2930,9 @@ EXPORT_SYMBOL_GPL(ip_route_output_tunnel);
 
 /* called with rcu_read_lock held */
 static int rt_fill_info(struct net *net, __be32 dst, __be32 src,
-			struct rtable *rt, u32 table_id, struct flowi4 *fl4,
-			struct sk_buff *skb, u32 portid, u32 seq,
-			unsigned int flags)
+			struct rtable *rt, u32 table_id, dscp_t dscp,
+			struct flowi4 *fl4, struct sk_buff *skb, u32 portid,
+			u32 seq, unsigned int flags)
 {
 	struct rtmsg *r;
 	struct nlmsghdr *nlh;
@@ -2948,7 +2948,7 @@ static int rt_fill_info(struct net *net, __be32 dst, __be32 src,
 	r->rtm_family	 = AF_INET;
 	r->rtm_dst_len	= 32;
 	r->rtm_src_len	= 0;
-	r->rtm_tos	= fl4 ? fl4->flowi4_tos : 0;
+	r->rtm_tos	= inet_dscp_to_dsfield(dscp);
 	r->rtm_table	= table_id < 256 ? table_id : RT_TABLE_COMPAT;
 	if (nla_put_u32(skb, RTA_TABLE, table_id))
 		goto nla_put_failure;
@@ -3098,7 +3098,7 @@ static int fnhe_dump_bucket(struct net *net, struct sk_buff *skb,
 				goto next;
 
 			err = rt_fill_info(net, fnhe->fnhe_daddr, 0, rt,
-					   table_id, NULL, skb,
+					   table_id, 0, NULL, skb,
 					   NETLINK_CB(cb->skb).portid,
 					   cb->nlh->nlmsg_seq, flags);
 			if (err)
@@ -3394,7 +3394,7 @@ static int inet_rtm_getroute(struct sk_buff *in_skb, struct nlmsghdr *nlh,
 		fri.tb_id = table_id;
 		fri.dst = res.prefix;
 		fri.dst_len = res.prefixlen;
-		fri.dscp = inet_dsfield_to_dscp(fl4.flowi4_tos);
+		fri.dscp = res.dscp;
 		fri.type = rt->rt_type;
 		fri.offload = 0;
 		fri.trap = 0;
@@ -3421,8 +3421,8 @@ static int inet_rtm_getroute(struct sk_buff *in_skb, struct nlmsghdr *nlh,
 		err = fib_dump_info(skb, NETLINK_CB(in_skb).portid,
 				    nlh->nlmsg_seq, RTM_NEWROUTE, &fri, 0);
 	} else {
-		err = rt_fill_info(net, dst, src, rt, table_id, &fl4, skb,
-				   NETLINK_CB(in_skb).portid,
+		err = rt_fill_info(net, dst, src, rt, table_id, res.dscp, &fl4,
+				   skb, NETLINK_CB(in_skb).portid,
 				   nlh->nlmsg_seq, 0);
 	}
 	if (err < 0)
diff --git a/net/ipv4/tcp.c b/net/ipv4/tcp.c
index 2df05ea2e00f..91c3d8264059 100644
--- a/net/ipv4/tcp.c
+++ b/net/ipv4/tcp.c
@@ -591,7 +591,7 @@ __poll_t tcp_poll(struct file *file, struct socket *sock, poll_table *wait)
 		 */
 		mask |= EPOLLOUT | EPOLLWRNORM;
 	}
-	/* This barrier is coupled with smp_wmb() in tcp_reset() */
+	/* This barrier is coupled with smp_wmb() in tcp_done_with_error() */
 	smp_rmb();
 	if (READ_ONCE(sk->sk_err) ||
 	    !skb_queue_empty_lockless(&sk->sk_error_queue))
diff --git a/net/ipv4/tcp_input.c b/net/ipv4/tcp_input.c
index b9133c0972d3..c2e4dac42453 100644
--- a/net/ipv4/tcp_input.c
+++ b/net/ipv4/tcp_input.c
@@ -4367,9 +4367,26 @@ static enum skb_drop_reason tcp_sequence(const struct tcp_sock *tp,
 	return SKB_NOT_DROPPED_YET;
 }
 
+
+void tcp_done_with_error(struct sock *sk, int err)
+{
+	/* This barrier is coupled with smp_rmb() in tcp_poll() */
+	WRITE_ONCE(sk->sk_err, err);
+	smp_wmb();
+
+	tcp_write_queue_purge(sk);
+	tcp_done(sk);
+
+	if (!sock_flag(sk, SOCK_DEAD))
+		sk_error_report(sk);
+}
+EXPORT_SYMBOL(tcp_done_with_error);
+
 /* When we get a reset we do this. */
 void tcp_reset(struct sock *sk, struct sk_buff *skb)
 {
+	int err;
+
 	trace_tcp_receive_reset(sk);
 
 	/* mptcp can't tell us to ignore reset pkts,
@@ -4381,24 +4398,17 @@ void tcp_reset(struct sock *sk, struct sk_buff *skb)
 	/* We want the right error as BSD sees it (and indeed as we do). */
 	switch (sk->sk_state) {
 	case TCP_SYN_SENT:
-		WRITE_ONCE(sk->sk_err, ECONNREFUSED);
+		err = ECONNREFUSED;
 		break;
 	case TCP_CLOSE_WAIT:
-		WRITE_ONCE(sk->sk_err, EPIPE);
+		err = EPIPE;
 		break;
 	case TCP_CLOSE:
 		return;
 	default:
-		WRITE_ONCE(sk->sk_err, ECONNRESET);
+		err = ECONNRESET;
 	}
-	/* This barrier is coupled with smp_rmb() in tcp_poll() */
-	smp_wmb();
-
-	tcp_write_queue_purge(sk);
-	tcp_done(sk);
-
-	if (!sock_flag(sk, SOCK_DEAD))
-		sk_error_report(sk);
+	tcp_done_with_error(sk, err);
 }
 
 /*
diff --git a/net/ipv4/tcp_ipv4.c b/net/ipv4/tcp_ipv4.c
index 7c2ca4df0daa..48ec2c1777d4 100644
--- a/net/ipv4/tcp_ipv4.c
+++ b/net/ipv4/tcp_ipv4.c
@@ -602,15 +602,10 @@ int tcp_v4_err(struct sk_buff *skb, u32 info)
 
 		ip_icmp_error(sk, skb, err, th->dest, info, (u8 *)th);
 
-		if (!sock_owned_by_user(sk)) {
-			WRITE_ONCE(sk->sk_err, err);
-
-			sk_error_report(sk);
-
-			tcp_done(sk);
-		} else {
+		if (!sock_owned_by_user(sk))
+			tcp_done_with_error(sk, err);
+		else
 			WRITE_ONCE(sk->sk_err_soft, err);
-		}
 		goto out;
 	}
 
diff --git a/net/ipv4/tcp_timer.c b/net/ipv4/tcp_timer.c
index 87ebe958a642..64bcf384e9dd 100644
--- a/net/ipv4/tcp_timer.c
+++ b/net/ipv4/tcp_timer.c
@@ -69,11 +69,7 @@ u32 tcp_clamp_probe0_to_user_timeout(const struct sock *sk, u32 when)
 
 static void tcp_write_err(struct sock *sk)
 {
-	WRITE_ONCE(sk->sk_err, READ_ONCE(sk->sk_err_soft) ? : ETIMEDOUT);
-	sk_error_report(sk);
-
-	tcp_write_queue_purge(sk);
-	tcp_done(sk);
+	tcp_done_with_error(sk, READ_ONCE(sk->sk_err_soft) ? : ETIMEDOUT);
 	__NET_INC_STATS(sock_net(sk), LINUX_MIB_TCPABORTONTIMEOUT);
 }
 
diff --git a/net/ipv6/addrconf.c b/net/ipv6/addrconf.c
index 9dfbda164e8c..a9358c796a81 100644
--- a/net/ipv6/addrconf.c
+++ b/net/ipv6/addrconf.c
@@ -1839,7 +1839,8 @@ int ipv6_dev_get_saddr(struct net *net, const struct net_device *dst_dev,
 							    master, &dst,
 							    scores, hiscore_idx);
 
-			if (scores[hiscore_idx].ifa)
+			if (scores[hiscore_idx].ifa &&
+			    scores[hiscore_idx].scopedist >= 0)
 				goto out;
 		}
 
diff --git a/net/ipv6/esp6.c b/net/ipv6/esp6.c
index a3fa3eda388a..62bb9651133c 100644
--- a/net/ipv6/esp6.c
+++ b/net/ipv6/esp6.c
@@ -255,8 +255,7 @@ static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb)
 #else
 static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb)
 {
-	kfree_skb(skb);
-
+	WARN_ON(1);
 	return -EOPNOTSUPP;
 }
 #endif
diff --git a/net/ipv6/tcp_ipv6.c b/net/ipv6/tcp_ipv6.c
index 07bcb690932e..d0034916d386 100644
--- a/net/ipv6/tcp_ipv6.c
+++ b/net/ipv6/tcp_ipv6.c
@@ -488,14 +488,10 @@ static int tcp_v6_err(struct sk_buff *skb, struct inet6_skb_parm *opt,
 
 		ipv6_icmp_error(sk, skb, err, th->dest, ntohl(info), (u8 *)th);
 
-		if (!sock_owned_by_user(sk)) {
-			WRITE_ONCE(sk->sk_err, err);
-			sk_error_report(sk);		/* Wake people up to see the error (see connect in sock.c) */
-
-			tcp_done(sk);
-		} else {
+		if (!sock_owned_by_user(sk))
+			tcp_done_with_error(sk, err);
+		else
 			WRITE_ONCE(sk->sk_err_soft, err);
-		}
 		goto out;
 	case TCP_LISTEN:
 		break;
diff --git a/net/mac80211/cfg.c b/net/mac80211/cfg.c
index f3fc0be9d8ea..ca5b111f20e5 100644
--- a/net/mac80211/cfg.c
+++ b/net/mac80211/cfg.c
@@ -1887,7 +1887,7 @@ static int sta_link_apply_parameters(struct ieee80211_local *local,
 					      sband->band);
 	}
 
-	ieee80211_sta_set_rx_nss(link_sta);
+	ieee80211_sta_init_nss(link_sta);
 
 	return ret;
 }
diff --git a/net/mac80211/ieee80211_i.h b/net/mac80211/ieee80211_i.h
index fb55014c0e89..daea061d0fc1 100644
--- a/net/mac80211/ieee80211_i.h
+++ b/net/mac80211/ieee80211_i.h
@@ -2150,7 +2150,7 @@ enum ieee80211_sta_rx_bandwidth
 ieee80211_sta_cap_rx_bw(struct link_sta_info *link_sta);
 enum ieee80211_sta_rx_bandwidth
 ieee80211_sta_cur_vht_bw(struct link_sta_info *link_sta);
-void ieee80211_sta_set_rx_nss(struct link_sta_info *link_sta);
+void ieee80211_sta_init_nss(struct link_sta_info *link_sta);
 enum ieee80211_sta_rx_bandwidth
 ieee80211_chan_width_to_rx_bw(enum nl80211_chan_width width);
 enum nl80211_chan_width
diff --git a/net/mac80211/rate.c b/net/mac80211/rate.c
index a2bc9c5d92b8..3cf252418bd3 100644
--- a/net/mac80211/rate.c
+++ b/net/mac80211/rate.c
@@ -37,7 +37,7 @@ void rate_control_rate_init(struct sta_info *sta)
 	struct ieee80211_supported_band *sband;
 	struct ieee80211_chanctx_conf *chanctx_conf;
 
-	ieee80211_sta_set_rx_nss(&sta->deflink);
+	ieee80211_sta_init_nss(&sta->deflink);
 
 	if (!ref)
 		return;
diff --git a/net/mac80211/sta_info.h b/net/mac80211/sta_info.h
index 195b563132d6..f4af851f45ce 100644
--- a/net/mac80211/sta_info.h
+++ b/net/mac80211/sta_info.h
@@ -3,7 +3,7 @@
  * Copyright 2002-2005, Devicescape Software, Inc.
  * Copyright 2013-2014  Intel Mobile Communications GmbH
  * Copyright(c) 2015-2017 Intel Deutschland GmbH
- * Copyright(c) 2020-2022 Intel Corporation
+ * Copyright(c) 2020-2024 Intel Corporation
  */
 
 #ifndef STA_INFO_H
@@ -485,6 +485,8 @@ struct ieee80211_fragment_cache {
  *	same for non-MLD STA. This is used as key for searching link STA
  * @link_id: Link ID uniquely identifying the link STA. This is 0 for non-MLD
  *	and set to the corresponding vif LinkId for MLD STA
+ * @op_mode_nss: NSS limit as set by operating mode notification, or 0
+ * @capa_nss: NSS limit as determined by local and peer capabilities
  * @link_hash_node: hash node for rhashtable
  * @sta: Points to the STA info
  * @gtk: group keys negotiated with this station, if any
@@ -521,6 +523,8 @@ struct link_sta_info {
 	u8 addr[ETH_ALEN];
 	u8 link_id;
 
+	u8 op_mode_nss, capa_nss;
+
 	struct rhlist_head link_hash_node;
 
 	struct sta_info *sta;
diff --git a/net/mac80211/vht.c b/net/mac80211/vht.c
index b3a5c3e96a72..bc13b1419981 100644
--- a/net/mac80211/vht.c
+++ b/net/mac80211/vht.c
@@ -4,7 +4,7 @@
  *
  * Portions of this file
  * Copyright(c) 2015 - 2016 Intel Deutschland GmbH
- * Copyright (C) 2018 - 2023 Intel Corporation
+ * Copyright (C) 2018 - 2024 Intel Corporation
  */
 
 #include <linux/ieee80211.h>
@@ -541,15 +541,11 @@ ieee80211_sta_cur_vht_bw(struct link_sta_info *link_sta)
 	return bw;
 }
 
-void ieee80211_sta_set_rx_nss(struct link_sta_info *link_sta)
+void ieee80211_sta_init_nss(struct link_sta_info *link_sta)
 {
 	u8 ht_rx_nss = 0, vht_rx_nss = 0, he_rx_nss = 0, eht_rx_nss = 0, rx_nss;
 	bool support_160;
 
-	/* if we received a notification already don't overwrite it */
-	if (link_sta->pub->rx_nss)
-		return;
-
 	if (link_sta->pub->eht_cap.has_eht) {
 		int i;
 		const u8 *rx_nss_mcs = (void *)&link_sta->pub->eht_cap.eht_mcs_nss_supp;
@@ -627,7 +623,15 @@ void ieee80211_sta_set_rx_nss(struct link_sta_info *link_sta)
 	rx_nss = max(vht_rx_nss, ht_rx_nss);
 	rx_nss = max(he_rx_nss, rx_nss);
 	rx_nss = max(eht_rx_nss, rx_nss);
-	link_sta->pub->rx_nss = max_t(u8, 1, rx_nss);
+	rx_nss = max_t(u8, 1, rx_nss);
+	link_sta->capa_nss = rx_nss;
+
+	/* that shouldn't be set yet, but we can handle it anyway */
+	if (link_sta->op_mode_nss)
+		link_sta->pub->rx_nss =
+			min_t(u8, rx_nss, link_sta->op_mode_nss);
+	else
+		link_sta->pub->rx_nss = rx_nss;
 }
 
 u32 __ieee80211_vht_handle_opmode(struct ieee80211_sub_if_data *sdata,
@@ -637,7 +641,7 @@ u32 __ieee80211_vht_handle_opmode(struct ieee80211_sub_if_data *sdata,
 	enum ieee80211_sta_rx_bandwidth new_bw;
 	struct sta_opmode_info sta_opmode = {};
 	u32 changed = 0;
-	u8 nss, cur_nss;
+	u8 nss;
 
 	/* ignore - no support for BF yet */
 	if (opmode & IEEE80211_OPMODE_NOTIF_RX_NSS_TYPE_BF)
@@ -647,23 +651,17 @@ u32 __ieee80211_vht_handle_opmode(struct ieee80211_sub_if_data *sdata,
 	nss >>= IEEE80211_OPMODE_NOTIF_RX_NSS_SHIFT;
 	nss += 1;
 
-	if (link_sta->pub->rx_nss != nss) {
-		cur_nss = link_sta->pub->rx_nss;
-		/* Reset rx_nss and call ieee80211_sta_set_rx_nss() which
-		 * will set the same to max nss value calculated based on capability.
-		 */
-		link_sta->pub->rx_nss = 0;
-		ieee80211_sta_set_rx_nss(link_sta);
-		/* Do not allow an nss change to rx_nss greater than max_nss
-		 * negotiated and capped to APs capability during association.
-		 */
-		if (nss <= link_sta->pub->rx_nss) {
-			link_sta->pub->rx_nss = nss;
-			sta_opmode.rx_nss = nss;
-			changed |= IEEE80211_RC_NSS_CHANGED;
-			sta_opmode.changed |= STA_OPMODE_N_SS_CHANGED;
+	if (link_sta->op_mode_nss != nss) {
+		if (nss <= link_sta->capa_nss) {
+			link_sta->op_mode_nss = nss;
+
+			if (nss != link_sta->pub->rx_nss) {
+				link_sta->pub->rx_nss = nss;
+				changed |= IEEE80211_RC_NSS_CHANGED;
+				sta_opmode.rx_nss = link_sta->pub->rx_nss;
+				sta_opmode.changed |= STA_OPMODE_N_SS_CHANGED;
+			}
 		} else {
-			link_sta->pub->rx_nss = cur_nss;
 			pr_warn_ratelimited("Ignoring NSS change in VHT Operating Mode Notification from %pM with invalid nss %d",
 					    link_sta->pub->addr, nss);
 		}
diff --git a/net/netfilter/ipvs/ip_vs_ctl.c b/net/netfilter/ipvs/ip_vs_ctl.c
index 143a341bbc0a..dec5309d9f1f 100644
--- a/net/netfilter/ipvs/ip_vs_ctl.c
+++ b/net/netfilter/ipvs/ip_vs_ctl.c
@@ -1459,18 +1459,18 @@ ip_vs_add_service(struct netns_ipvs *ipvs, struct ip_vs_service_user_kern *u,
 	if (ret < 0)
 		goto out_err;
 
-	/* Bind the ct retriever */
-	RCU_INIT_POINTER(svc->pe, pe);
-	pe = NULL;
-
 	/* Update the virtual service counters */
 	if (svc->port == FTPPORT)
 		atomic_inc(&ipvs->ftpsvc_counter);
 	else if (svc->port == 0)
 		atomic_inc(&ipvs->nullsvc_counter);
-	if (svc->pe && svc->pe->conn_out)
+	if (pe && pe->conn_out)
 		atomic_inc(&ipvs->conn_out_counter);
 
+	/* Bind the ct retriever */
+	RCU_INIT_POINTER(svc->pe, pe);
+	pe = NULL;
+
 	/* Count only IPv4 services for old get/setsockopt interface */
 	if (svc->af == AF_INET)
 		ipvs->num_services++;
diff --git a/net/netfilter/ipvs/ip_vs_proto_sctp.c b/net/netfilter/ipvs/ip_vs_proto_sctp.c
index 1e689c714127..83e452916403 100644
--- a/net/netfilter/ipvs/ip_vs_proto_sctp.c
+++ b/net/netfilter/ipvs/ip_vs_proto_sctp.c
@@ -126,7 +126,7 @@ sctp_snat_handler(struct sk_buff *skb, struct ip_vs_protocol *pp,
 	if (sctph->source != cp->vport || payload_csum ||
 	    skb->ip_summed == CHECKSUM_PARTIAL) {
 		sctph->source = cp->vport;
-		if (!skb_is_gso(skb) || !skb_is_gso_sctp(skb))
+		if (!skb_is_gso(skb))
 			sctp_nat_csum(skb, sctph, sctphoff);
 	} else {
 		skb->ip_summed = CHECKSUM_UNNECESSARY;
@@ -175,7 +175,7 @@ sctp_dnat_handler(struct sk_buff *skb, struct ip_vs_protocol *pp,
 	    (skb->ip_summed == CHECKSUM_PARTIAL &&
 	     !(skb_dst(skb)->dev->features & NETIF_F_SCTP_CRC))) {
 		sctph->dest = cp->dport;
-		if (!skb_is_gso(skb) || !skb_is_gso_sctp(skb))
+		if (!skb_is_gso(skb))
 			sctp_nat_csum(skb, sctph, sctphoff);
 	} else if (skb->ip_summed != CHECKSUM_PARTIAL) {
 		skb->ip_summed = CHECKSUM_UNNECESSARY;
diff --git a/net/netfilter/nf_conntrack_netlink.c b/net/netfilter/nf_conntrack_netlink.c
index 334db22199c1..4dab45039f34 100644
--- a/net/netfilter/nf_conntrack_netlink.c
+++ b/net/netfilter/nf_conntrack_netlink.c
@@ -3411,7 +3411,8 @@ static int ctnetlink_del_expect(struct sk_buff *skb,
 
 		if (cda[CTA_EXPECT_ID]) {
 			__be32 id = nla_get_be32(cda[CTA_EXPECT_ID]);
-			if (ntohl(id) != (u32)(unsigned long)exp) {
+
+			if (id != nf_expect_get_id(exp)) {
 				nf_ct_expect_put(exp);
 				return -ENOENT;
 			}
diff --git a/net/netfilter/nft_set_pipapo.c b/net/netfilter/nft_set_pipapo.c
index 69b02a3f1ff0..e4dd73093048 100644
--- a/net/netfilter/nft_set_pipapo.c
+++ b/net/netfilter/nft_set_pipapo.c
@@ -360,7 +360,7 @@
  * Return: -1 on no match, bit position on 'match_only', 0 otherwise.
  */
 int pipapo_refill(unsigned long *map, int len, int rules, unsigned long *dst,
-		  union nft_pipapo_map_bucket *mt, bool match_only)
+		  const union nft_pipapo_map_bucket *mt, bool match_only)
 {
 	unsigned long bitset;
 	int k, ret = -1;
@@ -412,9 +412,9 @@ bool nft_pipapo_lookup(const struct net *net, const struct nft_set *set,
 	struct nft_pipapo_scratch *scratch;
 	unsigned long *res_map, *fill_map;
 	u8 genmask = nft_genmask_cur(net);
+	const struct nft_pipapo_match *m;
+	const struct nft_pipapo_field *f;
 	const u8 *rp = (const u8 *)key;
-	struct nft_pipapo_match *m;
-	struct nft_pipapo_field *f;
 	bool map_index;
 	int i;
 
@@ -432,7 +432,7 @@ bool nft_pipapo_lookup(const struct net *net, const struct nft_set *set,
 	res_map  = scratch->map + (map_index ? m->bsize_max : 0);
 	fill_map = scratch->map + (map_index ? 0 : m->bsize_max);
 
-	memset(res_map, 0xff, m->bsize_max * sizeof(*res_map));
+	pipapo_resmap_init(m, res_map);
 
 	nft_pipapo_for_each_field(f, i, m) {
 		bool last = i == m->field_count - 1;
@@ -517,11 +517,13 @@ static struct nft_pipapo_elem *pipapo_get(const struct net *net,
 {
 	struct nft_pipapo_elem *ret = ERR_PTR(-ENOENT);
 	struct nft_pipapo *priv = nft_set_priv(set);
-	struct nft_pipapo_match *m = priv->clone;
 	unsigned long *res_map, *fill_map = NULL;
-	struct nft_pipapo_field *f;
+	const struct nft_pipapo_match *m;
+	const struct nft_pipapo_field *f;
 	int i;
 
+	m = priv->clone;
+
 	res_map = kmalloc_array(m->bsize_max, sizeof(*res_map), GFP_ATOMIC);
 	if (!res_map) {
 		ret = ERR_PTR(-ENOMEM);
@@ -534,7 +536,7 @@ static struct nft_pipapo_elem *pipapo_get(const struct net *net,
 		goto out;
 	}
 
-	memset(res_map, 0xff, m->bsize_max * sizeof(*res_map));
+	pipapo_resmap_init(m, res_map);
 
 	nft_pipapo_for_each_field(f, i, m) {
 		bool last = i == m->field_count - 1;
@@ -1590,7 +1592,7 @@ static void pipapo_gc(const struct nft_set *_set, struct nft_pipapo_match *m)
 
 	while ((rules_f0 = pipapo_rules_same_key(m->f, first_rule))) {
 		union nft_pipapo_map_bucket rulemap[NFT_PIPAPO_MAX_FIELDS];
-		struct nft_pipapo_field *f;
+		const struct nft_pipapo_field *f;
 		int i, start, rules_fx;
 
 		start = first_rule;
@@ -2036,8 +2038,8 @@ static void nft_pipapo_walk(const struct nft_ctx *ctx, struct nft_set *set,
 {
 	struct nft_pipapo *priv = nft_set_priv(set);
 	struct net *net = read_pnet(&set->net);
-	struct nft_pipapo_match *m;
-	struct nft_pipapo_field *f;
+	const struct nft_pipapo_match *m;
+	const struct nft_pipapo_field *f;
 	int i, r;
 
 	rcu_read_lock();
diff --git a/net/netfilter/nft_set_pipapo.h b/net/netfilter/nft_set_pipapo.h
index a4a58812c108..aad9130cc763 100644
--- a/net/netfilter/nft_set_pipapo.h
+++ b/net/netfilter/nft_set_pipapo.h
@@ -185,7 +185,7 @@ struct nft_pipapo_elem {
 };
 
 int pipapo_refill(unsigned long *map, int len, int rules, unsigned long *dst,
-		  union nft_pipapo_map_bucket *mt, bool match_only);
+		  const union nft_pipapo_map_bucket *mt, bool match_only);
 
 /**
  * pipapo_and_field_buckets_4bit() - Intersect 4-bit buckets
@@ -193,7 +193,7 @@ int pipapo_refill(unsigned long *map, int len, int rules, unsigned long *dst,
  * @dst:	Area to store result
  * @data:	Input data selecting table buckets
  */
-static inline void pipapo_and_field_buckets_4bit(struct nft_pipapo_field *f,
+static inline void pipapo_and_field_buckets_4bit(const struct nft_pipapo_field *f,
 						 unsigned long *dst,
 						 const u8 *data)
 {
@@ -221,7 +221,7 @@ static inline void pipapo_and_field_buckets_4bit(struct nft_pipapo_field *f,
  * @dst:	Area to store result
  * @data:	Input data selecting table buckets
  */
-static inline void pipapo_and_field_buckets_8bit(struct nft_pipapo_field *f,
+static inline void pipapo_and_field_buckets_8bit(const struct nft_pipapo_field *f,
 						 unsigned long *dst,
 						 const u8 *data)
 {
@@ -285,4 +285,25 @@ static u64 pipapo_estimate_size(const struct nft_set_desc *desc)
 	return size;
 }
 
+/**
+ * pipapo_resmap_init() - Initialise result map before first use
+ * @m:		Matching data, including mapping table
+ * @res_map:	Result map
+ *
+ * Initialize all bits covered by the first field to one, so that after
+ * the first step, only the matching bits of the first bit group remain.
+ *
+ * If other fields have a large bitmap, set remainder of res_map to 0.
+ */
+static inline void pipapo_resmap_init(const struct nft_pipapo_match *m, unsigned long *res_map)
+{
+	const struct nft_pipapo_field *f = m->f;
+	int i;
+
+	for (i = 0; i < f->bsize; i++)
+		res_map[i] = ULONG_MAX;
+
+	for (i = f->bsize; i < m->bsize_max; i++)
+		res_map[i] = 0ul;
+}
 #endif /* _NFT_SET_PIPAPO_H */
diff --git a/net/netfilter/nft_set_pipapo_avx2.c b/net/netfilter/nft_set_pipapo_avx2.c
index a3a8ddca9918..b8d3c3213efe 100644
--- a/net/netfilter/nft_set_pipapo_avx2.c
+++ b/net/netfilter/nft_set_pipapo_avx2.c
@@ -212,8 +212,9 @@ static int nft_pipapo_avx2_refill(int offset, unsigned long *map,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_4b_2(unsigned long *map, unsigned long *fill,
-				       struct nft_pipapo_field *f, int offset,
-				       const u8 *pkt, bool first, bool last)
+				       const struct nft_pipapo_field *f,
+				       int offset, const u8 *pkt,
+				       bool first, bool last)
 {
 	int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
 	u8 pg[2] = { pkt[0] >> 4, pkt[0] & 0xf };
@@ -274,8 +275,9 @@ static int nft_pipapo_avx2_lookup_4b_2(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_4b_4(unsigned long *map, unsigned long *fill,
-				       struct nft_pipapo_field *f, int offset,
-				       const u8 *pkt, bool first, bool last)
+				       const struct nft_pipapo_field *f,
+				       int offset, const u8 *pkt,
+				       bool first, bool last)
 {
 	int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
 	u8 pg[4] = { pkt[0] >> 4, pkt[0] & 0xf, pkt[1] >> 4, pkt[1] & 0xf };
@@ -350,8 +352,9 @@ static int nft_pipapo_avx2_lookup_4b_4(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_4b_8(unsigned long *map, unsigned long *fill,
-				       struct nft_pipapo_field *f, int offset,
-				       const u8 *pkt, bool first, bool last)
+				       const struct nft_pipapo_field *f,
+				       int offset, const u8 *pkt,
+				       bool first, bool last)
 {
 	u8 pg[8] = {  pkt[0] >> 4,  pkt[0] & 0xf,  pkt[1] >> 4,  pkt[1] & 0xf,
 		      pkt[2] >> 4,  pkt[2] & 0xf,  pkt[3] >> 4,  pkt[3] & 0xf,
@@ -445,8 +448,9 @@ static int nft_pipapo_avx2_lookup_4b_8(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_4b_12(unsigned long *map, unsigned long *fill,
-				        struct nft_pipapo_field *f, int offset,
-				        const u8 *pkt, bool first, bool last)
+					const struct nft_pipapo_field *f,
+					int offset, const u8 *pkt,
+					bool first, bool last)
 {
 	u8 pg[12] = {  pkt[0] >> 4,  pkt[0] & 0xf,  pkt[1] >> 4,  pkt[1] & 0xf,
 		       pkt[2] >> 4,  pkt[2] & 0xf,  pkt[3] >> 4,  pkt[3] & 0xf,
@@ -534,8 +538,9 @@ static int nft_pipapo_avx2_lookup_4b_12(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_4b_32(unsigned long *map, unsigned long *fill,
-					struct nft_pipapo_field *f, int offset,
-					const u8 *pkt, bool first, bool last)
+					const struct nft_pipapo_field *f,
+					int offset, const u8 *pkt,
+					bool first, bool last)
 {
 	u8 pg[32] = {  pkt[0] >> 4,  pkt[0] & 0xf,  pkt[1] >> 4,  pkt[1] & 0xf,
 		       pkt[2] >> 4,  pkt[2] & 0xf,  pkt[3] >> 4,  pkt[3] & 0xf,
@@ -669,8 +674,9 @@ static int nft_pipapo_avx2_lookup_4b_32(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_8b_1(unsigned long *map, unsigned long *fill,
-				       struct nft_pipapo_field *f, int offset,
-				       const u8 *pkt, bool first, bool last)
+				       const struct nft_pipapo_field *f,
+				       int offset, const u8 *pkt,
+				       bool first, bool last)
 {
 	int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
 	unsigned long *lt = f->lt, bsize = f->bsize;
@@ -726,8 +732,9 @@ static int nft_pipapo_avx2_lookup_8b_1(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_8b_2(unsigned long *map, unsigned long *fill,
-				       struct nft_pipapo_field *f, int offset,
-				       const u8 *pkt, bool first, bool last)
+				       const struct nft_pipapo_field *f,
+				       int offset, const u8 *pkt,
+				       bool first, bool last)
 {
 	int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
 	unsigned long *lt = f->lt, bsize = f->bsize;
@@ -790,8 +797,9 @@ static int nft_pipapo_avx2_lookup_8b_2(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_8b_4(unsigned long *map, unsigned long *fill,
-				       struct nft_pipapo_field *f, int offset,
-				       const u8 *pkt, bool first, bool last)
+				       const struct nft_pipapo_field *f,
+				       int offset, const u8 *pkt,
+				       bool first, bool last)
 {
 	int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
 	unsigned long *lt = f->lt, bsize = f->bsize;
@@ -865,8 +873,9 @@ static int nft_pipapo_avx2_lookup_8b_4(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_8b_6(unsigned long *map, unsigned long *fill,
-				       struct nft_pipapo_field *f, int offset,
-				       const u8 *pkt, bool first, bool last)
+				       const struct nft_pipapo_field *f,
+				       int offset, const u8 *pkt,
+				       bool first, bool last)
 {
 	int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
 	unsigned long *lt = f->lt, bsize = f->bsize;
@@ -950,8 +959,9 @@ static int nft_pipapo_avx2_lookup_8b_6(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_8b_16(unsigned long *map, unsigned long *fill,
-					struct nft_pipapo_field *f, int offset,
-					const u8 *pkt, bool first, bool last)
+					const struct nft_pipapo_field *f,
+					int offset, const u8 *pkt,
+					bool first, bool last)
 {
 	int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
 	unsigned long *lt = f->lt, bsize = f->bsize;
@@ -1026,6 +1036,7 @@ static int nft_pipapo_avx2_lookup_8b_16(unsigned long *map, unsigned long *fill,
 
 /**
  * nft_pipapo_avx2_lookup_slow() - Fallback function for uncommon field sizes
+ * @mdata:	Matching data, including mapping table
  * @map:	Previous match result, used as initial bitmap
  * @fill:	Destination bitmap to be filled with current match result
  * @f:		Field, containing lookup and mapping tables
@@ -1041,15 +1052,17 @@ static int nft_pipapo_avx2_lookup_8b_16(unsigned long *map, unsigned long *fill,
  * Return: -1 on no match, rule index of match if @last, otherwise first long
  * word index to be checked next (i.e. first filled word).
  */
-static int nft_pipapo_avx2_lookup_slow(unsigned long *map, unsigned long *fill,
-					struct nft_pipapo_field *f, int offset,
-					const u8 *pkt, bool first, bool last)
+static int nft_pipapo_avx2_lookup_slow(const struct nft_pipapo_match *mdata,
+					unsigned long *map, unsigned long *fill,
+					const struct nft_pipapo_field *f,
+					int offset, const u8 *pkt,
+					bool first, bool last)
 {
 	unsigned long bsize = f->bsize;
 	int i, ret = -1, b;
 
 	if (first)
-		memset(map, 0xff, bsize * sizeof(*map));
+		pipapo_resmap_init(mdata, map);
 
 	for (i = offset; i < bsize; i++) {
 		if (f->bb == 8)
@@ -1119,15 +1132,21 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
 	struct nft_pipapo *priv = nft_set_priv(set);
 	struct nft_pipapo_scratch *scratch;
 	u8 genmask = nft_genmask_cur(net);
+	const struct nft_pipapo_match *m;
+	const struct nft_pipapo_field *f;
 	const u8 *rp = (const u8 *)key;
-	struct nft_pipapo_match *m;
-	struct nft_pipapo_field *f;
 	unsigned long *res, *fill;
 	bool map_index;
 	int i, ret = 0;
 
-	if (unlikely(!irq_fpu_usable()))
-		return nft_pipapo_lookup(net, set, key, ext);
+	local_bh_disable();
+
+	if (unlikely(!irq_fpu_usable())) {
+		bool fallback_res = nft_pipapo_lookup(net, set, key, ext);
+
+		local_bh_enable();
+		return fallback_res;
+	}
 
 	m = rcu_dereference(priv->match);
 
@@ -1142,6 +1161,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
 	scratch = *raw_cpu_ptr(m->scratch);
 	if (unlikely(!scratch)) {
 		kernel_fpu_end();
+		local_bh_enable();
 		return false;
 	}
 
@@ -1175,7 +1195,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
 			} else if (f->groups == 16) {
 				NFT_SET_PIPAPO_AVX2_LOOKUP(8, 16);
 			} else {
-				ret = nft_pipapo_avx2_lookup_slow(res, fill, f,
+				ret = nft_pipapo_avx2_lookup_slow(m, res, fill, f,
 								  ret, rp,
 								  first, last);
 			}
@@ -1191,7 +1211,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
 			} else if (f->groups == 32) {
 				NFT_SET_PIPAPO_AVX2_LOOKUP(4, 32);
 			} else {
-				ret = nft_pipapo_avx2_lookup_slow(res, fill, f,
+				ret = nft_pipapo_avx2_lookup_slow(m, res, fill, f,
 								  ret, rp,
 								  first, last);
 			}
@@ -1222,6 +1242,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
 	if (i % 2)
 		scratch->map_index = !map_index;
 	kernel_fpu_end();
+	local_bh_enable();
 
 	return ret >= 0;
 }
diff --git a/net/packet/af_packet.c b/net/packet/af_packet.c
index 10a6ec43efb9..3e5703537e4e 100644
--- a/net/packet/af_packet.c
+++ b/net/packet/af_packet.c
@@ -538,6 +538,61 @@ static void *packet_current_frame(struct packet_sock *po,
 	return packet_lookup_frame(po, rb, rb->head, status);
 }
 
+static u16 vlan_get_tci(struct sk_buff *skb, struct net_device *dev)
+{
+	u8 *skb_orig_data = skb->data;
+	int skb_orig_len = skb->len;
+	struct vlan_hdr vhdr, *vh;
+	unsigned int header_len;
+
+	if (!dev)
+		return 0;
+
+	/* In the SOCK_DGRAM scenario, skb data starts at the network
+	 * protocol, which is after the VLAN headers. The outer VLAN
+	 * header is at the hard_header_len offset in non-variable
+	 * length link layer headers. If it's a VLAN device, the
+	 * min_header_len should be used to exclude the VLAN header
+	 * size.
+	 */
+	if (dev->min_header_len == dev->hard_header_len)
+		header_len = dev->hard_header_len;
+	else if (is_vlan_dev(dev))
+		header_len = dev->min_header_len;
+	else
+		return 0;
+
+	skb_push(skb, skb->data - skb_mac_header(skb));
+	vh = skb_header_pointer(skb, header_len, sizeof(vhdr), &vhdr);
+	if (skb_orig_data != skb->data) {
+		skb->data = skb_orig_data;
+		skb->len = skb_orig_len;
+	}
+	if (unlikely(!vh))
+		return 0;
+
+	return ntohs(vh->h_vlan_TCI);
+}
+
+static __be16 vlan_get_protocol_dgram(struct sk_buff *skb)
+{
+	__be16 proto = skb->protocol;
+
+	if (unlikely(eth_type_vlan(proto))) {
+		u8 *skb_orig_data = skb->data;
+		int skb_orig_len = skb->len;
+
+		skb_push(skb, skb->data - skb_mac_header(skb));
+		proto = __vlan_get_protocol(skb, proto, NULL);
+		if (skb_orig_data != skb->data) {
+			skb->data = skb_orig_data;
+			skb->len = skb_orig_len;
+		}
+	}
+
+	return proto;
+}
+
 static void prb_del_retire_blk_timer(struct tpacket_kbdq_core *pkc)
 {
 	del_timer_sync(&pkc->retire_blk_timer);
@@ -1007,10 +1062,16 @@ static void prb_clear_rxhash(struct tpacket_kbdq_core *pkc,
 static void prb_fill_vlan_info(struct tpacket_kbdq_core *pkc,
 			struct tpacket3_hdr *ppd)
 {
+	struct packet_sock *po = container_of(pkc, struct packet_sock, rx_ring.prb_bdqc);
+
 	if (skb_vlan_tag_present(pkc->skb)) {
 		ppd->hv1.tp_vlan_tci = skb_vlan_tag_get(pkc->skb);
 		ppd->hv1.tp_vlan_tpid = ntohs(pkc->skb->vlan_proto);
 		ppd->tp_status = TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
+	} else if (unlikely(po->sk.sk_type == SOCK_DGRAM && eth_type_vlan(pkc->skb->protocol))) {
+		ppd->hv1.tp_vlan_tci = vlan_get_tci(pkc->skb, pkc->skb->dev);
+		ppd->hv1.tp_vlan_tpid = ntohs(pkc->skb->protocol);
+		ppd->tp_status = TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
 	} else {
 		ppd->hv1.tp_vlan_tci = 0;
 		ppd->hv1.tp_vlan_tpid = 0;
@@ -2431,6 +2492,10 @@ static int tpacket_rcv(struct sk_buff *skb, struct net_device *dev,
 			h.h2->tp_vlan_tci = skb_vlan_tag_get(skb);
 			h.h2->tp_vlan_tpid = ntohs(skb->vlan_proto);
 			status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
+		} else if (unlikely(sk->sk_type == SOCK_DGRAM && eth_type_vlan(skb->protocol))) {
+			h.h2->tp_vlan_tci = vlan_get_tci(skb, skb->dev);
+			h.h2->tp_vlan_tpid = ntohs(skb->protocol);
+			status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
 		} else {
 			h.h2->tp_vlan_tci = 0;
 			h.h2->tp_vlan_tpid = 0;
@@ -2460,7 +2525,8 @@ static int tpacket_rcv(struct sk_buff *skb, struct net_device *dev,
 	sll->sll_halen = dev_parse_header(skb, sll->sll_addr);
 	sll->sll_family = AF_PACKET;
 	sll->sll_hatype = dev->type;
-	sll->sll_protocol = skb->protocol;
+	sll->sll_protocol = (sk->sk_type == SOCK_DGRAM) ?
+		vlan_get_protocol_dgram(skb) : skb->protocol;
 	sll->sll_pkttype = skb->pkt_type;
 	if (unlikely(packet_sock_flag(po, PACKET_SOCK_ORIGDEV)))
 		sll->sll_ifindex = orig_dev->ifindex;
@@ -3488,7 +3554,8 @@ static int packet_recvmsg(struct socket *sock, struct msghdr *msg, size_t len,
 		/* Original length was stored in sockaddr_ll fields */
 		origlen = PACKET_SKB_CB(skb)->sa.origlen;
 		sll->sll_family = AF_PACKET;
-		sll->sll_protocol = skb->protocol;
+		sll->sll_protocol = (sock->type == SOCK_DGRAM) ?
+			vlan_get_protocol_dgram(skb) : skb->protocol;
 	}
 
 	sock_recv_cmsgs(msg, sk, skb);
@@ -3545,6 +3612,21 @@ static int packet_recvmsg(struct socket *sock, struct msghdr *msg, size_t len,
 			aux.tp_vlan_tci = skb_vlan_tag_get(skb);
 			aux.tp_vlan_tpid = ntohs(skb->vlan_proto);
 			aux.tp_status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
+		} else if (unlikely(sock->type == SOCK_DGRAM && eth_type_vlan(skb->protocol))) {
+			struct sockaddr_ll *sll = &PACKET_SKB_CB(skb)->sa.ll;
+			struct net_device *dev;
+
+			rcu_read_lock();
+			dev = dev_get_by_index_rcu(sock_net(sk), sll->sll_ifindex);
+			if (dev) {
+				aux.tp_vlan_tci = vlan_get_tci(skb, dev);
+				aux.tp_vlan_tpid = ntohs(skb->protocol);
+				aux.tp_status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
+			} else {
+				aux.tp_vlan_tci = 0;
+				aux.tp_vlan_tpid = 0;
+			}
+			rcu_read_unlock();
 		} else {
 			aux.tp_vlan_tci = 0;
 			aux.tp_vlan_tpid = 0;
diff --git a/net/smc/smc_core.c b/net/smc/smc_core.c
index d520ee62c8ec..f99bb9d0adcc 100644
--- a/net/smc/smc_core.c
+++ b/net/smc/smc_core.c
@@ -1974,7 +1974,6 @@ int smc_conn_create(struct smc_sock *smc, struct smc_init_info *ini)
  */
 static u8 smc_compress_bufsize(int size, bool is_smcd, bool is_rmb)
 {
-	const unsigned int max_scat = SG_MAX_SINGLE_ALLOC * PAGE_SIZE;
 	u8 compressed;
 
 	if (size <= SMC_BUF_MIN_SIZE)
@@ -1984,9 +1983,11 @@ static u8 smc_compress_bufsize(int size, bool is_smcd, bool is_rmb)
 	compressed = min_t(u8, ilog2(size) + 1,
 			   is_smcd ? SMCD_DMBE_SIZES : SMCR_RMBE_SIZES);
 
+#ifdef CONFIG_ARCH_NO_SG_CHAIN
 	if (!is_smcd && is_rmb)
 		/* RMBs are backed by & limited to max size of scatterlists */
-		compressed = min_t(u8, compressed, ilog2(max_scat >> 14));
+		compressed = min_t(u8, compressed, ilog2((SG_MAX_SINGLE_ALLOC * PAGE_SIZE) >> 14));
+#endif
 
 	return compressed;
 }
diff --git a/net/sunrpc/auth_gss/gss_krb5_keys.c b/net/sunrpc/auth_gss/gss_krb5_keys.c
index 06d8ee0db000..4eb19c3a54c7 100644
--- a/net/sunrpc/auth_gss/gss_krb5_keys.c
+++ b/net/sunrpc/auth_gss/gss_krb5_keys.c
@@ -168,7 +168,7 @@ static int krb5_DK(const struct gss_krb5_enctype *gk5e,
 		goto err_return;
 	blocksize = crypto_sync_skcipher_blocksize(cipher);
 	if (crypto_sync_skcipher_setkey(cipher, inkey->data, inkey->len))
-		goto err_return;
+		goto err_free_cipher;
 
 	ret = -ENOMEM;
 	inblockdata = kmalloc(blocksize, gfp_mask);
diff --git a/net/sunrpc/clnt.c b/net/sunrpc/clnt.c
index d3c917c0c8d5..142ee6554848 100644
--- a/net/sunrpc/clnt.c
+++ b/net/sunrpc/clnt.c
@@ -2310,12 +2310,13 @@ call_transmit_status(struct rpc_task *task)
 		task->tk_action = call_transmit;
 		task->tk_status = 0;
 		break;
-	case -ECONNREFUSED:
 	case -EHOSTDOWN:
 	case -ENETDOWN:
 	case -EHOSTUNREACH:
 	case -ENETUNREACH:
 	case -EPERM:
+		break;
+	case -ECONNREFUSED:
 		if (RPC_IS_SOFTCONN(task)) {
 			if (!task->tk_msg.rpc_proc->p_proc)
 				trace_xprt_ping(task->tk_xprt,
diff --git a/net/sunrpc/xprtrdma/frwr_ops.c b/net/sunrpc/xprtrdma/frwr_ops.c
index ffbf99894970..47f33bb7bff8 100644
--- a/net/sunrpc/xprtrdma/frwr_ops.c
+++ b/net/sunrpc/xprtrdma/frwr_ops.c
@@ -92,7 +92,8 @@ static void frwr_mr_put(struct rpcrdma_mr *mr)
 	rpcrdma_mr_push(mr, &mr->mr_req->rl_free_mrs);
 }
 
-/* frwr_reset - Place MRs back on the free list
+/**
+ * frwr_reset - Place MRs back on @req's free list
  * @req: request to reset
  *
  * Used after a failed marshal. For FRWR, this means the MRs
diff --git a/net/sunrpc/xprtrdma/verbs.c b/net/sunrpc/xprtrdma/verbs.c
index 4f71627ba39c..cb909329a503 100644
--- a/net/sunrpc/xprtrdma/verbs.c
+++ b/net/sunrpc/xprtrdma/verbs.c
@@ -897,6 +897,8 @@ static int rpcrdma_reqs_setup(struct rpcrdma_xprt *r_xprt)
 
 static void rpcrdma_req_reset(struct rpcrdma_req *req)
 {
+	struct rpcrdma_mr *mr;
+
 	/* Credits are valid for only one connection */
 	req->rl_slot.rq_cong = 0;
 
@@ -906,7 +908,19 @@ static void rpcrdma_req_reset(struct rpcrdma_req *req)
 	rpcrdma_regbuf_dma_unmap(req->rl_sendbuf);
 	rpcrdma_regbuf_dma_unmap(req->rl_recvbuf);
 
-	frwr_reset(req);
+	/* The verbs consumer can't know the state of an MR on the
+	 * req->rl_registered list unless a successful completion
+	 * has occurred, so they cannot be re-used.
+	 */
+	while ((mr = rpcrdma_mr_pop(&req->rl_registered))) {
+		struct rpcrdma_buffer *buf = &mr->mr_xprt->rx_buf;
+
+		spin_lock(&buf->rb_lock);
+		list_del(&mr->mr_all);
+		spin_unlock(&buf->rb_lock);
+
+		frwr_mr_release(mr);
+	}
 }
 
 /* ASSUMPTION: the rb_allreqs list is stable for the duration,
diff --git a/net/tipc/udp_media.c b/net/tipc/udp_media.c
index f892b0903dba..cdc8378261ec 100644
--- a/net/tipc/udp_media.c
+++ b/net/tipc/udp_media.c
@@ -135,8 +135,11 @@ static int tipc_udp_addr2str(struct tipc_media_addr *a, char *buf, int size)
 		snprintf(buf, size, "%pI4:%u", &ua->ipv4, ntohs(ua->port));
 	else if (ntohs(ua->proto) == ETH_P_IPV6)
 		snprintf(buf, size, "%pI6:%u", &ua->ipv6, ntohs(ua->port));
-	else
+	else {
 		pr_err("Invalid UDP media address\n");
+		return 1;
+	}
+
 	return 0;
 }
 
diff --git a/net/unix/af_unix.c b/net/unix/af_unix.c
index 5a26e785ce70..a551be47cb6c 100644
--- a/net/unix/af_unix.c
+++ b/net/unix/af_unix.c
@@ -2624,10 +2624,49 @@ static struct sk_buff *manage_oob(struct sk_buff *skb, struct sock *sk,
 
 static int unix_stream_read_skb(struct sock *sk, skb_read_actor_t recv_actor)
 {
+	struct unix_sock *u = unix_sk(sk);
+	struct sk_buff *skb;
+	int err;
+
 	if (unlikely(READ_ONCE(sk->sk_state) != TCP_ESTABLISHED))
 		return -ENOTCONN;
 
-	return unix_read_skb(sk, recv_actor);
+	mutex_lock(&u->iolock);
+	skb = skb_recv_datagram(sk, MSG_DONTWAIT, &err);
+	mutex_unlock(&u->iolock);
+	if (!skb)
+		return err;
+
+#if IS_ENABLED(CONFIG_AF_UNIX_OOB)
+	if (unlikely(skb == READ_ONCE(u->oob_skb))) {
+		bool drop = false;
+
+		unix_state_lock(sk);
+
+		if (sock_flag(sk, SOCK_DEAD)) {
+			unix_state_unlock(sk);
+			kfree_skb(skb);
+			return -ECONNRESET;
+		}
+
+		spin_lock(&sk->sk_receive_queue.lock);
+		if (likely(skb == u->oob_skb)) {
+			WRITE_ONCE(u->oob_skb, NULL);
+			drop = true;
+		}
+		spin_unlock(&sk->sk_receive_queue.lock);
+
+		unix_state_unlock(sk);
+
+		if (drop) {
+			WARN_ON_ONCE(skb_unref(skb));
+			kfree_skb(skb);
+			return -EAGAIN;
+		}
+	}
+#endif
+
+	return recv_actor(sk, skb);
 }
 
 static int unix_stream_read_generic(struct unix_stream_read_state *state,
diff --git a/net/unix/unix_bpf.c b/net/unix/unix_bpf.c
index bd84785bf8d6..bca2d86ba97d 100644
--- a/net/unix/unix_bpf.c
+++ b/net/unix/unix_bpf.c
@@ -54,6 +54,9 @@ static int unix_bpf_recvmsg(struct sock *sk, struct msghdr *msg,
 	struct sk_psock *psock;
 	int copied;
 
+	if (flags & MSG_OOB)
+		return -EOPNOTSUPP;
+
 	if (!len)
 		return 0;
 
diff --git a/net/wireless/util.c b/net/wireless/util.c
index 57ea6d5b092d..7acd8d0db61a 100644
--- a/net/wireless/util.c
+++ b/net/wireless/util.c
@@ -1460,7 +1460,7 @@ static u32 cfg80211_calculate_bitrate_he(struct rate_info *rate)
 		  5120, /*  0.833333... */
 	};
 	u32 rates_160M[3] = { 960777777, 907400000, 816666666 };
-	u32 rates_969[3] =  { 480388888, 453700000, 408333333 };
+	u32 rates_996[3] =  { 480388888, 453700000, 408333333 };
 	u32 rates_484[3] =  { 229411111, 216666666, 195000000 };
 	u32 rates_242[3] =  { 114711111, 108333333,  97500000 };
 	u32 rates_106[3] =  {  40000000,  37777777,  34000000 };
@@ -1480,12 +1480,14 @@ static u32 cfg80211_calculate_bitrate_he(struct rate_info *rate)
 	if (WARN_ON_ONCE(rate->nss < 1 || rate->nss > 8))
 		return 0;
 
-	if (rate->bw == RATE_INFO_BW_160)
+	if (rate->bw == RATE_INFO_BW_160 ||
+	    (rate->bw == RATE_INFO_BW_HE_RU &&
+	     rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_2x996))
 		result = rates_160M[rate->he_gi];
 	else if (rate->bw == RATE_INFO_BW_80 ||
 		 (rate->bw == RATE_INFO_BW_HE_RU &&
 		  rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_996))
-		result = rates_969[rate->he_gi];
+		result = rates_996[rate->he_gi];
 	else if (rate->bw == RATE_INFO_BW_40 ||
 		 (rate->bw == RATE_INFO_BW_HE_RU &&
 		  rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_484))
diff --git a/net/xfrm/xfrm_policy.c b/net/xfrm/xfrm_policy.c
index 0dde08e02887..b699cc2ec35a 100644
--- a/net/xfrm/xfrm_policy.c
+++ b/net/xfrm/xfrm_policy.c
@@ -436,6 +436,8 @@ EXPORT_SYMBOL(xfrm_policy_destroy);
 
 static void xfrm_policy_kill(struct xfrm_policy *policy)
 {
+	xfrm_dev_policy_delete(policy);
+
 	write_lock_bh(&policy->lock);
 	policy->walk.dead = 1;
 	write_unlock_bh(&policy->lock);
@@ -1834,7 +1836,6 @@ int xfrm_policy_flush(struct net *net, u8 type, bool task_valid)
 
 		__xfrm_policy_unlink(pol, dir);
 		spin_unlock_bh(&net->xfrm.xfrm_policy_lock);
-		xfrm_dev_policy_delete(pol);
 		cnt++;
 		xfrm_audit_policy_delete(pol, 1, task_valid);
 		xfrm_policy_kill(pol);
@@ -1875,7 +1876,6 @@ int xfrm_dev_policy_flush(struct net *net, struct net_device *dev,
 
 		__xfrm_policy_unlink(pol, dir);
 		spin_unlock_bh(&net->xfrm.xfrm_policy_lock);
-		xfrm_dev_policy_delete(pol);
 		cnt++;
 		xfrm_audit_policy_delete(pol, 1, task_valid);
 		xfrm_policy_kill(pol);
@@ -2326,7 +2326,6 @@ int xfrm_policy_delete(struct xfrm_policy *pol, int dir)
 	pol = __xfrm_policy_unlink(pol, dir);
 	spin_unlock_bh(&net->xfrm.xfrm_policy_lock);
 	if (pol) {
-		xfrm_dev_policy_delete(pol);
 		xfrm_policy_kill(pol);
 		return 0;
 	}
diff --git a/net/xfrm/xfrm_state.c b/net/xfrm/xfrm_state.c
index bda5327bf34d..8a6e8656d014 100644
--- a/net/xfrm/xfrm_state.c
+++ b/net/xfrm/xfrm_state.c
@@ -49,6 +49,7 @@ static struct kmem_cache *xfrm_state_cache __ro_after_init;
 
 static DECLARE_WORK(xfrm_state_gc_work, xfrm_state_gc_task);
 static HLIST_HEAD(xfrm_state_gc_list);
+static HLIST_HEAD(xfrm_state_dev_gc_list);
 
 static inline bool xfrm_state_hold_rcu(struct xfrm_state __rcu *x)
 {
@@ -214,6 +215,7 @@ static DEFINE_SPINLOCK(xfrm_state_afinfo_lock);
 static struct xfrm_state_afinfo __rcu *xfrm_state_afinfo[NPROTO];
 
 static DEFINE_SPINLOCK(xfrm_state_gc_lock);
+static DEFINE_SPINLOCK(xfrm_state_dev_gc_lock);
 
 int __xfrm_state_delete(struct xfrm_state *x);
 
@@ -683,6 +685,41 @@ struct xfrm_state *xfrm_state_alloc(struct net *net)
 }
 EXPORT_SYMBOL(xfrm_state_alloc);
 
+#ifdef CONFIG_XFRM_OFFLOAD
+void xfrm_dev_state_delete(struct xfrm_state *x)
+{
+	struct xfrm_dev_offload *xso = &x->xso;
+	struct net_device *dev = READ_ONCE(xso->dev);
+
+	if (dev) {
+		dev->xfrmdev_ops->xdo_dev_state_delete(x);
+		spin_lock_bh(&xfrm_state_dev_gc_lock);
+		hlist_add_head(&x->dev_gclist, &xfrm_state_dev_gc_list);
+		spin_unlock_bh(&xfrm_state_dev_gc_lock);
+	}
+}
+EXPORT_SYMBOL_GPL(xfrm_dev_state_delete);
+
+void xfrm_dev_state_free(struct xfrm_state *x)
+{
+	struct xfrm_dev_offload *xso = &x->xso;
+	struct net_device *dev = READ_ONCE(xso->dev);
+
+	if (dev && dev->xfrmdev_ops) {
+		spin_lock_bh(&xfrm_state_dev_gc_lock);
+		if (!hlist_unhashed(&x->dev_gclist))
+			hlist_del(&x->dev_gclist);
+		spin_unlock_bh(&xfrm_state_dev_gc_lock);
+
+		if (dev->xfrmdev_ops->xdo_dev_state_free)
+			dev->xfrmdev_ops->xdo_dev_state_free(x);
+		WRITE_ONCE(xso->dev, NULL);
+		xso->type = XFRM_DEV_OFFLOAD_UNSPECIFIED;
+		netdev_put(dev, &xso->dev_tracker);
+	}
+}
+#endif
+
 void __xfrm_state_destroy(struct xfrm_state *x, bool sync)
 {
 	WARN_ON(x->km.state != XFRM_STATE_DEAD);
@@ -848,6 +885,9 @@ EXPORT_SYMBOL(xfrm_state_flush);
 
 int xfrm_dev_state_flush(struct net *net, struct net_device *dev, bool task_valid)
 {
+	struct xfrm_state *x;
+	struct hlist_node *tmp;
+	struct xfrm_dev_offload *xso;
 	int i, err = 0, cnt = 0;
 
 	spin_lock_bh(&net->xfrm.xfrm_state_lock);
@@ -857,8 +897,6 @@ int xfrm_dev_state_flush(struct net *net, struct net_device *dev, bool task_vali
 
 	err = -ESRCH;
 	for (i = 0; i <= net->xfrm.state_hmask; i++) {
-		struct xfrm_state *x;
-		struct xfrm_dev_offload *xso;
 restart:
 		hlist_for_each_entry(x, net->xfrm.state_bydst+i, bydst) {
 			xso = &x->xso;
@@ -868,6 +906,8 @@ int xfrm_dev_state_flush(struct net *net, struct net_device *dev, bool task_vali
 				spin_unlock_bh(&net->xfrm.xfrm_state_lock);
 
 				err = xfrm_state_delete(x);
+				xfrm_dev_state_free(x);
+
 				xfrm_audit_state_delete(x, err ? 0 : 1,
 							task_valid);
 				xfrm_state_put(x);
@@ -884,6 +924,24 @@ int xfrm_dev_state_flush(struct net *net, struct net_device *dev, bool task_vali
 
 out:
 	spin_unlock_bh(&net->xfrm.xfrm_state_lock);
+
+	spin_lock_bh(&xfrm_state_dev_gc_lock);
+restart_gc:
+	hlist_for_each_entry_safe(x, tmp, &xfrm_state_dev_gc_list, dev_gclist) {
+		xso = &x->xso;
+
+		if (xso->dev == dev) {
+			spin_unlock_bh(&xfrm_state_dev_gc_lock);
+			xfrm_dev_state_free(x);
+			spin_lock_bh(&xfrm_state_dev_gc_lock);
+			goto restart_gc;
+		}
+
+	}
+	spin_unlock_bh(&xfrm_state_dev_gc_lock);
+
+	xfrm_flush_gc();
+
 	return err;
 }
 EXPORT_SYMBOL(xfrm_dev_state_flush);
@@ -1273,8 +1331,7 @@ xfrm_state_find(const xfrm_address_t *daddr, const xfrm_address_t *saddr,
 			xso->dev = xdo->dev;
 			xso->real_dev = xdo->real_dev;
 			xso->flags = XFRM_DEV_OFFLOAD_FLAG_ACQ;
-			netdev_tracker_alloc(xso->dev, &xso->dev_tracker,
-					     GFP_ATOMIC);
+			netdev_hold(xso->dev, &xso->dev_tracker, GFP_ATOMIC);
 			error = xso->dev->xfrmdev_ops->xdo_dev_state_add(x, NULL);
 			if (error) {
 				xso->dir = 0;
diff --git a/net/xfrm/xfrm_user.c b/net/xfrm/xfrm_user.c
index 444e58bc3f44..979f23cded40 100644
--- a/net/xfrm/xfrm_user.c
+++ b/net/xfrm/xfrm_user.c
@@ -2348,7 +2348,6 @@ static int xfrm_get_policy(struct sk_buff *skb, struct nlmsghdr *nlh,
 					    NETLINK_CB(skb).portid);
 		}
 	} else {
-		xfrm_dev_policy_delete(xp);
 		xfrm_audit_policy_delete(xp, err ? 0 : 1, true);
 
 		if (err != 0)
diff --git a/scripts/Kconfig.include b/scripts/Kconfig.include
index 3ee8ecfb8c04..3500a3d62f0d 100644
--- a/scripts/Kconfig.include
+++ b/scripts/Kconfig.include
@@ -33,7 +33,8 @@ ld-option = $(success,$(LD) -v $(1))
 
 # $(as-instr,<instr>)
 # Return y if the assembler supports <instr>, n otherwise
-as-instr = $(success,printf "%b\n" "$(1)" | $(CC) $(CLANG_FLAGS) -Wa$(comma)--fatal-warnings -c -x assembler-with-cpp -o /dev/null -)
+as-instr = $(success,printf "%b\n" "$(1)" | $(CC) $(CLANG_FLAGS) $(2) -Wa$(comma)--fatal-warnings -c -x assembler-with-cpp -o /dev/null -)
+as-instr64 = $(as-instr,$(1),$(m64-flag))
 
 # check if $(CC) and $(LD) exist
 $(error-if,$(failure,command -v $(CC)),C compiler '$(CC)' not found)
diff --git a/scripts/Makefile.lib b/scripts/Makefile.lib
index 68d0134bdbf9..e702552fb131 100644
--- a/scripts/Makefile.lib
+++ b/scripts/Makefile.lib
@@ -395,8 +395,12 @@ cmd_dtc = $(HOSTCC) -E $(dtc_cpp_flags) -x assembler-with-cpp -o $(dtc-tmp) $< ;
 		-d $(depfile).dtc.tmp $(dtc-tmp) ; \
 	cat $(depfile).pre.tmp $(depfile).dtc.tmp > $(depfile)
 
+# NOTE:
+# Do not replace $(filter %.dtb %.dtbo, $^) with $(real-prereqs). When a single
+# DTB is turned into a multi-blob DTB, $^ will contain header file dependencies
+# recorded in the .*.cmd file.
 quiet_cmd_fdtoverlay = DTOVL   $@
-      cmd_fdtoverlay = $(objtree)/scripts/dtc/fdtoverlay -o $@ -i $(real-prereqs)
+      cmd_fdtoverlay = $(objtree)/scripts/dtc/fdtoverlay -o $@ -i $(filter %.dtb %.dtbo, $^)
 
 $(multi-dtb-y): FORCE
 	$(call if_changed,fdtoverlay)
diff --git a/scripts/gcc-x86_32-has-stack-protector.sh b/scripts/gcc-x86_32-has-stack-protector.sh
index 825c75c5b715..9459ca4f0f11 100755
--- a/scripts/gcc-x86_32-has-stack-protector.sh
+++ b/scripts/gcc-x86_32-has-stack-protector.sh
@@ -5,4 +5,4 @@
 # -mstack-protector-guard-reg, added by
 # https://gcc.gnu.org/bugzilla/show_bug.cgi?id=81708
 
-echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -c -m32 -O0 -fstack-protector -mstack-protector-guard-reg=fs -mstack-protector-guard-symbol=__stack_chk_guard - -o - 2> /dev/null | grep -q "%fs"
+echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -m32 -O0 -fstack-protector -mstack-protector-guard-reg=fs -mstack-protector-guard-symbol=__stack_chk_guard - -o - 2> /dev/null | grep -q "%fs"
diff --git a/scripts/gcc-x86_64-has-stack-protector.sh b/scripts/gcc-x86_64-has-stack-protector.sh
index 75e4e22b986a..f680bb01aeeb 100755
--- a/scripts/gcc-x86_64-has-stack-protector.sh
+++ b/scripts/gcc-x86_64-has-stack-protector.sh
@@ -1,4 +1,4 @@
 #!/bin/sh
 # SPDX-License-Identifier: GPL-2.0
 
-echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -c -m64 -O0 -mcmodel=kernel -fno-PIE -fstack-protector - -o - 2> /dev/null | grep -q "%gs"
+echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -m64 -O0 -mcmodel=kernel -fno-PIE -fstack-protector - -o - 2> /dev/null | grep -q "%gs"
diff --git a/security/apparmor/lsm.c b/security/apparmor/lsm.c
index 366cdfd6a7ba..5303a51eff9c 100644
--- a/security/apparmor/lsm.c
+++ b/security/apparmor/lsm.c
@@ -1130,6 +1130,13 @@ static int apparmor_socket_sock_rcv_skb(struct sock *sk, struct sk_buff *skb)
 	if (!skb->secmark)
 		return 0;
 
+	/*
+	 * If reach here before socket_post_create hook is called, in which
+	 * case label is null, drop the packet.
+	 */
+	if (!ctx->label)
+		return -EACCES;
+
 	return apparmor_secmark_check(ctx->label, OP_RECVMSG, AA_MAY_RECEIVE,
 				      skb->secmark, sk);
 }
diff --git a/security/apparmor/policy.c b/security/apparmor/policy.c
index 8a07793ce103..d9d3b3d776e1 100644
--- a/security/apparmor/policy.c
+++ b/security/apparmor/policy.c
@@ -188,7 +188,7 @@ static void aa_free_data(void *ptr, void *arg)
 {
 	struct aa_data *data = ptr;
 
-	kfree_sensitive(data->data);
+	kvfree_sensitive(data->data, data->size);
 	kfree_sensitive(data->key);
 	kfree_sensitive(data);
 }
diff --git a/security/apparmor/policy_unpack.c b/security/apparmor/policy_unpack.c
index d92788da6704..d752bfa9b3f3 100644
--- a/security/apparmor/policy_unpack.c
+++ b/security/apparmor/policy_unpack.c
@@ -1081,6 +1081,7 @@ static struct aa_profile *unpack_profile(struct aa_ext *e, char **ns_name)
 
 			if (rhashtable_insert_fast(profile->data, &data->head,
 						   profile->data->p)) {
+				kvfree_sensitive(data->data, data->size);
 				kfree_sensitive(data->key);
 				kfree_sensitive(data);
 				info = "failed to insert data to table";
diff --git a/security/keys/keyctl.c b/security/keys/keyctl.c
index 19be69fa4d05..aa1dc43b16dd 100644
--- a/security/keys/keyctl.c
+++ b/security/keys/keyctl.c
@@ -1694,7 +1694,7 @@ long keyctl_session_to_parent(void)
 		goto unlock;
 
 	/* cancel an already pending keyring replacement */
-	oldwork = task_work_cancel(parent, key_change_session_keyring);
+	oldwork = task_work_cancel_func(parent, key_change_session_keyring);
 
 	/* the replacement session keyring is applied just prior to userspace
 	 * restarting */
diff --git a/security/landlock/cred.c b/security/landlock/cred.c
index 13dff2a31545..94f0d03bfd64 100644
--- a/security/landlock/cred.c
+++ b/security/landlock/cred.c
@@ -14,8 +14,8 @@
 #include "ruleset.h"
 #include "setup.h"
 
-static int hook_cred_prepare(struct cred *const new,
-			     const struct cred *const old, const gfp_t gfp)
+static void hook_cred_transfer(struct cred *const new,
+			       const struct cred *const old)
 {
 	struct landlock_ruleset *const old_dom = landlock_cred(old)->domain;
 
@@ -23,6 +23,12 @@ static int hook_cred_prepare(struct cred *const new,
 		landlock_get_ruleset(old_dom);
 		landlock_cred(new)->domain = old_dom;
 	}
+}
+
+static int hook_cred_prepare(struct cred *const new,
+			     const struct cred *const old, const gfp_t gfp)
+{
+	hook_cred_transfer(new, old);
 	return 0;
 }
 
@@ -36,6 +42,7 @@ static void hook_cred_free(struct cred *const cred)
 
 static struct security_hook_list landlock_hooks[] __ro_after_init = {
 	LSM_HOOK_INIT(cred_prepare, hook_cred_prepare),
+	LSM_HOOK_INIT(cred_transfer, hook_cred_transfer),
 	LSM_HOOK_INIT(cred_free, hook_cred_free),
 };
 
diff --git a/sound/core/ump.c b/sound/core/ump.c
index d68d3bda97e4..8a7ecec74b5d 100644
--- a/sound/core/ump.c
+++ b/sound/core/ump.c
@@ -733,6 +733,12 @@ static void fill_fb_info(struct snd_ump_endpoint *ump,
 		info->block_id, info->direction, info->active,
 		info->first_group, info->num_groups, info->midi_ci_version,
 		info->sysex8_streams, info->flags);
+
+	if ((info->flags & SNDRV_UMP_BLOCK_IS_MIDI1) && info->num_groups != 1) {
+		info->num_groups = 1;
+		ump_dbg(ump, "FB %d: corrected groups to 1 for MIDI1\n",
+			info->block_id);
+	}
 }
 
 /* check whether the FB info gets updated by the current message */
@@ -806,6 +812,13 @@ static int ump_handle_fb_name_msg(struct snd_ump_endpoint *ump,
 	if (!fb)
 		return -ENODEV;
 
+	if (ump->parsed &&
+	    (ump->info.flags & SNDRV_UMP_EP_INFO_STATIC_BLOCKS)) {
+		ump_dbg(ump, "Skipping static FB name update (blk#%d)\n",
+			fb->info.block_id);
+		return 0;
+	}
+
 	ret = ump_append_string(ump, fb->info.name, sizeof(fb->info.name),
 				buf->raw, 3);
 	/* notify the FB name update to sequencer, too */
diff --git a/sound/soc/amd/acp-es8336.c b/sound/soc/amd/acp-es8336.c
index 5e56d3a53be7..49bffc567e68 100644
--- a/sound/soc/amd/acp-es8336.c
+++ b/sound/soc/amd/acp-es8336.c
@@ -203,8 +203,10 @@ static int st_es8336_late_probe(struct snd_soc_card *card)
 
 	codec_dev = acpi_get_first_physical_node(adev);
 	acpi_dev_put(adev);
-	if (!codec_dev)
+	if (!codec_dev) {
 		dev_err(card->dev, "can not find codec dev\n");
+		return -ENODEV;
+	}
 
 	ret = devm_acpi_dev_add_driver_gpios(codec_dev, acpi_es8336_gpios);
 	if (ret)
diff --git a/sound/soc/amd/yc/acp6x-mach.c b/sound/soc/amd/yc/acp6x-mach.c
index 4e3a8ce690a4..36dddf230c2c 100644
--- a/sound/soc/amd/yc/acp6x-mach.c
+++ b/sound/soc/amd/yc/acp6x-mach.c
@@ -220,6 +220,13 @@ static const struct dmi_system_id yc_acp_quirk_table[] = {
 			DMI_MATCH(DMI_PRODUCT_NAME, "21J6"),
 		}
 	},
+	{
+		.driver_data = &acp6x_card,
+		.matches = {
+			DMI_MATCH(DMI_BOARD_VENDOR, "LENOVO"),
+			DMI_MATCH(DMI_PRODUCT_NAME, "21M5"),
+		}
+	},
 	{
 		.driver_data = &acp6x_card,
 		.matches = {
diff --git a/sound/soc/codecs/cs35l56-shared.c b/sound/soc/codecs/cs35l56-shared.c
index 12291242362b..69c951e30584 100644
--- a/sound/soc/codecs/cs35l56-shared.c
+++ b/sound/soc/codecs/cs35l56-shared.c
@@ -354,7 +354,7 @@ int cs35l56_irq_request(struct cs35l56_base *cs35l56_base, int irq)
 {
 	int ret;
 
-	if (!irq)
+	if (irq < 1)
 		return 0;
 
 	ret = devm_request_threaded_irq(cs35l56_base->dev, irq, NULL, cs35l56_irq,
diff --git a/sound/soc/codecs/max98088.c b/sound/soc/codecs/max98088.c
index 8b56ee550c09..8b0645c63462 100644
--- a/sound/soc/codecs/max98088.c
+++ b/sound/soc/codecs/max98088.c
@@ -1318,6 +1318,7 @@ static int max98088_set_bias_level(struct snd_soc_component *component,
                                   enum snd_soc_bias_level level)
 {
 	struct max98088_priv *max98088 = snd_soc_component_get_drvdata(component);
+	int ret;
 
 	switch (level) {
 	case SND_SOC_BIAS_ON:
@@ -1333,10 +1334,13 @@ static int max98088_set_bias_level(struct snd_soc_component *component,
 		 */
 		if (!IS_ERR(max98088->mclk)) {
 			if (snd_soc_component_get_bias_level(component) ==
-			    SND_SOC_BIAS_ON)
+			    SND_SOC_BIAS_ON) {
 				clk_disable_unprepare(max98088->mclk);
-			else
-				clk_prepare_enable(max98088->mclk);
+			} else {
+				ret = clk_prepare_enable(max98088->mclk);
+				if (ret)
+					return ret;
+			}
 		}
 		break;
 
diff --git a/sound/soc/codecs/tas2781-fmwlib.c b/sound/soc/codecs/tas2781-fmwlib.c
index c6c47297a4fe..41ad82a42916 100644
--- a/sound/soc/codecs/tas2781-fmwlib.c
+++ b/sound/soc/codecs/tas2781-fmwlib.c
@@ -2193,7 +2193,7 @@ static void tasdev_load_calibrated_data(struct tasdevice_priv *priv, int i)
 		return;
 
 	cal = cal_fmw->calibrations;
-	if (cal)
+	if (!cal)
 		return;
 
 	load_calib_data(priv, &cal->dev_data);
@@ -2354,14 +2354,21 @@ void tasdevice_tuning_switch(void *context, int state)
 	struct tasdevice_fw *tas_fmw = tas_priv->fmw;
 	int profile_cfg_id = tas_priv->rcabin.profile_cfg_id;
 
-	if (tas_priv->fw_state == TASDEVICE_DSP_FW_FAIL) {
-		dev_err(tas_priv->dev, "DSP bin file not loaded\n");
+	/*
+	 * Only RCA-based Playback can still work with no dsp program running
+	 * inside the chip.
+	 */
+	switch (tas_priv->fw_state) {
+	case TASDEVICE_RCA_FW_OK:
+	case TASDEVICE_DSP_FW_ALL_OK:
+		break;
+	default:
 		return;
 	}
 
 	if (state == 0) {
-		if (tas_priv->cur_prog < tas_fmw->nr_programs) {
-			/*dsp mode or tuning mode*/
+		if (tas_fmw && tas_priv->cur_prog < tas_fmw->nr_programs) {
+			/* dsp mode or tuning mode */
 			profile_cfg_id = tas_priv->rcabin.profile_cfg_id;
 			tasdevice_select_tuningprm_cfg(tas_priv,
 				tas_priv->cur_prog, tas_priv->cur_conf,
@@ -2370,9 +2377,10 @@ void tasdevice_tuning_switch(void *context, int state)
 
 		tasdevice_select_cfg_blk(tas_priv, profile_cfg_id,
 			TASDEVICE_BIN_BLK_PRE_POWER_UP);
-	} else
+	} else {
 		tasdevice_select_cfg_blk(tas_priv, profile_cfg_id,
 			TASDEVICE_BIN_BLK_PRE_SHUTDOWN);
+	}
 }
 EXPORT_SYMBOL_NS_GPL(tasdevice_tuning_switch,
 	SND_SOC_TAS2781_FMWLIB);
diff --git a/sound/soc/codecs/tas2781-i2c.c b/sound/soc/codecs/tas2781-i2c.c
index 7327e9dcc8c0..a9d179e30773 100644
--- a/sound/soc/codecs/tas2781-i2c.c
+++ b/sound/soc/codecs/tas2781-i2c.c
@@ -378,23 +378,37 @@ static void tasdevice_fw_ready(const struct firmware *fmw,
 	mutex_lock(&tas_priv->codec_lock);
 
 	ret = tasdevice_rca_parser(tas_priv, fmw);
-	if (ret)
+	if (ret) {
+		tasdevice_config_info_remove(tas_priv);
 		goto out;
+	}
 	tasdevice_create_control(tas_priv);
 
 	tasdevice_dsp_remove(tas_priv);
 	tasdevice_calbin_remove(tas_priv);
-	tas_priv->fw_state = TASDEVICE_DSP_FW_PENDING;
+	/*
+	 * The baseline is the RCA-only case, and then the code attempts to
+	 * load DSP firmware but in case of failures just keep going, i.e.
+	 * failing to load DSP firmware is NOT an error.
+	 */
+	tas_priv->fw_state = TASDEVICE_RCA_FW_OK;
 	scnprintf(tas_priv->coef_binaryname, 64, "%s_coef.bin",
 		tas_priv->dev_name);
 	ret = tasdevice_dsp_parser(tas_priv);
 	if (ret) {
 		dev_err(tas_priv->dev, "dspfw load %s error\n",
 			tas_priv->coef_binaryname);
-		tas_priv->fw_state = TASDEVICE_DSP_FW_FAIL;
 		goto out;
 	}
-	tasdevice_dsp_create_ctrls(tas_priv);
+
+	/*
+	 * If no dsp-related kcontrol created, the dsp resource will be freed.
+	 */
+	ret = tasdevice_dsp_create_ctrls(tas_priv);
+	if (ret) {
+		dev_err(tas_priv->dev, "dsp controls error\n");
+		goto out;
+	}
 
 	tas_priv->fw_state = TASDEVICE_DSP_FW_ALL_OK;
 
@@ -415,9 +429,8 @@ static void tasdevice_fw_ready(const struct firmware *fmw,
 	tasdevice_prmg_load(tas_priv, 0);
 	tas_priv->cur_prog = 0;
 out:
-	if (tas_priv->fw_state == TASDEVICE_DSP_FW_FAIL) {
-		/*If DSP FW fail, kcontrol won't be created */
-		tasdevice_config_info_remove(tas_priv);
+	if (tas_priv->fw_state == TASDEVICE_RCA_FW_OK) {
+		/* If DSP FW fail, DSP kcontrol won't be created. */
 		tasdevice_dsp_remove(tas_priv);
 	}
 	mutex_unlock(&tas_priv->codec_lock);
@@ -464,14 +477,14 @@ static int tasdevice_startup(struct snd_pcm_substream *substream,
 {
 	struct snd_soc_component *codec = dai->component;
 	struct tasdevice_priv *tas_priv = snd_soc_component_get_drvdata(codec);
-	int ret = 0;
 
-	if (tas_priv->fw_state != TASDEVICE_DSP_FW_ALL_OK) {
-		dev_err(tas_priv->dev, "DSP bin file not loaded\n");
-		ret = -EINVAL;
+	switch (tas_priv->fw_state) {
+	case TASDEVICE_RCA_FW_OK:
+	case TASDEVICE_DSP_FW_ALL_OK:
+		return 0;
+	default:
+		return -EINVAL;
 	}
-
-	return ret;
 }
 
 static int tasdevice_hw_params(struct snd_pcm_substream *substream,
diff --git a/sound/soc/fsl/fsl_qmc_audio.c b/sound/soc/fsl/fsl_qmc_audio.c
index 56d6b0b039a2..df8188159a58 100644
--- a/sound/soc/fsl/fsl_qmc_audio.c
+++ b/sound/soc/fsl/fsl_qmc_audio.c
@@ -604,6 +604,8 @@ static int qmc_audio_dai_parse(struct qmc_audio *qmc_audio, struct device_node *
 
 	qmc_dai->name = devm_kasprintf(qmc_audio->dev, GFP_KERNEL, "%s.%d",
 				       np->parent->name, qmc_dai->id);
+	if (!qmc_dai->name)
+		return -ENOMEM;
 
 	qmc_dai->qmc_chan = devm_qmc_chan_get_byphandle(qmc_audio->dev, np,
 							"fsl,qmc-chan");
diff --git a/sound/soc/intel/common/soc-intel-quirks.h b/sound/soc/intel/common/soc-intel-quirks.h
index de4e550c5b34..42bd51456b94 100644
--- a/sound/soc/intel/common/soc-intel-quirks.h
+++ b/sound/soc/intel/common/soc-intel-quirks.h
@@ -11,7 +11,7 @@
 
 #include <linux/platform_data/x86/soc.h>
 
-#if IS_ENABLED(CONFIG_X86)
+#if IS_REACHABLE(CONFIG_IOSF_MBI)
 
 #include <linux/dmi.h>
 #include <asm/iosf_mbi.h>
diff --git a/sound/soc/qcom/lpass-cpu.c b/sound/soc/qcom/lpass-cpu.c
index 39571fed4001..73b42d9ee244 100644
--- a/sound/soc/qcom/lpass-cpu.c
+++ b/sound/soc/qcom/lpass-cpu.c
@@ -1170,9 +1170,13 @@ int asoc_qcom_lpass_cpu_platform_probe(struct platform_device *pdev)
 		}
 
 		res = platform_get_resource_byname(pdev, IORESOURCE_MEM, "lpass-rxtx-cdc-dma-lpm");
+		if (!res)
+			return -EINVAL;
 		drvdata->rxtx_cdc_dma_lpm_buf = res->start;
 
 		res = platform_get_resource_byname(pdev, IORESOURCE_MEM, "lpass-va-cdc-dma-lpm");
+		if (!res)
+			return -EINVAL;
 		drvdata->va_cdc_dma_lpm_buf = res->start;
 	}
 
diff --git a/sound/soc/sof/amd/pci-vangogh.c b/sound/soc/sof/amd/pci-vangogh.c
index d8be42fbcb6d..b035e31fadab 100644
--- a/sound/soc/sof/amd/pci-vangogh.c
+++ b/sound/soc/sof/amd/pci-vangogh.c
@@ -34,7 +34,6 @@ static const struct sof_amd_acp_desc vangogh_chip_info = {
 	.dsp_intr_base	= ACP5X_DSP_SW_INTR_BASE,
 	.sram_pte_offset = ACP5X_SRAM_PTE_OFFSET,
 	.hw_semaphore_offset = ACP5X_AXI2DAGB_SEM_0,
-	.acp_clkmux_sel = ACP5X_CLKMUX_SEL,
 	.probe_reg_offset = ACP5X_FUTURE_REG_ACLK_0,
 };
 
diff --git a/sound/soc/sof/imx/imx8m.c b/sound/soc/sof/imx/imx8m.c
index 1243f8a6141e..186ba4bbb5b2 100644
--- a/sound/soc/sof/imx/imx8m.c
+++ b/sound/soc/sof/imx/imx8m.c
@@ -243,7 +243,7 @@ static int imx8m_probe(struct snd_sof_dev *sdev)
 	/* set default mailbox offset for FW ready message */
 	sdev->dsp_box.offset = MBOX_OFFSET;
 
-	priv->regmap = syscon_regmap_lookup_by_compatible("fsl,dsp-ctrl");
+	priv->regmap = syscon_regmap_lookup_by_phandle(np, "fsl,dsp-ctrl");
 	if (IS_ERR(priv->regmap)) {
 		dev_err(sdev->dev, "cannot find dsp-ctrl registers");
 		ret = PTR_ERR(priv->regmap);
diff --git a/sound/soc/sof/ipc4-topology.c b/sound/soc/sof/ipc4-topology.c
index 78ff129be772..284efad30f1a 100644
--- a/sound/soc/sof/ipc4-topology.c
+++ b/sound/soc/sof/ipc4-topology.c
@@ -1254,7 +1254,13 @@ static void sof_ipc4_unprepare_copier_module(struct snd_sof_widget *swidget)
 		ipc4_copier = dai->private;
 
 		if (pipeline->use_chain_dma) {
-			pipeline->msg.primary = 0;
+			/*
+			 * Preserve the DMA Link ID and clear other bits since
+			 * the DMA Link ID is only configured once during
+			 * dai_config, other fields are expected to be 0 for
+			 * re-configuration
+			 */
+			pipeline->msg.primary &= SOF_IPC4_GLB_CHAIN_DMA_LINK_ID_MASK;
 			pipeline->msg.extension = 0;
 		}
 
diff --git a/sound/usb/mixer.c b/sound/usb/mixer.c
index 409fc1164694..d1bdb0b93bda 100644
--- a/sound/usb/mixer.c
+++ b/sound/usb/mixer.c
@@ -1211,6 +1211,13 @@ static void volume_control_quirks(struct usb_mixer_elem_info *cval,
 			cval->res = 16;
 		}
 		break;
+	case USB_ID(0x1bcf, 0x2281): /* HD Webcam */
+		if (!strcmp(kctl->id.name, "Mic Capture Volume")) {
+			usb_audio_info(chip,
+				"set resolution quirk: cval->res = 16\n");
+			cval->res = 16;
+		}
+		break;
 	}
 }
 
diff --git a/sound/usb/quirks.c b/sound/usb/quirks.c
index 09712e61c606..b437b14d838a 100644
--- a/sound/usb/quirks.c
+++ b/sound/usb/quirks.c
@@ -2085,6 +2085,8 @@ static const struct usb_audio_quirk_flags_table quirk_flags_table[] = {
 		   QUIRK_FLAG_CTL_MSG_DELAY_1M),
 	DEVICE_FLG(0x0b0e, 0x0349, /* Jabra 550a */
 		   QUIRK_FLAG_CTL_MSG_DELAY_1M),
+	DEVICE_FLG(0x0c45, 0x6340, /* Sonix HD USB Camera */
+		   QUIRK_FLAG_GET_SAMPLE_RATE),
 	DEVICE_FLG(0x0ecb, 0x205c, /* JBL Quantum610 Wireless */
 		   QUIRK_FLAG_FIXED_RATE),
 	DEVICE_FLG(0x0ecb, 0x2069, /* JBL Quantum810 Wireless */
@@ -2127,6 +2129,8 @@ static const struct usb_audio_quirk_flags_table quirk_flags_table[] = {
 		   QUIRK_FLAG_GET_SAMPLE_RATE),
 	DEVICE_FLG(0x19f7, 0x0035, /* RODE NT-USB+ */
 		   QUIRK_FLAG_GET_SAMPLE_RATE),
+	DEVICE_FLG(0x1bcf, 0x2281, /* HD Webcam */
+		   QUIRK_FLAG_GET_SAMPLE_RATE),
 	DEVICE_FLG(0x1bcf, 0x2283, /* NexiGo N930AF FHD Webcam */
 		   QUIRK_FLAG_GET_SAMPLE_RATE),
 	DEVICE_FLG(0x2040, 0x7200, /* Hauppauge HVR-950Q */
diff --git a/tools/bpf/bpftool/common.c b/tools/bpf/bpftool/common.c
index 958e92acca8e..9b75639434b8 100644
--- a/tools/bpf/bpftool/common.c
+++ b/tools/bpf/bpftool/common.c
@@ -410,7 +410,7 @@ void get_prog_full_name(const struct bpf_prog_info *prog_info, int prog_fd,
 {
 	const char *prog_name = prog_info->name;
 	const struct btf_type *func_type;
-	const struct bpf_func_info finfo = {};
+	struct bpf_func_info finfo = {};
 	struct bpf_prog_info info = {};
 	__u32 info_len = sizeof(info);
 	struct btf *prog_btf = NULL;
diff --git a/tools/bpf/bpftool/prog.c b/tools/bpf/bpftool/prog.c
index 086b93939ce9..e5e0fe3854a3 100644
--- a/tools/bpf/bpftool/prog.c
+++ b/tools/bpf/bpftool/prog.c
@@ -1809,6 +1809,10 @@ static int load_with_options(int argc, char **argv, bool first_prog_only)
 	}
 
 	if (pinmaps) {
+		err = create_and_mount_bpffs_dir(pinmaps);
+		if (err)
+			goto err_unpin;
+
 		err = bpf_object__pin_maps(obj, pinmaps);
 		if (err) {
 			p_err("failed to pin all maps");
diff --git a/tools/bpf/resolve_btfids/main.c b/tools/bpf/resolve_btfids/main.c
index af393c7dee1f..b3edc239fe56 100644
--- a/tools/bpf/resolve_btfids/main.c
+++ b/tools/bpf/resolve_btfids/main.c
@@ -696,7 +696,7 @@ static int sets_patch(struct object *obj)
 			 * Make sure id is at the beginning of the pairs
 			 * struct, otherwise the below qsort would not work.
 			 */
-			BUILD_BUG_ON(set8->pairs != &set8->pairs[0].id);
+			BUILD_BUG_ON((u32 *)set8->pairs != &set8->pairs[0].id);
 			qsort(set8->pairs, set8->cnt, sizeof(set8->pairs[0]), cmp_id);
 
 			/*
diff --git a/tools/lib/bpf/btf_dump.c b/tools/lib/bpf/btf_dump.c
index 4d9f30bf7f01..ebf56d21d08e 100644
--- a/tools/lib/bpf/btf_dump.c
+++ b/tools/lib/bpf/btf_dump.c
@@ -1559,10 +1559,12 @@ static void btf_dump_emit_type_chain(struct btf_dump *d,
 			 * Clang for BPF target generates func_proto with no
 			 * args as a func_proto with a single void arg (e.g.,
 			 * `int (*f)(void)` vs just `int (*f)()`). We are
-			 * going to pretend there are no args for such case.
+			 * going to emit valid empty args (void) syntax for
+			 * such case. Similarly and conveniently, valid
+			 * no args case can be special-cased here as well.
 			 */
-			if (vlen == 1 && p->type == 0) {
-				btf_dump_printf(d, ")");
+			if (vlen == 0 || (vlen == 1 && p->type == 0)) {
+				btf_dump_printf(d, "void)");
 				return;
 			}
 
diff --git a/tools/lib/bpf/linker.c b/tools/lib/bpf/linker.c
index 5ced96d99f8c..b311bb91f672 100644
--- a/tools/lib/bpf/linker.c
+++ b/tools/lib/bpf/linker.c
@@ -2194,10 +2194,17 @@ static int linker_fixup_btf(struct src_obj *obj)
 		vi = btf_var_secinfos(t);
 		for (j = 0, m = btf_vlen(t); j < m; j++, vi++) {
 			const struct btf_type *vt = btf__type_by_id(obj->btf, vi->type);
-			const char *var_name = btf__str_by_offset(obj->btf, vt->name_off);
-			int var_linkage = btf_var(vt)->linkage;
+			const char *var_name;
+			int var_linkage;
 			Elf64_Sym *sym;
 
+			/* could be a variable or function */
+			if (!btf_is_var(vt))
+				continue;
+
+			var_name = btf__str_by_offset(obj->btf, vt->name_off);
+			var_linkage = btf_var(vt)->linkage;
+
 			/* no need to patch up static or extern vars */
 			if (var_linkage != BTF_VAR_GLOBAL_ALLOCATED)
 				continue;
diff --git a/tools/memory-model/lock.cat b/tools/memory-model/lock.cat
index 53b5a492739d..21ba65086938 100644
--- a/tools/memory-model/lock.cat
+++ b/tools/memory-model/lock.cat
@@ -102,19 +102,19 @@ let rf-lf = rfe-lf | rfi-lf
  * within one of the lock's critical sections returns False.
  *)
 
-(* rfi for RU events: an RU may read from the last po-previous UL *)
-let rfi-ru = ([UL] ; po-loc ; [RU]) \ ([UL] ; po-loc ; [LKW] ; po-loc)
-
-(* rfe for RU events: an RU may read from an external UL or the initial write *)
-let all-possible-rfe-ru =
-	let possible-rfe-ru r =
+(*
+ * rf for RU events: an RU may read from an external UL or the initial write,
+ * or from the last po-previous UL
+ *)
+let all-possible-rf-ru =
+	let possible-rf-ru r =
 		let pair-to-relation p = p ++ 0
-		in map pair-to-relation (((UL | IW) * {r}) & loc & ext)
-	in map possible-rfe-ru RU
+		in map pair-to-relation ((((UL | IW) * {r}) & loc & ext) |
+			(((UL * {r}) & po-loc) \ ([UL] ; po-loc ; [LKW] ; po-loc)))
+	in map possible-rf-ru RU
 
 (* Generate all rf relations for RU events *)
-with rfe-ru from cross(all-possible-rfe-ru)
-let rf-ru = rfe-ru | rfi-ru
+with rf-ru from cross(all-possible-rf-ru)
 
 (* Final rf relation *)
 let rf = rf | rf-lf | rf-ru
diff --git a/tools/perf/arch/x86/util/intel-pt.c b/tools/perf/arch/x86/util/intel-pt.c
index 31807791589e..aaa2c641e787 100644
--- a/tools/perf/arch/x86/util/intel-pt.c
+++ b/tools/perf/arch/x86/util/intel-pt.c
@@ -32,6 +32,7 @@
 #include "../../../util/tsc.h"
 #include <internal/lib.h> // page_size
 #include "../../../util/intel-pt.h"
+#include <api/fs/fs.h>
 
 #define KiB(x) ((x) * 1024)
 #define MiB(x) ((x) * 1024 * 1024)
@@ -436,6 +437,16 @@ static int intel_pt_track_switches(struct evlist *evlist)
 }
 #endif
 
+static bool intel_pt_exclude_guest(void)
+{
+	int pt_mode;
+
+	if (sysfs__read_int("module/kvm_intel/parameters/pt_mode", &pt_mode))
+		pt_mode = 0;
+
+	return pt_mode == 1;
+}
+
 static void intel_pt_valid_str(char *str, size_t len, u64 valid)
 {
 	unsigned int val, last = 0, state = 1;
@@ -628,6 +639,7 @@ static int intel_pt_recording_options(struct auxtrace_record *itr,
 			}
 			evsel->core.attr.freq = 0;
 			evsel->core.attr.sample_period = 1;
+			evsel->core.attr.exclude_guest = intel_pt_exclude_guest();
 			evsel->no_aux_samples = true;
 			evsel->needs_auxtrace_mmap = true;
 			intel_pt_evsel = evsel;
@@ -766,7 +778,8 @@ static int intel_pt_recording_options(struct auxtrace_record *itr,
 	}
 
 	if (!opts->auxtrace_snapshot_mode && !opts->auxtrace_sample_mode) {
-		u32 aux_watermark = opts->auxtrace_mmap_pages * page_size / 4;
+		size_t aw = opts->auxtrace_mmap_pages * (size_t)page_size / 4;
+		u32 aux_watermark = aw > UINT_MAX ? UINT_MAX : aw;
 
 		intel_pt_evsel->core.attr.aux_watermark = aux_watermark;
 	}
diff --git a/tools/perf/tests/shell/test_arm_callgraph_fp.sh b/tools/perf/tests/shell/test_arm_callgraph_fp.sh
index 66dfdfdad553..60cd35c73e47 100755
--- a/tools/perf/tests/shell/test_arm_callgraph_fp.sh
+++ b/tools/perf/tests/shell/test_arm_callgraph_fp.sh
@@ -14,28 +14,21 @@ cleanup_files()
 
 trap cleanup_files EXIT TERM INT
 
-# Add a 1 second delay to skip samples that are not in the leaf() function
 # shellcheck disable=SC2086
-perf record -o "$PERF_DATA" --call-graph fp -e cycles//u -D 1000 --user-callchains -- $TEST_PROGRAM 2> /dev/null &
-PID=$!
+perf record -o "$PERF_DATA" --call-graph fp -e cycles//u --user-callchains -- $TEST_PROGRAM
 
-echo " + Recording (PID=$PID)..."
-sleep 2
-echo " + Stopping perf-record..."
-
-kill $PID
-wait $PID
+# Try opening the file so any immediate errors are visible in the log
+perf script -i "$PERF_DATA" -F comm,ip,sym | head -n4
 
-# expected perf-script output:
+# expected perf-script output if 'leaf' has been inserted correctly:
 #
-# program
+# perf
 # 	728 leaf
 # 	753 parent
 # 	76c leafloop
-# ...
+# ... remaining stack to main() ...
 
-perf script -i "$PERF_DATA" -F comm,ip,sym | head -n4
-perf script -i "$PERF_DATA" -F comm,ip,sym | head -n4 | \
-	awk '{ if ($2 != "") sym[i++] = $2 } END { if (sym[0] != "leaf" ||
-						       sym[1] != "parent" ||
-						       sym[2] != "leafloop") exit 1 }'
+# Each frame is separated by a tab, some spaces and an address
+SEP="[[:space:]]+ [[:xdigit:]]+"
+perf script -i "$PERF_DATA" -F comm,ip,sym | tr '\n' ' ' | \
+	grep -E -q "perf $SEP leaf $SEP parent $SEP leafloop"
diff --git a/tools/perf/tests/workloads/leafloop.c b/tools/perf/tests/workloads/leafloop.c
index 1bf5cc97649b..f7561767e32c 100644
--- a/tools/perf/tests/workloads/leafloop.c
+++ b/tools/perf/tests/workloads/leafloop.c
@@ -1,6 +1,8 @@
 /* SPDX-License-Identifier: GPL-2.0 */
+#include <signal.h>
 #include <stdlib.h>
 #include <linux/compiler.h>
+#include <unistd.h>
 #include "../tests.h"
 
 /* We want to check these symbols in perf script */
@@ -8,10 +10,16 @@ noinline void leaf(volatile int b);
 noinline void parent(volatile int b);
 
 static volatile int a;
+static volatile sig_atomic_t done;
+
+static void sighandler(int sig __maybe_unused)
+{
+	done = 1;
+}
 
 noinline void leaf(volatile int b)
 {
-	for (;;)
+	while (!done)
 		a += b;
 }
 
@@ -22,12 +30,16 @@ noinline void parent(volatile int b)
 
 static int leafloop(int argc, const char **argv)
 {
-	int c = 1;
+	int sec = 1;
 
 	if (argc > 0)
-		c = atoi(argv[0]);
+		sec = atoi(argv[0]);
+
+	signal(SIGINT, sighandler);
+	signal(SIGALRM, sighandler);
+	alarm(sec);
 
-	parent(c);
+	parent(sec);
 	return 0;
 }
 
diff --git a/tools/perf/util/pmus.c b/tools/perf/util/pmus.c
index cec869cbe163..54a237b2b853 100644
--- a/tools/perf/util/pmus.c
+++ b/tools/perf/util/pmus.c
@@ -470,8 +470,8 @@ void perf_pmus__print_pmu_events(const struct print_callbacks *print_cb, void *p
 	qsort(aliases, len, sizeof(struct sevent), cmp_sevent);
 	for (int j = 0; j < len; j++) {
 		/* Skip duplicates */
-		if (j > 0 && pmu_alias_is_duplicate(&aliases[j], &aliases[j - 1]))
-			continue;
+		if (j < len - 1 && pmu_alias_is_duplicate(&aliases[j], &aliases[j + 1]))
+			goto free;
 
 		print_cb->print_event(print_state,
 				aliases[j].pmu_name,
@@ -484,6 +484,7 @@ void perf_pmus__print_pmu_events(const struct print_callbacks *print_cb, void *p
 				aliases[j].desc,
 				aliases[j].long_desc,
 				aliases[j].encoding_desc);
+free:
 		zfree(&aliases[j].name);
 		zfree(&aliases[j].alias);
 		zfree(&aliases[j].scale_unit);
diff --git a/tools/perf/util/sort.c b/tools/perf/util/sort.c
index 6aa1c7f2b444..6ab8147a3f87 100644
--- a/tools/perf/util/sort.c
+++ b/tools/perf/util/sort.c
@@ -332,7 +332,7 @@ sort__sym_cmp(struct hist_entry *left, struct hist_entry *right)
 	 * comparing symbol address alone is not enough since it's a
 	 * relative address within a dso.
 	 */
-	if (!hists__has(left->hists, dso) || hists__has(right->hists, dso)) {
+	if (!hists__has(left->hists, dso)) {
 		ret = sort__dso_cmp(left, right);
 		if (ret != 0)
 			return ret;
diff --git a/tools/perf/util/stat-shadow.c b/tools/perf/util/stat-shadow.c
index cf573ff3fa84..2affa4d45aa2 100644
--- a/tools/perf/util/stat-shadow.c
+++ b/tools/perf/util/stat-shadow.c
@@ -176,6 +176,13 @@ static double find_stat(const struct evsel *evsel, int aggr_idx, enum stat_type
 		if (type != evsel__stat_type(cur))
 			continue;
 
+		/*
+		 * Except the SW CLOCK events,
+		 * ignore if not the PMU we're looking for.
+		 */
+		if ((type != STAT_NSECS) && (evsel->pmu != cur->pmu))
+			continue;
+
 		aggr = &cur->stats->aggr[aggr_idx];
 		if (type == STAT_NSECS)
 			return aggr->counts.val;
diff --git a/tools/testing/selftests/bpf/DENYLIST.aarch64 b/tools/testing/selftests/bpf/DENYLIST.aarch64
index 3babaf3eee5c..ec6aa58fb181 100644
--- a/tools/testing/selftests/bpf/DENYLIST.aarch64
+++ b/tools/testing/selftests/bpf/DENYLIST.aarch64
@@ -1,6 +1,5 @@
 bpf_cookie/multi_kprobe_attach_api               # kprobe_multi_link_api_subtest:FAIL:fentry_raw_skel_load unexpected error: -3
 bpf_cookie/multi_kprobe_link_api                 # kprobe_multi_link_api_subtest:FAIL:fentry_raw_skel_load unexpected error: -3
-fexit_sleep                                      # The test never returns. The remaining tests cannot start.
 kprobe_multi_bench_attach                        # needs CONFIG_FPROBE
 kprobe_multi_test                                # needs CONFIG_FPROBE
 module_attach                                    # prog 'kprobe_multi': failed to auto-attach: -95
diff --git a/tools/testing/selftests/bpf/prog_tests/bpf_tcp_ca.c b/tools/testing/selftests/bpf/prog_tests/bpf_tcp_ca.c
index 4aabeaa525d4..d0d9a0241545 100644
--- a/tools/testing/selftests/bpf/prog_tests/bpf_tcp_ca.c
+++ b/tools/testing/selftests/bpf/prog_tests/bpf_tcp_ca.c
@@ -396,7 +396,8 @@ static void test_update_ca(void)
 		return;
 
 	link = bpf_map__attach_struct_ops(skel->maps.ca_update_1);
-	ASSERT_OK_PTR(link, "attach_struct_ops");
+	if (!ASSERT_OK_PTR(link, "attach_struct_ops"))
+		goto out;
 
 	do_test("tcp_ca_update", NULL);
 	saved_ca1_cnt = skel->bss->ca1_cnt;
@@ -410,6 +411,7 @@ static void test_update_ca(void)
 	ASSERT_GT(skel->bss->ca2_cnt, 0, "ca2_ca2_cnt");
 
 	bpf_link__destroy(link);
+out:
 	tcp_ca_update__destroy(skel);
 }
 
@@ -425,7 +427,8 @@ static void test_update_wrong(void)
 		return;
 
 	link = bpf_map__attach_struct_ops(skel->maps.ca_update_1);
-	ASSERT_OK_PTR(link, "attach_struct_ops");
+	if (!ASSERT_OK_PTR(link, "attach_struct_ops"))
+		goto out;
 
 	do_test("tcp_ca_update", NULL);
 	saved_ca1_cnt = skel->bss->ca1_cnt;
@@ -438,6 +441,7 @@ static void test_update_wrong(void)
 	ASSERT_GT(skel->bss->ca1_cnt, saved_ca1_cnt, "ca2_ca1_cnt");
 
 	bpf_link__destroy(link);
+out:
 	tcp_ca_update__destroy(skel);
 }
 
@@ -452,7 +456,8 @@ static void test_mixed_links(void)
 		return;
 
 	link_nl = bpf_map__attach_struct_ops(skel->maps.ca_no_link);
-	ASSERT_OK_PTR(link_nl, "attach_struct_ops_nl");
+	if (!ASSERT_OK_PTR(link_nl, "attach_struct_ops_nl"))
+		goto out;
 
 	link = bpf_map__attach_struct_ops(skel->maps.ca_update_1);
 	ASSERT_OK_PTR(link, "attach_struct_ops");
@@ -465,6 +470,7 @@ static void test_mixed_links(void)
 
 	bpf_link__destroy(link);
 	bpf_link__destroy(link_nl);
+out:
 	tcp_ca_update__destroy(skel);
 }
 
@@ -507,7 +513,8 @@ static void test_link_replace(void)
 	bpf_link__destroy(link);
 
 	link = bpf_map__attach_struct_ops(skel->maps.ca_update_2);
-	ASSERT_OK_PTR(link, "attach_struct_ops_2nd");
+	if (!ASSERT_OK_PTR(link, "attach_struct_ops_2nd"))
+		goto out;
 
 	/* BPF_F_REPLACE with a wrong old map Fd. It should fail!
 	 *
@@ -530,6 +537,7 @@ static void test_link_replace(void)
 
 	bpf_link__destroy(link);
 
+out:
 	tcp_ca_update__destroy(skel);
 }
 
diff --git a/tools/testing/selftests/bpf/prog_tests/fexit_sleep.c b/tools/testing/selftests/bpf/prog_tests/fexit_sleep.c
index f949647dbbc2..552a0875ca6d 100644
--- a/tools/testing/selftests/bpf/prog_tests/fexit_sleep.c
+++ b/tools/testing/selftests/bpf/prog_tests/fexit_sleep.c
@@ -21,13 +21,13 @@ static int do_sleep(void *skel)
 }
 
 #define STACK_SIZE (1024 * 1024)
-static char child_stack[STACK_SIZE];
 
 void test_fexit_sleep(void)
 {
 	struct fexit_sleep_lskel *fexit_skel = NULL;
 	int wstatus, duration = 0;
 	pid_t cpid;
+	char *child_stack = NULL;
 	int err, fexit_cnt;
 
 	fexit_skel = fexit_sleep_lskel__open_and_load();
@@ -38,6 +38,11 @@ void test_fexit_sleep(void)
 	if (CHECK(err, "fexit_attach", "fexit attach failed: %d\n", err))
 		goto cleanup;
 
+	child_stack = mmap(NULL, STACK_SIZE, PROT_READ | PROT_WRITE, MAP_PRIVATE |
+			   MAP_ANONYMOUS | MAP_STACK, -1, 0);
+	if (!ASSERT_NEQ(child_stack, MAP_FAILED, "mmap"))
+		goto cleanup;
+
 	cpid = clone(do_sleep, child_stack + STACK_SIZE, CLONE_FILES | SIGCHLD, fexit_skel);
 	if (CHECK(cpid == -1, "clone", "%s\n", strerror(errno)))
 		goto cleanup;
@@ -78,5 +83,6 @@ void test_fexit_sleep(void)
 		goto cleanup;
 
 cleanup:
+	munmap(child_stack, STACK_SIZE);
 	fexit_sleep_lskel__destroy(fexit_skel);
 }
diff --git a/tools/testing/selftests/bpf/prog_tests/sk_lookup.c b/tools/testing/selftests/bpf/prog_tests/sk_lookup.c
index 597d0467a926..de2466547efe 100644
--- a/tools/testing/selftests/bpf/prog_tests/sk_lookup.c
+++ b/tools/testing/selftests/bpf/prog_tests/sk_lookup.c
@@ -994,7 +994,7 @@ static void drop_on_reuseport(const struct test *t)
 
 	err = update_lookup_map(t->sock_map, SERVER_A, server1);
 	if (err)
-		goto detach;
+		goto close_srv1;
 
 	/* second server on destination address we should never reach */
 	server2 = make_server(t->sotype, t->connect_to.ip, t->connect_to.port,
diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c b/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c
index f09505f8b038..53d6ad8c2257 100644
--- a/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c
+++ b/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c
@@ -222,7 +222,7 @@ static void test_xdp_adjust_frags_tail_grow(void)
 
 	prog = bpf_object__next_program(obj, NULL);
 	if (bpf_object__load(obj))
-		return;
+		goto out;
 
 	prog_fd = bpf_program__fd(prog);
 
diff --git a/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c b/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c
index ba97165bdb28..a657651eba52 100644
--- a/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c
+++ b/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c
@@ -14,9 +14,9 @@ typedef int *ptr_arr_t[6];
 
 typedef int *ptr_multiarr_t[7][8][9][10];
 
-typedef int * (*fn_ptr_arr_t[11])();
+typedef int * (*fn_ptr_arr_t[11])(void);
 
-typedef int * (*fn_ptr_multiarr_t[12][13])();
+typedef int * (*fn_ptr_multiarr_t[12][13])(void);
 
 struct root_struct {
 	arr_t _1;
diff --git a/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c b/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c
index ad21ee8c7e23..29d01fff32bd 100644
--- a/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c
+++ b/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c
@@ -100,7 +100,7 @@ typedef void (*printf_fn_t)(const char *, ...);
  *   `int -> char *` function and returns pointer to a char. Equivalent:
  *   typedef char * (*fn_input_t)(int);
  *   typedef char * (*fn_output_outer_t)(fn_input_t);
- *   typedef const fn_output_outer_t (* fn_output_inner_t)();
+ *   typedef const fn_output_outer_t (* fn_output_inner_t)(void);
  *   typedef const fn_output_inner_t fn_ptr_arr2_t[5];
  */
 /* ----- START-EXPECTED-OUTPUT ----- */
@@ -127,7 +127,7 @@ typedef void (* (*signal_t)(int, void (*)(int)))(int);
 
 typedef char * (*fn_ptr_arr1_t[10])(int **);
 
-typedef char * (* (* const fn_ptr_arr2_t[5])())(char * (*)(int));
+typedef char * (* (* const fn_ptr_arr2_t[5])(void))(char * (*)(int));
 
 struct struct_w_typedefs {
 	int_t a;
diff --git a/tools/testing/selftests/bpf/test_sockmap.c b/tools/testing/selftests/bpf/test_sockmap.c
index 43612de44fbf..a181c0ccf98b 100644
--- a/tools/testing/selftests/bpf/test_sockmap.c
+++ b/tools/testing/selftests/bpf/test_sockmap.c
@@ -63,7 +63,7 @@ int passed;
 int failed;
 int map_fd[9];
 struct bpf_map *maps[9];
-int prog_fd[11];
+int prog_fd[9];
 
 int txmsg_pass;
 int txmsg_redir;
@@ -680,7 +680,8 @@ static int msg_loop(int fd, int iov_count, int iov_length, int cnt,
 				}
 			}
 
-			s->bytes_recvd += recv;
+			if (recv > 0)
+				s->bytes_recvd += recv;
 
 			if (opt->check_recved_len && s->bytes_recvd > total_bytes) {
 				errno = EMSGSIZE;
@@ -1793,8 +1794,6 @@ int prog_attach_type[] = {
 	BPF_SK_MSG_VERDICT,
 	BPF_SK_MSG_VERDICT,
 	BPF_SK_MSG_VERDICT,
-	BPF_SK_MSG_VERDICT,
-	BPF_SK_MSG_VERDICT,
 };
 
 int prog_type[] = {
@@ -1807,8 +1806,6 @@ int prog_type[] = {
 	BPF_PROG_TYPE_SK_MSG,
 	BPF_PROG_TYPE_SK_MSG,
 	BPF_PROG_TYPE_SK_MSG,
-	BPF_PROG_TYPE_SK_MSG,
-	BPF_PROG_TYPE_SK_MSG,
 };
 
 static int populate_progs(char *bpf_file)
diff --git a/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh b/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh
index 616d3581419c..21d0f419cc6d 100755
--- a/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh
+++ b/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh
@@ -11,7 +11,7 @@ ALL_TESTS="single_mask_test identical_filters_test two_masks_test \
 	multiple_masks_test ctcam_edge_cases_test delta_simple_test \
 	delta_two_masks_one_key_test delta_simple_rehash_test \
 	bloom_simple_test bloom_complex_test bloom_delta_test \
-	max_erp_entries_test max_group_size_test"
+	max_erp_entries_test max_group_size_test collision_test"
 NUM_NETIFS=2
 source $lib_dir/lib.sh
 source $lib_dir/tc_common.sh
@@ -457,7 +457,7 @@ delta_two_masks_one_key_test()
 {
 	# If 2 keys are the same and only differ in mask in a way that
 	# they belong under the same ERP (second is delta of the first),
-	# there should be no C-TCAM spill.
+	# there should be C-TCAM spill.
 
 	RET=0
 
@@ -474,8 +474,8 @@ delta_two_masks_one_key_test()
 	tp_record "mlxsw:*" "tc filter add dev $h2 ingress protocol ip \
 		   pref 2 handle 102 flower $tcflags dst_ip 192.0.2.2 \
 		   action drop"
-	tp_check_hits "mlxsw:mlxsw_sp_acl_atcam_entry_add_ctcam_spill" 0
-	check_err $? "incorrect C-TCAM spill while inserting the second rule"
+	tp_check_hits "mlxsw:mlxsw_sp_acl_atcam_entry_add_ctcam_spill" 1
+	check_err $? "C-TCAM spill did not happen while inserting the second rule"
 
 	$MZ $h1 -c 1 -p 64 -a $h1mac -b $h2mac -A 192.0.2.1 -B 192.0.2.2 \
 		-t ip -q
@@ -1087,6 +1087,53 @@ max_group_size_test()
 	log_test "max ACL group size test ($tcflags). max size $max_size"
 }
 
+collision_test()
+{
+	# Filters cannot share an eRP if in the common unmasked part (i.e.,
+	# without the delta bits) they have the same values. If the driver does
+	# not prevent such configuration (by spilling into the C-TCAM), then
+	# multiple entries will be present in the device with the same key,
+	# leading to collisions and a reduced scale.
+	#
+	# Create such a scenario and make sure all the filters are successfully
+	# added.
+
+	RET=0
+
+	local ret
+
+	if [[ "$tcflags" != "skip_sw" ]]; then
+		return 0;
+	fi
+
+	# Add a single dst_ip/24 filter and multiple dst_ip/32 filters that all
+	# have the same values in the common unmasked part (dst_ip/24).
+
+	tc filter add dev $h2 ingress pref 1 proto ipv4 handle 101 \
+		flower $tcflags dst_ip 198.51.100.0/24 \
+		action drop
+
+	for i in {0..255}; do
+		tc filter add dev $h2 ingress pref 2 proto ipv4 \
+			handle $((102 + i)) \
+			flower $tcflags dst_ip 198.51.100.${i}/32 \
+			action drop
+		ret=$?
+		[[ $ret -ne 0 ]] && break
+	done
+
+	check_err $ret "failed to add all the filters"
+
+	for i in {255..0}; do
+		tc filter del dev $h2 ingress pref 2 proto ipv4 \
+			handle $((102 + i)) flower
+	done
+
+	tc filter del dev $h2 ingress pref 1 proto ipv4 handle 101 flower
+
+	log_test "collision test ($tcflags)"
+}
+
 setup_prepare()
 {
 	h1=${NETIFS[p1]}
diff --git a/tools/testing/selftests/landlock/base_test.c b/tools/testing/selftests/landlock/base_test.c
index 792c3f0a59b4..5aa7d2feab10 100644
--- a/tools/testing/selftests/landlock/base_test.c
+++ b/tools/testing/selftests/landlock/base_test.c
@@ -9,6 +9,7 @@
 #define _GNU_SOURCE
 #include <errno.h>
 #include <fcntl.h>
+#include <linux/keyctl.h>
 #include <linux/landlock.h>
 #include <string.h>
 #include <sys/prctl.h>
@@ -326,4 +327,77 @@ TEST(ruleset_fd_transfer)
 	ASSERT_EQ(EXIT_SUCCESS, WEXITSTATUS(status));
 }
 
+TEST(cred_transfer)
+{
+	struct landlock_ruleset_attr ruleset_attr = {
+		.handled_access_fs = LANDLOCK_ACCESS_FS_READ_DIR,
+	};
+	int ruleset_fd, dir_fd;
+	pid_t child;
+	int status;
+
+	drop_caps(_metadata);
+
+	dir_fd = open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC);
+	EXPECT_LE(0, dir_fd);
+	EXPECT_EQ(0, close(dir_fd));
+
+	/* Denies opening directories. */
+	ruleset_fd =
+		landlock_create_ruleset(&ruleset_attr, sizeof(ruleset_attr), 0);
+	ASSERT_LE(0, ruleset_fd);
+	EXPECT_EQ(0, prctl(PR_SET_NO_NEW_PRIVS, 1, 0, 0, 0));
+	ASSERT_EQ(0, landlock_restrict_self(ruleset_fd, 0));
+	EXPECT_EQ(0, close(ruleset_fd));
+
+	/* Checks ruleset enforcement. */
+	EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC));
+	EXPECT_EQ(EACCES, errno);
+
+	/* Needed for KEYCTL_SESSION_TO_PARENT permission checks */
+	EXPECT_NE(-1, syscall(__NR_keyctl, KEYCTL_JOIN_SESSION_KEYRING, NULL, 0,
+			      0, 0))
+	{
+		TH_LOG("Failed to join session keyring: %s", strerror(errno));
+	}
+
+	child = fork();
+	ASSERT_LE(0, child);
+	if (child == 0) {
+		/* Checks ruleset enforcement. */
+		EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC));
+		EXPECT_EQ(EACCES, errno);
+
+		/*
+		 * KEYCTL_SESSION_TO_PARENT is a no-op unless we have a
+		 * different session keyring in the child, so make that happen.
+		 */
+		EXPECT_NE(-1, syscall(__NR_keyctl, KEYCTL_JOIN_SESSION_KEYRING,
+				      NULL, 0, 0, 0));
+
+		/*
+		 * KEYCTL_SESSION_TO_PARENT installs credentials on the parent
+		 * that never go through the cred_prepare hook, this path uses
+		 * cred_transfer instead.
+		 */
+		EXPECT_EQ(0, syscall(__NR_keyctl, KEYCTL_SESSION_TO_PARENT, 0,
+				     0, 0, 0));
+
+		/* Re-checks ruleset enforcement. */
+		EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC));
+		EXPECT_EQ(EACCES, errno);
+
+		_exit(_metadata->passed ? EXIT_SUCCESS : EXIT_FAILURE);
+		return;
+	}
+
+	EXPECT_EQ(child, waitpid(child, &status, 0));
+	EXPECT_EQ(1, WIFEXITED(status));
+	EXPECT_EQ(EXIT_SUCCESS, WEXITSTATUS(status));
+
+	/* Re-checks ruleset enforcement. */
+	EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC));
+	EXPECT_EQ(EACCES, errno);
+}
+
 TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/landlock/config b/tools/testing/selftests/landlock/config
index 3dc9e438eab1..efca1c733367 100644
--- a/tools/testing/selftests/landlock/config
+++ b/tools/testing/selftests/landlock/config
@@ -1,5 +1,6 @@
 CONFIG_CGROUPS=y
 CONFIG_CGROUP_SCHED=y
+CONFIG_KEYS=y
 CONFIG_OVERLAY_FS=y
 CONFIG_PROC_FS=y
 CONFIG_SECURITY=y
diff --git a/tools/testing/selftests/net/fib_tests.sh b/tools/testing/selftests/net/fib_tests.sh
index 66d0db7a2614..ede2c0ec2a9d 100755
--- a/tools/testing/selftests/net/fib_tests.sh
+++ b/tools/testing/selftests/net/fib_tests.sh
@@ -1643,53 +1643,53 @@ ipv4_rt_dsfield()
 
 	# DSCP 0x10 should match the specific route, no matter the ECN bits
 	$IP route get fibmatch 172.16.102.1 dsfield 0x10 | \
-		grep -q "via 172.16.103.2"
+		grep -q "172.16.102.0/24 tos 0x10 via 172.16.103.2"
 	log_test $? 0 "IPv4 route with DSCP and ECN:Not-ECT"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x11 | \
-		grep -q "via 172.16.103.2"
+		grep -q "172.16.102.0/24 tos 0x10 via 172.16.103.2"
 	log_test $? 0 "IPv4 route with DSCP and ECN:ECT(1)"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x12 | \
-		grep -q "via 172.16.103.2"
+		grep -q "172.16.102.0/24 tos 0x10 via 172.16.103.2"
 	log_test $? 0 "IPv4 route with DSCP and ECN:ECT(0)"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x13 | \
-		grep -q "via 172.16.103.2"
+		grep -q "172.16.102.0/24 tos 0x10 via 172.16.103.2"
 	log_test $? 0 "IPv4 route with DSCP and ECN:CE"
 
 	# Unknown DSCP should match the generic route, no matter the ECN bits
 	$IP route get fibmatch 172.16.102.1 dsfield 0x14 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with unknown DSCP and ECN:Not-ECT"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x15 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with unknown DSCP and ECN:ECT(1)"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x16 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with unknown DSCP and ECN:ECT(0)"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x17 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with unknown DSCP and ECN:CE"
 
 	# Null DSCP should match the generic route, no matter the ECN bits
 	$IP route get fibmatch 172.16.102.1 dsfield 0x00 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with no DSCP and ECN:Not-ECT"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x01 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with no DSCP and ECN:ECT(1)"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x02 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with no DSCP and ECN:ECT(0)"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x03 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with no DSCP and ECN:CE"
 }
 
diff --git a/tools/testing/selftests/net/forwarding/devlink_lib.sh b/tools/testing/selftests/net/forwarding/devlink_lib.sh
index f1de525cfa55..62a05bca1e82 100644
--- a/tools/testing/selftests/net/forwarding/devlink_lib.sh
+++ b/tools/testing/selftests/net/forwarding/devlink_lib.sh
@@ -122,6 +122,8 @@ devlink_reload()
 	still_pending=$(devlink resource show "$DEVLINK_DEV" | \
 			grep -c "size_new")
 	check_err $still_pending "Failed reload - There are still unset sizes"
+
+	udevadm settle
 }
 
 declare -A DEVLINK_ORIG
diff --git a/tools/testing/selftests/resctrl/cache.c b/tools/testing/selftests/resctrl/cache.c
index a0318bd3a63d..601ab78dbf42 100644
--- a/tools/testing/selftests/resctrl/cache.c
+++ b/tools/testing/selftests/resctrl/cache.c
@@ -40,7 +40,7 @@ static int perf_event_open_llc_miss(pid_t pid, int cpu_no)
 	fd_lm = perf_event_open(&pea_llc_miss, pid, cpu_no, -1,
 				PERF_FLAG_FD_CLOEXEC);
 	if (fd_lm == -1) {
-		perror("Error opening leader");
+		ksft_perror("Error opening leader");
 		ctrlc_handler(0, NULL, NULL);
 		return -1;
 	}
@@ -95,7 +95,7 @@ static int get_llc_perf(unsigned long *llc_perf_miss)
 
 	ret = read(fd_lm, &rf_cqm, sizeof(struct read_format));
 	if (ret == -1) {
-		perror("Could not get llc misses through perf");
+		ksft_perror("Could not get llc misses through perf");
 		return -1;
 	}
 
@@ -124,12 +124,12 @@ static int get_llc_occu_resctrl(unsigned long *llc_occupancy)
 
 	fp = fopen(llc_occup_path, "r");
 	if (!fp) {
-		perror("Failed to open results file");
+		ksft_perror("Failed to open results file");
 
 		return errno;
 	}
 	if (fscanf(fp, "%lu", llc_occupancy) <= 0) {
-		perror("Could not get llc occupancy");
+		ksft_perror("Could not get llc occupancy");
 		fclose(fp);
 
 		return -1;
@@ -159,7 +159,7 @@ static int print_results_cache(char *filename, int bm_pid,
 	} else {
 		fp = fopen(filename, "a");
 		if (!fp) {
-			perror("Cannot open results file");
+			ksft_perror("Cannot open results file");
 
 			return errno;
 		}
diff --git a/tools/testing/selftests/resctrl/cat_test.c b/tools/testing/selftests/resctrl/cat_test.c
index 224ba8544d8a..9bb8ba93f433 100644
--- a/tools/testing/selftests/resctrl/cat_test.c
+++ b/tools/testing/selftests/resctrl/cat_test.c
@@ -51,7 +51,7 @@ static int check_results(struct resctrl_val_param *param, size_t span)
 	ksft_print_msg("Checking for pass/fail\n");
 	fp = fopen(param->filename, "r");
 	if (!fp) {
-		perror("# Cannot open file");
+		ksft_perror("Cannot open file");
 
 		return errno;
 	}
@@ -149,7 +149,7 @@ int cat_perf_miss_val(int cpu_no, int n, char *cache_type)
 	param.num_of_runs = 0;
 
 	if (pipe(pipefd)) {
-		perror("# Unable to create pipe");
+		ksft_perror("Unable to create pipe");
 		return errno;
 	}
 
@@ -185,7 +185,7 @@ int cat_perf_miss_val(int cpu_no, int n, char *cache_type)
 			 * Just print the error message.
 			 * Let while(1) run and wait for itself to be killed.
 			 */
-			perror("# failed signaling parent process");
+			ksft_perror("Failed signaling parent process");
 
 		close(pipefd[1]);
 		while (1)
@@ -197,7 +197,7 @@ int cat_perf_miss_val(int cpu_no, int n, char *cache_type)
 		while (pipe_message != 1) {
 			if (read(pipefd[0], &pipe_message,
 				 sizeof(pipe_message)) < sizeof(pipe_message)) {
-				perror("# failed reading from child process");
+				ksft_perror("Failed reading from child process");
 				break;
 			}
 		}
diff --git a/tools/testing/selftests/resctrl/cmt_test.c b/tools/testing/selftests/resctrl/cmt_test.c
index 50bdbce9fba9..16fc0488e0a5 100644
--- a/tools/testing/selftests/resctrl/cmt_test.c
+++ b/tools/testing/selftests/resctrl/cmt_test.c
@@ -37,7 +37,7 @@ static int check_results(struct resctrl_val_param *param, size_t span, int no_of
 	ksft_print_msg("Checking for pass/fail\n");
 	fp = fopen(param->filename, "r");
 	if (!fp) {
-		perror("# Error in opening file\n");
+		ksft_perror("Error in opening file");
 
 		return errno;
 	}
diff --git a/tools/testing/selftests/resctrl/fill_buf.c b/tools/testing/selftests/resctrl/fill_buf.c
index 0d425f26583a..0f6cca61ec94 100644
--- a/tools/testing/selftests/resctrl/fill_buf.c
+++ b/tools/testing/selftests/resctrl/fill_buf.c
@@ -115,7 +115,7 @@ static int fill_cache_read(unsigned char *buf, size_t buf_size, bool once)
 	/* Consume read result so that reading memory is not optimized out. */
 	fp = fopen("/dev/null", "w");
 	if (!fp) {
-		perror("Unable to write to /dev/null");
+		ksft_perror("Unable to write to /dev/null");
 		return -1;
 	}
 	fprintf(fp, "Sum: %d ", ret);
diff --git a/tools/testing/selftests/resctrl/mba_test.c b/tools/testing/selftests/resctrl/mba_test.c
index d3bf4368341e..4988b93add6a 100644
--- a/tools/testing/selftests/resctrl/mba_test.c
+++ b/tools/testing/selftests/resctrl/mba_test.c
@@ -109,7 +109,7 @@ static int check_results(void)
 
 	fp = fopen(output, "r");
 	if (!fp) {
-		perror(output);
+		ksft_perror(output);
 
 		return errno;
 	}
diff --git a/tools/testing/selftests/resctrl/mbm_test.c b/tools/testing/selftests/resctrl/mbm_test.c
index d3c0d30c676a..eb488aabb9ae 100644
--- a/tools/testing/selftests/resctrl/mbm_test.c
+++ b/tools/testing/selftests/resctrl/mbm_test.c
@@ -59,7 +59,7 @@ static int check_results(size_t span)
 
 	fp = fopen(output, "r");
 	if (!fp) {
-		perror(output);
+		ksft_perror(output);
 
 		return errno;
 	}
diff --git a/tools/testing/selftests/resctrl/resctrl.h b/tools/testing/selftests/resctrl/resctrl.h
index 8578a8b4e145..dd3546655657 100644
--- a/tools/testing/selftests/resctrl/resctrl.h
+++ b/tools/testing/selftests/resctrl/resctrl.h
@@ -37,9 +37,8 @@
 
 #define DEFAULT_SPAN		(250 * MB)
 
-#define PARENT_EXIT(err_msg)			\
+#define PARENT_EXIT()				\
 	do {					\
-		perror(err_msg);		\
 		kill(ppid, SIGKILL);		\
 		umount_resctrlfs();		\
 		exit(EXIT_FAILURE);		\
@@ -86,7 +85,6 @@ int validate_bw_report_request(char *bw_report);
 bool validate_resctrl_feature_request(const char *resource, const char *feature);
 char *fgrep(FILE *inf, const char *str);
 int taskset_benchmark(pid_t bm_pid, int cpu_no);
-void run_benchmark(int signum, siginfo_t *info, void *ucontext);
 int write_schemata(char *ctrlgrp, char *schemata, int cpu_no,
 		   char *resctrl_val);
 int write_bm_pid_to_resctrl(pid_t bm_pid, char *ctrlgrp, char *mongrp,
diff --git a/tools/testing/selftests/resctrl/resctrl_val.c b/tools/testing/selftests/resctrl/resctrl_val.c
index b8ca6fa40b3b..45439e726e79 100644
--- a/tools/testing/selftests/resctrl/resctrl_val.c
+++ b/tools/testing/selftests/resctrl/resctrl_val.c
@@ -156,12 +156,12 @@ static int read_from_imc_dir(char *imc_dir, int count)
 	sprintf(imc_counter_type, "%s%s", imc_dir, "type");
 	fp = fopen(imc_counter_type, "r");
 	if (!fp) {
-		perror("Failed to open imc counter type file");
+		ksft_perror("Failed to open iMC counter type file");
 
 		return -1;
 	}
 	if (fscanf(fp, "%u", &imc_counters_config[count][READ].type) <= 0) {
-		perror("Could not get imc type");
+		ksft_perror("Could not get iMC type");
 		fclose(fp);
 
 		return -1;
@@ -175,12 +175,12 @@ static int read_from_imc_dir(char *imc_dir, int count)
 	sprintf(imc_counter_cfg, "%s%s", imc_dir, READ_FILE_NAME);
 	fp = fopen(imc_counter_cfg, "r");
 	if (!fp) {
-		perror("Failed to open imc config file");
+		ksft_perror("Failed to open iMC config file");
 
 		return -1;
 	}
 	if (fscanf(fp, "%s", cas_count_cfg) <= 0) {
-		perror("Could not get imc cas count read");
+		ksft_perror("Could not get iMC cas count read");
 		fclose(fp);
 
 		return -1;
@@ -193,12 +193,12 @@ static int read_from_imc_dir(char *imc_dir, int count)
 	sprintf(imc_counter_cfg, "%s%s", imc_dir, WRITE_FILE_NAME);
 	fp = fopen(imc_counter_cfg, "r");
 	if (!fp) {
-		perror("Failed to open imc config file");
+		ksft_perror("Failed to open iMC config file");
 
 		return -1;
 	}
 	if  (fscanf(fp, "%s", cas_count_cfg) <= 0) {
-		perror("Could not get imc cas count write");
+		ksft_perror("Could not get iMC cas count write");
 		fclose(fp);
 
 		return -1;
@@ -262,12 +262,12 @@ static int num_of_imcs(void)
 		}
 		closedir(dp);
 		if (count == 0) {
-			perror("Unable find iMC counters!\n");
+			ksft_print_msg("Unable to find iMC counters\n");
 
 			return -1;
 		}
 	} else {
-		perror("Unable to open PMU directory!\n");
+		ksft_perror("Unable to open PMU directory");
 
 		return -1;
 	}
@@ -292,6 +292,18 @@ static int initialize_mem_bw_imc(void)
 	return 0;
 }
 
+static void perf_close_imc_mem_bw(void)
+{
+	int mc;
+
+	for (mc = 0; mc < imcs; mc++) {
+		if (imc_counters_config[mc][READ].fd != -1)
+			close(imc_counters_config[mc][READ].fd);
+		if (imc_counters_config[mc][WRITE].fd != -1)
+			close(imc_counters_config[mc][WRITE].fd);
+	}
+}
+
 /*
  * get_mem_bw_imc:	Memory band width as reported by iMC counters
  * @cpu_no:		CPU number that the benchmark PID is binded to
@@ -305,26 +317,33 @@ static int initialize_mem_bw_imc(void)
 static int get_mem_bw_imc(int cpu_no, char *bw_report, float *bw_imc)
 {
 	float reads, writes, of_mul_read, of_mul_write;
-	int imc, j, ret;
+	int imc, ret;
+
+	for (imc = 0; imc < imcs; imc++) {
+		imc_counters_config[imc][READ].fd = -1;
+		imc_counters_config[imc][WRITE].fd = -1;
+	}
 
 	/* Start all iMC counters to log values (both read and write) */
 	reads = 0, writes = 0, of_mul_read = 1, of_mul_write = 1;
 	for (imc = 0; imc < imcs; imc++) {
-		for (j = 0; j < 2; j++) {
-			ret = open_perf_event(imc, cpu_no, j);
-			if (ret)
-				return -1;
-		}
-		for (j = 0; j < 2; j++)
-			membw_ioctl_perf_event_ioc_reset_enable(imc, j);
+		ret = open_perf_event(imc, cpu_no, READ);
+		if (ret)
+			goto close_fds;
+		ret = open_perf_event(imc, cpu_no, WRITE);
+		if (ret)
+			goto close_fds;
+
+		membw_ioctl_perf_event_ioc_reset_enable(imc, READ);
+		membw_ioctl_perf_event_ioc_reset_enable(imc, WRITE);
 	}
 
 	sleep(1);
 
 	/* Stop counters after a second to get results (both read and write) */
 	for (imc = 0; imc < imcs; imc++) {
-		for (j = 0; j < 2; j++)
-			membw_ioctl_perf_event_ioc_disable(imc, j);
+		membw_ioctl_perf_event_ioc_disable(imc, READ);
+		membw_ioctl_perf_event_ioc_disable(imc, WRITE);
 	}
 
 	/*
@@ -339,16 +358,14 @@ static int get_mem_bw_imc(int cpu_no, char *bw_report, float *bw_imc)
 
 		if (read(r->fd, &r->return_value,
 			 sizeof(struct membw_read_format)) == -1) {
-			perror("Couldn't get read b/w through iMC");
-
-			return -1;
+			ksft_perror("Couldn't get read b/w through iMC");
+			goto close_fds;
 		}
 
 		if (read(w->fd, &w->return_value,
 			 sizeof(struct membw_read_format)) == -1) {
-			perror("Couldn't get write bw through iMC");
-
-			return -1;
+			ksft_perror("Couldn't get write bw through iMC");
+			goto close_fds;
 		}
 
 		__u64 r_time_enabled = r->return_value.time_enabled;
@@ -368,10 +385,7 @@ static int get_mem_bw_imc(int cpu_no, char *bw_report, float *bw_imc)
 		writes += w->return_value.value * of_mul_write * SCALE;
 	}
 
-	for (imc = 0; imc < imcs; imc++) {
-		close(imc_counters_config[imc][READ].fd);
-		close(imc_counters_config[imc][WRITE].fd);
-	}
+	perf_close_imc_mem_bw();
 
 	if (strcmp(bw_report, "reads") == 0) {
 		*bw_imc = reads;
@@ -385,6 +399,10 @@ static int get_mem_bw_imc(int cpu_no, char *bw_report, float *bw_imc)
 
 	*bw_imc = reads + writes;
 	return 0;
+
+close_fds:
+	perf_close_imc_mem_bw();
+	return -1;
 }
 
 void set_mbm_path(const char *ctrlgrp, const char *mongrp, int resource_id)
@@ -416,7 +434,7 @@ static void initialize_mem_bw_resctrl(const char *ctrlgrp, const char *mongrp,
 	int resource_id;
 
 	if (get_resource_id(cpu_no, &resource_id) < 0) {
-		perror("Could not get resource_id");
+		ksft_print_msg("Could not get resource_id\n");
 		return;
 	}
 
@@ -449,12 +467,12 @@ static int get_mem_bw_resctrl(unsigned long *mbm_total)
 
 	fp = fopen(mbm_total_path, "r");
 	if (!fp) {
-		perror("Failed to open total bw file");
+		ksft_perror("Failed to open total bw file");
 
 		return -1;
 	}
 	if (fscanf(fp, "%lu", mbm_total) <= 0) {
-		perror("Could not get mbm local bytes");
+		ksft_perror("Could not get mbm local bytes");
 		fclose(fp);
 
 		return -1;
@@ -495,7 +513,7 @@ int signal_handler_register(void)
 	if (sigaction(SIGINT, &sigact, NULL) ||
 	    sigaction(SIGTERM, &sigact, NULL) ||
 	    sigaction(SIGHUP, &sigact, NULL)) {
-		perror("# sigaction");
+		ksft_perror("sigaction");
 		ret = -1;
 	}
 	return ret;
@@ -515,7 +533,7 @@ void signal_handler_unregister(void)
 	if (sigaction(SIGINT, &sigact, NULL) ||
 	    sigaction(SIGTERM, &sigact, NULL) ||
 	    sigaction(SIGHUP, &sigact, NULL)) {
-		perror("# sigaction");
+		ksft_perror("sigaction");
 	}
 }
 
@@ -540,14 +558,14 @@ static int print_results_bw(char *filename,  int bm_pid, float bw_imc,
 	} else {
 		fp = fopen(filename, "a");
 		if (!fp) {
-			perror("Cannot open results file");
+			ksft_perror("Cannot open results file");
 
 			return errno;
 		}
 		if (fprintf(fp, "Pid: %d \t Mem_BW_iMC: %f \t Mem_BW_resc: %lu \t Difference: %lu\n",
 			    bm_pid, bw_imc, bw_resc, diff) <= 0) {
+			ksft_print_msg("Could not log results\n");
 			fclose(fp);
-			perror("Could not log results.");
 
 			return errno;
 		}
@@ -585,7 +603,7 @@ static void initialize_llc_occu_resctrl(const char *ctrlgrp, const char *mongrp,
 	int resource_id;
 
 	if (get_resource_id(cpu_no, &resource_id) < 0) {
-		perror("# Unable to resource_id");
+		ksft_print_msg("Could not get resource_id\n");
 		return;
 	}
 
@@ -625,6 +643,61 @@ measure_vals(struct resctrl_val_param *param, unsigned long *bw_resc_start)
 	return 0;
 }
 
+/*
+ * run_benchmark - Run a specified benchmark or fill_buf (default benchmark)
+ *		   in specified signal. Direct benchmark stdio to /dev/null.
+ * @signum:	signal number
+ * @info:	signal info
+ * @ucontext:	user context in signal handling
+ */
+static void run_benchmark(int signum, siginfo_t *info, void *ucontext)
+{
+	int operation, ret, memflush;
+	char **benchmark_cmd;
+	size_t span;
+	bool once;
+	FILE *fp;
+
+	benchmark_cmd = info->si_ptr;
+
+	/*
+	 * Direct stdio of child to /dev/null, so that only parent writes to
+	 * stdio (console)
+	 */
+	fp = freopen("/dev/null", "w", stdout);
+	if (!fp) {
+		ksft_perror("Unable to direct benchmark status to /dev/null");
+		PARENT_EXIT();
+	}
+
+	if (strcmp(benchmark_cmd[0], "fill_buf") == 0) {
+		/* Execute default fill_buf benchmark */
+		span = strtoul(benchmark_cmd[1], NULL, 10);
+		memflush =  atoi(benchmark_cmd[2]);
+		operation = atoi(benchmark_cmd[3]);
+		if (!strcmp(benchmark_cmd[4], "true")) {
+			once = true;
+		} else if (!strcmp(benchmark_cmd[4], "false")) {
+			once = false;
+		} else {
+			ksft_print_msg("Invalid once parameter\n");
+			PARENT_EXIT();
+		}
+
+		if (run_fill_buf(span, memflush, operation, once))
+			fprintf(stderr, "Error in running fill buffer\n");
+	} else {
+		/* Execute specified benchmark */
+		ret = execvp(benchmark_cmd[0], benchmark_cmd);
+		if (ret)
+			ksft_perror("execvp");
+	}
+
+	fclose(stdout);
+	ksft_print_msg("Unable to run specified benchmark\n");
+	PARENT_EXIT();
+}
+
 /*
  * resctrl_val:	execute benchmark and measure memory bandwidth on
  *			the benchmark
@@ -659,7 +732,7 @@ int resctrl_val(const char * const *benchmark_cmd, struct resctrl_val_param *par
 	ppid = getpid();
 
 	if (pipe(pipefd)) {
-		perror("# Unable to create pipe");
+		ksft_perror("Unable to create pipe");
 
 		return -1;
 	}
@@ -671,7 +744,7 @@ int resctrl_val(const char * const *benchmark_cmd, struct resctrl_val_param *par
 	fflush(stdout);
 	bm_pid = fork();
 	if (bm_pid == -1) {
-		perror("# Unable to fork");
+		ksft_perror("Unable to fork");
 
 		return -1;
 	}
@@ -688,15 +761,17 @@ int resctrl_val(const char * const *benchmark_cmd, struct resctrl_val_param *par
 		sigact.sa_flags = SA_SIGINFO;
 
 		/* Register for "SIGUSR1" signal from parent */
-		if (sigaction(SIGUSR1, &sigact, NULL))
-			PARENT_EXIT("Can't register child for signal");
+		if (sigaction(SIGUSR1, &sigact, NULL)) {
+			ksft_perror("Can't register child for signal");
+			PARENT_EXIT();
+		}
 
 		/* Tell parent that child is ready */
 		close(pipefd[0]);
 		pipe_message = 1;
 		if (write(pipefd[1], &pipe_message, sizeof(pipe_message)) <
 		    sizeof(pipe_message)) {
-			perror("# failed signaling parent process");
+			ksft_perror("Failed signaling parent process");
 			close(pipefd[1]);
 			return -1;
 		}
@@ -705,7 +780,8 @@ int resctrl_val(const char * const *benchmark_cmd, struct resctrl_val_param *par
 		/* Suspend child until delivery of "SIGUSR1" from parent */
 		sigsuspend(&sigact.sa_mask);
 
-		PARENT_EXIT("Child is done");
+		ksft_perror("Child is done");
+		PARENT_EXIT();
 	}
 
 	ksft_print_msg("Benchmark PID: %d\n", bm_pid);
@@ -746,7 +822,7 @@ int resctrl_val(const char * const *benchmark_cmd, struct resctrl_val_param *par
 	while (pipe_message != 1) {
 		if (read(pipefd[0], &pipe_message, sizeof(pipe_message)) <
 		    sizeof(pipe_message)) {
-			perror("# failed reading message from child process");
+			ksft_perror("Failed reading message from child process");
 			close(pipefd[0]);
 			goto out;
 		}
@@ -755,7 +831,7 @@ int resctrl_val(const char * const *benchmark_cmd, struct resctrl_val_param *par
 
 	/* Signal child to start benchmark */
 	if (sigqueue(bm_pid, SIGUSR1, value) == -1) {
-		perror("# sigqueue SIGUSR1 to child");
+		ksft_perror("sigqueue SIGUSR1 to child");
 		ret = errno;
 		goto out;
 	}
diff --git a/tools/testing/selftests/resctrl/resctrlfs.c b/tools/testing/selftests/resctrl/resctrlfs.c
index 3a8111362d26..71ad2b335b83 100644
--- a/tools/testing/selftests/resctrl/resctrlfs.c
+++ b/tools/testing/selftests/resctrl/resctrlfs.c
@@ -19,7 +19,7 @@ static int find_resctrl_mount(char *buffer)
 
 	mounts = fopen("/proc/mounts", "r");
 	if (!mounts) {
-		perror("/proc/mounts");
+		ksft_perror("/proc/mounts");
 		return -ENXIO;
 	}
 	while (!feof(mounts)) {
@@ -68,7 +68,7 @@ int mount_resctrlfs(void)
 	ksft_print_msg("Mounting resctrl to \"%s\"\n", RESCTRL_PATH);
 	ret = mount("resctrl", RESCTRL_PATH, "resctrl", 0, NULL);
 	if (ret)
-		perror("# mount");
+		ksft_perror("mount");
 
 	return ret;
 }
@@ -85,7 +85,7 @@ int umount_resctrlfs(void)
 		return ret;
 
 	if (umount(mountpoint)) {
-		perror("# Unable to umount resctrl");
+		ksft_perror("Unable to umount resctrl");
 
 		return errno;
 	}
@@ -114,12 +114,12 @@ int get_resource_id(int cpu_no, int *resource_id)
 
 	fp = fopen(phys_pkg_path, "r");
 	if (!fp) {
-		perror("Failed to open physical_package_id");
+		ksft_perror("Failed to open physical_package_id");
 
 		return -1;
 	}
 	if (fscanf(fp, "%d", resource_id) <= 0) {
-		perror("Could not get socket number or l3 id");
+		ksft_perror("Could not get socket number or l3 id");
 		fclose(fp);
 
 		return -1;
@@ -148,7 +148,7 @@ int get_cache_size(int cpu_no, char *cache_type, unsigned long *cache_size)
 	} else if (!strcmp(cache_type, "L2")) {
 		cache_num = 2;
 	} else {
-		perror("Invalid cache level");
+		ksft_print_msg("Invalid cache level\n");
 		return -1;
 	}
 
@@ -156,12 +156,12 @@ int get_cache_size(int cpu_no, char *cache_type, unsigned long *cache_size)
 		cpu_no, cache_num);
 	fp = fopen(cache_path, "r");
 	if (!fp) {
-		perror("Failed to open cache size");
+		ksft_perror("Failed to open cache size");
 
 		return -1;
 	}
 	if (fscanf(fp, "%s", cache_str) <= 0) {
-		perror("Could not get cache_size");
+		ksft_perror("Could not get cache_size");
 		fclose(fp);
 
 		return -1;
@@ -213,12 +213,12 @@ int get_cbm_mask(char *cache_type, char *cbm_mask)
 
 	fp = fopen(cbm_mask_path, "r");
 	if (!fp) {
-		perror("Failed to open cache level");
+		ksft_perror("Failed to open cache level");
 
 		return -1;
 	}
 	if (fscanf(fp, "%s", cbm_mask) <= 0) {
-		perror("Could not get max cbm_mask");
+		ksft_perror("Could not get max cbm_mask");
 		fclose(fp);
 
 		return -1;
@@ -245,12 +245,12 @@ int get_core_sibling(int cpu_no)
 
 	fp = fopen(core_siblings_path, "r");
 	if (!fp) {
-		perror("Failed to open core siblings path");
+		ksft_perror("Failed to open core siblings path");
 
 		return -1;
 	}
 	if (fscanf(fp, "%s", cpu_list_str) <= 0) {
-		perror("Could not get core_siblings list");
+		ksft_perror("Could not get core_siblings list");
 		fclose(fp);
 
 		return -1;
@@ -285,7 +285,7 @@ int taskset_benchmark(pid_t bm_pid, int cpu_no)
 	CPU_SET(cpu_no, &my_set);
 
 	if (sched_setaffinity(bm_pid, sizeof(cpu_set_t), &my_set)) {
-		perror("Unable to taskset benchmark");
+		ksft_perror("Unable to taskset benchmark");
 
 		return -1;
 	}
@@ -293,58 +293,6 @@ int taskset_benchmark(pid_t bm_pid, int cpu_no)
 	return 0;
 }
 
-/*
- * run_benchmark - Run a specified benchmark or fill_buf (default benchmark)
- *		   in specified signal. Direct benchmark stdio to /dev/null.
- * @signum:	signal number
- * @info:	signal info
- * @ucontext:	user context in signal handling
- *
- * Return: void
- */
-void run_benchmark(int signum, siginfo_t *info, void *ucontext)
-{
-	int operation, ret, memflush;
-	char **benchmark_cmd;
-	size_t span;
-	bool once;
-	FILE *fp;
-
-	benchmark_cmd = info->si_ptr;
-
-	/*
-	 * Direct stdio of child to /dev/null, so that only parent writes to
-	 * stdio (console)
-	 */
-	fp = freopen("/dev/null", "w", stdout);
-	if (!fp)
-		PARENT_EXIT("Unable to direct benchmark status to /dev/null");
-
-	if (strcmp(benchmark_cmd[0], "fill_buf") == 0) {
-		/* Execute default fill_buf benchmark */
-		span = strtoul(benchmark_cmd[1], NULL, 10);
-		memflush =  atoi(benchmark_cmd[2]);
-		operation = atoi(benchmark_cmd[3]);
-		if (!strcmp(benchmark_cmd[4], "true"))
-			once = true;
-		else if (!strcmp(benchmark_cmd[4], "false"))
-			once = false;
-		else
-			PARENT_EXIT("Invalid once parameter");
-
-		if (run_fill_buf(span, memflush, operation, once))
-			fprintf(stderr, "Error in running fill buffer\n");
-	} else {
-		/* Execute specified benchmark */
-		ret = execvp(benchmark_cmd[0], benchmark_cmd);
-		if (ret)
-			perror("wrong\n");
-	}
-
-	fclose(stdout);
-	PARENT_EXIT("Unable to run specified benchmark");
-}
-
 /*
  * create_grp - Create a group only if one doesn't exist
  * @grp_name:	Name of the group
@@ -376,7 +324,7 @@ static int create_grp(const char *grp_name, char *grp, const char *parent_grp)
 		}
 		closedir(dp);
 	} else {
-		perror("Unable to open resctrl for group");
+		ksft_perror("Unable to open resctrl for group");
 
 		return -1;
 	}
@@ -384,7 +332,7 @@ static int create_grp(const char *grp_name, char *grp, const char *parent_grp)
 	/* Requested grp doesn't exist, hence create it */
 	if (found_grp == 0) {
 		if (mkdir(grp, 0) == -1) {
-			perror("Unable to create group");
+			ksft_perror("Unable to create group");
 
 			return -1;
 		}
@@ -399,12 +347,12 @@ static int write_pid_to_tasks(char *tasks, pid_t pid)
 
 	fp = fopen(tasks, "w");
 	if (!fp) {
-		perror("Failed to open tasks file");
+		ksft_perror("Failed to open tasks file");
 
 		return -1;
 	}
 	if (fprintf(fp, "%d\n", pid) < 0) {
-		perror("Failed to wr pid to tasks file");
+		ksft_print_msg("Failed to write pid to tasks file\n");
 		fclose(fp);
 
 		return -1;
@@ -471,7 +419,7 @@ int write_bm_pid_to_resctrl(pid_t bm_pid, char *ctrlgrp, char *mongrp,
 out:
 	ksft_print_msg("Writing benchmark parameters to resctrl FS\n");
 	if (ret)
-		perror("# writing to resctrlfs");
+		ksft_print_msg("Failed writing to resctrlfs\n");
 
 	return ret;
 }
@@ -658,7 +606,7 @@ int filter_dmesg(void)
 
 	ret = pipe(pipefds);
 	if (ret) {
-		perror("pipe");
+		ksft_perror("pipe");
 		return ret;
 	}
 	fflush(stdout);
@@ -667,13 +615,13 @@ int filter_dmesg(void)
 		close(pipefds[0]);
 		dup2(pipefds[1], STDOUT_FILENO);
 		execlp("dmesg", "dmesg", NULL);
-		perror("executing dmesg");
+		ksft_perror("Executing dmesg");
 		exit(1);
 	}
 	close(pipefds[1]);
 	fp = fdopen(pipefds[0], "r");
 	if (!fp) {
-		perror("fdopen(pipe)");
+		ksft_perror("fdopen(pipe)");
 		kill(pid, SIGTERM);
 
 		return -1;
diff --git a/tools/testing/selftests/sigaltstack/current_stack_pointer.h b/tools/testing/selftests/sigaltstack/current_stack_pointer.h
index ea9bdf3a90b1..09da8f1011ce 100644
--- a/tools/testing/selftests/sigaltstack/current_stack_pointer.h
+++ b/tools/testing/selftests/sigaltstack/current_stack_pointer.h
@@ -8,7 +8,7 @@ register unsigned long sp asm("sp");
 register unsigned long sp asm("esp");
 #elif __loongarch64
 register unsigned long sp asm("$sp");
-#elif __ppc__
+#elif __powerpc__
 register unsigned long sp asm("r1");
 #elif __s390x__
 register unsigned long sp asm("%15");

Powered by blists - more mailing lists

Powered by Openwall GNU/*/Linux Powered by OpenVZ